fix wrong git ignore
This commit is contained in:
Adrian Zürcher
1899
internal/pdf/model/annotations.go
Normal file
1899
internal/pdf/model/annotations.go
Normal file
File diff suppressed because it is too large
Load Diff
2805
internal/pdf/model/colorspace.go
Normal file
2805
internal/pdf/model/colorspace.go
Normal file
File diff suppressed because it is too large
Load Diff
14
internal/pdf/model/const.go
Normal file
14
internal/pdf/model/const.go
Normal file
@@ -0,0 +1,14 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
)
|
||||
|
||||
var (
|
||||
ErrRequiredAttributeMissing = errors.New("required attribute missing")
|
||||
ErrInvalidAttribute = errors.New("invalid attribute")
|
||||
ErrTypeError = errors.New("type check error")
|
||||
|
||||
// ErrRangeError typically occurs when an input parameter is out of range or has invalid value.
|
||||
ErrRangeError = errors.New("range check error")
|
||||
)
|
||||
393
internal/pdf/model/font.go
Normal file
393
internal/pdf/model/font.go
Normal file
@@ -0,0 +1,393 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"os"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/fonts"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// The PdfFont structure represents an underlying font structure which can be of type:
|
||||
// - Type0
|
||||
// - Type1
|
||||
// - TrueType
|
||||
// etc.
|
||||
type PdfFont struct {
|
||||
context any // The underlying font: Type0, Type1, Truetype, etc..
|
||||
}
|
||||
|
||||
// Set the encoding for the underlying font.
|
||||
func (font PdfFont) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
switch t := font.context.(type) {
|
||||
case *pdfFontTrueType:
|
||||
t.SetEncoder(encoder)
|
||||
}
|
||||
}
|
||||
|
||||
func (font PdfFont) GetGlyphCharMetrics(glyph string) (fonts.CharMetrics, bool) {
|
||||
switch t := font.context.(type) {
|
||||
case *pdfFontTrueType:
|
||||
return t.GetGlyphCharMetrics(glyph)
|
||||
}
|
||||
|
||||
return fonts.CharMetrics{}, false
|
||||
}
|
||||
|
||||
func (font PdfFont) ToPdfObject() core.PdfObject {
|
||||
switch f := font.context.(type) {
|
||||
case *pdfFontTrueType:
|
||||
return f.ToPdfObject()
|
||||
}
|
||||
|
||||
// If not supported, return null..
|
||||
common.Log.Debug("Unsupported font (%T) - returning null object", font.context)
|
||||
return core.MakeNull()
|
||||
}
|
||||
|
||||
type pdfFontTrueType struct {
|
||||
Encoder textencoding.TextEncoder
|
||||
|
||||
firstChar int
|
||||
lastChar int
|
||||
charWidths []float64
|
||||
|
||||
// Subtype shall be TrueType.
|
||||
// Encoding is subject to limitations that are described in 9.6.6, "Character Encoding".
|
||||
// BaseFont is derived differently.
|
||||
BaseFont core.PdfObject
|
||||
FirstChar core.PdfObject
|
||||
LastChar core.PdfObject
|
||||
Widths core.PdfObject
|
||||
FontDescriptor *PdfFontDescriptor
|
||||
Encoding core.PdfObject
|
||||
ToUnicode core.PdfObject
|
||||
|
||||
container *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
func (font pdfFontTrueType) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.Encoder = encoder
|
||||
}
|
||||
|
||||
func (font pdfFontTrueType) GetGlyphCharMetrics(glyph string) (fonts.CharMetrics, bool) {
|
||||
metrics := fonts.CharMetrics{}
|
||||
|
||||
code, found := font.Encoder.GlyphToCharcode(glyph)
|
||||
if !found {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
if int(code) < font.firstChar {
|
||||
common.Log.Debug("Code lower than firstchar (%d < %d)", code, font.firstChar)
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
if int(code) > font.lastChar {
|
||||
common.Log.Debug("Code higher than lastchar (%d < %d)", code, font.lastChar)
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
index := int(code) - font.firstChar
|
||||
if index >= len(font.charWidths) {
|
||||
common.Log.Debug("Code outside of widths range")
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
width := font.charWidths[index]
|
||||
metrics.Wx = width
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (ftt *pdfFontTrueType) ToPdfObject() core.PdfObject {
|
||||
if ftt.container == nil {
|
||||
ftt.container = &core.PdfIndirectObject{}
|
||||
}
|
||||
d := core.MakeDict()
|
||||
ftt.container.PdfObject = d
|
||||
|
||||
d.Set("Type", core.MakeName("Font"))
|
||||
d.Set("Subtype", core.MakeName("TrueType"))
|
||||
|
||||
if ftt.BaseFont != nil {
|
||||
d.Set("BaseFont", ftt.BaseFont)
|
||||
}
|
||||
if ftt.FirstChar != nil {
|
||||
d.Set("FirstChar", ftt.FirstChar)
|
||||
}
|
||||
if ftt.LastChar != nil {
|
||||
d.Set("LastChar", ftt.LastChar)
|
||||
}
|
||||
if ftt.Widths != nil {
|
||||
d.Set("Widths", ftt.Widths)
|
||||
}
|
||||
if ftt.FontDescriptor != nil {
|
||||
d.Set("FontDescriptor", ftt.FontDescriptor.ToPdfObject())
|
||||
}
|
||||
if ftt.Encoding != nil {
|
||||
d.Set("Encoding", ftt.Encoding)
|
||||
}
|
||||
if ftt.ToUnicode != nil {
|
||||
d.Set("ToUnicode", ftt.ToUnicode)
|
||||
}
|
||||
|
||||
return ftt.container
|
||||
}
|
||||
|
||||
func NewPdfFontFromTTFFile(filePath string) (*PdfFont, error) {
|
||||
ttf, err := fonts.TtfParse(filePath)
|
||||
if err != nil {
|
||||
common.Log.Debug("error loading ttf font: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
truefont := &pdfFontTrueType{}
|
||||
|
||||
truefont.Encoder = textencoding.NewWinAnsiTextEncoder()
|
||||
truefont.firstChar = 32
|
||||
truefont.lastChar = 255
|
||||
|
||||
truefont.BaseFont = core.MakeName(ttf.PostScriptName)
|
||||
truefont.FirstChar = core.MakeInteger(32)
|
||||
truefont.LastChar = core.MakeInteger(255)
|
||||
|
||||
k := 1000.0 / float64(ttf.UnitsPerEm)
|
||||
|
||||
if len(ttf.Widths) <= 0 {
|
||||
return nil, errors.New("missing required attribute (Widths)")
|
||||
}
|
||||
|
||||
missingWidth := k * float64(ttf.Widths[0])
|
||||
vals := []float64{}
|
||||
|
||||
for charcode := 32; charcode <= 255; charcode++ {
|
||||
runeVal, found := truefont.Encoder.CharcodeToRune(byte(charcode))
|
||||
if !found {
|
||||
common.Log.Debug("Rune not found (charcode: %d)", charcode)
|
||||
vals = append(vals, missingWidth)
|
||||
continue
|
||||
}
|
||||
|
||||
pos, ok := ttf.Chars[uint16(runeVal)]
|
||||
if !ok {
|
||||
common.Log.Debug("Rune not in TTF Chars")
|
||||
vals = append(vals, missingWidth)
|
||||
continue
|
||||
}
|
||||
|
||||
w := k * float64(ttf.Widths[pos])
|
||||
|
||||
vals = append(vals, w)
|
||||
}
|
||||
|
||||
truefont.Widths = &core.PdfIndirectObject{PdfObject: core.MakeArrayFromFloats(vals)}
|
||||
|
||||
if len(vals) < (255 - 32 + 1) {
|
||||
common.Log.Debug("invalid length of widths, %d < %d", len(vals), 255-32+1)
|
||||
return nil, errors.New("range check error")
|
||||
}
|
||||
|
||||
truefont.charWidths = vals[:255-32+1]
|
||||
|
||||
// Default.
|
||||
// XXX/FIXME TODO: Only use the encoder object.
|
||||
|
||||
truefont.Encoding = core.MakeName("WinAnsiEncoding")
|
||||
|
||||
descriptor := &PdfFontDescriptor{}
|
||||
descriptor.Ascent = core.MakeFloat(k * float64(ttf.TypoAscender))
|
||||
descriptor.Descent = core.MakeFloat(k * float64(ttf.TypoDescender))
|
||||
descriptor.CapHeight = core.MakeFloat(k * float64(ttf.CapHeight))
|
||||
descriptor.FontBBox = core.MakeArrayFromFloats([]float64{k * float64(ttf.Xmin), k * float64(ttf.Ymin), k * float64(ttf.Xmax), k * float64(ttf.Ymax)})
|
||||
descriptor.ItalicAngle = core.MakeFloat(float64(ttf.ItalicAngle))
|
||||
descriptor.MissingWidth = core.MakeFloat(k * float64(ttf.Widths[0]))
|
||||
|
||||
ttfBytes, err := os.ReadFile(filePath)
|
||||
if err != nil {
|
||||
common.Log.Debug("Unable to read file contents: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// XXX/TODO: Encode the file...
|
||||
stream, err := core.MakeStream(ttfBytes, core.NewFlateEncoder())
|
||||
if err != nil {
|
||||
common.Log.Debug("Unable to make stream: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
stream.PdfObjectDictionary.Set("Length1", core.MakeInteger(int64(len(ttfBytes))))
|
||||
descriptor.FontFile2 = stream
|
||||
|
||||
if ttf.Bold {
|
||||
descriptor.StemV = core.MakeInteger(120)
|
||||
} else {
|
||||
descriptor.StemV = core.MakeInteger(70)
|
||||
}
|
||||
|
||||
// Flags.
|
||||
flags := 1 << 5
|
||||
if ttf.IsFixedPitch {
|
||||
flags |= 1
|
||||
}
|
||||
if ttf.ItalicAngle != 0 {
|
||||
flags |= 1 << 6
|
||||
}
|
||||
descriptor.Flags = core.MakeInteger(int64(flags))
|
||||
|
||||
// Build Font.
|
||||
truefont.FontDescriptor = descriptor
|
||||
|
||||
font := &PdfFont{}
|
||||
font.context = truefont
|
||||
|
||||
return font, nil
|
||||
}
|
||||
|
||||
// Font descriptors specifies metrics and other attributes of a font.
|
||||
type PdfFontDescriptor struct {
|
||||
FontName core.PdfObject
|
||||
FontFamily core.PdfObject
|
||||
FontStretch core.PdfObject
|
||||
FontWeight core.PdfObject
|
||||
Flags core.PdfObject
|
||||
FontBBox core.PdfObject
|
||||
ItalicAngle core.PdfObject
|
||||
Ascent core.PdfObject
|
||||
Descent core.PdfObject
|
||||
Leading core.PdfObject
|
||||
CapHeight core.PdfObject
|
||||
XHeight core.PdfObject
|
||||
StemV core.PdfObject
|
||||
StemH core.PdfObject
|
||||
AvgWidth core.PdfObject
|
||||
MaxWidth core.PdfObject
|
||||
MissingWidth core.PdfObject
|
||||
FontFile core.PdfObject
|
||||
FontFile2 core.PdfObject
|
||||
FontFile3 core.PdfObject
|
||||
CharSet core.PdfObject
|
||||
|
||||
// Additional entries for CIDFonts
|
||||
Style core.PdfObject
|
||||
Lang core.PdfObject
|
||||
FD core.PdfObject
|
||||
CIDSet core.PdfObject
|
||||
|
||||
// Container.
|
||||
container *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
// Convert to a PDF dictionary inside an indirect object.
|
||||
func (pfd *PdfFontDescriptor) ToPdfObject() core.PdfObject {
|
||||
d := core.MakeDict()
|
||||
if pfd.container == nil {
|
||||
pfd.container = &core.PdfIndirectObject{}
|
||||
}
|
||||
pfd.container.PdfObject = d
|
||||
|
||||
d.Set("Type", core.MakeName("FontDescriptor"))
|
||||
|
||||
if pfd.FontName != nil {
|
||||
d.Set("FontName", pfd.FontName)
|
||||
}
|
||||
|
||||
if pfd.FontFamily != nil {
|
||||
d.Set("FontFamily", pfd.FontFamily)
|
||||
}
|
||||
|
||||
if pfd.FontStretch != nil {
|
||||
d.Set("FontStretch", pfd.FontStretch)
|
||||
}
|
||||
|
||||
if pfd.FontWeight != nil {
|
||||
d.Set("FontWeight", pfd.FontWeight)
|
||||
}
|
||||
|
||||
if pfd.Flags != nil {
|
||||
d.Set("Flags", pfd.Flags)
|
||||
}
|
||||
|
||||
if pfd.FontBBox != nil {
|
||||
d.Set("FontBBox", pfd.FontBBox)
|
||||
}
|
||||
|
||||
if pfd.ItalicAngle != nil {
|
||||
d.Set("ItalicAngle", pfd.ItalicAngle)
|
||||
}
|
||||
|
||||
if pfd.Ascent != nil {
|
||||
d.Set("Ascent", pfd.Ascent)
|
||||
}
|
||||
|
||||
if pfd.Descent != nil {
|
||||
d.Set("Descent", pfd.Descent)
|
||||
}
|
||||
|
||||
if pfd.Leading != nil {
|
||||
d.Set("Leading", pfd.Leading)
|
||||
}
|
||||
|
||||
if pfd.CapHeight != nil {
|
||||
d.Set("CapHeight", pfd.CapHeight)
|
||||
}
|
||||
|
||||
if pfd.XHeight != nil {
|
||||
d.Set("XHeight", pfd.XHeight)
|
||||
}
|
||||
|
||||
if pfd.StemV != nil {
|
||||
d.Set("StemV", pfd.StemV)
|
||||
}
|
||||
|
||||
if pfd.StemH != nil {
|
||||
d.Set("StemH", pfd.StemH)
|
||||
}
|
||||
|
||||
if pfd.AvgWidth != nil {
|
||||
d.Set("AvgWidth", pfd.AvgWidth)
|
||||
}
|
||||
|
||||
if pfd.MaxWidth != nil {
|
||||
d.Set("MaxWidth", pfd.MaxWidth)
|
||||
}
|
||||
|
||||
if pfd.MissingWidth != nil {
|
||||
d.Set("MissingWidth", pfd.MissingWidth)
|
||||
}
|
||||
|
||||
if pfd.FontFile != nil {
|
||||
d.Set("FontFile", pfd.FontFile)
|
||||
}
|
||||
|
||||
if pfd.FontFile2 != nil {
|
||||
d.Set("FontFile2", pfd.FontFile2)
|
||||
}
|
||||
|
||||
if pfd.FontFile3 != nil {
|
||||
d.Set("FontFile3", pfd.FontFile3)
|
||||
}
|
||||
|
||||
if pfd.CharSet != nil {
|
||||
d.Set("CharSet", pfd.CharSet)
|
||||
}
|
||||
|
||||
if pfd.Style != nil {
|
||||
d.Set("FontName", pfd.FontName)
|
||||
}
|
||||
|
||||
if pfd.Lang != nil {
|
||||
d.Set("Lang", pfd.Lang)
|
||||
}
|
||||
|
||||
if pfd.FD != nil {
|
||||
d.Set("FD", pfd.FD)
|
||||
}
|
||||
|
||||
if pfd.CIDSet != nil {
|
||||
d.Set("CIDSet", pfd.CIDSet)
|
||||
}
|
||||
|
||||
return pfd.container
|
||||
}
|
||||
342
internal/pdf/model/fonts/afms/Courier-Bold.afm
Normal file
342
internal/pdf/model/fonts/afms/Courier-Bold.afm
Normal file
@@ -0,0 +1,342 @@
|
||||
StartFontMetrics 4.1
|
||||
Comment Copyright (c) 1989, 1990, 1991, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
Comment Creation Date: Mon Jun 23 16:28:00 1997
|
||||
Comment UniqueID 43048
|
||||
Comment VMusage 41139 52164
|
||||
FontName Courier-Bold
|
||||
FullName Courier Bold
|
||||
FamilyName Courier
|
||||
Weight Bold
|
||||
ItalicAngle 0
|
||||
IsFixedPitch true
|
||||
CharacterSet ExtendedRoman
|
||||
FontBBox -113 -250 749 801
|
||||
UnderlinePosition -100
|
||||
UnderlineThickness 50
|
||||
Version 003.000
|
||||
Notice Copyright (c) 1989, 1990, 1991, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
EncodingScheme AdobeStandardEncoding
|
||||
CapHeight 562
|
||||
XHeight 439
|
||||
Ascender 629
|
||||
Descender -157
|
||||
StdHW 84
|
||||
StdVW 106
|
||||
StartCharMetrics 315
|
||||
C 32 ; WX 600 ; N space ; B 0 0 0 0 ;
|
||||
C 33 ; WX 600 ; N exclam ; B 202 -15 398 572 ;
|
||||
C 34 ; WX 600 ; N quotedbl ; B 135 277 465 562 ;
|
||||
C 35 ; WX 600 ; N numbersign ; B 56 -45 544 651 ;
|
||||
C 36 ; WX 600 ; N dollar ; B 82 -126 519 666 ;
|
||||
C 37 ; WX 600 ; N percent ; B 5 -15 595 616 ;
|
||||
C 38 ; WX 600 ; N ampersand ; B 36 -15 546 543 ;
|
||||
C 39 ; WX 600 ; N quoteright ; B 171 277 423 562 ;
|
||||
C 40 ; WX 600 ; N parenleft ; B 219 -102 461 616 ;
|
||||
C 41 ; WX 600 ; N parenright ; B 139 -102 381 616 ;
|
||||
C 42 ; WX 600 ; N asterisk ; B 91 219 509 601 ;
|
||||
C 43 ; WX 600 ; N plus ; B 71 39 529 478 ;
|
||||
C 44 ; WX 600 ; N comma ; B 123 -111 393 174 ;
|
||||
C 45 ; WX 600 ; N hyphen ; B 100 203 500 313 ;
|
||||
C 46 ; WX 600 ; N period ; B 192 -15 408 171 ;
|
||||
C 47 ; WX 600 ; N slash ; B 98 -77 502 626 ;
|
||||
C 48 ; WX 600 ; N zero ; B 87 -15 513 616 ;
|
||||
C 49 ; WX 600 ; N one ; B 81 0 539 616 ;
|
||||
C 50 ; WX 600 ; N two ; B 61 0 499 616 ;
|
||||
C 51 ; WX 600 ; N three ; B 63 -15 501 616 ;
|
||||
C 52 ; WX 600 ; N four ; B 53 0 507 616 ;
|
||||
C 53 ; WX 600 ; N five ; B 70 -15 521 601 ;
|
||||
C 54 ; WX 600 ; N six ; B 90 -15 521 616 ;
|
||||
C 55 ; WX 600 ; N seven ; B 55 0 494 601 ;
|
||||
C 56 ; WX 600 ; N eight ; B 83 -15 517 616 ;
|
||||
C 57 ; WX 600 ; N nine ; B 79 -15 510 616 ;
|
||||
C 58 ; WX 600 ; N colon ; B 191 -15 407 425 ;
|
||||
C 59 ; WX 600 ; N semicolon ; B 123 -111 408 425 ;
|
||||
C 60 ; WX 600 ; N less ; B 66 15 523 501 ;
|
||||
C 61 ; WX 600 ; N equal ; B 71 118 529 398 ;
|
||||
C 62 ; WX 600 ; N greater ; B 77 15 534 501 ;
|
||||
C 63 ; WX 600 ; N question ; B 98 -14 501 580 ;
|
||||
C 64 ; WX 600 ; N at ; B 16 -15 584 616 ;
|
||||
C 65 ; WX 600 ; N A ; B -9 0 609 562 ;
|
||||
C 66 ; WX 600 ; N B ; B 30 0 573 562 ;
|
||||
C 67 ; WX 600 ; N C ; B 22 -18 560 580 ;
|
||||
C 68 ; WX 600 ; N D ; B 30 0 594 562 ;
|
||||
C 69 ; WX 600 ; N E ; B 25 0 560 562 ;
|
||||
C 70 ; WX 600 ; N F ; B 39 0 570 562 ;
|
||||
C 71 ; WX 600 ; N G ; B 22 -18 594 580 ;
|
||||
C 72 ; WX 600 ; N H ; B 20 0 580 562 ;
|
||||
C 73 ; WX 600 ; N I ; B 77 0 523 562 ;
|
||||
C 74 ; WX 600 ; N J ; B 37 -18 601 562 ;
|
||||
C 75 ; WX 600 ; N K ; B 21 0 599 562 ;
|
||||
C 76 ; WX 600 ; N L ; B 39 0 578 562 ;
|
||||
C 77 ; WX 600 ; N M ; B -2 0 602 562 ;
|
||||
C 78 ; WX 600 ; N N ; B 8 -12 610 562 ;
|
||||
C 79 ; WX 600 ; N O ; B 22 -18 578 580 ;
|
||||
C 80 ; WX 600 ; N P ; B 48 0 559 562 ;
|
||||
C 81 ; WX 600 ; N Q ; B 32 -138 578 580 ;
|
||||
C 82 ; WX 600 ; N R ; B 24 0 599 562 ;
|
||||
C 83 ; WX 600 ; N S ; B 47 -22 553 582 ;
|
||||
C 84 ; WX 600 ; N T ; B 21 0 579 562 ;
|
||||
C 85 ; WX 600 ; N U ; B 4 -18 596 562 ;
|
||||
C 86 ; WX 600 ; N V ; B -13 0 613 562 ;
|
||||
C 87 ; WX 600 ; N W ; B -18 0 618 562 ;
|
||||
C 88 ; WX 600 ; N X ; B 12 0 588 562 ;
|
||||
C 89 ; WX 600 ; N Y ; B 12 0 589 562 ;
|
||||
C 90 ; WX 600 ; N Z ; B 62 0 539 562 ;
|
||||
C 91 ; WX 600 ; N bracketleft ; B 245 -102 475 616 ;
|
||||
C 92 ; WX 600 ; N backslash ; B 99 -77 503 626 ;
|
||||
C 93 ; WX 600 ; N bracketright ; B 125 -102 355 616 ;
|
||||
C 94 ; WX 600 ; N asciicircum ; B 108 250 492 616 ;
|
||||
C 95 ; WX 600 ; N underscore ; B 0 -125 600 -75 ;
|
||||
C 96 ; WX 600 ; N quoteleft ; B 178 277 428 562 ;
|
||||
C 97 ; WX 600 ; N a ; B 35 -15 570 454 ;
|
||||
C 98 ; WX 600 ; N b ; B 0 -15 584 626 ;
|
||||
C 99 ; WX 600 ; N c ; B 40 -15 545 459 ;
|
||||
C 100 ; WX 600 ; N d ; B 20 -15 591 626 ;
|
||||
C 101 ; WX 600 ; N e ; B 40 -15 563 454 ;
|
||||
C 102 ; WX 600 ; N f ; B 83 0 547 626 ; L i fi ; L l fl ;
|
||||
C 103 ; WX 600 ; N g ; B 30 -146 580 454 ;
|
||||
C 104 ; WX 600 ; N h ; B 5 0 592 626 ;
|
||||
C 105 ; WX 600 ; N i ; B 77 0 523 658 ;
|
||||
C 106 ; WX 600 ; N j ; B 63 -146 440 658 ;
|
||||
C 107 ; WX 600 ; N k ; B 20 0 585 626 ;
|
||||
C 108 ; WX 600 ; N l ; B 77 0 523 626 ;
|
||||
C 109 ; WX 600 ; N m ; B -22 0 626 454 ;
|
||||
C 110 ; WX 600 ; N n ; B 18 0 592 454 ;
|
||||
C 111 ; WX 600 ; N o ; B 30 -15 570 454 ;
|
||||
C 112 ; WX 600 ; N p ; B -1 -142 570 454 ;
|
||||
C 113 ; WX 600 ; N q ; B 20 -142 591 454 ;
|
||||
C 114 ; WX 600 ; N r ; B 47 0 580 454 ;
|
||||
C 115 ; WX 600 ; N s ; B 68 -17 535 459 ;
|
||||
C 116 ; WX 600 ; N t ; B 47 -15 532 562 ;
|
||||
C 117 ; WX 600 ; N u ; B -1 -15 569 439 ;
|
||||
C 118 ; WX 600 ; N v ; B -1 0 601 439 ;
|
||||
C 119 ; WX 600 ; N w ; B -18 0 618 439 ;
|
||||
C 120 ; WX 600 ; N x ; B 6 0 594 439 ;
|
||||
C 121 ; WX 600 ; N y ; B -4 -142 601 439 ;
|
||||
C 122 ; WX 600 ; N z ; B 81 0 520 439 ;
|
||||
C 123 ; WX 600 ; N braceleft ; B 160 -102 464 616 ;
|
||||
C 124 ; WX 600 ; N bar ; B 255 -250 345 750 ;
|
||||
C 125 ; WX 600 ; N braceright ; B 136 -102 440 616 ;
|
||||
C 126 ; WX 600 ; N asciitilde ; B 71 153 530 356 ;
|
||||
C 161 ; WX 600 ; N exclamdown ; B 202 -146 398 449 ;
|
||||
C 162 ; WX 600 ; N cent ; B 66 -49 518 614 ;
|
||||
C 163 ; WX 600 ; N sterling ; B 72 -28 558 611 ;
|
||||
C 164 ; WX 600 ; N fraction ; B 25 -60 576 661 ;
|
||||
C 165 ; WX 600 ; N yen ; B 10 0 590 562 ;
|
||||
C 166 ; WX 600 ; N florin ; B -30 -131 572 616 ;
|
||||
C 167 ; WX 600 ; N section ; B 83 -70 517 580 ;
|
||||
C 168 ; WX 600 ; N currency ; B 54 49 546 517 ;
|
||||
C 169 ; WX 600 ; N quotesingle ; B 227 277 373 562 ;
|
||||
C 170 ; WX 600 ; N quotedblleft ; B 71 277 535 562 ;
|
||||
C 171 ; WX 600 ; N guillemotleft ; B 8 70 553 446 ;
|
||||
C 172 ; WX 600 ; N guilsinglleft ; B 141 70 459 446 ;
|
||||
C 173 ; WX 600 ; N guilsinglright ; B 141 70 459 446 ;
|
||||
C 174 ; WX 600 ; N fi ; B 12 0 593 626 ;
|
||||
C 175 ; WX 600 ; N fl ; B 12 0 593 626 ;
|
||||
C 177 ; WX 600 ; N endash ; B 65 203 535 313 ;
|
||||
C 178 ; WX 600 ; N dagger ; B 106 -70 494 580 ;
|
||||
C 179 ; WX 600 ; N daggerdbl ; B 106 -70 494 580 ;
|
||||
C 180 ; WX 600 ; N periodcentered ; B 196 165 404 351 ;
|
||||
C 182 ; WX 600 ; N paragraph ; B 6 -70 576 580 ;
|
||||
C 183 ; WX 600 ; N bullet ; B 140 132 460 430 ;
|
||||
C 184 ; WX 600 ; N quotesinglbase ; B 175 -142 427 143 ;
|
||||
C 185 ; WX 600 ; N quotedblbase ; B 65 -142 529 143 ;
|
||||
C 186 ; WX 600 ; N quotedblright ; B 61 277 525 562 ;
|
||||
C 187 ; WX 600 ; N guillemotright ; B 47 70 592 446 ;
|
||||
C 188 ; WX 600 ; N ellipsis ; B 26 -15 574 116 ;
|
||||
C 189 ; WX 600 ; N perthousand ; B -113 -15 713 616 ;
|
||||
C 191 ; WX 600 ; N questiondown ; B 99 -146 502 449 ;
|
||||
C 193 ; WX 600 ; N grave ; B 132 508 395 661 ;
|
||||
C 194 ; WX 600 ; N acute ; B 205 508 468 661 ;
|
||||
C 195 ; WX 600 ; N circumflex ; B 103 483 497 657 ;
|
||||
C 196 ; WX 600 ; N tilde ; B 89 493 512 636 ;
|
||||
C 197 ; WX 600 ; N macron ; B 88 505 512 585 ;
|
||||
C 198 ; WX 600 ; N breve ; B 83 468 517 631 ;
|
||||
C 199 ; WX 600 ; N dotaccent ; B 230 498 370 638 ;
|
||||
C 200 ; WX 600 ; N dieresis ; B 128 498 472 638 ;
|
||||
C 202 ; WX 600 ; N ring ; B 198 481 402 678 ;
|
||||
C 203 ; WX 600 ; N cedilla ; B 205 -206 387 0 ;
|
||||
C 205 ; WX 600 ; N hungarumlaut ; B 68 488 588 661 ;
|
||||
C 206 ; WX 600 ; N ogonek ; B 169 -199 400 0 ;
|
||||
C 207 ; WX 600 ; N caron ; B 103 493 497 667 ;
|
||||
C 208 ; WX 600 ; N emdash ; B -10 203 610 313 ;
|
||||
C 225 ; WX 600 ; N AE ; B -29 0 602 562 ;
|
||||
C 227 ; WX 600 ; N ordfeminine ; B 147 196 453 580 ;
|
||||
C 232 ; WX 600 ; N Lslash ; B 39 0 578 562 ;
|
||||
C 233 ; WX 600 ; N Oslash ; B 22 -22 578 584 ;
|
||||
C 234 ; WX 600 ; N OE ; B -25 0 595 562 ;
|
||||
C 235 ; WX 600 ; N ordmasculine ; B 147 196 453 580 ;
|
||||
C 241 ; WX 600 ; N ae ; B -4 -15 601 454 ;
|
||||
C 245 ; WX 600 ; N dotlessi ; B 77 0 523 439 ;
|
||||
C 248 ; WX 600 ; N lslash ; B 77 0 523 626 ;
|
||||
C 249 ; WX 600 ; N oslash ; B 30 -24 570 463 ;
|
||||
C 250 ; WX 600 ; N oe ; B -18 -15 611 454 ;
|
||||
C 251 ; WX 600 ; N germandbls ; B 22 -15 596 626 ;
|
||||
C -1 ; WX 600 ; N Idieresis ; B 77 0 523 761 ;
|
||||
C -1 ; WX 600 ; N eacute ; B 40 -15 563 661 ;
|
||||
C -1 ; WX 600 ; N abreve ; B 35 -15 570 661 ;
|
||||
C -1 ; WX 600 ; N uhungarumlaut ; B -1 -15 628 661 ;
|
||||
C -1 ; WX 600 ; N ecaron ; B 40 -15 563 667 ;
|
||||
C -1 ; WX 600 ; N Ydieresis ; B 12 0 589 761 ;
|
||||
C -1 ; WX 600 ; N divide ; B 71 16 529 500 ;
|
||||
C -1 ; WX 600 ; N Yacute ; B 12 0 589 784 ;
|
||||
C -1 ; WX 600 ; N Acircumflex ; B -9 0 609 780 ;
|
||||
C -1 ; WX 600 ; N aacute ; B 35 -15 570 661 ;
|
||||
C -1 ; WX 600 ; N Ucircumflex ; B 4 -18 596 780 ;
|
||||
C -1 ; WX 600 ; N yacute ; B -4 -142 601 661 ;
|
||||
C -1 ; WX 600 ; N scommaaccent ; B 68 -250 535 459 ;
|
||||
C -1 ; WX 600 ; N ecircumflex ; B 40 -15 563 657 ;
|
||||
C -1 ; WX 600 ; N Uring ; B 4 -18 596 801 ;
|
||||
C -1 ; WX 600 ; N Udieresis ; B 4 -18 596 761 ;
|
||||
C -1 ; WX 600 ; N aogonek ; B 35 -199 586 454 ;
|
||||
C -1 ; WX 600 ; N Uacute ; B 4 -18 596 784 ;
|
||||
C -1 ; WX 600 ; N uogonek ; B -1 -199 585 439 ;
|
||||
C -1 ; WX 600 ; N Edieresis ; B 25 0 560 761 ;
|
||||
C -1 ; WX 600 ; N Dcroat ; B 30 0 594 562 ;
|
||||
C -1 ; WX 600 ; N commaaccent ; B 205 -250 397 -57 ;
|
||||
C -1 ; WX 600 ; N copyright ; B 0 -18 600 580 ;
|
||||
C -1 ; WX 600 ; N Emacron ; B 25 0 560 708 ;
|
||||
C -1 ; WX 600 ; N ccaron ; B 40 -15 545 667 ;
|
||||
C -1 ; WX 600 ; N aring ; B 35 -15 570 678 ;
|
||||
C -1 ; WX 600 ; N Ncommaaccent ; B 8 -250 610 562 ;
|
||||
C -1 ; WX 600 ; N lacute ; B 77 0 523 801 ;
|
||||
C -1 ; WX 600 ; N agrave ; B 35 -15 570 661 ;
|
||||
C -1 ; WX 600 ; N Tcommaaccent ; B 21 -250 579 562 ;
|
||||
C -1 ; WX 600 ; N Cacute ; B 22 -18 560 784 ;
|
||||
C -1 ; WX 600 ; N atilde ; B 35 -15 570 636 ;
|
||||
C -1 ; WX 600 ; N Edotaccent ; B 25 0 560 761 ;
|
||||
C -1 ; WX 600 ; N scaron ; B 68 -17 535 667 ;
|
||||
C -1 ; WX 600 ; N scedilla ; B 68 -206 535 459 ;
|
||||
C -1 ; WX 600 ; N iacute ; B 77 0 523 661 ;
|
||||
C -1 ; WX 600 ; N lozenge ; B 66 0 534 740 ;
|
||||
C -1 ; WX 600 ; N Rcaron ; B 24 0 599 790 ;
|
||||
C -1 ; WX 600 ; N Gcommaaccent ; B 22 -250 594 580 ;
|
||||
C -1 ; WX 600 ; N ucircumflex ; B -1 -15 569 657 ;
|
||||
C -1 ; WX 600 ; N acircumflex ; B 35 -15 570 657 ;
|
||||
C -1 ; WX 600 ; N Amacron ; B -9 0 609 708 ;
|
||||
C -1 ; WX 600 ; N rcaron ; B 47 0 580 667 ;
|
||||
C -1 ; WX 600 ; N ccedilla ; B 40 -206 545 459 ;
|
||||
C -1 ; WX 600 ; N Zdotaccent ; B 62 0 539 761 ;
|
||||
C -1 ; WX 600 ; N Thorn ; B 48 0 557 562 ;
|
||||
C -1 ; WX 600 ; N Omacron ; B 22 -18 578 708 ;
|
||||
C -1 ; WX 600 ; N Racute ; B 24 0 599 784 ;
|
||||
C -1 ; WX 600 ; N Sacute ; B 47 -22 553 784 ;
|
||||
C -1 ; WX 600 ; N dcaron ; B 20 -15 727 626 ;
|
||||
C -1 ; WX 600 ; N Umacron ; B 4 -18 596 708 ;
|
||||
C -1 ; WX 600 ; N uring ; B -1 -15 569 678 ;
|
||||
C -1 ; WX 600 ; N threesuperior ; B 138 222 433 616 ;
|
||||
C -1 ; WX 600 ; N Ograve ; B 22 -18 578 784 ;
|
||||
C -1 ; WX 600 ; N Agrave ; B -9 0 609 784 ;
|
||||
C -1 ; WX 600 ; N Abreve ; B -9 0 609 784 ;
|
||||
C -1 ; WX 600 ; N multiply ; B 81 39 520 478 ;
|
||||
C -1 ; WX 600 ; N uacute ; B -1 -15 569 661 ;
|
||||
C -1 ; WX 600 ; N Tcaron ; B 21 0 579 790 ;
|
||||
C -1 ; WX 600 ; N partialdiff ; B 63 -38 537 728 ;
|
||||
C -1 ; WX 600 ; N ydieresis ; B -4 -142 601 638 ;
|
||||
C -1 ; WX 600 ; N Nacute ; B 8 -12 610 784 ;
|
||||
C -1 ; WX 600 ; N icircumflex ; B 73 0 523 657 ;
|
||||
C -1 ; WX 600 ; N Ecircumflex ; B 25 0 560 780 ;
|
||||
C -1 ; WX 600 ; N adieresis ; B 35 -15 570 638 ;
|
||||
C -1 ; WX 600 ; N edieresis ; B 40 -15 563 638 ;
|
||||
C -1 ; WX 600 ; N cacute ; B 40 -15 545 661 ;
|
||||
C -1 ; WX 600 ; N nacute ; B 18 0 592 661 ;
|
||||
C -1 ; WX 600 ; N umacron ; B -1 -15 569 585 ;
|
||||
C -1 ; WX 600 ; N Ncaron ; B 8 -12 610 790 ;
|
||||
C -1 ; WX 600 ; N Iacute ; B 77 0 523 784 ;
|
||||
C -1 ; WX 600 ; N plusminus ; B 71 24 529 515 ;
|
||||
C -1 ; WX 600 ; N brokenbar ; B 255 -175 345 675 ;
|
||||
C -1 ; WX 600 ; N registered ; B 0 -18 600 580 ;
|
||||
C -1 ; WX 600 ; N Gbreve ; B 22 -18 594 784 ;
|
||||
C -1 ; WX 600 ; N Idotaccent ; B 77 0 523 761 ;
|
||||
C -1 ; WX 600 ; N summation ; B 15 -10 586 706 ;
|
||||
C -1 ; WX 600 ; N Egrave ; B 25 0 560 784 ;
|
||||
C -1 ; WX 600 ; N racute ; B 47 0 580 661 ;
|
||||
C -1 ; WX 600 ; N omacron ; B 30 -15 570 585 ;
|
||||
C -1 ; WX 600 ; N Zacute ; B 62 0 539 784 ;
|
||||
C -1 ; WX 600 ; N Zcaron ; B 62 0 539 790 ;
|
||||
C -1 ; WX 600 ; N greaterequal ; B 26 0 523 696 ;
|
||||
C -1 ; WX 600 ; N Eth ; B 30 0 594 562 ;
|
||||
C -1 ; WX 600 ; N Ccedilla ; B 22 -206 560 580 ;
|
||||
C -1 ; WX 600 ; N lcommaaccent ; B 77 -250 523 626 ;
|
||||
C -1 ; WX 600 ; N tcaron ; B 47 -15 532 703 ;
|
||||
C -1 ; WX 600 ; N eogonek ; B 40 -199 563 454 ;
|
||||
C -1 ; WX 600 ; N Uogonek ; B 4 -199 596 562 ;
|
||||
C -1 ; WX 600 ; N Aacute ; B -9 0 609 784 ;
|
||||
C -1 ; WX 600 ; N Adieresis ; B -9 0 609 761 ;
|
||||
C -1 ; WX 600 ; N egrave ; B 40 -15 563 661 ;
|
||||
C -1 ; WX 600 ; N zacute ; B 81 0 520 661 ;
|
||||
C -1 ; WX 600 ; N iogonek ; B 77 -199 523 658 ;
|
||||
C -1 ; WX 600 ; N Oacute ; B 22 -18 578 784 ;
|
||||
C -1 ; WX 600 ; N oacute ; B 30 -15 570 661 ;
|
||||
C -1 ; WX 600 ; N amacron ; B 35 -15 570 585 ;
|
||||
C -1 ; WX 600 ; N sacute ; B 68 -17 535 661 ;
|
||||
C -1 ; WX 600 ; N idieresis ; B 77 0 523 618 ;
|
||||
C -1 ; WX 600 ; N Ocircumflex ; B 22 -18 578 780 ;
|
||||
C -1 ; WX 600 ; N Ugrave ; B 4 -18 596 784 ;
|
||||
C -1 ; WX 600 ; N Delta ; B 6 0 594 688 ;
|
||||
C -1 ; WX 600 ; N thorn ; B -14 -142 570 626 ;
|
||||
C -1 ; WX 600 ; N twosuperior ; B 143 230 436 616 ;
|
||||
C -1 ; WX 600 ; N Odieresis ; B 22 -18 578 761 ;
|
||||
C -1 ; WX 600 ; N mu ; B -1 -142 569 439 ;
|
||||
C -1 ; WX 600 ; N igrave ; B 77 0 523 661 ;
|
||||
C -1 ; WX 600 ; N ohungarumlaut ; B 30 -15 668 661 ;
|
||||
C -1 ; WX 600 ; N Eogonek ; B 25 -199 576 562 ;
|
||||
C -1 ; WX 600 ; N dcroat ; B 20 -15 591 626 ;
|
||||
C -1 ; WX 600 ; N threequarters ; B -47 -60 648 661 ;
|
||||
C -1 ; WX 600 ; N Scedilla ; B 47 -206 553 582 ;
|
||||
C -1 ; WX 600 ; N lcaron ; B 77 0 597 626 ;
|
||||
C -1 ; WX 600 ; N Kcommaaccent ; B 21 -250 599 562 ;
|
||||
C -1 ; WX 600 ; N Lacute ; B 39 0 578 784 ;
|
||||
C -1 ; WX 600 ; N trademark ; B -9 230 749 562 ;
|
||||
C -1 ; WX 600 ; N edotaccent ; B 40 -15 563 638 ;
|
||||
C -1 ; WX 600 ; N Igrave ; B 77 0 523 784 ;
|
||||
C -1 ; WX 600 ; N Imacron ; B 77 0 523 708 ;
|
||||
C -1 ; WX 600 ; N Lcaron ; B 39 0 637 562 ;
|
||||
C -1 ; WX 600 ; N onehalf ; B -47 -60 648 661 ;
|
||||
C -1 ; WX 600 ; N lessequal ; B 26 0 523 696 ;
|
||||
C -1 ; WX 600 ; N ocircumflex ; B 30 -15 570 657 ;
|
||||
C -1 ; WX 600 ; N ntilde ; B 18 0 592 636 ;
|
||||
C -1 ; WX 600 ; N Uhungarumlaut ; B 4 -18 638 784 ;
|
||||
C -1 ; WX 600 ; N Eacute ; B 25 0 560 784 ;
|
||||
C -1 ; WX 600 ; N emacron ; B 40 -15 563 585 ;
|
||||
C -1 ; WX 600 ; N gbreve ; B 30 -146 580 661 ;
|
||||
C -1 ; WX 600 ; N onequarter ; B -56 -60 656 661 ;
|
||||
C -1 ; WX 600 ; N Scaron ; B 47 -22 553 790 ;
|
||||
C -1 ; WX 600 ; N Scommaaccent ; B 47 -250 553 582 ;
|
||||
C -1 ; WX 600 ; N Ohungarumlaut ; B 22 -18 628 784 ;
|
||||
C -1 ; WX 600 ; N degree ; B 86 243 474 616 ;
|
||||
C -1 ; WX 600 ; N ograve ; B 30 -15 570 661 ;
|
||||
C -1 ; WX 600 ; N Ccaron ; B 22 -18 560 790 ;
|
||||
C -1 ; WX 600 ; N ugrave ; B -1 -15 569 661 ;
|
||||
C -1 ; WX 600 ; N radical ; B -19 -104 473 778 ;
|
||||
C -1 ; WX 600 ; N Dcaron ; B 30 0 594 790 ;
|
||||
C -1 ; WX 600 ; N rcommaaccent ; B 47 -250 580 454 ;
|
||||
C -1 ; WX 600 ; N Ntilde ; B 8 -12 610 759 ;
|
||||
C -1 ; WX 600 ; N otilde ; B 30 -15 570 636 ;
|
||||
C -1 ; WX 600 ; N Rcommaaccent ; B 24 -250 599 562 ;
|
||||
C -1 ; WX 600 ; N Lcommaaccent ; B 39 -250 578 562 ;
|
||||
C -1 ; WX 600 ; N Atilde ; B -9 0 609 759 ;
|
||||
C -1 ; WX 600 ; N Aogonek ; B -9 -199 625 562 ;
|
||||
C -1 ; WX 600 ; N Aring ; B -9 0 609 801 ;
|
||||
C -1 ; WX 600 ; N Otilde ; B 22 -18 578 759 ;
|
||||
C -1 ; WX 600 ; N zdotaccent ; B 81 0 520 638 ;
|
||||
C -1 ; WX 600 ; N Ecaron ; B 25 0 560 790 ;
|
||||
C -1 ; WX 600 ; N Iogonek ; B 77 -199 523 562 ;
|
||||
C -1 ; WX 600 ; N kcommaaccent ; B 20 -250 585 626 ;
|
||||
C -1 ; WX 600 ; N minus ; B 71 203 529 313 ;
|
||||
C -1 ; WX 600 ; N Icircumflex ; B 77 0 523 780 ;
|
||||
C -1 ; WX 600 ; N ncaron ; B 18 0 592 667 ;
|
||||
C -1 ; WX 600 ; N tcommaaccent ; B 47 -250 532 562 ;
|
||||
C -1 ; WX 600 ; N logicalnot ; B 71 103 529 413 ;
|
||||
C -1 ; WX 600 ; N odieresis ; B 30 -15 570 638 ;
|
||||
C -1 ; WX 600 ; N udieresis ; B -1 -15 569 638 ;
|
||||
C -1 ; WX 600 ; N notequal ; B 12 -47 537 563 ;
|
||||
C -1 ; WX 600 ; N gcommaaccent ; B 30 -146 580 714 ;
|
||||
C -1 ; WX 600 ; N eth ; B 58 -27 543 626 ;
|
||||
C -1 ; WX 600 ; N zcaron ; B 81 0 520 667 ;
|
||||
C -1 ; WX 600 ; N ncommaaccent ; B 18 -250 592 454 ;
|
||||
C -1 ; WX 600 ; N onesuperior ; B 153 230 447 616 ;
|
||||
C -1 ; WX 600 ; N imacron ; B 77 0 523 585 ;
|
||||
C -1 ; WX 600 ; N Euro ; B 0 0 0 0 ;
|
||||
EndCharMetrics
|
||||
EndFontMetrics
|
||||
342
internal/pdf/model/fonts/afms/Courier-BoldOblique.afm
Normal file
342
internal/pdf/model/fonts/afms/Courier-BoldOblique.afm
Normal file
@@ -0,0 +1,342 @@
|
||||
StartFontMetrics 4.1
|
||||
Comment Copyright (c) 1989, 1990, 1991, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
Comment Creation Date: Mon Jun 23 16:28:46 1997
|
||||
Comment UniqueID 43049
|
||||
Comment VMusage 17529 79244
|
||||
FontName Courier-BoldOblique
|
||||
FullName Courier Bold Oblique
|
||||
FamilyName Courier
|
||||
Weight Bold
|
||||
ItalicAngle -12
|
||||
IsFixedPitch true
|
||||
CharacterSet ExtendedRoman
|
||||
FontBBox -57 -250 869 801
|
||||
UnderlinePosition -100
|
||||
UnderlineThickness 50
|
||||
Version 003.000
|
||||
Notice Copyright (c) 1989, 1990, 1991, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
EncodingScheme AdobeStandardEncoding
|
||||
CapHeight 562
|
||||
XHeight 439
|
||||
Ascender 629
|
||||
Descender -157
|
||||
StdHW 84
|
||||
StdVW 106
|
||||
StartCharMetrics 315
|
||||
C 32 ; WX 600 ; N space ; B 0 0 0 0 ;
|
||||
C 33 ; WX 600 ; N exclam ; B 215 -15 495 572 ;
|
||||
C 34 ; WX 600 ; N quotedbl ; B 211 277 585 562 ;
|
||||
C 35 ; WX 600 ; N numbersign ; B 88 -45 641 651 ;
|
||||
C 36 ; WX 600 ; N dollar ; B 87 -126 630 666 ;
|
||||
C 37 ; WX 600 ; N percent ; B 101 -15 625 616 ;
|
||||
C 38 ; WX 600 ; N ampersand ; B 61 -15 595 543 ;
|
||||
C 39 ; WX 600 ; N quoteright ; B 229 277 543 562 ;
|
||||
C 40 ; WX 600 ; N parenleft ; B 265 -102 592 616 ;
|
||||
C 41 ; WX 600 ; N parenright ; B 117 -102 444 616 ;
|
||||
C 42 ; WX 600 ; N asterisk ; B 179 219 598 601 ;
|
||||
C 43 ; WX 600 ; N plus ; B 114 39 596 478 ;
|
||||
C 44 ; WX 600 ; N comma ; B 99 -111 430 174 ;
|
||||
C 45 ; WX 600 ; N hyphen ; B 143 203 567 313 ;
|
||||
C 46 ; WX 600 ; N period ; B 206 -15 427 171 ;
|
||||
C 47 ; WX 600 ; N slash ; B 90 -77 626 626 ;
|
||||
C 48 ; WX 600 ; N zero ; B 135 -15 593 616 ;
|
||||
C 49 ; WX 600 ; N one ; B 93 0 562 616 ;
|
||||
C 50 ; WX 600 ; N two ; B 61 0 594 616 ;
|
||||
C 51 ; WX 600 ; N three ; B 71 -15 571 616 ;
|
||||
C 52 ; WX 600 ; N four ; B 81 0 559 616 ;
|
||||
C 53 ; WX 600 ; N five ; B 77 -15 621 601 ;
|
||||
C 54 ; WX 600 ; N six ; B 135 -15 652 616 ;
|
||||
C 55 ; WX 600 ; N seven ; B 147 0 622 601 ;
|
||||
C 56 ; WX 600 ; N eight ; B 115 -15 604 616 ;
|
||||
C 57 ; WX 600 ; N nine ; B 75 -15 592 616 ;
|
||||
C 58 ; WX 600 ; N colon ; B 205 -15 480 425 ;
|
||||
C 59 ; WX 600 ; N semicolon ; B 99 -111 481 425 ;
|
||||
C 60 ; WX 600 ; N less ; B 120 15 613 501 ;
|
||||
C 61 ; WX 600 ; N equal ; B 96 118 614 398 ;
|
||||
C 62 ; WX 600 ; N greater ; B 97 15 589 501 ;
|
||||
C 63 ; WX 600 ; N question ; B 183 -14 592 580 ;
|
||||
C 64 ; WX 600 ; N at ; B 65 -15 642 616 ;
|
||||
C 65 ; WX 600 ; N A ; B -9 0 632 562 ;
|
||||
C 66 ; WX 600 ; N B ; B 30 0 630 562 ;
|
||||
C 67 ; WX 600 ; N C ; B 74 -18 675 580 ;
|
||||
C 68 ; WX 600 ; N D ; B 30 0 664 562 ;
|
||||
C 69 ; WX 600 ; N E ; B 25 0 670 562 ;
|
||||
C 70 ; WX 600 ; N F ; B 39 0 684 562 ;
|
||||
C 71 ; WX 600 ; N G ; B 74 -18 675 580 ;
|
||||
C 72 ; WX 600 ; N H ; B 20 0 700 562 ;
|
||||
C 73 ; WX 600 ; N I ; B 77 0 643 562 ;
|
||||
C 74 ; WX 600 ; N J ; B 58 -18 721 562 ;
|
||||
C 75 ; WX 600 ; N K ; B 21 0 692 562 ;
|
||||
C 76 ; WX 600 ; N L ; B 39 0 636 562 ;
|
||||
C 77 ; WX 600 ; N M ; B -2 0 722 562 ;
|
||||
C 78 ; WX 600 ; N N ; B 8 -12 730 562 ;
|
||||
C 79 ; WX 600 ; N O ; B 74 -18 645 580 ;
|
||||
C 80 ; WX 600 ; N P ; B 48 0 643 562 ;
|
||||
C 81 ; WX 600 ; N Q ; B 83 -138 636 580 ;
|
||||
C 82 ; WX 600 ; N R ; B 24 0 617 562 ;
|
||||
C 83 ; WX 600 ; N S ; B 54 -22 673 582 ;
|
||||
C 84 ; WX 600 ; N T ; B 86 0 679 562 ;
|
||||
C 85 ; WX 600 ; N U ; B 101 -18 716 562 ;
|
||||
C 86 ; WX 600 ; N V ; B 84 0 733 562 ;
|
||||
C 87 ; WX 600 ; N W ; B 79 0 738 562 ;
|
||||
C 88 ; WX 600 ; N X ; B 12 0 690 562 ;
|
||||
C 89 ; WX 600 ; N Y ; B 109 0 709 562 ;
|
||||
C 90 ; WX 600 ; N Z ; B 62 0 637 562 ;
|
||||
C 91 ; WX 600 ; N bracketleft ; B 223 -102 606 616 ;
|
||||
C 92 ; WX 600 ; N backslash ; B 222 -77 496 626 ;
|
||||
C 93 ; WX 600 ; N bracketright ; B 103 -102 486 616 ;
|
||||
C 94 ; WX 600 ; N asciicircum ; B 171 250 556 616 ;
|
||||
C 95 ; WX 600 ; N underscore ; B -27 -125 585 -75 ;
|
||||
C 96 ; WX 600 ; N quoteleft ; B 297 277 487 562 ;
|
||||
C 97 ; WX 600 ; N a ; B 61 -15 593 454 ;
|
||||
C 98 ; WX 600 ; N b ; B 13 -15 636 626 ;
|
||||
C 99 ; WX 600 ; N c ; B 81 -15 631 459 ;
|
||||
C 100 ; WX 600 ; N d ; B 60 -15 645 626 ;
|
||||
C 101 ; WX 600 ; N e ; B 81 -15 605 454 ;
|
||||
C 102 ; WX 600 ; N f ; B 83 0 677 626 ; L i fi ; L l fl ;
|
||||
C 103 ; WX 600 ; N g ; B 40 -146 674 454 ;
|
||||
C 104 ; WX 600 ; N h ; B 18 0 615 626 ;
|
||||
C 105 ; WX 600 ; N i ; B 77 0 546 658 ;
|
||||
C 106 ; WX 600 ; N j ; B 36 -146 580 658 ;
|
||||
C 107 ; WX 600 ; N k ; B 33 0 643 626 ;
|
||||
C 108 ; WX 600 ; N l ; B 77 0 546 626 ;
|
||||
C 109 ; WX 600 ; N m ; B -22 0 649 454 ;
|
||||
C 110 ; WX 600 ; N n ; B 18 0 615 454 ;
|
||||
C 111 ; WX 600 ; N o ; B 71 -15 622 454 ;
|
||||
C 112 ; WX 600 ; N p ; B -32 -142 622 454 ;
|
||||
C 113 ; WX 600 ; N q ; B 60 -142 685 454 ;
|
||||
C 114 ; WX 600 ; N r ; B 47 0 655 454 ;
|
||||
C 115 ; WX 600 ; N s ; B 66 -17 608 459 ;
|
||||
C 116 ; WX 600 ; N t ; B 118 -15 567 562 ;
|
||||
C 117 ; WX 600 ; N u ; B 70 -15 592 439 ;
|
||||
C 118 ; WX 600 ; N v ; B 70 0 695 439 ;
|
||||
C 119 ; WX 600 ; N w ; B 53 0 712 439 ;
|
||||
C 120 ; WX 600 ; N x ; B 6 0 671 439 ;
|
||||
C 121 ; WX 600 ; N y ; B -21 -142 695 439 ;
|
||||
C 122 ; WX 600 ; N z ; B 81 0 614 439 ;
|
||||
C 123 ; WX 600 ; N braceleft ; B 203 -102 595 616 ;
|
||||
C 124 ; WX 600 ; N bar ; B 201 -250 505 750 ;
|
||||
C 125 ; WX 600 ; N braceright ; B 114 -102 506 616 ;
|
||||
C 126 ; WX 600 ; N asciitilde ; B 120 153 590 356 ;
|
||||
C 161 ; WX 600 ; N exclamdown ; B 196 -146 477 449 ;
|
||||
C 162 ; WX 600 ; N cent ; B 121 -49 605 614 ;
|
||||
C 163 ; WX 600 ; N sterling ; B 106 -28 650 611 ;
|
||||
C 164 ; WX 600 ; N fraction ; B 22 -60 708 661 ;
|
||||
C 165 ; WX 600 ; N yen ; B 98 0 710 562 ;
|
||||
C 166 ; WX 600 ; N florin ; B -57 -131 702 616 ;
|
||||
C 167 ; WX 600 ; N section ; B 74 -70 620 580 ;
|
||||
C 168 ; WX 600 ; N currency ; B 77 49 644 517 ;
|
||||
C 169 ; WX 600 ; N quotesingle ; B 303 277 493 562 ;
|
||||
C 170 ; WX 600 ; N quotedblleft ; B 190 277 594 562 ;
|
||||
C 171 ; WX 600 ; N guillemotleft ; B 62 70 639 446 ;
|
||||
C 172 ; WX 600 ; N guilsinglleft ; B 195 70 545 446 ;
|
||||
C 173 ; WX 600 ; N guilsinglright ; B 165 70 514 446 ;
|
||||
C 174 ; WX 600 ; N fi ; B 12 0 644 626 ;
|
||||
C 175 ; WX 600 ; N fl ; B 12 0 644 626 ;
|
||||
C 177 ; WX 600 ; N endash ; B 108 203 602 313 ;
|
||||
C 178 ; WX 600 ; N dagger ; B 175 -70 586 580 ;
|
||||
C 179 ; WX 600 ; N daggerdbl ; B 121 -70 587 580 ;
|
||||
C 180 ; WX 600 ; N periodcentered ; B 248 165 461 351 ;
|
||||
C 182 ; WX 600 ; N paragraph ; B 61 -70 700 580 ;
|
||||
C 183 ; WX 600 ; N bullet ; B 196 132 523 430 ;
|
||||
C 184 ; WX 600 ; N quotesinglbase ; B 144 -142 458 143 ;
|
||||
C 185 ; WX 600 ; N quotedblbase ; B 34 -142 560 143 ;
|
||||
C 186 ; WX 600 ; N quotedblright ; B 119 277 645 562 ;
|
||||
C 187 ; WX 600 ; N guillemotright ; B 71 70 647 446 ;
|
||||
C 188 ; WX 600 ; N ellipsis ; B 35 -15 587 116 ;
|
||||
C 189 ; WX 600 ; N perthousand ; B -45 -15 743 616 ;
|
||||
C 191 ; WX 600 ; N questiondown ; B 100 -146 509 449 ;
|
||||
C 193 ; WX 600 ; N grave ; B 272 508 503 661 ;
|
||||
C 194 ; WX 600 ; N acute ; B 312 508 609 661 ;
|
||||
C 195 ; WX 600 ; N circumflex ; B 212 483 607 657 ;
|
||||
C 196 ; WX 600 ; N tilde ; B 199 493 643 636 ;
|
||||
C 197 ; WX 600 ; N macron ; B 195 505 637 585 ;
|
||||
C 198 ; WX 600 ; N breve ; B 217 468 652 631 ;
|
||||
C 199 ; WX 600 ; N dotaccent ; B 348 498 493 638 ;
|
||||
C 200 ; WX 600 ; N dieresis ; B 246 498 595 638 ;
|
||||
C 202 ; WX 600 ; N ring ; B 319 481 528 678 ;
|
||||
C 203 ; WX 600 ; N cedilla ; B 168 -206 368 0 ;
|
||||
C 205 ; WX 600 ; N hungarumlaut ; B 171 488 729 661 ;
|
||||
C 206 ; WX 600 ; N ogonek ; B 143 -199 367 0 ;
|
||||
C 207 ; WX 600 ; N caron ; B 238 493 633 667 ;
|
||||
C 208 ; WX 600 ; N emdash ; B 33 203 677 313 ;
|
||||
C 225 ; WX 600 ; N AE ; B -29 0 708 562 ;
|
||||
C 227 ; WX 600 ; N ordfeminine ; B 188 196 526 580 ;
|
||||
C 232 ; WX 600 ; N Lslash ; B 39 0 636 562 ;
|
||||
C 233 ; WX 600 ; N Oslash ; B 48 -22 673 584 ;
|
||||
C 234 ; WX 600 ; N OE ; B 26 0 701 562 ;
|
||||
C 235 ; WX 600 ; N ordmasculine ; B 188 196 543 580 ;
|
||||
C 241 ; WX 600 ; N ae ; B 21 -15 652 454 ;
|
||||
C 245 ; WX 600 ; N dotlessi ; B 77 0 546 439 ;
|
||||
C 248 ; WX 600 ; N lslash ; B 77 0 587 626 ;
|
||||
C 249 ; WX 600 ; N oslash ; B 54 -24 638 463 ;
|
||||
C 250 ; WX 600 ; N oe ; B 18 -15 662 454 ;
|
||||
C 251 ; WX 600 ; N germandbls ; B 22 -15 629 626 ;
|
||||
C -1 ; WX 600 ; N Idieresis ; B 77 0 643 761 ;
|
||||
C -1 ; WX 600 ; N eacute ; B 81 -15 609 661 ;
|
||||
C -1 ; WX 600 ; N abreve ; B 61 -15 658 661 ;
|
||||
C -1 ; WX 600 ; N uhungarumlaut ; B 70 -15 769 661 ;
|
||||
C -1 ; WX 600 ; N ecaron ; B 81 -15 633 667 ;
|
||||
C -1 ; WX 600 ; N Ydieresis ; B 109 0 709 761 ;
|
||||
C -1 ; WX 600 ; N divide ; B 114 16 596 500 ;
|
||||
C -1 ; WX 600 ; N Yacute ; B 109 0 709 784 ;
|
||||
C -1 ; WX 600 ; N Acircumflex ; B -9 0 632 780 ;
|
||||
C -1 ; WX 600 ; N aacute ; B 61 -15 609 661 ;
|
||||
C -1 ; WX 600 ; N Ucircumflex ; B 101 -18 716 780 ;
|
||||
C -1 ; WX 600 ; N yacute ; B -21 -142 695 661 ;
|
||||
C -1 ; WX 600 ; N scommaaccent ; B 66 -250 608 459 ;
|
||||
C -1 ; WX 600 ; N ecircumflex ; B 81 -15 607 657 ;
|
||||
C -1 ; WX 600 ; N Uring ; B 101 -18 716 801 ;
|
||||
C -1 ; WX 600 ; N Udieresis ; B 101 -18 716 761 ;
|
||||
C -1 ; WX 600 ; N aogonek ; B 61 -199 593 454 ;
|
||||
C -1 ; WX 600 ; N Uacute ; B 101 -18 716 784 ;
|
||||
C -1 ; WX 600 ; N uogonek ; B 70 -199 592 439 ;
|
||||
C -1 ; WX 600 ; N Edieresis ; B 25 0 670 761 ;
|
||||
C -1 ; WX 600 ; N Dcroat ; B 30 0 664 562 ;
|
||||
C -1 ; WX 600 ; N commaaccent ; B 151 -250 385 -57 ;
|
||||
C -1 ; WX 600 ; N copyright ; B 53 -18 667 580 ;
|
||||
C -1 ; WX 600 ; N Emacron ; B 25 0 670 708 ;
|
||||
C -1 ; WX 600 ; N ccaron ; B 81 -15 633 667 ;
|
||||
C -1 ; WX 600 ; N aring ; B 61 -15 593 678 ;
|
||||
C -1 ; WX 600 ; N Ncommaaccent ; B 8 -250 730 562 ;
|
||||
C -1 ; WX 600 ; N lacute ; B 77 0 639 801 ;
|
||||
C -1 ; WX 600 ; N agrave ; B 61 -15 593 661 ;
|
||||
C -1 ; WX 600 ; N Tcommaaccent ; B 86 -250 679 562 ;
|
||||
C -1 ; WX 600 ; N Cacute ; B 74 -18 675 784 ;
|
||||
C -1 ; WX 600 ; N atilde ; B 61 -15 643 636 ;
|
||||
C -1 ; WX 600 ; N Edotaccent ; B 25 0 670 761 ;
|
||||
C -1 ; WX 600 ; N scaron ; B 66 -17 633 667 ;
|
||||
C -1 ; WX 600 ; N scedilla ; B 66 -206 608 459 ;
|
||||
C -1 ; WX 600 ; N iacute ; B 77 0 609 661 ;
|
||||
C -1 ; WX 600 ; N lozenge ; B 145 0 614 740 ;
|
||||
C -1 ; WX 600 ; N Rcaron ; B 24 0 659 790 ;
|
||||
C -1 ; WX 600 ; N Gcommaaccent ; B 74 -250 675 580 ;
|
||||
C -1 ; WX 600 ; N ucircumflex ; B 70 -15 597 657 ;
|
||||
C -1 ; WX 600 ; N acircumflex ; B 61 -15 607 657 ;
|
||||
C -1 ; WX 600 ; N Amacron ; B -9 0 633 708 ;
|
||||
C -1 ; WX 600 ; N rcaron ; B 47 0 655 667 ;
|
||||
C -1 ; WX 600 ; N ccedilla ; B 81 -206 631 459 ;
|
||||
C -1 ; WX 600 ; N Zdotaccent ; B 62 0 637 761 ;
|
||||
C -1 ; WX 600 ; N Thorn ; B 48 0 620 562 ;
|
||||
C -1 ; WX 600 ; N Omacron ; B 74 -18 663 708 ;
|
||||
C -1 ; WX 600 ; N Racute ; B 24 0 665 784 ;
|
||||
C -1 ; WX 600 ; N Sacute ; B 54 -22 673 784 ;
|
||||
C -1 ; WX 600 ; N dcaron ; B 60 -15 861 626 ;
|
||||
C -1 ; WX 600 ; N Umacron ; B 101 -18 716 708 ;
|
||||
C -1 ; WX 600 ; N uring ; B 70 -15 592 678 ;
|
||||
C -1 ; WX 600 ; N threesuperior ; B 193 222 526 616 ;
|
||||
C -1 ; WX 600 ; N Ograve ; B 74 -18 645 784 ;
|
||||
C -1 ; WX 600 ; N Agrave ; B -9 0 632 784 ;
|
||||
C -1 ; WX 600 ; N Abreve ; B -9 0 684 784 ;
|
||||
C -1 ; WX 600 ; N multiply ; B 104 39 606 478 ;
|
||||
C -1 ; WX 600 ; N uacute ; B 70 -15 599 661 ;
|
||||
C -1 ; WX 600 ; N Tcaron ; B 86 0 679 790 ;
|
||||
C -1 ; WX 600 ; N partialdiff ; B 91 -38 627 728 ;
|
||||
C -1 ; WX 600 ; N ydieresis ; B -21 -142 695 638 ;
|
||||
C -1 ; WX 600 ; N Nacute ; B 8 -12 730 784 ;
|
||||
C -1 ; WX 600 ; N icircumflex ; B 77 0 577 657 ;
|
||||
C -1 ; WX 600 ; N Ecircumflex ; B 25 0 670 780 ;
|
||||
C -1 ; WX 600 ; N adieresis ; B 61 -15 595 638 ;
|
||||
C -1 ; WX 600 ; N edieresis ; B 81 -15 605 638 ;
|
||||
C -1 ; WX 600 ; N cacute ; B 81 -15 649 661 ;
|
||||
C -1 ; WX 600 ; N nacute ; B 18 0 639 661 ;
|
||||
C -1 ; WX 600 ; N umacron ; B 70 -15 637 585 ;
|
||||
C -1 ; WX 600 ; N Ncaron ; B 8 -12 730 790 ;
|
||||
C -1 ; WX 600 ; N Iacute ; B 77 0 643 784 ;
|
||||
C -1 ; WX 600 ; N plusminus ; B 76 24 614 515 ;
|
||||
C -1 ; WX 600 ; N brokenbar ; B 217 -175 489 675 ;
|
||||
C -1 ; WX 600 ; N registered ; B 53 -18 667 580 ;
|
||||
C -1 ; WX 600 ; N Gbreve ; B 74 -18 684 784 ;
|
||||
C -1 ; WX 600 ; N Idotaccent ; B 77 0 643 761 ;
|
||||
C -1 ; WX 600 ; N summation ; B 15 -10 672 706 ;
|
||||
C -1 ; WX 600 ; N Egrave ; B 25 0 670 784 ;
|
||||
C -1 ; WX 600 ; N racute ; B 47 0 655 661 ;
|
||||
C -1 ; WX 600 ; N omacron ; B 71 -15 637 585 ;
|
||||
C -1 ; WX 600 ; N Zacute ; B 62 0 665 784 ;
|
||||
C -1 ; WX 600 ; N Zcaron ; B 62 0 659 790 ;
|
||||
C -1 ; WX 600 ; N greaterequal ; B 26 0 627 696 ;
|
||||
C -1 ; WX 600 ; N Eth ; B 30 0 664 562 ;
|
||||
C -1 ; WX 600 ; N Ccedilla ; B 74 -206 675 580 ;
|
||||
C -1 ; WX 600 ; N lcommaaccent ; B 77 -250 546 626 ;
|
||||
C -1 ; WX 600 ; N tcaron ; B 118 -15 627 703 ;
|
||||
C -1 ; WX 600 ; N eogonek ; B 81 -199 605 454 ;
|
||||
C -1 ; WX 600 ; N Uogonek ; B 101 -199 716 562 ;
|
||||
C -1 ; WX 600 ; N Aacute ; B -9 0 655 784 ;
|
||||
C -1 ; WX 600 ; N Adieresis ; B -9 0 632 761 ;
|
||||
C -1 ; WX 600 ; N egrave ; B 81 -15 605 661 ;
|
||||
C -1 ; WX 600 ; N zacute ; B 81 0 614 661 ;
|
||||
C -1 ; WX 600 ; N iogonek ; B 77 -199 546 658 ;
|
||||
C -1 ; WX 600 ; N Oacute ; B 74 -18 645 784 ;
|
||||
C -1 ; WX 600 ; N oacute ; B 71 -15 649 661 ;
|
||||
C -1 ; WX 600 ; N amacron ; B 61 -15 637 585 ;
|
||||
C -1 ; WX 600 ; N sacute ; B 66 -17 609 661 ;
|
||||
C -1 ; WX 600 ; N idieresis ; B 77 0 561 618 ;
|
||||
C -1 ; WX 600 ; N Ocircumflex ; B 74 -18 645 780 ;
|
||||
C -1 ; WX 600 ; N Ugrave ; B 101 -18 716 784 ;
|
||||
C -1 ; WX 600 ; N Delta ; B 6 0 594 688 ;
|
||||
C -1 ; WX 600 ; N thorn ; B -32 -142 622 626 ;
|
||||
C -1 ; WX 600 ; N twosuperior ; B 191 230 542 616 ;
|
||||
C -1 ; WX 600 ; N Odieresis ; B 74 -18 645 761 ;
|
||||
C -1 ; WX 600 ; N mu ; B 49 -142 592 439 ;
|
||||
C -1 ; WX 600 ; N igrave ; B 77 0 546 661 ;
|
||||
C -1 ; WX 600 ; N ohungarumlaut ; B 71 -15 809 661 ;
|
||||
C -1 ; WX 600 ; N Eogonek ; B 25 -199 670 562 ;
|
||||
C -1 ; WX 600 ; N dcroat ; B 60 -15 712 626 ;
|
||||
C -1 ; WX 600 ; N threequarters ; B 8 -60 699 661 ;
|
||||
C -1 ; WX 600 ; N Scedilla ; B 54 -206 673 582 ;
|
||||
C -1 ; WX 600 ; N lcaron ; B 77 0 731 626 ;
|
||||
C -1 ; WX 600 ; N Kcommaaccent ; B 21 -250 692 562 ;
|
||||
C -1 ; WX 600 ; N Lacute ; B 39 0 636 784 ;
|
||||
C -1 ; WX 600 ; N trademark ; B 86 230 869 562 ;
|
||||
C -1 ; WX 600 ; N edotaccent ; B 81 -15 605 638 ;
|
||||
C -1 ; WX 600 ; N Igrave ; B 77 0 643 784 ;
|
||||
C -1 ; WX 600 ; N Imacron ; B 77 0 663 708 ;
|
||||
C -1 ; WX 600 ; N Lcaron ; B 39 0 757 562 ;
|
||||
C -1 ; WX 600 ; N onehalf ; B 22 -60 716 661 ;
|
||||
C -1 ; WX 600 ; N lessequal ; B 26 0 671 696 ;
|
||||
C -1 ; WX 600 ; N ocircumflex ; B 71 -15 622 657 ;
|
||||
C -1 ; WX 600 ; N ntilde ; B 18 0 643 636 ;
|
||||
C -1 ; WX 600 ; N Uhungarumlaut ; B 101 -18 805 784 ;
|
||||
C -1 ; WX 600 ; N Eacute ; B 25 0 670 784 ;
|
||||
C -1 ; WX 600 ; N emacron ; B 81 -15 637 585 ;
|
||||
C -1 ; WX 600 ; N gbreve ; B 40 -146 674 661 ;
|
||||
C -1 ; WX 600 ; N onequarter ; B 13 -60 707 661 ;
|
||||
C -1 ; WX 600 ; N Scaron ; B 54 -22 689 790 ;
|
||||
C -1 ; WX 600 ; N Scommaaccent ; B 54 -250 673 582 ;
|
||||
C -1 ; WX 600 ; N Ohungarumlaut ; B 74 -18 795 784 ;
|
||||
C -1 ; WX 600 ; N degree ; B 173 243 570 616 ;
|
||||
C -1 ; WX 600 ; N ograve ; B 71 -15 622 661 ;
|
||||
C -1 ; WX 600 ; N Ccaron ; B 74 -18 689 790 ;
|
||||
C -1 ; WX 600 ; N ugrave ; B 70 -15 592 661 ;
|
||||
C -1 ; WX 600 ; N radical ; B 67 -104 635 778 ;
|
||||
C -1 ; WX 600 ; N Dcaron ; B 30 0 664 790 ;
|
||||
C -1 ; WX 600 ; N rcommaaccent ; B 47 -250 655 454 ;
|
||||
C -1 ; WX 600 ; N Ntilde ; B 8 -12 730 759 ;
|
||||
C -1 ; WX 600 ; N otilde ; B 71 -15 643 636 ;
|
||||
C -1 ; WX 600 ; N Rcommaaccent ; B 24 -250 617 562 ;
|
||||
C -1 ; WX 600 ; N Lcommaaccent ; B 39 -250 636 562 ;
|
||||
C -1 ; WX 600 ; N Atilde ; B -9 0 669 759 ;
|
||||
C -1 ; WX 600 ; N Aogonek ; B -9 -199 632 562 ;
|
||||
C -1 ; WX 600 ; N Aring ; B -9 0 632 801 ;
|
||||
C -1 ; WX 600 ; N Otilde ; B 74 -18 669 759 ;
|
||||
C -1 ; WX 600 ; N zdotaccent ; B 81 0 614 638 ;
|
||||
C -1 ; WX 600 ; N Ecaron ; B 25 0 670 790 ;
|
||||
C -1 ; WX 600 ; N Iogonek ; B 77 -199 643 562 ;
|
||||
C -1 ; WX 600 ; N kcommaaccent ; B 33 -250 643 626 ;
|
||||
C -1 ; WX 600 ; N minus ; B 114 203 596 313 ;
|
||||
C -1 ; WX 600 ; N Icircumflex ; B 77 0 643 780 ;
|
||||
C -1 ; WX 600 ; N ncaron ; B 18 0 633 667 ;
|
||||
C -1 ; WX 600 ; N tcommaaccent ; B 118 -250 567 562 ;
|
||||
C -1 ; WX 600 ; N logicalnot ; B 135 103 617 413 ;
|
||||
C -1 ; WX 600 ; N odieresis ; B 71 -15 622 638 ;
|
||||
C -1 ; WX 600 ; N udieresis ; B 70 -15 595 638 ;
|
||||
C -1 ; WX 600 ; N notequal ; B 30 -47 626 563 ;
|
||||
C -1 ; WX 600 ; N gcommaaccent ; B 40 -146 674 714 ;
|
||||
C -1 ; WX 600 ; N eth ; B 93 -27 661 626 ;
|
||||
C -1 ; WX 600 ; N zcaron ; B 81 0 643 667 ;
|
||||
C -1 ; WX 600 ; N ncommaaccent ; B 18 -250 615 454 ;
|
||||
C -1 ; WX 600 ; N onesuperior ; B 212 230 514 616 ;
|
||||
C -1 ; WX 600 ; N imacron ; B 77 0 575 585 ;
|
||||
C -1 ; WX 600 ; N Euro ; B 0 0 0 0 ;
|
||||
EndCharMetrics
|
||||
EndFontMetrics
|
||||
342
internal/pdf/model/fonts/afms/Courier-Oblique.afm
Normal file
342
internal/pdf/model/fonts/afms/Courier-Oblique.afm
Normal file
@@ -0,0 +1,342 @@
|
||||
StartFontMetrics 4.1
|
||||
Comment Copyright (c) 1989, 1990, 1991, 1992, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
Comment Creation Date: Thu May 1 17:37:52 1997
|
||||
Comment UniqueID 43051
|
||||
Comment VMusage 16248 75829
|
||||
FontName Courier-Oblique
|
||||
FullName Courier Oblique
|
||||
FamilyName Courier
|
||||
Weight Medium
|
||||
ItalicAngle -12
|
||||
IsFixedPitch true
|
||||
CharacterSet ExtendedRoman
|
||||
FontBBox -27 -250 849 805
|
||||
UnderlinePosition -100
|
||||
UnderlineThickness 50
|
||||
Version 003.000
|
||||
Notice Copyright (c) 1989, 1990, 1991, 1992, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
EncodingScheme AdobeStandardEncoding
|
||||
CapHeight 562
|
||||
XHeight 426
|
||||
Ascender 629
|
||||
Descender -157
|
||||
StdHW 51
|
||||
StdVW 51
|
||||
StartCharMetrics 315
|
||||
C 32 ; WX 600 ; N space ; B 0 0 0 0 ;
|
||||
C 33 ; WX 600 ; N exclam ; B 243 -15 464 572 ;
|
||||
C 34 ; WX 600 ; N quotedbl ; B 273 328 532 562 ;
|
||||
C 35 ; WX 600 ; N numbersign ; B 133 -32 596 639 ;
|
||||
C 36 ; WX 600 ; N dollar ; B 108 -126 596 662 ;
|
||||
C 37 ; WX 600 ; N percent ; B 134 -15 599 622 ;
|
||||
C 38 ; WX 600 ; N ampersand ; B 87 -15 580 543 ;
|
||||
C 39 ; WX 600 ; N quoteright ; B 283 328 495 562 ;
|
||||
C 40 ; WX 600 ; N parenleft ; B 313 -108 572 622 ;
|
||||
C 41 ; WX 600 ; N parenright ; B 137 -108 396 622 ;
|
||||
C 42 ; WX 600 ; N asterisk ; B 212 257 580 607 ;
|
||||
C 43 ; WX 600 ; N plus ; B 129 44 580 470 ;
|
||||
C 44 ; WX 600 ; N comma ; B 157 -112 370 122 ;
|
||||
C 45 ; WX 600 ; N hyphen ; B 152 231 558 285 ;
|
||||
C 46 ; WX 600 ; N period ; B 238 -15 382 109 ;
|
||||
C 47 ; WX 600 ; N slash ; B 112 -80 604 629 ;
|
||||
C 48 ; WX 600 ; N zero ; B 154 -15 575 622 ;
|
||||
C 49 ; WX 600 ; N one ; B 98 0 515 622 ;
|
||||
C 50 ; WX 600 ; N two ; B 70 0 568 622 ;
|
||||
C 51 ; WX 600 ; N three ; B 82 -15 538 622 ;
|
||||
C 52 ; WX 600 ; N four ; B 108 0 541 622 ;
|
||||
C 53 ; WX 600 ; N five ; B 99 -15 589 607 ;
|
||||
C 54 ; WX 600 ; N six ; B 155 -15 629 622 ;
|
||||
C 55 ; WX 600 ; N seven ; B 182 0 612 607 ;
|
||||
C 56 ; WX 600 ; N eight ; B 132 -15 588 622 ;
|
||||
C 57 ; WX 600 ; N nine ; B 93 -15 574 622 ;
|
||||
C 58 ; WX 600 ; N colon ; B 238 -15 441 385 ;
|
||||
C 59 ; WX 600 ; N semicolon ; B 157 -112 441 385 ;
|
||||
C 60 ; WX 600 ; N less ; B 96 42 610 472 ;
|
||||
C 61 ; WX 600 ; N equal ; B 109 138 600 376 ;
|
||||
C 62 ; WX 600 ; N greater ; B 85 42 599 472 ;
|
||||
C 63 ; WX 600 ; N question ; B 222 -15 583 572 ;
|
||||
C 64 ; WX 600 ; N at ; B 127 -15 582 622 ;
|
||||
C 65 ; WX 600 ; N A ; B 3 0 607 562 ;
|
||||
C 66 ; WX 600 ; N B ; B 43 0 616 562 ;
|
||||
C 67 ; WX 600 ; N C ; B 93 -18 655 580 ;
|
||||
C 68 ; WX 600 ; N D ; B 43 0 645 562 ;
|
||||
C 69 ; WX 600 ; N E ; B 53 0 660 562 ;
|
||||
C 70 ; WX 600 ; N F ; B 53 0 660 562 ;
|
||||
C 71 ; WX 600 ; N G ; B 83 -18 645 580 ;
|
||||
C 72 ; WX 600 ; N H ; B 32 0 687 562 ;
|
||||
C 73 ; WX 600 ; N I ; B 96 0 623 562 ;
|
||||
C 74 ; WX 600 ; N J ; B 52 -18 685 562 ;
|
||||
C 75 ; WX 600 ; N K ; B 38 0 671 562 ;
|
||||
C 76 ; WX 600 ; N L ; B 47 0 607 562 ;
|
||||
C 77 ; WX 600 ; N M ; B 4 0 715 562 ;
|
||||
C 78 ; WX 600 ; N N ; B 7 -13 712 562 ;
|
||||
C 79 ; WX 600 ; N O ; B 94 -18 625 580 ;
|
||||
C 80 ; WX 600 ; N P ; B 79 0 644 562 ;
|
||||
C 81 ; WX 600 ; N Q ; B 95 -138 625 580 ;
|
||||
C 82 ; WX 600 ; N R ; B 38 0 598 562 ;
|
||||
C 83 ; WX 600 ; N S ; B 76 -20 650 580 ;
|
||||
C 84 ; WX 600 ; N T ; B 108 0 665 562 ;
|
||||
C 85 ; WX 600 ; N U ; B 125 -18 702 562 ;
|
||||
C 86 ; WX 600 ; N V ; B 105 -13 723 562 ;
|
||||
C 87 ; WX 600 ; N W ; B 106 -13 722 562 ;
|
||||
C 88 ; WX 600 ; N X ; B 23 0 675 562 ;
|
||||
C 89 ; WX 600 ; N Y ; B 133 0 695 562 ;
|
||||
C 90 ; WX 600 ; N Z ; B 86 0 610 562 ;
|
||||
C 91 ; WX 600 ; N bracketleft ; B 246 -108 574 622 ;
|
||||
C 92 ; WX 600 ; N backslash ; B 249 -80 468 629 ;
|
||||
C 93 ; WX 600 ; N bracketright ; B 135 -108 463 622 ;
|
||||
C 94 ; WX 600 ; N asciicircum ; B 175 354 587 622 ;
|
||||
C 95 ; WX 600 ; N underscore ; B -27 -125 584 -75 ;
|
||||
C 96 ; WX 600 ; N quoteleft ; B 343 328 457 562 ;
|
||||
C 97 ; WX 600 ; N a ; B 76 -15 569 441 ;
|
||||
C 98 ; WX 600 ; N b ; B 29 -15 625 629 ;
|
||||
C 99 ; WX 600 ; N c ; B 106 -15 608 441 ;
|
||||
C 100 ; WX 600 ; N d ; B 85 -15 640 629 ;
|
||||
C 101 ; WX 600 ; N e ; B 106 -15 598 441 ;
|
||||
C 102 ; WX 600 ; N f ; B 114 0 662 629 ; L i fi ; L l fl ;
|
||||
C 103 ; WX 600 ; N g ; B 61 -157 657 441 ;
|
||||
C 104 ; WX 600 ; N h ; B 33 0 592 629 ;
|
||||
C 105 ; WX 600 ; N i ; B 95 0 515 657 ;
|
||||
C 106 ; WX 600 ; N j ; B 52 -157 550 657 ;
|
||||
C 107 ; WX 600 ; N k ; B 58 0 633 629 ;
|
||||
C 108 ; WX 600 ; N l ; B 95 0 515 629 ;
|
||||
C 109 ; WX 600 ; N m ; B -5 0 615 441 ;
|
||||
C 110 ; WX 600 ; N n ; B 26 0 585 441 ;
|
||||
C 111 ; WX 600 ; N o ; B 102 -15 588 441 ;
|
||||
C 112 ; WX 600 ; N p ; B -24 -157 605 441 ;
|
||||
C 113 ; WX 600 ; N q ; B 85 -157 682 441 ;
|
||||
C 114 ; WX 600 ; N r ; B 60 0 636 441 ;
|
||||
C 115 ; WX 600 ; N s ; B 78 -15 584 441 ;
|
||||
C 116 ; WX 600 ; N t ; B 167 -15 561 561 ;
|
||||
C 117 ; WX 600 ; N u ; B 101 -15 572 426 ;
|
||||
C 118 ; WX 600 ; N v ; B 90 -10 681 426 ;
|
||||
C 119 ; WX 600 ; N w ; B 76 -10 695 426 ;
|
||||
C 120 ; WX 600 ; N x ; B 20 0 655 426 ;
|
||||
C 121 ; WX 600 ; N y ; B -4 -157 683 426 ;
|
||||
C 122 ; WX 600 ; N z ; B 99 0 593 426 ;
|
||||
C 123 ; WX 600 ; N braceleft ; B 233 -108 569 622 ;
|
||||
C 124 ; WX 600 ; N bar ; B 222 -250 485 750 ;
|
||||
C 125 ; WX 600 ; N braceright ; B 140 -108 477 622 ;
|
||||
C 126 ; WX 600 ; N asciitilde ; B 116 197 600 320 ;
|
||||
C 161 ; WX 600 ; N exclamdown ; B 225 -157 445 430 ;
|
||||
C 162 ; WX 600 ; N cent ; B 151 -49 588 614 ;
|
||||
C 163 ; WX 600 ; N sterling ; B 124 -21 621 611 ;
|
||||
C 164 ; WX 600 ; N fraction ; B 84 -57 646 665 ;
|
||||
C 165 ; WX 600 ; N yen ; B 120 0 693 562 ;
|
||||
C 166 ; WX 600 ; N florin ; B -26 -143 671 622 ;
|
||||
C 167 ; WX 600 ; N section ; B 104 -78 590 580 ;
|
||||
C 168 ; WX 600 ; N currency ; B 94 58 628 506 ;
|
||||
C 169 ; WX 600 ; N quotesingle ; B 345 328 460 562 ;
|
||||
C 170 ; WX 600 ; N quotedblleft ; B 262 328 541 562 ;
|
||||
C 171 ; WX 600 ; N guillemotleft ; B 92 70 652 446 ;
|
||||
C 172 ; WX 600 ; N guilsinglleft ; B 204 70 540 446 ;
|
||||
C 173 ; WX 600 ; N guilsinglright ; B 170 70 506 446 ;
|
||||
C 174 ; WX 600 ; N fi ; B 3 0 619 629 ;
|
||||
C 175 ; WX 600 ; N fl ; B 3 0 619 629 ;
|
||||
C 177 ; WX 600 ; N endash ; B 124 231 586 285 ;
|
||||
C 178 ; WX 600 ; N dagger ; B 217 -78 546 580 ;
|
||||
C 179 ; WX 600 ; N daggerdbl ; B 163 -78 546 580 ;
|
||||
C 180 ; WX 600 ; N periodcentered ; B 275 189 434 327 ;
|
||||
C 182 ; WX 600 ; N paragraph ; B 100 -78 630 562 ;
|
||||
C 183 ; WX 600 ; N bullet ; B 224 130 485 383 ;
|
||||
C 184 ; WX 600 ; N quotesinglbase ; B 185 -134 397 100 ;
|
||||
C 185 ; WX 600 ; N quotedblbase ; B 115 -134 478 100 ;
|
||||
C 186 ; WX 600 ; N quotedblright ; B 213 328 576 562 ;
|
||||
C 187 ; WX 600 ; N guillemotright ; B 58 70 618 446 ;
|
||||
C 188 ; WX 600 ; N ellipsis ; B 46 -15 575 111 ;
|
||||
C 189 ; WX 600 ; N perthousand ; B 59 -15 627 622 ;
|
||||
C 191 ; WX 600 ; N questiondown ; B 105 -157 466 430 ;
|
||||
C 193 ; WX 600 ; N grave ; B 294 497 484 672 ;
|
||||
C 194 ; WX 600 ; N acute ; B 348 497 612 672 ;
|
||||
C 195 ; WX 600 ; N circumflex ; B 229 477 581 654 ;
|
||||
C 196 ; WX 600 ; N tilde ; B 212 489 629 606 ;
|
||||
C 197 ; WX 600 ; N macron ; B 232 525 600 565 ;
|
||||
C 198 ; WX 600 ; N breve ; B 279 501 576 609 ;
|
||||
C 199 ; WX 600 ; N dotaccent ; B 373 537 478 640 ;
|
||||
C 200 ; WX 600 ; N dieresis ; B 272 537 579 640 ;
|
||||
C 202 ; WX 600 ; N ring ; B 332 463 500 627 ;
|
||||
C 203 ; WX 600 ; N cedilla ; B 197 -151 344 10 ;
|
||||
C 205 ; WX 600 ; N hungarumlaut ; B 239 497 683 672 ;
|
||||
C 206 ; WX 600 ; N ogonek ; B 189 -172 377 4 ;
|
||||
C 207 ; WX 600 ; N caron ; B 262 492 614 669 ;
|
||||
C 208 ; WX 600 ; N emdash ; B 49 231 661 285 ;
|
||||
C 225 ; WX 600 ; N AE ; B 3 0 655 562 ;
|
||||
C 227 ; WX 600 ; N ordfeminine ; B 209 249 512 580 ;
|
||||
C 232 ; WX 600 ; N Lslash ; B 47 0 607 562 ;
|
||||
C 233 ; WX 600 ; N Oslash ; B 94 -80 625 629 ;
|
||||
C 234 ; WX 600 ; N OE ; B 59 0 672 562 ;
|
||||
C 235 ; WX 600 ; N ordmasculine ; B 210 249 535 580 ;
|
||||
C 241 ; WX 600 ; N ae ; B 41 -15 626 441 ;
|
||||
C 245 ; WX 600 ; N dotlessi ; B 95 0 515 426 ;
|
||||
C 248 ; WX 600 ; N lslash ; B 95 0 587 629 ;
|
||||
C 249 ; WX 600 ; N oslash ; B 102 -80 588 506 ;
|
||||
C 250 ; WX 600 ; N oe ; B 54 -15 615 441 ;
|
||||
C 251 ; WX 600 ; N germandbls ; B 48 -15 617 629 ;
|
||||
C -1 ; WX 600 ; N Idieresis ; B 96 0 623 753 ;
|
||||
C -1 ; WX 600 ; N eacute ; B 106 -15 612 672 ;
|
||||
C -1 ; WX 600 ; N abreve ; B 76 -15 576 609 ;
|
||||
C -1 ; WX 600 ; N uhungarumlaut ; B 101 -15 723 672 ;
|
||||
C -1 ; WX 600 ; N ecaron ; B 106 -15 614 669 ;
|
||||
C -1 ; WX 600 ; N Ydieresis ; B 133 0 695 753 ;
|
||||
C -1 ; WX 600 ; N divide ; B 136 48 573 467 ;
|
||||
C -1 ; WX 600 ; N Yacute ; B 133 0 695 805 ;
|
||||
C -1 ; WX 600 ; N Acircumflex ; B 3 0 607 787 ;
|
||||
C -1 ; WX 600 ; N aacute ; B 76 -15 612 672 ;
|
||||
C -1 ; WX 600 ; N Ucircumflex ; B 125 -18 702 787 ;
|
||||
C -1 ; WX 600 ; N yacute ; B -4 -157 683 672 ;
|
||||
C -1 ; WX 600 ; N scommaaccent ; B 78 -250 584 441 ;
|
||||
C -1 ; WX 600 ; N ecircumflex ; B 106 -15 598 654 ;
|
||||
C -1 ; WX 600 ; N Uring ; B 125 -18 702 760 ;
|
||||
C -1 ; WX 600 ; N Udieresis ; B 125 -18 702 753 ;
|
||||
C -1 ; WX 600 ; N aogonek ; B 76 -172 569 441 ;
|
||||
C -1 ; WX 600 ; N Uacute ; B 125 -18 702 805 ;
|
||||
C -1 ; WX 600 ; N uogonek ; B 101 -172 572 426 ;
|
||||
C -1 ; WX 600 ; N Edieresis ; B 53 0 660 753 ;
|
||||
C -1 ; WX 600 ; N Dcroat ; B 43 0 645 562 ;
|
||||
C -1 ; WX 600 ; N commaaccent ; B 145 -250 323 -58 ;
|
||||
C -1 ; WX 600 ; N copyright ; B 53 -18 667 580 ;
|
||||
C -1 ; WX 600 ; N Emacron ; B 53 0 660 698 ;
|
||||
C -1 ; WX 600 ; N ccaron ; B 106 -15 614 669 ;
|
||||
C -1 ; WX 600 ; N aring ; B 76 -15 569 627 ;
|
||||
C -1 ; WX 600 ; N Ncommaaccent ; B 7 -250 712 562 ;
|
||||
C -1 ; WX 600 ; N lacute ; B 95 0 640 805 ;
|
||||
C -1 ; WX 600 ; N agrave ; B 76 -15 569 672 ;
|
||||
C -1 ; WX 600 ; N Tcommaaccent ; B 108 -250 665 562 ;
|
||||
C -1 ; WX 600 ; N Cacute ; B 93 -18 655 805 ;
|
||||
C -1 ; WX 600 ; N atilde ; B 76 -15 629 606 ;
|
||||
C -1 ; WX 600 ; N Edotaccent ; B 53 0 660 753 ;
|
||||
C -1 ; WX 600 ; N scaron ; B 78 -15 614 669 ;
|
||||
C -1 ; WX 600 ; N scedilla ; B 78 -151 584 441 ;
|
||||
C -1 ; WX 600 ; N iacute ; B 95 0 612 672 ;
|
||||
C -1 ; WX 600 ; N lozenge ; B 94 0 519 706 ;
|
||||
C -1 ; WX 600 ; N Rcaron ; B 38 0 642 802 ;
|
||||
C -1 ; WX 600 ; N Gcommaaccent ; B 83 -250 645 580 ;
|
||||
C -1 ; WX 600 ; N ucircumflex ; B 101 -15 572 654 ;
|
||||
C -1 ; WX 600 ; N acircumflex ; B 76 -15 581 654 ;
|
||||
C -1 ; WX 600 ; N Amacron ; B 3 0 607 698 ;
|
||||
C -1 ; WX 600 ; N rcaron ; B 60 0 636 669 ;
|
||||
C -1 ; WX 600 ; N ccedilla ; B 106 -151 614 441 ;
|
||||
C -1 ; WX 600 ; N Zdotaccent ; B 86 0 610 753 ;
|
||||
C -1 ; WX 600 ; N Thorn ; B 79 0 606 562 ;
|
||||
C -1 ; WX 600 ; N Omacron ; B 94 -18 628 698 ;
|
||||
C -1 ; WX 600 ; N Racute ; B 38 0 670 805 ;
|
||||
C -1 ; WX 600 ; N Sacute ; B 76 -20 650 805 ;
|
||||
C -1 ; WX 600 ; N dcaron ; B 85 -15 849 629 ;
|
||||
C -1 ; WX 600 ; N Umacron ; B 125 -18 702 698 ;
|
||||
C -1 ; WX 600 ; N uring ; B 101 -15 572 627 ;
|
||||
C -1 ; WX 600 ; N threesuperior ; B 213 240 501 622 ;
|
||||
C -1 ; WX 600 ; N Ograve ; B 94 -18 625 805 ;
|
||||
C -1 ; WX 600 ; N Agrave ; B 3 0 607 805 ;
|
||||
C -1 ; WX 600 ; N Abreve ; B 3 0 607 732 ;
|
||||
C -1 ; WX 600 ; N multiply ; B 103 43 607 470 ;
|
||||
C -1 ; WX 600 ; N uacute ; B 101 -15 602 672 ;
|
||||
C -1 ; WX 600 ; N Tcaron ; B 108 0 665 802 ;
|
||||
C -1 ; WX 600 ; N partialdiff ; B 45 -38 546 710 ;
|
||||
C -1 ; WX 600 ; N ydieresis ; B -4 -157 683 620 ;
|
||||
C -1 ; WX 600 ; N Nacute ; B 7 -13 712 805 ;
|
||||
C -1 ; WX 600 ; N icircumflex ; B 95 0 551 654 ;
|
||||
C -1 ; WX 600 ; N Ecircumflex ; B 53 0 660 787 ;
|
||||
C -1 ; WX 600 ; N adieresis ; B 76 -15 575 620 ;
|
||||
C -1 ; WX 600 ; N edieresis ; B 106 -15 598 620 ;
|
||||
C -1 ; WX 600 ; N cacute ; B 106 -15 612 672 ;
|
||||
C -1 ; WX 600 ; N nacute ; B 26 0 602 672 ;
|
||||
C -1 ; WX 600 ; N umacron ; B 101 -15 600 565 ;
|
||||
C -1 ; WX 600 ; N Ncaron ; B 7 -13 712 802 ;
|
||||
C -1 ; WX 600 ; N Iacute ; B 96 0 640 805 ;
|
||||
C -1 ; WX 600 ; N plusminus ; B 96 44 594 558 ;
|
||||
C -1 ; WX 600 ; N brokenbar ; B 238 -175 469 675 ;
|
||||
C -1 ; WX 600 ; N registered ; B 53 -18 667 580 ;
|
||||
C -1 ; WX 600 ; N Gbreve ; B 83 -18 645 732 ;
|
||||
C -1 ; WX 600 ; N Idotaccent ; B 96 0 623 753 ;
|
||||
C -1 ; WX 600 ; N summation ; B 15 -10 670 706 ;
|
||||
C -1 ; WX 600 ; N Egrave ; B 53 0 660 805 ;
|
||||
C -1 ; WX 600 ; N racute ; B 60 0 636 672 ;
|
||||
C -1 ; WX 600 ; N omacron ; B 102 -15 600 565 ;
|
||||
C -1 ; WX 600 ; N Zacute ; B 86 0 670 805 ;
|
||||
C -1 ; WX 600 ; N Zcaron ; B 86 0 642 802 ;
|
||||
C -1 ; WX 600 ; N greaterequal ; B 98 0 594 710 ;
|
||||
C -1 ; WX 600 ; N Eth ; B 43 0 645 562 ;
|
||||
C -1 ; WX 600 ; N Ccedilla ; B 93 -151 658 580 ;
|
||||
C -1 ; WX 600 ; N lcommaaccent ; B 95 -250 515 629 ;
|
||||
C -1 ; WX 600 ; N tcaron ; B 167 -15 587 717 ;
|
||||
C -1 ; WX 600 ; N eogonek ; B 106 -172 598 441 ;
|
||||
C -1 ; WX 600 ; N Uogonek ; B 124 -172 702 562 ;
|
||||
C -1 ; WX 600 ; N Aacute ; B 3 0 660 805 ;
|
||||
C -1 ; WX 600 ; N Adieresis ; B 3 0 607 753 ;
|
||||
C -1 ; WX 600 ; N egrave ; B 106 -15 598 672 ;
|
||||
C -1 ; WX 600 ; N zacute ; B 99 0 612 672 ;
|
||||
C -1 ; WX 600 ; N iogonek ; B 95 -172 515 657 ;
|
||||
C -1 ; WX 600 ; N Oacute ; B 94 -18 640 805 ;
|
||||
C -1 ; WX 600 ; N oacute ; B 102 -15 612 672 ;
|
||||
C -1 ; WX 600 ; N amacron ; B 76 -15 600 565 ;
|
||||
C -1 ; WX 600 ; N sacute ; B 78 -15 612 672 ;
|
||||
C -1 ; WX 600 ; N idieresis ; B 95 0 545 620 ;
|
||||
C -1 ; WX 600 ; N Ocircumflex ; B 94 -18 625 787 ;
|
||||
C -1 ; WX 600 ; N Ugrave ; B 125 -18 702 805 ;
|
||||
C -1 ; WX 600 ; N Delta ; B 6 0 598 688 ;
|
||||
C -1 ; WX 600 ; N thorn ; B -24 -157 605 629 ;
|
||||
C -1 ; WX 600 ; N twosuperior ; B 230 249 535 622 ;
|
||||
C -1 ; WX 600 ; N Odieresis ; B 94 -18 625 753 ;
|
||||
C -1 ; WX 600 ; N mu ; B 72 -157 572 426 ;
|
||||
C -1 ; WX 600 ; N igrave ; B 95 0 515 672 ;
|
||||
C -1 ; WX 600 ; N ohungarumlaut ; B 102 -15 723 672 ;
|
||||
C -1 ; WX 600 ; N Eogonek ; B 53 -172 660 562 ;
|
||||
C -1 ; WX 600 ; N dcroat ; B 85 -15 704 629 ;
|
||||
C -1 ; WX 600 ; N threequarters ; B 73 -56 659 666 ;
|
||||
C -1 ; WX 600 ; N Scedilla ; B 76 -151 650 580 ;
|
||||
C -1 ; WX 600 ; N lcaron ; B 95 0 667 629 ;
|
||||
C -1 ; WX 600 ; N Kcommaaccent ; B 38 -250 671 562 ;
|
||||
C -1 ; WX 600 ; N Lacute ; B 47 0 607 805 ;
|
||||
C -1 ; WX 600 ; N trademark ; B 75 263 742 562 ;
|
||||
C -1 ; WX 600 ; N edotaccent ; B 106 -15 598 620 ;
|
||||
C -1 ; WX 600 ; N Igrave ; B 96 0 623 805 ;
|
||||
C -1 ; WX 600 ; N Imacron ; B 96 0 628 698 ;
|
||||
C -1 ; WX 600 ; N Lcaron ; B 47 0 632 562 ;
|
||||
C -1 ; WX 600 ; N onehalf ; B 65 -57 669 665 ;
|
||||
C -1 ; WX 600 ; N lessequal ; B 98 0 645 710 ;
|
||||
C -1 ; WX 600 ; N ocircumflex ; B 102 -15 588 654 ;
|
||||
C -1 ; WX 600 ; N ntilde ; B 26 0 629 606 ;
|
||||
C -1 ; WX 600 ; N Uhungarumlaut ; B 125 -18 761 805 ;
|
||||
C -1 ; WX 600 ; N Eacute ; B 53 0 670 805 ;
|
||||
C -1 ; WX 600 ; N emacron ; B 106 -15 600 565 ;
|
||||
C -1 ; WX 600 ; N gbreve ; B 61 -157 657 609 ;
|
||||
C -1 ; WX 600 ; N onequarter ; B 65 -57 674 665 ;
|
||||
C -1 ; WX 600 ; N Scaron ; B 76 -20 672 802 ;
|
||||
C -1 ; WX 600 ; N Scommaaccent ; B 76 -250 650 580 ;
|
||||
C -1 ; WX 600 ; N Ohungarumlaut ; B 94 -18 751 805 ;
|
||||
C -1 ; WX 600 ; N degree ; B 214 269 576 622 ;
|
||||
C -1 ; WX 600 ; N ograve ; B 102 -15 588 672 ;
|
||||
C -1 ; WX 600 ; N Ccaron ; B 93 -18 672 802 ;
|
||||
C -1 ; WX 600 ; N ugrave ; B 101 -15 572 672 ;
|
||||
C -1 ; WX 600 ; N radical ; B 85 -15 765 792 ;
|
||||
C -1 ; WX 600 ; N Dcaron ; B 43 0 645 802 ;
|
||||
C -1 ; WX 600 ; N rcommaaccent ; B 60 -250 636 441 ;
|
||||
C -1 ; WX 600 ; N Ntilde ; B 7 -13 712 729 ;
|
||||
C -1 ; WX 600 ; N otilde ; B 102 -15 629 606 ;
|
||||
C -1 ; WX 600 ; N Rcommaaccent ; B 38 -250 598 562 ;
|
||||
C -1 ; WX 600 ; N Lcommaaccent ; B 47 -250 607 562 ;
|
||||
C -1 ; WX 600 ; N Atilde ; B 3 0 655 729 ;
|
||||
C -1 ; WX 600 ; N Aogonek ; B 3 -172 607 562 ;
|
||||
C -1 ; WX 600 ; N Aring ; B 3 0 607 750 ;
|
||||
C -1 ; WX 600 ; N Otilde ; B 94 -18 655 729 ;
|
||||
C -1 ; WX 600 ; N zdotaccent ; B 99 0 593 620 ;
|
||||
C -1 ; WX 600 ; N Ecaron ; B 53 0 660 802 ;
|
||||
C -1 ; WX 600 ; N Iogonek ; B 96 -172 623 562 ;
|
||||
C -1 ; WX 600 ; N kcommaaccent ; B 58 -250 633 629 ;
|
||||
C -1 ; WX 600 ; N minus ; B 129 232 580 283 ;
|
||||
C -1 ; WX 600 ; N Icircumflex ; B 96 0 623 787 ;
|
||||
C -1 ; WX 600 ; N ncaron ; B 26 0 614 669 ;
|
||||
C -1 ; WX 600 ; N tcommaaccent ; B 165 -250 561 561 ;
|
||||
C -1 ; WX 600 ; N logicalnot ; B 155 108 591 369 ;
|
||||
C -1 ; WX 600 ; N odieresis ; B 102 -15 588 620 ;
|
||||
C -1 ; WX 600 ; N udieresis ; B 101 -15 575 620 ;
|
||||
C -1 ; WX 600 ; N notequal ; B 43 -16 621 529 ;
|
||||
C -1 ; WX 600 ; N gcommaaccent ; B 61 -157 657 708 ;
|
||||
C -1 ; WX 600 ; N eth ; B 102 -15 639 629 ;
|
||||
C -1 ; WX 600 ; N zcaron ; B 99 0 624 669 ;
|
||||
C -1 ; WX 600 ; N ncommaaccent ; B 26 -250 585 441 ;
|
||||
C -1 ; WX 600 ; N onesuperior ; B 231 249 491 622 ;
|
||||
C -1 ; WX 600 ; N imacron ; B 95 0 543 565 ;
|
||||
C -1 ; WX 600 ; N Euro ; B 0 0 0 0 ;
|
||||
EndCharMetrics
|
||||
EndFontMetrics
|
||||
342
internal/pdf/model/fonts/afms/Courier.afm
Normal file
342
internal/pdf/model/fonts/afms/Courier.afm
Normal file
@@ -0,0 +1,342 @@
|
||||
StartFontMetrics 4.1
|
||||
Comment Copyright (c) 1989, 1990, 1991, 1992, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
Comment Creation Date: Thu May 1 17:27:09 1997
|
||||
Comment UniqueID 43050
|
||||
Comment VMusage 39754 50779
|
||||
FontName Courier
|
||||
FullName Courier
|
||||
FamilyName Courier
|
||||
Weight Medium
|
||||
ItalicAngle 0
|
||||
IsFixedPitch true
|
||||
CharacterSet ExtendedRoman
|
||||
FontBBox -23 -250 715 805
|
||||
UnderlinePosition -100
|
||||
UnderlineThickness 50
|
||||
Version 003.000
|
||||
Notice Copyright (c) 1989, 1990, 1991, 1992, 1993, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
EncodingScheme AdobeStandardEncoding
|
||||
CapHeight 562
|
||||
XHeight 426
|
||||
Ascender 629
|
||||
Descender -157
|
||||
StdHW 51
|
||||
StdVW 51
|
||||
StartCharMetrics 315
|
||||
C 32 ; WX 600 ; N space ; B 0 0 0 0 ;
|
||||
C 33 ; WX 600 ; N exclam ; B 236 -15 364 572 ;
|
||||
C 34 ; WX 600 ; N quotedbl ; B 187 328 413 562 ;
|
||||
C 35 ; WX 600 ; N numbersign ; B 93 -32 507 639 ;
|
||||
C 36 ; WX 600 ; N dollar ; B 105 -126 496 662 ;
|
||||
C 37 ; WX 600 ; N percent ; B 81 -15 518 622 ;
|
||||
C 38 ; WX 600 ; N ampersand ; B 63 -15 538 543 ;
|
||||
C 39 ; WX 600 ; N quoteright ; B 213 328 376 562 ;
|
||||
C 40 ; WX 600 ; N parenleft ; B 269 -108 440 622 ;
|
||||
C 41 ; WX 600 ; N parenright ; B 160 -108 331 622 ;
|
||||
C 42 ; WX 600 ; N asterisk ; B 116 257 484 607 ;
|
||||
C 43 ; WX 600 ; N plus ; B 80 44 520 470 ;
|
||||
C 44 ; WX 600 ; N comma ; B 181 -112 344 122 ;
|
||||
C 45 ; WX 600 ; N hyphen ; B 103 231 497 285 ;
|
||||
C 46 ; WX 600 ; N period ; B 229 -15 371 109 ;
|
||||
C 47 ; WX 600 ; N slash ; B 125 -80 475 629 ;
|
||||
C 48 ; WX 600 ; N zero ; B 106 -15 494 622 ;
|
||||
C 49 ; WX 600 ; N one ; B 96 0 505 622 ;
|
||||
C 50 ; WX 600 ; N two ; B 70 0 471 622 ;
|
||||
C 51 ; WX 600 ; N three ; B 75 -15 466 622 ;
|
||||
C 52 ; WX 600 ; N four ; B 78 0 500 622 ;
|
||||
C 53 ; WX 600 ; N five ; B 92 -15 497 607 ;
|
||||
C 54 ; WX 600 ; N six ; B 111 -15 497 622 ;
|
||||
C 55 ; WX 600 ; N seven ; B 82 0 483 607 ;
|
||||
C 56 ; WX 600 ; N eight ; B 102 -15 498 622 ;
|
||||
C 57 ; WX 600 ; N nine ; B 96 -15 489 622 ;
|
||||
C 58 ; WX 600 ; N colon ; B 229 -15 371 385 ;
|
||||
C 59 ; WX 600 ; N semicolon ; B 181 -112 371 385 ;
|
||||
C 60 ; WX 600 ; N less ; B 41 42 519 472 ;
|
||||
C 61 ; WX 600 ; N equal ; B 80 138 520 376 ;
|
||||
C 62 ; WX 600 ; N greater ; B 66 42 544 472 ;
|
||||
C 63 ; WX 600 ; N question ; B 129 -15 492 572 ;
|
||||
C 64 ; WX 600 ; N at ; B 77 -15 533 622 ;
|
||||
C 65 ; WX 600 ; N A ; B 3 0 597 562 ;
|
||||
C 66 ; WX 600 ; N B ; B 43 0 559 562 ;
|
||||
C 67 ; WX 600 ; N C ; B 41 -18 540 580 ;
|
||||
C 68 ; WX 600 ; N D ; B 43 0 574 562 ;
|
||||
C 69 ; WX 600 ; N E ; B 53 0 550 562 ;
|
||||
C 70 ; WX 600 ; N F ; B 53 0 545 562 ;
|
||||
C 71 ; WX 600 ; N G ; B 31 -18 575 580 ;
|
||||
C 72 ; WX 600 ; N H ; B 32 0 568 562 ;
|
||||
C 73 ; WX 600 ; N I ; B 96 0 504 562 ;
|
||||
C 74 ; WX 600 ; N J ; B 34 -18 566 562 ;
|
||||
C 75 ; WX 600 ; N K ; B 38 0 582 562 ;
|
||||
C 76 ; WX 600 ; N L ; B 47 0 554 562 ;
|
||||
C 77 ; WX 600 ; N M ; B 4 0 596 562 ;
|
||||
C 78 ; WX 600 ; N N ; B 7 -13 593 562 ;
|
||||
C 79 ; WX 600 ; N O ; B 43 -18 557 580 ;
|
||||
C 80 ; WX 600 ; N P ; B 79 0 558 562 ;
|
||||
C 81 ; WX 600 ; N Q ; B 43 -138 557 580 ;
|
||||
C 82 ; WX 600 ; N R ; B 38 0 588 562 ;
|
||||
C 83 ; WX 600 ; N S ; B 72 -20 529 580 ;
|
||||
C 84 ; WX 600 ; N T ; B 38 0 563 562 ;
|
||||
C 85 ; WX 600 ; N U ; B 17 -18 583 562 ;
|
||||
C 86 ; WX 600 ; N V ; B -4 -13 604 562 ;
|
||||
C 87 ; WX 600 ; N W ; B -3 -13 603 562 ;
|
||||
C 88 ; WX 600 ; N X ; B 23 0 577 562 ;
|
||||
C 89 ; WX 600 ; N Y ; B 24 0 576 562 ;
|
||||
C 90 ; WX 600 ; N Z ; B 86 0 514 562 ;
|
||||
C 91 ; WX 600 ; N bracketleft ; B 269 -108 442 622 ;
|
||||
C 92 ; WX 600 ; N backslash ; B 118 -80 482 629 ;
|
||||
C 93 ; WX 600 ; N bracketright ; B 158 -108 331 622 ;
|
||||
C 94 ; WX 600 ; N asciicircum ; B 94 354 506 622 ;
|
||||
C 95 ; WX 600 ; N underscore ; B 0 -125 600 -75 ;
|
||||
C 96 ; WX 600 ; N quoteleft ; B 224 328 387 562 ;
|
||||
C 97 ; WX 600 ; N a ; B 53 -15 559 441 ;
|
||||
C 98 ; WX 600 ; N b ; B 14 -15 575 629 ;
|
||||
C 99 ; WX 600 ; N c ; B 66 -15 529 441 ;
|
||||
C 100 ; WX 600 ; N d ; B 45 -15 591 629 ;
|
||||
C 101 ; WX 600 ; N e ; B 66 -15 548 441 ;
|
||||
C 102 ; WX 600 ; N f ; B 114 0 531 629 ; L i fi ; L l fl ;
|
||||
C 103 ; WX 600 ; N g ; B 45 -157 566 441 ;
|
||||
C 104 ; WX 600 ; N h ; B 18 0 582 629 ;
|
||||
C 105 ; WX 600 ; N i ; B 95 0 505 657 ;
|
||||
C 106 ; WX 600 ; N j ; B 82 -157 410 657 ;
|
||||
C 107 ; WX 600 ; N k ; B 43 0 580 629 ;
|
||||
C 108 ; WX 600 ; N l ; B 95 0 505 629 ;
|
||||
C 109 ; WX 600 ; N m ; B -5 0 605 441 ;
|
||||
C 110 ; WX 600 ; N n ; B 26 0 575 441 ;
|
||||
C 111 ; WX 600 ; N o ; B 62 -15 538 441 ;
|
||||
C 112 ; WX 600 ; N p ; B 9 -157 555 441 ;
|
||||
C 113 ; WX 600 ; N q ; B 45 -157 591 441 ;
|
||||
C 114 ; WX 600 ; N r ; B 60 0 559 441 ;
|
||||
C 115 ; WX 600 ; N s ; B 80 -15 513 441 ;
|
||||
C 116 ; WX 600 ; N t ; B 87 -15 530 561 ;
|
||||
C 117 ; WX 600 ; N u ; B 21 -15 562 426 ;
|
||||
C 118 ; WX 600 ; N v ; B 10 -10 590 426 ;
|
||||
C 119 ; WX 600 ; N w ; B -4 -10 604 426 ;
|
||||
C 120 ; WX 600 ; N x ; B 20 0 580 426 ;
|
||||
C 121 ; WX 600 ; N y ; B 7 -157 592 426 ;
|
||||
C 122 ; WX 600 ; N z ; B 99 0 502 426 ;
|
||||
C 123 ; WX 600 ; N braceleft ; B 182 -108 437 622 ;
|
||||
C 124 ; WX 600 ; N bar ; B 275 -250 326 750 ;
|
||||
C 125 ; WX 600 ; N braceright ; B 163 -108 418 622 ;
|
||||
C 126 ; WX 600 ; N asciitilde ; B 63 197 540 320 ;
|
||||
C 161 ; WX 600 ; N exclamdown ; B 236 -157 364 430 ;
|
||||
C 162 ; WX 600 ; N cent ; B 96 -49 500 614 ;
|
||||
C 163 ; WX 600 ; N sterling ; B 84 -21 521 611 ;
|
||||
C 164 ; WX 600 ; N fraction ; B 92 -57 509 665 ;
|
||||
C 165 ; WX 600 ; N yen ; B 26 0 574 562 ;
|
||||
C 166 ; WX 600 ; N florin ; B 4 -143 539 622 ;
|
||||
C 167 ; WX 600 ; N section ; B 113 -78 488 580 ;
|
||||
C 168 ; WX 600 ; N currency ; B 73 58 527 506 ;
|
||||
C 169 ; WX 600 ; N quotesingle ; B 259 328 341 562 ;
|
||||
C 170 ; WX 600 ; N quotedblleft ; B 143 328 471 562 ;
|
||||
C 171 ; WX 600 ; N guillemotleft ; B 37 70 563 446 ;
|
||||
C 172 ; WX 600 ; N guilsinglleft ; B 149 70 451 446 ;
|
||||
C 173 ; WX 600 ; N guilsinglright ; B 149 70 451 446 ;
|
||||
C 174 ; WX 600 ; N fi ; B 3 0 597 629 ;
|
||||
C 175 ; WX 600 ; N fl ; B 3 0 597 629 ;
|
||||
C 177 ; WX 600 ; N endash ; B 75 231 525 285 ;
|
||||
C 178 ; WX 600 ; N dagger ; B 141 -78 459 580 ;
|
||||
C 179 ; WX 600 ; N daggerdbl ; B 141 -78 459 580 ;
|
||||
C 180 ; WX 600 ; N periodcentered ; B 222 189 378 327 ;
|
||||
C 182 ; WX 600 ; N paragraph ; B 50 -78 511 562 ;
|
||||
C 183 ; WX 600 ; N bullet ; B 172 130 428 383 ;
|
||||
C 184 ; WX 600 ; N quotesinglbase ; B 213 -134 376 100 ;
|
||||
C 185 ; WX 600 ; N quotedblbase ; B 143 -134 457 100 ;
|
||||
C 186 ; WX 600 ; N quotedblright ; B 143 328 457 562 ;
|
||||
C 187 ; WX 600 ; N guillemotright ; B 37 70 563 446 ;
|
||||
C 188 ; WX 600 ; N ellipsis ; B 37 -15 563 111 ;
|
||||
C 189 ; WX 600 ; N perthousand ; B 3 -15 600 622 ;
|
||||
C 191 ; WX 600 ; N questiondown ; B 108 -157 471 430 ;
|
||||
C 193 ; WX 600 ; N grave ; B 151 497 378 672 ;
|
||||
C 194 ; WX 600 ; N acute ; B 242 497 469 672 ;
|
||||
C 195 ; WX 600 ; N circumflex ; B 124 477 476 654 ;
|
||||
C 196 ; WX 600 ; N tilde ; B 105 489 503 606 ;
|
||||
C 197 ; WX 600 ; N macron ; B 120 525 480 565 ;
|
||||
C 198 ; WX 600 ; N breve ; B 153 501 447 609 ;
|
||||
C 199 ; WX 600 ; N dotaccent ; B 249 537 352 640 ;
|
||||
C 200 ; WX 600 ; N dieresis ; B 148 537 453 640 ;
|
||||
C 202 ; WX 600 ; N ring ; B 218 463 382 627 ;
|
||||
C 203 ; WX 600 ; N cedilla ; B 224 -151 362 10 ;
|
||||
C 205 ; WX 600 ; N hungarumlaut ; B 133 497 540 672 ;
|
||||
C 206 ; WX 600 ; N ogonek ; B 211 -172 407 4 ;
|
||||
C 207 ; WX 600 ; N caron ; B 124 492 476 669 ;
|
||||
C 208 ; WX 600 ; N emdash ; B 0 231 600 285 ;
|
||||
C 225 ; WX 600 ; N AE ; B 3 0 550 562 ;
|
||||
C 227 ; WX 600 ; N ordfeminine ; B 156 249 442 580 ;
|
||||
C 232 ; WX 600 ; N Lslash ; B 47 0 554 562 ;
|
||||
C 233 ; WX 600 ; N Oslash ; B 43 -80 557 629 ;
|
||||
C 234 ; WX 600 ; N OE ; B 7 0 567 562 ;
|
||||
C 235 ; WX 600 ; N ordmasculine ; B 157 249 443 580 ;
|
||||
C 241 ; WX 600 ; N ae ; B 19 -15 570 441 ;
|
||||
C 245 ; WX 600 ; N dotlessi ; B 95 0 505 426 ;
|
||||
C 248 ; WX 600 ; N lslash ; B 95 0 505 629 ;
|
||||
C 249 ; WX 600 ; N oslash ; B 62 -80 538 506 ;
|
||||
C 250 ; WX 600 ; N oe ; B 19 -15 559 441 ;
|
||||
C 251 ; WX 600 ; N germandbls ; B 48 -15 588 629 ;
|
||||
C -1 ; WX 600 ; N Idieresis ; B 96 0 504 753 ;
|
||||
C -1 ; WX 600 ; N eacute ; B 66 -15 548 672 ;
|
||||
C -1 ; WX 600 ; N abreve ; B 53 -15 559 609 ;
|
||||
C -1 ; WX 600 ; N uhungarumlaut ; B 21 -15 580 672 ;
|
||||
C -1 ; WX 600 ; N ecaron ; B 66 -15 548 669 ;
|
||||
C -1 ; WX 600 ; N Ydieresis ; B 24 0 576 753 ;
|
||||
C -1 ; WX 600 ; N divide ; B 87 48 513 467 ;
|
||||
C -1 ; WX 600 ; N Yacute ; B 24 0 576 805 ;
|
||||
C -1 ; WX 600 ; N Acircumflex ; B 3 0 597 787 ;
|
||||
C -1 ; WX 600 ; N aacute ; B 53 -15 559 672 ;
|
||||
C -1 ; WX 600 ; N Ucircumflex ; B 17 -18 583 787 ;
|
||||
C -1 ; WX 600 ; N yacute ; B 7 -157 592 672 ;
|
||||
C -1 ; WX 600 ; N scommaaccent ; B 80 -250 513 441 ;
|
||||
C -1 ; WX 600 ; N ecircumflex ; B 66 -15 548 654 ;
|
||||
C -1 ; WX 600 ; N Uring ; B 17 -18 583 760 ;
|
||||
C -1 ; WX 600 ; N Udieresis ; B 17 -18 583 753 ;
|
||||
C -1 ; WX 600 ; N aogonek ; B 53 -172 587 441 ;
|
||||
C -1 ; WX 600 ; N Uacute ; B 17 -18 583 805 ;
|
||||
C -1 ; WX 600 ; N uogonek ; B 21 -172 590 426 ;
|
||||
C -1 ; WX 600 ; N Edieresis ; B 53 0 550 753 ;
|
||||
C -1 ; WX 600 ; N Dcroat ; B 30 0 574 562 ;
|
||||
C -1 ; WX 600 ; N commaaccent ; B 198 -250 335 -58 ;
|
||||
C -1 ; WX 600 ; N copyright ; B 0 -18 600 580 ;
|
||||
C -1 ; WX 600 ; N Emacron ; B 53 0 550 698 ;
|
||||
C -1 ; WX 600 ; N ccaron ; B 66 -15 529 669 ;
|
||||
C -1 ; WX 600 ; N aring ; B 53 -15 559 627 ;
|
||||
C -1 ; WX 600 ; N Ncommaaccent ; B 7 -250 593 562 ;
|
||||
C -1 ; WX 600 ; N lacute ; B 95 0 505 805 ;
|
||||
C -1 ; WX 600 ; N agrave ; B 53 -15 559 672 ;
|
||||
C -1 ; WX 600 ; N Tcommaaccent ; B 38 -250 563 562 ;
|
||||
C -1 ; WX 600 ; N Cacute ; B 41 -18 540 805 ;
|
||||
C -1 ; WX 600 ; N atilde ; B 53 -15 559 606 ;
|
||||
C -1 ; WX 600 ; N Edotaccent ; B 53 0 550 753 ;
|
||||
C -1 ; WX 600 ; N scaron ; B 80 -15 513 669 ;
|
||||
C -1 ; WX 600 ; N scedilla ; B 80 -151 513 441 ;
|
||||
C -1 ; WX 600 ; N iacute ; B 95 0 505 672 ;
|
||||
C -1 ; WX 600 ; N lozenge ; B 18 0 443 706 ;
|
||||
C -1 ; WX 600 ; N Rcaron ; B 38 0 588 802 ;
|
||||
C -1 ; WX 600 ; N Gcommaaccent ; B 31 -250 575 580 ;
|
||||
C -1 ; WX 600 ; N ucircumflex ; B 21 -15 562 654 ;
|
||||
C -1 ; WX 600 ; N acircumflex ; B 53 -15 559 654 ;
|
||||
C -1 ; WX 600 ; N Amacron ; B 3 0 597 698 ;
|
||||
C -1 ; WX 600 ; N rcaron ; B 60 0 559 669 ;
|
||||
C -1 ; WX 600 ; N ccedilla ; B 66 -151 529 441 ;
|
||||
C -1 ; WX 600 ; N Zdotaccent ; B 86 0 514 753 ;
|
||||
C -1 ; WX 600 ; N Thorn ; B 79 0 538 562 ;
|
||||
C -1 ; WX 600 ; N Omacron ; B 43 -18 557 698 ;
|
||||
C -1 ; WX 600 ; N Racute ; B 38 0 588 805 ;
|
||||
C -1 ; WX 600 ; N Sacute ; B 72 -20 529 805 ;
|
||||
C -1 ; WX 600 ; N dcaron ; B 45 -15 715 629 ;
|
||||
C -1 ; WX 600 ; N Umacron ; B 17 -18 583 698 ;
|
||||
C -1 ; WX 600 ; N uring ; B 21 -15 562 627 ;
|
||||
C -1 ; WX 600 ; N threesuperior ; B 155 240 406 622 ;
|
||||
C -1 ; WX 600 ; N Ograve ; B 43 -18 557 805 ;
|
||||
C -1 ; WX 600 ; N Agrave ; B 3 0 597 805 ;
|
||||
C -1 ; WX 600 ; N Abreve ; B 3 0 597 732 ;
|
||||
C -1 ; WX 600 ; N multiply ; B 87 43 515 470 ;
|
||||
C -1 ; WX 600 ; N uacute ; B 21 -15 562 672 ;
|
||||
C -1 ; WX 600 ; N Tcaron ; B 38 0 563 802 ;
|
||||
C -1 ; WX 600 ; N partialdiff ; B 17 -38 459 710 ;
|
||||
C -1 ; WX 600 ; N ydieresis ; B 7 -157 592 620 ;
|
||||
C -1 ; WX 600 ; N Nacute ; B 7 -13 593 805 ;
|
||||
C -1 ; WX 600 ; N icircumflex ; B 94 0 505 654 ;
|
||||
C -1 ; WX 600 ; N Ecircumflex ; B 53 0 550 787 ;
|
||||
C -1 ; WX 600 ; N adieresis ; B 53 -15 559 620 ;
|
||||
C -1 ; WX 600 ; N edieresis ; B 66 -15 548 620 ;
|
||||
C -1 ; WX 600 ; N cacute ; B 66 -15 529 672 ;
|
||||
C -1 ; WX 600 ; N nacute ; B 26 0 575 672 ;
|
||||
C -1 ; WX 600 ; N umacron ; B 21 -15 562 565 ;
|
||||
C -1 ; WX 600 ; N Ncaron ; B 7 -13 593 802 ;
|
||||
C -1 ; WX 600 ; N Iacute ; B 96 0 504 805 ;
|
||||
C -1 ; WX 600 ; N plusminus ; B 87 44 513 558 ;
|
||||
C -1 ; WX 600 ; N brokenbar ; B 275 -175 326 675 ;
|
||||
C -1 ; WX 600 ; N registered ; B 0 -18 600 580 ;
|
||||
C -1 ; WX 600 ; N Gbreve ; B 31 -18 575 732 ;
|
||||
C -1 ; WX 600 ; N Idotaccent ; B 96 0 504 753 ;
|
||||
C -1 ; WX 600 ; N summation ; B 15 -10 585 706 ;
|
||||
C -1 ; WX 600 ; N Egrave ; B 53 0 550 805 ;
|
||||
C -1 ; WX 600 ; N racute ; B 60 0 559 672 ;
|
||||
C -1 ; WX 600 ; N omacron ; B 62 -15 538 565 ;
|
||||
C -1 ; WX 600 ; N Zacute ; B 86 0 514 805 ;
|
||||
C -1 ; WX 600 ; N Zcaron ; B 86 0 514 802 ;
|
||||
C -1 ; WX 600 ; N greaterequal ; B 98 0 502 710 ;
|
||||
C -1 ; WX 600 ; N Eth ; B 30 0 574 562 ;
|
||||
C -1 ; WX 600 ; N Ccedilla ; B 41 -151 540 580 ;
|
||||
C -1 ; WX 600 ; N lcommaaccent ; B 95 -250 505 629 ;
|
||||
C -1 ; WX 600 ; N tcaron ; B 87 -15 530 717 ;
|
||||
C -1 ; WX 600 ; N eogonek ; B 66 -172 548 441 ;
|
||||
C -1 ; WX 600 ; N Uogonek ; B 17 -172 583 562 ;
|
||||
C -1 ; WX 600 ; N Aacute ; B 3 0 597 805 ;
|
||||
C -1 ; WX 600 ; N Adieresis ; B 3 0 597 753 ;
|
||||
C -1 ; WX 600 ; N egrave ; B 66 -15 548 672 ;
|
||||
C -1 ; WX 600 ; N zacute ; B 99 0 502 672 ;
|
||||
C -1 ; WX 600 ; N iogonek ; B 95 -172 505 657 ;
|
||||
C -1 ; WX 600 ; N Oacute ; B 43 -18 557 805 ;
|
||||
C -1 ; WX 600 ; N oacute ; B 62 -15 538 672 ;
|
||||
C -1 ; WX 600 ; N amacron ; B 53 -15 559 565 ;
|
||||
C -1 ; WX 600 ; N sacute ; B 80 -15 513 672 ;
|
||||
C -1 ; WX 600 ; N idieresis ; B 95 0 505 620 ;
|
||||
C -1 ; WX 600 ; N Ocircumflex ; B 43 -18 557 787 ;
|
||||
C -1 ; WX 600 ; N Ugrave ; B 17 -18 583 805 ;
|
||||
C -1 ; WX 600 ; N Delta ; B 6 0 598 688 ;
|
||||
C -1 ; WX 600 ; N thorn ; B -6 -157 555 629 ;
|
||||
C -1 ; WX 600 ; N twosuperior ; B 177 249 424 622 ;
|
||||
C -1 ; WX 600 ; N Odieresis ; B 43 -18 557 753 ;
|
||||
C -1 ; WX 600 ; N mu ; B 21 -157 562 426 ;
|
||||
C -1 ; WX 600 ; N igrave ; B 95 0 505 672 ;
|
||||
C -1 ; WX 600 ; N ohungarumlaut ; B 62 -15 580 672 ;
|
||||
C -1 ; WX 600 ; N Eogonek ; B 53 -172 561 562 ;
|
||||
C -1 ; WX 600 ; N dcroat ; B 45 -15 591 629 ;
|
||||
C -1 ; WX 600 ; N threequarters ; B 8 -56 593 666 ;
|
||||
C -1 ; WX 600 ; N Scedilla ; B 72 -151 529 580 ;
|
||||
C -1 ; WX 600 ; N lcaron ; B 95 0 533 629 ;
|
||||
C -1 ; WX 600 ; N Kcommaaccent ; B 38 -250 582 562 ;
|
||||
C -1 ; WX 600 ; N Lacute ; B 47 0 554 805 ;
|
||||
C -1 ; WX 600 ; N trademark ; B -23 263 623 562 ;
|
||||
C -1 ; WX 600 ; N edotaccent ; B 66 -15 548 620 ;
|
||||
C -1 ; WX 600 ; N Igrave ; B 96 0 504 805 ;
|
||||
C -1 ; WX 600 ; N Imacron ; B 96 0 504 698 ;
|
||||
C -1 ; WX 600 ; N Lcaron ; B 47 0 554 562 ;
|
||||
C -1 ; WX 600 ; N onehalf ; B 0 -57 611 665 ;
|
||||
C -1 ; WX 600 ; N lessequal ; B 98 0 502 710 ;
|
||||
C -1 ; WX 600 ; N ocircumflex ; B 62 -15 538 654 ;
|
||||
C -1 ; WX 600 ; N ntilde ; B 26 0 575 606 ;
|
||||
C -1 ; WX 600 ; N Uhungarumlaut ; B 17 -18 590 805 ;
|
||||
C -1 ; WX 600 ; N Eacute ; B 53 0 550 805 ;
|
||||
C -1 ; WX 600 ; N emacron ; B 66 -15 548 565 ;
|
||||
C -1 ; WX 600 ; N gbreve ; B 45 -157 566 609 ;
|
||||
C -1 ; WX 600 ; N onequarter ; B 0 -57 600 665 ;
|
||||
C -1 ; WX 600 ; N Scaron ; B 72 -20 529 802 ;
|
||||
C -1 ; WX 600 ; N Scommaaccent ; B 72 -250 529 580 ;
|
||||
C -1 ; WX 600 ; N Ohungarumlaut ; B 43 -18 580 805 ;
|
||||
C -1 ; WX 600 ; N degree ; B 123 269 477 622 ;
|
||||
C -1 ; WX 600 ; N ograve ; B 62 -15 538 672 ;
|
||||
C -1 ; WX 600 ; N Ccaron ; B 41 -18 540 802 ;
|
||||
C -1 ; WX 600 ; N ugrave ; B 21 -15 562 672 ;
|
||||
C -1 ; WX 600 ; N radical ; B 3 -15 597 792 ;
|
||||
C -1 ; WX 600 ; N Dcaron ; B 43 0 574 802 ;
|
||||
C -1 ; WX 600 ; N rcommaaccent ; B 60 -250 559 441 ;
|
||||
C -1 ; WX 600 ; N Ntilde ; B 7 -13 593 729 ;
|
||||
C -1 ; WX 600 ; N otilde ; B 62 -15 538 606 ;
|
||||
C -1 ; WX 600 ; N Rcommaaccent ; B 38 -250 588 562 ;
|
||||
C -1 ; WX 600 ; N Lcommaaccent ; B 47 -250 554 562 ;
|
||||
C -1 ; WX 600 ; N Atilde ; B 3 0 597 729 ;
|
||||
C -1 ; WX 600 ; N Aogonek ; B 3 -172 608 562 ;
|
||||
C -1 ; WX 600 ; N Aring ; B 3 0 597 750 ;
|
||||
C -1 ; WX 600 ; N Otilde ; B 43 -18 557 729 ;
|
||||
C -1 ; WX 600 ; N zdotaccent ; B 99 0 502 620 ;
|
||||
C -1 ; WX 600 ; N Ecaron ; B 53 0 550 802 ;
|
||||
C -1 ; WX 600 ; N Iogonek ; B 96 -172 504 562 ;
|
||||
C -1 ; WX 600 ; N kcommaaccent ; B 43 -250 580 629 ;
|
||||
C -1 ; WX 600 ; N minus ; B 80 232 520 283 ;
|
||||
C -1 ; WX 600 ; N Icircumflex ; B 96 0 504 787 ;
|
||||
C -1 ; WX 600 ; N ncaron ; B 26 0 575 669 ;
|
||||
C -1 ; WX 600 ; N tcommaaccent ; B 87 -250 530 561 ;
|
||||
C -1 ; WX 600 ; N logicalnot ; B 87 108 513 369 ;
|
||||
C -1 ; WX 600 ; N odieresis ; B 62 -15 538 620 ;
|
||||
C -1 ; WX 600 ; N udieresis ; B 21 -15 562 620 ;
|
||||
C -1 ; WX 600 ; N notequal ; B 15 -16 540 529 ;
|
||||
C -1 ; WX 600 ; N gcommaaccent ; B 45 -157 566 708 ;
|
||||
C -1 ; WX 600 ; N eth ; B 62 -15 538 629 ;
|
||||
C -1 ; WX 600 ; N zcaron ; B 99 0 502 669 ;
|
||||
C -1 ; WX 600 ; N ncommaaccent ; B 26 -250 575 441 ;
|
||||
C -1 ; WX 600 ; N onesuperior ; B 172 249 428 622 ;
|
||||
C -1 ; WX 600 ; N imacron ; B 95 0 505 565 ;
|
||||
C -1 ; WX 600 ; N Euro ; B 0 0 0 0 ;
|
||||
EndCharMetrics
|
||||
EndFontMetrics
|
||||
2827
internal/pdf/model/fonts/afms/Helvetica-Bold.afm
Normal file
2827
internal/pdf/model/fonts/afms/Helvetica-Bold.afm
Normal file
File diff suppressed because it is too large
Load Diff
2827
internal/pdf/model/fonts/afms/Helvetica-BoldOblique.afm
Normal file
2827
internal/pdf/model/fonts/afms/Helvetica-BoldOblique.afm
Normal file
File diff suppressed because it is too large
Load Diff
3051
internal/pdf/model/fonts/afms/Helvetica-Oblique.afm
Normal file
3051
internal/pdf/model/fonts/afms/Helvetica-Oblique.afm
Normal file
File diff suppressed because it is too large
Load Diff
3051
internal/pdf/model/fonts/afms/Helvetica.afm
Normal file
3051
internal/pdf/model/fonts/afms/Helvetica.afm
Normal file
File diff suppressed because it is too large
Load Diff
1
internal/pdf/model/fonts/afms/MustRead.html
Normal file
1
internal/pdf/model/fonts/afms/MustRead.html
Normal file
@@ -0,0 +1 @@
|
||||
<html>
|
||||
213
internal/pdf/model/fonts/afms/Symbol.afm
Normal file
213
internal/pdf/model/fonts/afms/Symbol.afm
Normal file
@@ -0,0 +1,213 @@
|
||||
StartFontMetrics 4.1
|
||||
Comment Copyright (c) 1985, 1987, 1989, 1990, 1997 Adobe Systems Incorporated. All rights reserved.
|
||||
Comment Creation Date: Thu May 1 15:12:25 1997
|
||||
Comment UniqueID 43064
|
||||
Comment VMusage 30820 39997
|
||||
FontName Symbol
|
||||
FullName Symbol
|
||||
FamilyName Symbol
|
||||
Weight Medium
|
||||
ItalicAngle 0
|
||||
IsFixedPitch false
|
||||
CharacterSet Special
|
||||
FontBBox -180 -293 1090 1010
|
||||
UnderlinePosition -100
|
||||
UnderlineThickness 50
|
||||
Version 001.008
|
||||
Notice Copyright (c) 1985, 1987, 1989, 1990, 1997 Adobe Systems Incorporated. All rights reserved.
|
||||
EncodingScheme FontSpecific
|
||||
StdHW 92
|
||||
StdVW 85
|
||||
StartCharMetrics 190
|
||||
C 32 ; WX 250 ; N space ; B 0 0 0 0 ;
|
||||
C 33 ; WX 333 ; N exclam ; B 128 -17 240 672 ;
|
||||
C 34 ; WX 713 ; N universal ; B 31 0 681 705 ;
|
||||
C 35 ; WX 500 ; N numbersign ; B 20 -16 481 673 ;
|
||||
C 36 ; WX 549 ; N existential ; B 25 0 478 707 ;
|
||||
C 37 ; WX 833 ; N percent ; B 63 -36 771 655 ;
|
||||
C 38 ; WX 778 ; N ampersand ; B 41 -18 750 661 ;
|
||||
C 39 ; WX 439 ; N suchthat ; B 48 -17 414 500 ;
|
||||
C 40 ; WX 333 ; N parenleft ; B 53 -191 300 673 ;
|
||||
C 41 ; WX 333 ; N parenright ; B 30 -191 277 673 ;
|
||||
C 42 ; WX 500 ; N asteriskmath ; B 65 134 427 551 ;
|
||||
C 43 ; WX 549 ; N plus ; B 10 0 539 533 ;
|
||||
C 44 ; WX 250 ; N comma ; B 56 -152 194 104 ;
|
||||
C 45 ; WX 549 ; N minus ; B 11 233 535 288 ;
|
||||
C 46 ; WX 250 ; N period ; B 69 -17 181 95 ;
|
||||
C 47 ; WX 278 ; N slash ; B 0 -18 254 646 ;
|
||||
C 48 ; WX 500 ; N zero ; B 24 -14 476 685 ;
|
||||
C 49 ; WX 500 ; N one ; B 117 0 390 673 ;
|
||||
C 50 ; WX 500 ; N two ; B 25 0 475 685 ;
|
||||
C 51 ; WX 500 ; N three ; B 43 -14 435 685 ;
|
||||
C 52 ; WX 500 ; N four ; B 15 0 469 685 ;
|
||||
C 53 ; WX 500 ; N five ; B 32 -14 445 690 ;
|
||||
C 54 ; WX 500 ; N six ; B 34 -14 468 685 ;
|
||||
C 55 ; WX 500 ; N seven ; B 24 -16 448 673 ;
|
||||
C 56 ; WX 500 ; N eight ; B 56 -14 445 685 ;
|
||||
C 57 ; WX 500 ; N nine ; B 30 -18 459 685 ;
|
||||
C 58 ; WX 278 ; N colon ; B 81 -17 193 460 ;
|
||||
C 59 ; WX 278 ; N semicolon ; B 83 -152 221 460 ;
|
||||
C 60 ; WX 549 ; N less ; B 26 0 523 522 ;
|
||||
C 61 ; WX 549 ; N equal ; B 11 141 537 390 ;
|
||||
C 62 ; WX 549 ; N greater ; B 26 0 523 522 ;
|
||||
C 63 ; WX 444 ; N question ; B 70 -17 412 686 ;
|
||||
C 64 ; WX 549 ; N congruent ; B 11 0 537 475 ;
|
||||
C 65 ; WX 722 ; N Alpha ; B 4 0 684 673 ;
|
||||
C 66 ; WX 667 ; N Beta ; B 29 0 592 673 ;
|
||||
C 67 ; WX 722 ; N Chi ; B -9 0 704 673 ;
|
||||
C 68 ; WX 612 ; N Delta ; B 6 0 608 688 ;
|
||||
C 69 ; WX 611 ; N Epsilon ; B 32 0 617 673 ;
|
||||
C 70 ; WX 763 ; N Phi ; B 26 0 741 673 ;
|
||||
C 71 ; WX 603 ; N Gamma ; B 24 0 609 673 ;
|
||||
C 72 ; WX 722 ; N Eta ; B 39 0 729 673 ;
|
||||
C 73 ; WX 333 ; N Iota ; B 32 0 316 673 ;
|
||||
C 74 ; WX 631 ; N theta1 ; B 18 -18 623 689 ;
|
||||
C 75 ; WX 722 ; N Kappa ; B 35 0 722 673 ;
|
||||
C 76 ; WX 686 ; N Lambda ; B 6 0 680 688 ;
|
||||
C 77 ; WX 889 ; N Mu ; B 28 0 887 673 ;
|
||||
C 78 ; WX 722 ; N Nu ; B 29 -8 720 673 ;
|
||||
C 79 ; WX 722 ; N Omicron ; B 41 -17 715 685 ;
|
||||
C 80 ; WX 768 ; N Pi ; B 25 0 745 673 ;
|
||||
C 81 ; WX 741 ; N Theta ; B 41 -17 715 685 ;
|
||||
C 82 ; WX 556 ; N Rho ; B 28 0 563 673 ;
|
||||
C 83 ; WX 592 ; N Sigma ; B 5 0 589 673 ;
|
||||
C 84 ; WX 611 ; N Tau ; B 33 0 607 673 ;
|
||||
C 85 ; WX 690 ; N Upsilon ; B -8 0 694 673 ;
|
||||
C 86 ; WX 439 ; N sigma1 ; B 40 -233 436 500 ;
|
||||
C 87 ; WX 768 ; N Omega ; B 34 0 736 688 ;
|
||||
C 88 ; WX 645 ; N Xi ; B 40 0 599 673 ;
|
||||
C 89 ; WX 795 ; N Psi ; B 15 0 781 684 ;
|
||||
C 90 ; WX 611 ; N Zeta ; B 44 0 636 673 ;
|
||||
C 91 ; WX 333 ; N bracketleft ; B 86 -155 299 674 ;
|
||||
C 92 ; WX 863 ; N therefore ; B 163 0 701 487 ;
|
||||
C 93 ; WX 333 ; N bracketright ; B 33 -155 246 674 ;
|
||||
C 94 ; WX 658 ; N perpendicular ; B 15 0 652 674 ;
|
||||
C 95 ; WX 500 ; N underscore ; B -2 -125 502 -75 ;
|
||||
C 96 ; WX 500 ; N radicalex ; B 480 881 1090 917 ;
|
||||
C 97 ; WX 631 ; N alpha ; B 41 -18 622 500 ;
|
||||
C 98 ; WX 549 ; N beta ; B 61 -223 515 741 ;
|
||||
C 99 ; WX 549 ; N chi ; B 12 -231 522 499 ;
|
||||
C 100 ; WX 494 ; N delta ; B 40 -19 481 740 ;
|
||||
C 101 ; WX 439 ; N epsilon ; B 22 -19 427 502 ;
|
||||
C 102 ; WX 521 ; N phi ; B 28 -224 492 673 ;
|
||||
C 103 ; WX 411 ; N gamma ; B 5 -225 484 499 ;
|
||||
C 104 ; WX 603 ; N eta ; B 0 -202 527 514 ;
|
||||
C 105 ; WX 329 ; N iota ; B 0 -17 301 503 ;
|
||||
C 106 ; WX 603 ; N phi1 ; B 36 -224 587 499 ;
|
||||
C 107 ; WX 549 ; N kappa ; B 33 0 558 501 ;
|
||||
C 108 ; WX 549 ; N lambda ; B 24 -17 548 739 ;
|
||||
C 109 ; WX 576 ; N mu ; B 33 -223 567 500 ;
|
||||
C 110 ; WX 521 ; N nu ; B -9 -16 475 507 ;
|
||||
C 111 ; WX 549 ; N omicron ; B 35 -19 501 499 ;
|
||||
C 112 ; WX 549 ; N pi ; B 10 -19 530 487 ;
|
||||
C 113 ; WX 521 ; N theta ; B 43 -17 485 690 ;
|
||||
C 114 ; WX 549 ; N rho ; B 50 -230 490 499 ;
|
||||
C 115 ; WX 603 ; N sigma ; B 30 -21 588 500 ;
|
||||
C 116 ; WX 439 ; N tau ; B 10 -19 418 500 ;
|
||||
C 117 ; WX 576 ; N upsilon ; B 7 -18 535 507 ;
|
||||
C 118 ; WX 713 ; N omega1 ; B 12 -18 671 583 ;
|
||||
C 119 ; WX 686 ; N omega ; B 42 -17 684 500 ;
|
||||
C 120 ; WX 493 ; N xi ; B 27 -224 469 766 ;
|
||||
C 121 ; WX 686 ; N psi ; B 12 -228 701 500 ;
|
||||
C 122 ; WX 494 ; N zeta ; B 60 -225 467 756 ;
|
||||
C 123 ; WX 480 ; N braceleft ; B 58 -183 397 673 ;
|
||||
C 124 ; WX 200 ; N bar ; B 65 -293 135 707 ;
|
||||
C 125 ; WX 480 ; N braceright ; B 79 -183 418 673 ;
|
||||
C 126 ; WX 549 ; N similar ; B 17 203 529 307 ;
|
||||
C 160 ; WX 750 ; N Euro ; B 20 -12 714 685 ;
|
||||
C 161 ; WX 620 ; N Upsilon1 ; B -2 0 610 685 ;
|
||||
C 162 ; WX 247 ; N minute ; B 27 459 228 735 ;
|
||||
C 163 ; WX 549 ; N lessequal ; B 29 0 526 639 ;
|
||||
C 164 ; WX 167 ; N fraction ; B -180 -12 340 677 ;
|
||||
C 165 ; WX 713 ; N infinity ; B 26 124 688 404 ;
|
||||
C 166 ; WX 500 ; N florin ; B 2 -193 494 686 ;
|
||||
C 167 ; WX 753 ; N club ; B 86 -26 660 533 ;
|
||||
C 168 ; WX 753 ; N diamond ; B 142 -36 600 550 ;
|
||||
C 169 ; WX 753 ; N heart ; B 117 -33 631 532 ;
|
||||
C 170 ; WX 753 ; N spade ; B 113 -36 629 548 ;
|
||||
C 171 ; WX 1042 ; N arrowboth ; B 24 -15 1024 511 ;
|
||||
C 172 ; WX 987 ; N arrowleft ; B 32 -15 942 511 ;
|
||||
C 173 ; WX 603 ; N arrowup ; B 45 0 571 910 ;
|
||||
C 174 ; WX 987 ; N arrowright ; B 49 -15 959 511 ;
|
||||
C 175 ; WX 603 ; N arrowdown ; B 45 -22 571 888 ;
|
||||
C 176 ; WX 400 ; N degree ; B 50 385 350 685 ;
|
||||
C 177 ; WX 549 ; N plusminus ; B 10 0 539 645 ;
|
||||
C 178 ; WX 411 ; N second ; B 20 459 413 737 ;
|
||||
C 179 ; WX 549 ; N greaterequal ; B 29 0 526 639 ;
|
||||
C 180 ; WX 549 ; N multiply ; B 17 8 533 524 ;
|
||||
C 181 ; WX 713 ; N proportional ; B 27 123 639 404 ;
|
||||
C 182 ; WX 494 ; N partialdiff ; B 26 -20 462 746 ;
|
||||
C 183 ; WX 460 ; N bullet ; B 50 113 410 473 ;
|
||||
C 184 ; WX 549 ; N divide ; B 10 71 536 456 ;
|
||||
C 185 ; WX 549 ; N notequal ; B 15 -25 540 549 ;
|
||||
C 186 ; WX 549 ; N equivalence ; B 14 82 538 443 ;
|
||||
C 187 ; WX 549 ; N approxequal ; B 14 135 527 394 ;
|
||||
C 188 ; WX 1000 ; N ellipsis ; B 111 -17 889 95 ;
|
||||
C 189 ; WX 603 ; N arrowvertex ; B 280 -120 336 1010 ;
|
||||
C 190 ; WX 1000 ; N arrowhorizex ; B -60 220 1050 276 ;
|
||||
C 191 ; WX 658 ; N carriagereturn ; B 15 -16 602 629 ;
|
||||
C 192 ; WX 823 ; N aleph ; B 175 -18 661 658 ;
|
||||
C 193 ; WX 686 ; N Ifraktur ; B 10 -53 578 740 ;
|
||||
C 194 ; WX 795 ; N Rfraktur ; B 26 -15 759 734 ;
|
||||
C 195 ; WX 987 ; N weierstrass ; B 159 -211 870 573 ;
|
||||
C 196 ; WX 768 ; N circlemultiply ; B 43 -17 733 673 ;
|
||||
C 197 ; WX 768 ; N circleplus ; B 43 -15 733 675 ;
|
||||
C 198 ; WX 823 ; N emptyset ; B 39 -24 781 719 ;
|
||||
C 199 ; WX 768 ; N intersection ; B 40 0 732 509 ;
|
||||
C 200 ; WX 768 ; N union ; B 40 -17 732 492 ;
|
||||
C 201 ; WX 713 ; N propersuperset ; B 20 0 673 470 ;
|
||||
C 202 ; WX 713 ; N reflexsuperset ; B 20 -125 673 470 ;
|
||||
C 203 ; WX 713 ; N notsubset ; B 36 -70 690 540 ;
|
||||
C 204 ; WX 713 ; N propersubset ; B 37 0 690 470 ;
|
||||
C 205 ; WX 713 ; N reflexsubset ; B 37 -125 690 470 ;
|
||||
C 206 ; WX 713 ; N element ; B 45 0 505 468 ;
|
||||
C 207 ; WX 713 ; N notelement ; B 45 -58 505 555 ;
|
||||
C 208 ; WX 768 ; N angle ; B 26 0 738 673 ;
|
||||
C 209 ; WX 713 ; N gradient ; B 36 -19 681 718 ;
|
||||
C 210 ; WX 790 ; N registerserif ; B 50 -17 740 673 ;
|
||||
C 211 ; WX 790 ; N copyrightserif ; B 51 -15 741 675 ;
|
||||
C 212 ; WX 890 ; N trademarkserif ; B 18 293 855 673 ;
|
||||
C 213 ; WX 823 ; N product ; B 25 -101 803 751 ;
|
||||
C 214 ; WX 549 ; N radical ; B 10 -38 515 917 ;
|
||||
C 215 ; WX 250 ; N dotmath ; B 69 210 169 310 ;
|
||||
C 216 ; WX 713 ; N logicalnot ; B 15 0 680 288 ;
|
||||
C 217 ; WX 603 ; N logicaland ; B 23 0 583 454 ;
|
||||
C 218 ; WX 603 ; N logicalor ; B 30 0 578 477 ;
|
||||
C 219 ; WX 1042 ; N arrowdblboth ; B 27 -20 1023 510 ;
|
||||
C 220 ; WX 987 ; N arrowdblleft ; B 30 -15 939 513 ;
|
||||
C 221 ; WX 603 ; N arrowdblup ; B 39 2 567 911 ;
|
||||
C 222 ; WX 987 ; N arrowdblright ; B 45 -20 954 508 ;
|
||||
C 223 ; WX 603 ; N arrowdbldown ; B 44 -19 572 890 ;
|
||||
C 224 ; WX 494 ; N lozenge ; B 18 0 466 745 ;
|
||||
C 225 ; WX 329 ; N angleleft ; B 25 -198 306 746 ;
|
||||
C 226 ; WX 790 ; N registersans ; B 50 -20 740 670 ;
|
||||
C 227 ; WX 790 ; N copyrightsans ; B 49 -15 739 675 ;
|
||||
C 228 ; WX 786 ; N trademarksans ; B 5 293 725 673 ;
|
||||
C 229 ; WX 713 ; N summation ; B 14 -108 695 752 ;
|
||||
C 230 ; WX 384 ; N parenlefttp ; B 24 -293 436 926 ;
|
||||
C 231 ; WX 384 ; N parenleftex ; B 24 -85 108 925 ;
|
||||
C 232 ; WX 384 ; N parenleftbt ; B 24 -293 436 926 ;
|
||||
C 233 ; WX 384 ; N bracketlefttp ; B 0 -80 349 926 ;
|
||||
C 234 ; WX 384 ; N bracketleftex ; B 0 -79 77 925 ;
|
||||
C 235 ; WX 384 ; N bracketleftbt ; B 0 -80 349 926 ;
|
||||
C 236 ; WX 494 ; N bracelefttp ; B 209 -85 445 925 ;
|
||||
C 237 ; WX 494 ; N braceleftmid ; B 20 -85 284 935 ;
|
||||
C 238 ; WX 494 ; N braceleftbt ; B 209 -75 445 935 ;
|
||||
C 239 ; WX 494 ; N braceex ; B 209 -85 284 935 ;
|
||||
C 241 ; WX 329 ; N angleright ; B 21 -198 302 746 ;
|
||||
C 242 ; WX 274 ; N integral ; B 2 -107 291 916 ;
|
||||
C 243 ; WX 686 ; N integraltp ; B 308 -88 675 920 ;
|
||||
C 244 ; WX 686 ; N integralex ; B 308 -88 378 975 ;
|
||||
C 245 ; WX 686 ; N integralbt ; B 11 -87 378 921 ;
|
||||
C 246 ; WX 384 ; N parenrighttp ; B 54 -293 466 926 ;
|
||||
C 247 ; WX 384 ; N parenrightex ; B 382 -85 466 925 ;
|
||||
C 248 ; WX 384 ; N parenrightbt ; B 54 -293 466 926 ;
|
||||
C 249 ; WX 384 ; N bracketrighttp ; B 22 -80 371 926 ;
|
||||
C 250 ; WX 384 ; N bracketrightex ; B 294 -79 371 925 ;
|
||||
C 251 ; WX 384 ; N bracketrightbt ; B 22 -80 371 926 ;
|
||||
C 252 ; WX 494 ; N bracerighttp ; B 48 -85 284 925 ;
|
||||
C 253 ; WX 494 ; N bracerightmid ; B 209 -85 473 935 ;
|
||||
C 254 ; WX 494 ; N bracerightbt ; B 48 -75 284 935 ;
|
||||
C -1 ; WX 790 ; N apple ; B 56 -3 733 808 ;
|
||||
EndCharMetrics
|
||||
EndFontMetrics
|
||||
2588
internal/pdf/model/fonts/afms/Times-Bold.afm
Normal file
2588
internal/pdf/model/fonts/afms/Times-Bold.afm
Normal file
File diff suppressed because it is too large
Load Diff
2384
internal/pdf/model/fonts/afms/Times-BoldItalic.afm
Normal file
2384
internal/pdf/model/fonts/afms/Times-BoldItalic.afm
Normal file
File diff suppressed because it is too large
Load Diff
2667
internal/pdf/model/fonts/afms/Times-Italic.afm
Normal file
2667
internal/pdf/model/fonts/afms/Times-Italic.afm
Normal file
File diff suppressed because it is too large
Load Diff
2419
internal/pdf/model/fonts/afms/Times-Roman.afm
Normal file
2419
internal/pdf/model/fonts/afms/Times-Roman.afm
Normal file
File diff suppressed because it is too large
Load Diff
225
internal/pdf/model/fonts/afms/ZapfDingbats.afm
Normal file
225
internal/pdf/model/fonts/afms/ZapfDingbats.afm
Normal file
@@ -0,0 +1,225 @@
|
||||
StartFontMetrics 4.1
|
||||
Comment Copyright (c) 1985, 1987, 1988, 1989, 1997 Adobe Systems Incorporated. All Rights Reserved.
|
||||
Comment Creation Date: Thu May 1 15:14:13 1997
|
||||
Comment UniqueID 43082
|
||||
Comment VMusage 45775 55535
|
||||
FontName ZapfDingbats
|
||||
FullName ITC Zapf Dingbats
|
||||
FamilyName ZapfDingbats
|
||||
Weight Medium
|
||||
ItalicAngle 0
|
||||
IsFixedPitch false
|
||||
CharacterSet Special
|
||||
FontBBox -1 -143 981 820
|
||||
UnderlinePosition -100
|
||||
UnderlineThickness 50
|
||||
Version 002.000
|
||||
Notice Copyright (c) 1985, 1987, 1988, 1989, 1997 Adobe Systems Incorporated. All Rights Reserved.ITC Zapf Dingbats is a registered trademark of International Typeface Corporation.
|
||||
EncodingScheme FontSpecific
|
||||
StdHW 28
|
||||
StdVW 90
|
||||
StartCharMetrics 202
|
||||
C 32 ; WX 278 ; N space ; B 0 0 0 0 ;
|
||||
C 33 ; WX 974 ; N a1 ; B 35 72 939 621 ;
|
||||
C 34 ; WX 961 ; N a2 ; B 35 81 927 611 ;
|
||||
C 35 ; WX 974 ; N a202 ; B 35 72 939 621 ;
|
||||
C 36 ; WX 980 ; N a3 ; B 35 0 945 692 ;
|
||||
C 37 ; WX 719 ; N a4 ; B 34 139 685 566 ;
|
||||
C 38 ; WX 789 ; N a5 ; B 35 -14 755 705 ;
|
||||
C 39 ; WX 790 ; N a119 ; B 35 -14 755 705 ;
|
||||
C 40 ; WX 791 ; N a118 ; B 35 -13 761 705 ;
|
||||
C 41 ; WX 690 ; N a117 ; B 34 138 655 553 ;
|
||||
C 42 ; WX 960 ; N a11 ; B 35 123 925 568 ;
|
||||
C 43 ; WX 939 ; N a12 ; B 35 134 904 559 ;
|
||||
C 44 ; WX 549 ; N a13 ; B 29 -11 516 705 ;
|
||||
C 45 ; WX 855 ; N a14 ; B 34 59 820 632 ;
|
||||
C 46 ; WX 911 ; N a15 ; B 35 50 876 642 ;
|
||||
C 47 ; WX 933 ; N a16 ; B 35 139 899 550 ;
|
||||
C 48 ; WX 911 ; N a105 ; B 35 50 876 642 ;
|
||||
C 49 ; WX 945 ; N a17 ; B 35 139 909 553 ;
|
||||
C 50 ; WX 974 ; N a18 ; B 35 104 938 587 ;
|
||||
C 51 ; WX 755 ; N a19 ; B 34 -13 721 705 ;
|
||||
C 52 ; WX 846 ; N a20 ; B 36 -14 811 705 ;
|
||||
C 53 ; WX 762 ; N a21 ; B 35 0 727 692 ;
|
||||
C 54 ; WX 761 ; N a22 ; B 35 0 727 692 ;
|
||||
C 55 ; WX 571 ; N a23 ; B -1 -68 571 661 ;
|
||||
C 56 ; WX 677 ; N a24 ; B 36 -13 642 705 ;
|
||||
C 57 ; WX 763 ; N a25 ; B 35 0 728 692 ;
|
||||
C 58 ; WX 760 ; N a26 ; B 35 0 726 692 ;
|
||||
C 59 ; WX 759 ; N a27 ; B 35 0 725 692 ;
|
||||
C 60 ; WX 754 ; N a28 ; B 35 0 720 692 ;
|
||||
C 61 ; WX 494 ; N a6 ; B 35 0 460 692 ;
|
||||
C 62 ; WX 552 ; N a7 ; B 35 0 517 692 ;
|
||||
C 63 ; WX 537 ; N a8 ; B 35 0 503 692 ;
|
||||
C 64 ; WX 577 ; N a9 ; B 35 96 542 596 ;
|
||||
C 65 ; WX 692 ; N a10 ; B 35 -14 657 705 ;
|
||||
C 66 ; WX 786 ; N a29 ; B 35 -14 751 705 ;
|
||||
C 67 ; WX 788 ; N a30 ; B 35 -14 752 705 ;
|
||||
C 68 ; WX 788 ; N a31 ; B 35 -14 753 705 ;
|
||||
C 69 ; WX 790 ; N a32 ; B 35 -14 756 705 ;
|
||||
C 70 ; WX 793 ; N a33 ; B 35 -13 759 705 ;
|
||||
C 71 ; WX 794 ; N a34 ; B 35 -13 759 705 ;
|
||||
C 72 ; WX 816 ; N a35 ; B 35 -14 782 705 ;
|
||||
C 73 ; WX 823 ; N a36 ; B 35 -14 787 705 ;
|
||||
C 74 ; WX 789 ; N a37 ; B 35 -14 754 705 ;
|
||||
C 75 ; WX 841 ; N a38 ; B 35 -14 807 705 ;
|
||||
C 76 ; WX 823 ; N a39 ; B 35 -14 789 705 ;
|
||||
C 77 ; WX 833 ; N a40 ; B 35 -14 798 705 ;
|
||||
C 78 ; WX 816 ; N a41 ; B 35 -13 782 705 ;
|
||||
C 79 ; WX 831 ; N a42 ; B 35 -14 796 705 ;
|
||||
C 80 ; WX 923 ; N a43 ; B 35 -14 888 705 ;
|
||||
C 81 ; WX 744 ; N a44 ; B 35 0 710 692 ;
|
||||
C 82 ; WX 723 ; N a45 ; B 35 0 688 692 ;
|
||||
C 83 ; WX 749 ; N a46 ; B 35 0 714 692 ;
|
||||
C 84 ; WX 790 ; N a47 ; B 34 -14 756 705 ;
|
||||
C 85 ; WX 792 ; N a48 ; B 35 -14 758 705 ;
|
||||
C 86 ; WX 695 ; N a49 ; B 35 -14 661 706 ;
|
||||
C 87 ; WX 776 ; N a50 ; B 35 -6 741 699 ;
|
||||
C 88 ; WX 768 ; N a51 ; B 35 -7 734 699 ;
|
||||
C 89 ; WX 792 ; N a52 ; B 35 -14 757 705 ;
|
||||
C 90 ; WX 759 ; N a53 ; B 35 0 725 692 ;
|
||||
C 91 ; WX 707 ; N a54 ; B 35 -13 672 704 ;
|
||||
C 92 ; WX 708 ; N a55 ; B 35 -14 672 705 ;
|
||||
C 93 ; WX 682 ; N a56 ; B 35 -14 647 705 ;
|
||||
C 94 ; WX 701 ; N a57 ; B 35 -14 666 705 ;
|
||||
C 95 ; WX 826 ; N a58 ; B 35 -14 791 705 ;
|
||||
C 96 ; WX 815 ; N a59 ; B 35 -14 780 705 ;
|
||||
C 97 ; WX 789 ; N a60 ; B 35 -14 754 705 ;
|
||||
C 98 ; WX 789 ; N a61 ; B 35 -14 754 705 ;
|
||||
C 99 ; WX 707 ; N a62 ; B 34 -14 673 705 ;
|
||||
C 100 ; WX 687 ; N a63 ; B 36 0 651 692 ;
|
||||
C 101 ; WX 696 ; N a64 ; B 35 0 661 691 ;
|
||||
C 102 ; WX 689 ; N a65 ; B 35 0 655 692 ;
|
||||
C 103 ; WX 786 ; N a66 ; B 34 -14 751 705 ;
|
||||
C 104 ; WX 787 ; N a67 ; B 35 -14 752 705 ;
|
||||
C 105 ; WX 713 ; N a68 ; B 35 -14 678 705 ;
|
||||
C 106 ; WX 791 ; N a69 ; B 35 -14 756 705 ;
|
||||
C 107 ; WX 785 ; N a70 ; B 36 -14 751 705 ;
|
||||
C 108 ; WX 791 ; N a71 ; B 35 -14 757 705 ;
|
||||
C 109 ; WX 873 ; N a72 ; B 35 -14 838 705 ;
|
||||
C 110 ; WX 761 ; N a73 ; B 35 0 726 692 ;
|
||||
C 111 ; WX 762 ; N a74 ; B 35 0 727 692 ;
|
||||
C 112 ; WX 762 ; N a203 ; B 35 0 727 692 ;
|
||||
C 113 ; WX 759 ; N a75 ; B 35 0 725 692 ;
|
||||
C 114 ; WX 759 ; N a204 ; B 35 0 725 692 ;
|
||||
C 115 ; WX 892 ; N a76 ; B 35 0 858 705 ;
|
||||
C 116 ; WX 892 ; N a77 ; B 35 -14 858 692 ;
|
||||
C 117 ; WX 788 ; N a78 ; B 35 -14 754 705 ;
|
||||
C 118 ; WX 784 ; N a79 ; B 35 -14 749 705 ;
|
||||
C 119 ; WX 438 ; N a81 ; B 35 -14 403 705 ;
|
||||
C 120 ; WX 138 ; N a82 ; B 35 0 104 692 ;
|
||||
C 121 ; WX 277 ; N a83 ; B 35 0 242 692 ;
|
||||
C 122 ; WX 415 ; N a84 ; B 35 0 380 692 ;
|
||||
C 123 ; WX 392 ; N a97 ; B 35 263 357 705 ;
|
||||
C 124 ; WX 392 ; N a98 ; B 34 263 357 705 ;
|
||||
C 125 ; WX 668 ; N a99 ; B 35 263 633 705 ;
|
||||
C 126 ; WX 668 ; N a100 ; B 36 263 634 705 ;
|
||||
C 128 ; WX 390 ; N a89 ; B 35 -14 356 705 ;
|
||||
C 129 ; WX 390 ; N a90 ; B 35 -14 355 705 ;
|
||||
C 130 ; WX 317 ; N a93 ; B 35 0 283 692 ;
|
||||
C 131 ; WX 317 ; N a94 ; B 35 0 283 692 ;
|
||||
C 132 ; WX 276 ; N a91 ; B 35 0 242 692 ;
|
||||
C 133 ; WX 276 ; N a92 ; B 35 0 242 692 ;
|
||||
C 134 ; WX 509 ; N a205 ; B 35 0 475 692 ;
|
||||
C 135 ; WX 509 ; N a85 ; B 35 0 475 692 ;
|
||||
C 136 ; WX 410 ; N a206 ; B 35 0 375 692 ;
|
||||
C 137 ; WX 410 ; N a86 ; B 35 0 375 692 ;
|
||||
C 138 ; WX 234 ; N a87 ; B 35 -14 199 705 ;
|
||||
C 139 ; WX 234 ; N a88 ; B 35 -14 199 705 ;
|
||||
C 140 ; WX 334 ; N a95 ; B 35 0 299 692 ;
|
||||
C 141 ; WX 334 ; N a96 ; B 35 0 299 692 ;
|
||||
C 161 ; WX 732 ; N a101 ; B 35 -143 697 806 ;
|
||||
C 162 ; WX 544 ; N a102 ; B 56 -14 488 706 ;
|
||||
C 163 ; WX 544 ; N a103 ; B 34 -14 508 705 ;
|
||||
C 164 ; WX 910 ; N a104 ; B 35 40 875 651 ;
|
||||
C 165 ; WX 667 ; N a106 ; B 35 -14 633 705 ;
|
||||
C 166 ; WX 760 ; N a107 ; B 35 -14 726 705 ;
|
||||
C 167 ; WX 760 ; N a108 ; B 0 121 758 569 ;
|
||||
C 168 ; WX 776 ; N a112 ; B 35 0 741 705 ;
|
||||
C 169 ; WX 595 ; N a111 ; B 34 -14 560 705 ;
|
||||
C 170 ; WX 694 ; N a110 ; B 35 -14 659 705 ;
|
||||
C 171 ; WX 626 ; N a109 ; B 34 0 591 705 ;
|
||||
C 172 ; WX 788 ; N a120 ; B 35 -14 754 705 ;
|
||||
C 173 ; WX 788 ; N a121 ; B 35 -14 754 705 ;
|
||||
C 174 ; WX 788 ; N a122 ; B 35 -14 754 705 ;
|
||||
C 175 ; WX 788 ; N a123 ; B 35 -14 754 705 ;
|
||||
C 176 ; WX 788 ; N a124 ; B 35 -14 754 705 ;
|
||||
C 177 ; WX 788 ; N a125 ; B 35 -14 754 705 ;
|
||||
C 178 ; WX 788 ; N a126 ; B 35 -14 754 705 ;
|
||||
C 179 ; WX 788 ; N a127 ; B 35 -14 754 705 ;
|
||||
C 180 ; WX 788 ; N a128 ; B 35 -14 754 705 ;
|
||||
C 181 ; WX 788 ; N a129 ; B 35 -14 754 705 ;
|
||||
C 182 ; WX 788 ; N a130 ; B 35 -14 754 705 ;
|
||||
C 183 ; WX 788 ; N a131 ; B 35 -14 754 705 ;
|
||||
C 184 ; WX 788 ; N a132 ; B 35 -14 754 705 ;
|
||||
C 185 ; WX 788 ; N a133 ; B 35 -14 754 705 ;
|
||||
C 186 ; WX 788 ; N a134 ; B 35 -14 754 705 ;
|
||||
C 187 ; WX 788 ; N a135 ; B 35 -14 754 705 ;
|
||||
C 188 ; WX 788 ; N a136 ; B 35 -14 754 705 ;
|
||||
C 189 ; WX 788 ; N a137 ; B 35 -14 754 705 ;
|
||||
C 190 ; WX 788 ; N a138 ; B 35 -14 754 705 ;
|
||||
C 191 ; WX 788 ; N a139 ; B 35 -14 754 705 ;
|
||||
C 192 ; WX 788 ; N a140 ; B 35 -14 754 705 ;
|
||||
C 193 ; WX 788 ; N a141 ; B 35 -14 754 705 ;
|
||||
C 194 ; WX 788 ; N a142 ; B 35 -14 754 705 ;
|
||||
C 195 ; WX 788 ; N a143 ; B 35 -14 754 705 ;
|
||||
C 196 ; WX 788 ; N a144 ; B 35 -14 754 705 ;
|
||||
C 197 ; WX 788 ; N a145 ; B 35 -14 754 705 ;
|
||||
C 198 ; WX 788 ; N a146 ; B 35 -14 754 705 ;
|
||||
C 199 ; WX 788 ; N a147 ; B 35 -14 754 705 ;
|
||||
C 200 ; WX 788 ; N a148 ; B 35 -14 754 705 ;
|
||||
C 201 ; WX 788 ; N a149 ; B 35 -14 754 705 ;
|
||||
C 202 ; WX 788 ; N a150 ; B 35 -14 754 705 ;
|
||||
C 203 ; WX 788 ; N a151 ; B 35 -14 754 705 ;
|
||||
C 204 ; WX 788 ; N a152 ; B 35 -14 754 705 ;
|
||||
C 205 ; WX 788 ; N a153 ; B 35 -14 754 705 ;
|
||||
C 206 ; WX 788 ; N a154 ; B 35 -14 754 705 ;
|
||||
C 207 ; WX 788 ; N a155 ; B 35 -14 754 705 ;
|
||||
C 208 ; WX 788 ; N a156 ; B 35 -14 754 705 ;
|
||||
C 209 ; WX 788 ; N a157 ; B 35 -14 754 705 ;
|
||||
C 210 ; WX 788 ; N a158 ; B 35 -14 754 705 ;
|
||||
C 211 ; WX 788 ; N a159 ; B 35 -14 754 705 ;
|
||||
C 212 ; WX 894 ; N a160 ; B 35 58 860 634 ;
|
||||
C 213 ; WX 838 ; N a161 ; B 35 152 803 540 ;
|
||||
C 214 ; WX 1016 ; N a163 ; B 34 152 981 540 ;
|
||||
C 215 ; WX 458 ; N a164 ; B 35 -127 422 820 ;
|
||||
C 216 ; WX 748 ; N a196 ; B 35 94 698 597 ;
|
||||
C 217 ; WX 924 ; N a165 ; B 35 140 890 552 ;
|
||||
C 218 ; WX 748 ; N a192 ; B 35 94 698 597 ;
|
||||
C 219 ; WX 918 ; N a166 ; B 35 166 884 526 ;
|
||||
C 220 ; WX 927 ; N a167 ; B 35 32 892 660 ;
|
||||
C 221 ; WX 928 ; N a168 ; B 35 129 891 562 ;
|
||||
C 222 ; WX 928 ; N a169 ; B 35 128 893 563 ;
|
||||
C 223 ; WX 834 ; N a170 ; B 35 155 799 537 ;
|
||||
C 224 ; WX 873 ; N a171 ; B 35 93 838 599 ;
|
||||
C 225 ; WX 828 ; N a172 ; B 35 104 791 588 ;
|
||||
C 226 ; WX 924 ; N a173 ; B 35 98 889 594 ;
|
||||
C 227 ; WX 924 ; N a162 ; B 35 98 889 594 ;
|
||||
C 228 ; WX 917 ; N a174 ; B 35 0 882 692 ;
|
||||
C 229 ; WX 930 ; N a175 ; B 35 84 896 608 ;
|
||||
C 230 ; WX 931 ; N a176 ; B 35 84 896 608 ;
|
||||
C 231 ; WX 463 ; N a177 ; B 35 -99 429 791 ;
|
||||
C 232 ; WX 883 ; N a178 ; B 35 71 848 623 ;
|
||||
C 233 ; WX 836 ; N a179 ; B 35 44 802 648 ;
|
||||
C 234 ; WX 836 ; N a193 ; B 35 44 802 648 ;
|
||||
C 235 ; WX 867 ; N a180 ; B 35 101 832 591 ;
|
||||
C 236 ; WX 867 ; N a199 ; B 35 101 832 591 ;
|
||||
C 237 ; WX 696 ; N a181 ; B 35 44 661 648 ;
|
||||
C 238 ; WX 696 ; N a200 ; B 35 44 661 648 ;
|
||||
C 239 ; WX 874 ; N a182 ; B 35 77 840 619 ;
|
||||
C 241 ; WX 874 ; N a201 ; B 35 73 840 615 ;
|
||||
C 242 ; WX 760 ; N a183 ; B 35 0 725 692 ;
|
||||
C 243 ; WX 946 ; N a184 ; B 35 160 911 533 ;
|
||||
C 244 ; WX 771 ; N a197 ; B 34 37 736 655 ;
|
||||
C 245 ; WX 865 ; N a185 ; B 35 207 830 481 ;
|
||||
C 246 ; WX 771 ; N a194 ; B 34 37 736 655 ;
|
||||
C 247 ; WX 888 ; N a198 ; B 34 -19 853 712 ;
|
||||
C 248 ; WX 967 ; N a186 ; B 35 124 932 568 ;
|
||||
C 249 ; WX 888 ; N a195 ; B 34 -19 853 712 ;
|
||||
C 250 ; WX 831 ; N a187 ; B 35 113 796 579 ;
|
||||
C 251 ; WX 873 ; N a188 ; B 36 118 838 578 ;
|
||||
C 252 ; WX 927 ; N a189 ; B 35 150 891 542 ;
|
||||
C 253 ; WX 970 ; N a190 ; B 35 76 931 616 ;
|
||||
C 254 ; WX 918 ; N a191 ; B 34 99 884 593 ;
|
||||
EndCharMetrics
|
||||
EndFontMetrics
|
||||
362
internal/pdf/model/fonts/courier.go
Normal file
362
internal/pdf/model/fonts/courier.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Courier. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontCourier struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontCourier() fontCourier {
|
||||
font := fontCourier{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontCourier) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontCourier) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := courierCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontCourier) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Courier"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var courierCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 600.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 600.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 600.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 600.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 600.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 600.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 600.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 600.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 600.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 600.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 600.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 600.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 600.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 600.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 600.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 600.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 600.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 600.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 600.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 600.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 600.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 600.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 600.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 600.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 600.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 600.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 600.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 600.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 600.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 600.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 600.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 600.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 600.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 600.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 600.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 600.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 600.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 600.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 600.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 600.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 600.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 600.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 600.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 600.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 600.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 600.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 600.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 600.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 600.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 600.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 600.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 600.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 600.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 600.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 600.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 600.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 600.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 600.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 600.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 600.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 600.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 600.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 600.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 600.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 600.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 600.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 600.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 600.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 600.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 600.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 600.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 600.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 600.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 600.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 600.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 600.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 600.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 600.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 600.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 600.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 600.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 600.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 600.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 600.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 600.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 600.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 600.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 600.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 600.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 600.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 600.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 600.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 600.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 600.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 600.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 600.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 600.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 600.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 600.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 600.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 600.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 600.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 600.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 600.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 600.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 600.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 600.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 600.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 600.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 600.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 600.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 600.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 600.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 600.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 600.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 600.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 600.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 600.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 600.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 600.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/courier_bold.go
Normal file
362
internal/pdf/model/fonts/courier_bold.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Courier-Bold. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontCourierBold struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontCourierBold() fontCourierBold {
|
||||
font := fontCourierBold{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontCourierBold) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontCourierBold) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := courierBoldCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontCourierBold) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Courier-Bold"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var courierBoldCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 600.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 600.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 600.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 600.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 600.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 600.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 600.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 600.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 600.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 600.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 600.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 600.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 600.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 600.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 600.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 600.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 600.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 600.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 600.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 600.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 600.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 600.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 600.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 600.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 600.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 600.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 600.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 600.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 600.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 600.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 600.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 600.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 600.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 600.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 600.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 600.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 600.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 600.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 600.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 600.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 600.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 600.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 600.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 600.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 600.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 600.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 600.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 600.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 600.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 600.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 600.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 600.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 600.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 600.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 600.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 600.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 600.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 600.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 600.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 600.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 600.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 600.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 600.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 600.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 600.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 600.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 600.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 600.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 600.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 600.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 600.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 600.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 600.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 600.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 600.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 600.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 600.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 600.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 600.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 600.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 600.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 600.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 600.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 600.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 600.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 600.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 600.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 600.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 600.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 600.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 600.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 600.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 600.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 600.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 600.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 600.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 600.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 600.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 600.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 600.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 600.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 600.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 600.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 600.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 600.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 600.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 600.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 600.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 600.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 600.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 600.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 600.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 600.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 600.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 600.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 600.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 600.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 600.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 600.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 600.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/courier_bold_oblique.go
Normal file
362
internal/pdf/model/fonts/courier_bold_oblique.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Courier-BoldOblique. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontCourierBoldOblique struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontCourierBoldOblique() fontCourierBoldOblique {
|
||||
font := fontCourierBoldOblique{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontCourierBoldOblique) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontCourierBoldOblique) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := courierBoldObliqueCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontCourierBoldOblique) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Courier-BoldOblique"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var courierBoldObliqueCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 600.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 600.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 600.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 600.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 600.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 600.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 600.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 600.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 600.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 600.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 600.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 600.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 600.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 600.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 600.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 600.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 600.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 600.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 600.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 600.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 600.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 600.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 600.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 600.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 600.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 600.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 600.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 600.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 600.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 600.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 600.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 600.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 600.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 600.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 600.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 600.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 600.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 600.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 600.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 600.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 600.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 600.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 600.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 600.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 600.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 600.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 600.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 600.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 600.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 600.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 600.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 600.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 600.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 600.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 600.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 600.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 600.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 600.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 600.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 600.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 600.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 600.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 600.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 600.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 600.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 600.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 600.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 600.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 600.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 600.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 600.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 600.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 600.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 600.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 600.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 600.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 600.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 600.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 600.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 600.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 600.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 600.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 600.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 600.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 600.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 600.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 600.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 600.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 600.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 600.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 600.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 600.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 600.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 600.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 600.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 600.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 600.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 600.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 600.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 600.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 600.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 600.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 600.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 600.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 600.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 600.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 600.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 600.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 600.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 600.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 600.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 600.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 600.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 600.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 600.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 600.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 600.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 600.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 600.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 600.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/courier_oblique.go
Normal file
362
internal/pdf/model/fonts/courier_oblique.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Courier-Oblique. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontCourierOblique struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontCourierOblique() fontCourierOblique {
|
||||
font := fontCourierOblique{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontCourierOblique) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontCourierOblique) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := courierObliqueCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontCourierOblique) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Courier-Oblique"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var courierObliqueCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 600.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 600.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 600.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 600.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 600.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 600.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 600.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 600.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 600.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 600.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 600.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 600.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 600.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 600.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 600.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 600.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 600.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 600.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 600.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 600.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 600.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 600.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 600.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 600.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 600.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 600.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 600.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 600.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 600.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 600.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 600.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 600.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 600.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 600.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 600.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 600.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 600.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 600.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 600.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 600.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 600.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 600.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 600.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 600.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 600.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 600.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 600.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 600.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 600.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 600.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 600.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 600.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 600.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 600.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 600.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 600.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 600.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 600.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 600.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 600.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 600.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 600.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 600.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 600.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 600.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 600.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 600.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 600.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 600.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 600.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 600.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 600.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 600.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 600.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 600.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 600.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 600.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 600.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 600.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 600.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 600.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 600.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 600.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 600.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 600.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 600.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 600.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 600.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 600.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 600.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 600.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 600.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 600.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 600.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 600.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 600.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 600.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 600.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 600.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 600.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 600.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 600.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 600.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 600.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 600.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 600.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 600.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 600.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 600.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 600.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 600.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 600.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 600.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 600.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 600.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 600.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 600.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 600.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 600.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 600.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 600.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 600.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 600.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 600.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 600.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 600.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 600.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 600.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 600.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 600.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 600.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 600.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 600.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 600.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 600.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 600.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 600.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 600.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 600.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 600.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 600.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 600.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 600.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 600.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 600.000000, Wy: 0.000000},
|
||||
}
|
||||
18
internal/pdf/model/fonts/font.go
Normal file
18
internal/pdf/model/fonts/font.go
Normal file
@@ -0,0 +1,18 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
type Font interface {
|
||||
SetEncoder(encoder textencoding.TextEncoder)
|
||||
GetGlyphCharMetrics(glyph string) (CharMetrics, bool)
|
||||
ToPdfObject() core.PdfObject
|
||||
}
|
||||
|
||||
type CharMetrics struct {
|
||||
GlyphName string
|
||||
Wx float64
|
||||
Wy float64
|
||||
}
|
||||
362
internal/pdf/model/fonts/helvetica.go
Normal file
362
internal/pdf/model/fonts/helvetica.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Helvetica. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontHelvetica struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontHelvetica() fontHelvetica {
|
||||
font := fontHelvetica{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontHelvetica) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontHelvetica) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := helveticaCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontHelvetica) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Helvetica"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var helveticaCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 667.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 667.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 667.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 667.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 667.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 722.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 722.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 556.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 611.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 778.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 722.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 500.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 667.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 556.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 833.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 722.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 778.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 778.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 778.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 778.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 778.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 778.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 667.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 778.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 722.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 667.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 667.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 667.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 944.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 667.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 667.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 556.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 556.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 889.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 667.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 556.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 469.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 584.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 389.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 1015.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 556.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 260.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 334.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 334.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 278.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 278.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 260.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 500.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 500.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 556.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 278.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 278.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 737.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 556.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 556.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 556.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 556.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 643.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 556.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 584.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 556.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 556.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 556.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 1000.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 556.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 584.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 556.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 278.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 333.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 278.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 500.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 556.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 500.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 556.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 556.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 556.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 556.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 611.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 584.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 556.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 556.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 556.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 222.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 222.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 222.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 500.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 222.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 222.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 299.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 222.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 584.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 584.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 471.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 222.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 833.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 584.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 556.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 584.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 556.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 556.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 556.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 556.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 944.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 556.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 556.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 556.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 834.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 834.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 370.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 365.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 556.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 537.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 476.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 889.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 278.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 278.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 584.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 584.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 556.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 556.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 611.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 355.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 333.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 222.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 222.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 222.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 191.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 333.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 333.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 453.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 333.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 737.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 500.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 500.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 556.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 278.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 556.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 556.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 278.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 556.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 278.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 317.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 556.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 556.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 834.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 1000.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 556.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 556.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 556.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 556.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 556.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 500.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 722.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 500.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 500.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 556.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 500.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 556.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/helvetica_bold.go
Normal file
362
internal/pdf/model/fonts/helvetica_bold.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Helvetica-Bold. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontHelveticaBold struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontHelveticaBold() fontHelveticaBold {
|
||||
font := fontHelveticaBold{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontHelveticaBold) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontHelveticaBold) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := helveticaBoldCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontHelveticaBold) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Helvetica-Bold"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var helveticaBoldCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 722.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 722.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 722.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 722.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 722.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 556.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 611.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 778.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 722.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 556.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 722.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 833.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 722.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 778.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 778.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 778.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 778.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 778.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 778.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 667.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 778.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 722.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 667.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 667.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 667.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 944.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 667.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 667.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 556.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 556.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 889.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 722.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 556.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 584.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 584.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 389.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 975.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 611.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 280.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 389.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 389.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 333.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 280.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 556.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 556.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 556.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 333.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 278.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 737.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 556.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 611.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 556.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 556.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 743.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 611.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 584.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 556.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 556.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 556.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 1000.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 556.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 584.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 611.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 333.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 333.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 333.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 611.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 556.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 611.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 556.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 556.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 611.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 611.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 611.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 584.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 556.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 556.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 611.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 278.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 278.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 556.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 278.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 400.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 584.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 584.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 494.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 889.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 584.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 611.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 584.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 611.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 556.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 611.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 556.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 611.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 611.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 944.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 611.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 611.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 611.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 556.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 834.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 834.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 370.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 365.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 611.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 611.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 556.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 494.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 889.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 278.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 278.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 584.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 584.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 611.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 611.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 611.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 474.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 500.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 278.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 278.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 278.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 238.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 389.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 389.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 549.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 737.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 556.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 556.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 556.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 333.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 556.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 556.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 278.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 556.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 333.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 611.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 556.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 834.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 1000.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 556.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 611.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 611.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 611.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 611.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 611.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 556.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 611.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 611.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 556.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 778.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 556.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 556.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 556.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 500.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 556.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/helvetica_bold_oblique.go
Normal file
362
internal/pdf/model/fonts/helvetica_bold_oblique.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Helvetica-BoldOblique. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontHelveticaBoldOblique struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontHelveticaBoldOblique() fontHelveticaBoldOblique {
|
||||
font := fontHelveticaBoldOblique{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontHelveticaBoldOblique) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontHelveticaBoldOblique) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := helveticaBoldObliqueCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontHelveticaBoldOblique) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Helvetica-BoldOblique"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var helveticaBoldObliqueCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 722.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 722.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 722.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 722.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 722.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 556.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 611.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 778.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 722.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 556.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 722.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 833.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 722.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 778.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 778.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 778.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 778.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 778.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 778.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 667.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 778.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 722.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 667.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 667.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 667.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 944.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 667.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 667.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 556.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 556.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 889.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 722.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 556.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 584.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 584.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 389.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 975.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 611.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 280.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 389.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 389.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 333.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 280.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 556.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 556.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 556.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 333.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 278.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 737.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 556.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 611.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 556.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 556.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 743.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 611.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 584.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 556.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 556.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 556.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 1000.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 556.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 584.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 611.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 333.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 333.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 333.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 611.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 556.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 611.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 556.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 556.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 611.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 611.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 611.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 584.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 556.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 556.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 611.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 278.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 278.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 556.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 278.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 400.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 584.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 584.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 494.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 889.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 584.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 611.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 584.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 611.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 556.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 611.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 556.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 611.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 611.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 944.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 611.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 611.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 611.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 556.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 834.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 834.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 370.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 365.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 611.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 611.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 556.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 494.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 889.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 278.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 278.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 584.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 584.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 611.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 611.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 611.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 474.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 500.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 278.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 278.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 278.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 238.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 389.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 389.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 549.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 737.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 556.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 556.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 556.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 333.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 556.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 556.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 278.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 556.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 333.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 611.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 556.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 834.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 1000.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 556.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 611.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 611.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 611.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 611.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 611.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 556.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 611.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 611.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 556.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 778.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 556.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 556.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 556.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 500.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 556.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/helvetica_oblique.go
Normal file
362
internal/pdf/model/fonts/helvetica_oblique.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Helvetica-Oblique. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontHelveticaOblique struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontHelveticaOblique() fontHelveticaOblique {
|
||||
font := fontHelveticaOblique{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontHelveticaOblique) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontHelveticaOblique) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := helveticaObliqueCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontHelveticaOblique) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Helvetica-Oblique"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var helveticaObliqueCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 667.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 667.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 667.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 667.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 667.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 722.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 722.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 556.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 611.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 778.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 722.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 500.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 667.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 556.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 833.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 722.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 778.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 778.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 778.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 778.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 778.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 778.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 667.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 778.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 722.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 667.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 667.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 667.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 667.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 944.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 667.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 667.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 556.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 556.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 889.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 667.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 556.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 469.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 584.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 389.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 1015.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 556.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 260.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 334.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 334.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 278.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 278.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 260.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 500.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 500.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 556.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 278.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 278.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 737.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 556.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 556.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 556.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 556.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 643.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 556.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 584.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 556.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 556.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 556.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 1000.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 556.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 584.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 556.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 278.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 333.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 278.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 500.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 556.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 500.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 556.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 556.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 556.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 556.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 611.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 584.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 556.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 556.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 556.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 222.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 222.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 222.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 500.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 222.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 222.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 299.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 222.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 584.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 584.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 471.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 222.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 833.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 584.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 556.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 584.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 556.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 556.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 556.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 556.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 944.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 556.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 556.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 556.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 834.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 834.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 370.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 365.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 556.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 537.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 476.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 889.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 278.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 278.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 584.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 584.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 556.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 556.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 611.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 355.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 333.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 222.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 222.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 222.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 191.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 333.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 333.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 453.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 333.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 737.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 500.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 500.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 556.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 278.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 556.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 556.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 278.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 556.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 278.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 317.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 556.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 556.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 834.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 1000.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 556.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 333.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 556.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 556.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 556.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 556.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 500.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 722.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 500.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 500.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 556.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 500.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 556.000000, Wy: 0.000000},
|
||||
}
|
||||
239
internal/pdf/model/fonts/symbol.go
Normal file
239
internal/pdf/model/fonts/symbol.go
Normal file
@@ -0,0 +1,239 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Symbol. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontSymbol struct {
|
||||
// By default encoder is not set, which means that we use the font's built in encoding.
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontSymbol() fontSymbol {
|
||||
font := fontSymbol{}
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontSymbol) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontSymbol) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := symbolCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontSymbol) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Symbol"))
|
||||
if font.encoder != nil {
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
}
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var symbolCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"Alpha": {GlyphName: "Alpha", Wx: 722.000000, Wy: 0.000000},
|
||||
"Beta": {GlyphName: "Beta", Wx: 667.000000, Wy: 0.000000},
|
||||
"Chi": {GlyphName: "Chi", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"Epsilon": {GlyphName: "Epsilon", Wx: 611.000000, Wy: 0.000000},
|
||||
"Eta": {GlyphName: "Eta", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 750.000000, Wy: 0.000000},
|
||||
"Gamma": {GlyphName: "Gamma", Wx: 603.000000, Wy: 0.000000},
|
||||
"Ifraktur": {GlyphName: "Ifraktur", Wx: 686.000000, Wy: 0.000000},
|
||||
"Iota": {GlyphName: "Iota", Wx: 333.000000, Wy: 0.000000},
|
||||
"Kappa": {GlyphName: "Kappa", Wx: 722.000000, Wy: 0.000000},
|
||||
"Lambda": {GlyphName: "Lambda", Wx: 686.000000, Wy: 0.000000},
|
||||
"Mu": {GlyphName: "Mu", Wx: 889.000000, Wy: 0.000000},
|
||||
"Nu": {GlyphName: "Nu", Wx: 722.000000, Wy: 0.000000},
|
||||
"Omega": {GlyphName: "Omega", Wx: 768.000000, Wy: 0.000000},
|
||||
"Omicron": {GlyphName: "Omicron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Phi": {GlyphName: "Phi", Wx: 763.000000, Wy: 0.000000},
|
||||
"Pi": {GlyphName: "Pi", Wx: 768.000000, Wy: 0.000000},
|
||||
"Psi": {GlyphName: "Psi", Wx: 795.000000, Wy: 0.000000},
|
||||
"Rfraktur": {GlyphName: "Rfraktur", Wx: 795.000000, Wy: 0.000000},
|
||||
"Rho": {GlyphName: "Rho", Wx: 556.000000, Wy: 0.000000},
|
||||
"Sigma": {GlyphName: "Sigma", Wx: 592.000000, Wy: 0.000000},
|
||||
"Tau": {GlyphName: "Tau", Wx: 611.000000, Wy: 0.000000},
|
||||
"Theta": {GlyphName: "Theta", Wx: 741.000000, Wy: 0.000000},
|
||||
"Upsilon": {GlyphName: "Upsilon", Wx: 690.000000, Wy: 0.000000},
|
||||
"Upsilon1": {GlyphName: "Upsilon1", Wx: 620.000000, Wy: 0.000000},
|
||||
"Xi": {GlyphName: "Xi", Wx: 645.000000, Wy: 0.000000},
|
||||
"Zeta": {GlyphName: "Zeta", Wx: 611.000000, Wy: 0.000000},
|
||||
"aleph": {GlyphName: "aleph", Wx: 823.000000, Wy: 0.000000},
|
||||
"alpha": {GlyphName: "alpha", Wx: 631.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 778.000000, Wy: 0.000000},
|
||||
"angle": {GlyphName: "angle", Wx: 768.000000, Wy: 0.000000},
|
||||
"angleleft": {GlyphName: "angleleft", Wx: 329.000000, Wy: 0.000000},
|
||||
"angleright": {GlyphName: "angleright", Wx: 329.000000, Wy: 0.000000},
|
||||
"apple": {GlyphName: "apple", Wx: 790.000000, Wy: 0.000000},
|
||||
"approxequal": {GlyphName: "approxequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"arrowboth": {GlyphName: "arrowboth", Wx: 1042.000000, Wy: 0.000000},
|
||||
"arrowdblboth": {GlyphName: "arrowdblboth", Wx: 1042.000000, Wy: 0.000000},
|
||||
"arrowdbldown": {GlyphName: "arrowdbldown", Wx: 603.000000, Wy: 0.000000},
|
||||
"arrowdblleft": {GlyphName: "arrowdblleft", Wx: 987.000000, Wy: 0.000000},
|
||||
"arrowdblright": {GlyphName: "arrowdblright", Wx: 987.000000, Wy: 0.000000},
|
||||
"arrowdblup": {GlyphName: "arrowdblup", Wx: 603.000000, Wy: 0.000000},
|
||||
"arrowdown": {GlyphName: "arrowdown", Wx: 603.000000, Wy: 0.000000},
|
||||
"arrowhorizex": {GlyphName: "arrowhorizex", Wx: 1000.000000, Wy: 0.000000},
|
||||
"arrowleft": {GlyphName: "arrowleft", Wx: 987.000000, Wy: 0.000000},
|
||||
"arrowright": {GlyphName: "arrowright", Wx: 987.000000, Wy: 0.000000},
|
||||
"arrowup": {GlyphName: "arrowup", Wx: 603.000000, Wy: 0.000000},
|
||||
"arrowvertex": {GlyphName: "arrowvertex", Wx: 603.000000, Wy: 0.000000},
|
||||
"asteriskmath": {GlyphName: "asteriskmath", Wx: 500.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 200.000000, Wy: 0.000000},
|
||||
"beta": {GlyphName: "beta", Wx: 549.000000, Wy: 0.000000},
|
||||
"braceex": {GlyphName: "braceex", Wx: 494.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 480.000000, Wy: 0.000000},
|
||||
"braceleftbt": {GlyphName: "braceleftbt", Wx: 494.000000, Wy: 0.000000},
|
||||
"braceleftmid": {GlyphName: "braceleftmid", Wx: 494.000000, Wy: 0.000000},
|
||||
"bracelefttp": {GlyphName: "bracelefttp", Wx: 494.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 480.000000, Wy: 0.000000},
|
||||
"bracerightbt": {GlyphName: "bracerightbt", Wx: 494.000000, Wy: 0.000000},
|
||||
"bracerightmid": {GlyphName: "bracerightmid", Wx: 494.000000, Wy: 0.000000},
|
||||
"bracerighttp": {GlyphName: "bracerighttp", Wx: 494.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"bracketleftbt": {GlyphName: "bracketleftbt", Wx: 384.000000, Wy: 0.000000},
|
||||
"bracketleftex": {GlyphName: "bracketleftex", Wx: 384.000000, Wy: 0.000000},
|
||||
"bracketlefttp": {GlyphName: "bracketlefttp", Wx: 384.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 333.000000, Wy: 0.000000},
|
||||
"bracketrightbt": {GlyphName: "bracketrightbt", Wx: 384.000000, Wy: 0.000000},
|
||||
"bracketrightex": {GlyphName: "bracketrightex", Wx: 384.000000, Wy: 0.000000},
|
||||
"bracketrighttp": {GlyphName: "bracketrighttp", Wx: 384.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 460.000000, Wy: 0.000000},
|
||||
"carriagereturn": {GlyphName: "carriagereturn", Wx: 658.000000, Wy: 0.000000},
|
||||
"chi": {GlyphName: "chi", Wx: 549.000000, Wy: 0.000000},
|
||||
"circlemultiply": {GlyphName: "circlemultiply", Wx: 768.000000, Wy: 0.000000},
|
||||
"circleplus": {GlyphName: "circleplus", Wx: 768.000000, Wy: 0.000000},
|
||||
"club": {GlyphName: "club", Wx: 753.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 278.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 250.000000, Wy: 0.000000},
|
||||
"congruent": {GlyphName: "congruent", Wx: 549.000000, Wy: 0.000000},
|
||||
"copyrightsans": {GlyphName: "copyrightsans", Wx: 790.000000, Wy: 0.000000},
|
||||
"copyrightserif": {GlyphName: "copyrightserif", Wx: 790.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"delta": {GlyphName: "delta", Wx: 494.000000, Wy: 0.000000},
|
||||
"diamond": {GlyphName: "diamond", Wx: 753.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 549.000000, Wy: 0.000000},
|
||||
"dotmath": {GlyphName: "dotmath", Wx: 250.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 500.000000, Wy: 0.000000},
|
||||
"element": {GlyphName: "element", Wx: 713.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emptyset": {GlyphName: "emptyset", Wx: 823.000000, Wy: 0.000000},
|
||||
"epsilon": {GlyphName: "epsilon", Wx: 439.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 549.000000, Wy: 0.000000},
|
||||
"equivalence": {GlyphName: "equivalence", Wx: 549.000000, Wy: 0.000000},
|
||||
"eta": {GlyphName: "eta", Wx: 603.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 333.000000, Wy: 0.000000},
|
||||
"existential": {GlyphName: "existential", Wx: 549.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 500.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 500.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 500.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"gamma": {GlyphName: "gamma", Wx: 411.000000, Wy: 0.000000},
|
||||
"gradient": {GlyphName: "gradient", Wx: 713.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 549.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"heart": {GlyphName: "heart", Wx: 753.000000, Wy: 0.000000},
|
||||
"infinity": {GlyphName: "infinity", Wx: 713.000000, Wy: 0.000000},
|
||||
"integral": {GlyphName: "integral", Wx: 274.000000, Wy: 0.000000},
|
||||
"integralbt": {GlyphName: "integralbt", Wx: 686.000000, Wy: 0.000000},
|
||||
"integralex": {GlyphName: "integralex", Wx: 686.000000, Wy: 0.000000},
|
||||
"integraltp": {GlyphName: "integraltp", Wx: 686.000000, Wy: 0.000000},
|
||||
"intersection": {GlyphName: "intersection", Wx: 768.000000, Wy: 0.000000},
|
||||
"iota": {GlyphName: "iota", Wx: 329.000000, Wy: 0.000000},
|
||||
"kappa": {GlyphName: "kappa", Wx: 549.000000, Wy: 0.000000},
|
||||
"lambda": {GlyphName: "lambda", Wx: 549.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 549.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicaland": {GlyphName: "logicaland", Wx: 603.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 713.000000, Wy: 0.000000},
|
||||
"logicalor": {GlyphName: "logicalor", Wx: 603.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 494.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 549.000000, Wy: 0.000000},
|
||||
"minute": {GlyphName: "minute", Wx: 247.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 576.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 549.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 500.000000, Wy: 0.000000},
|
||||
"notelement": {GlyphName: "notelement", Wx: 713.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"notsubset": {GlyphName: "notsubset", Wx: 713.000000, Wy: 0.000000},
|
||||
"nu": {GlyphName: "nu", Wx: 521.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 500.000000, Wy: 0.000000},
|
||||
"omega": {GlyphName: "omega", Wx: 686.000000, Wy: 0.000000},
|
||||
"omega1": {GlyphName: "omega1", Wx: 713.000000, Wy: 0.000000},
|
||||
"omicron": {GlyphName: "omicron", Wx: 549.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 500.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenleftbt": {GlyphName: "parenleftbt", Wx: 384.000000, Wy: 0.000000},
|
||||
"parenleftex": {GlyphName: "parenleftex", Wx: 384.000000, Wy: 0.000000},
|
||||
"parenlefttp": {GlyphName: "parenlefttp", Wx: 384.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenrightbt": {GlyphName: "parenrightbt", Wx: 384.000000, Wy: 0.000000},
|
||||
"parenrightex": {GlyphName: "parenrightex", Wx: 384.000000, Wy: 0.000000},
|
||||
"parenrighttp": {GlyphName: "parenrighttp", Wx: 384.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 494.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 833.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 250.000000, Wy: 0.000000},
|
||||
"perpendicular": {GlyphName: "perpendicular", Wx: 658.000000, Wy: 0.000000},
|
||||
"phi": {GlyphName: "phi", Wx: 521.000000, Wy: 0.000000},
|
||||
"phi1": {GlyphName: "phi1", Wx: 603.000000, Wy: 0.000000},
|
||||
"pi": {GlyphName: "pi", Wx: 549.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 549.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 549.000000, Wy: 0.000000},
|
||||
"product": {GlyphName: "product", Wx: 823.000000, Wy: 0.000000},
|
||||
"propersubset": {GlyphName: "propersubset", Wx: 713.000000, Wy: 0.000000},
|
||||
"propersuperset": {GlyphName: "propersuperset", Wx: 713.000000, Wy: 0.000000},
|
||||
"proportional": {GlyphName: "proportional", Wx: 713.000000, Wy: 0.000000},
|
||||
"psi": {GlyphName: "psi", Wx: 686.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 444.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 549.000000, Wy: 0.000000},
|
||||
"radicalex": {GlyphName: "radicalex", Wx: 500.000000, Wy: 0.000000},
|
||||
"reflexsubset": {GlyphName: "reflexsubset", Wx: 713.000000, Wy: 0.000000},
|
||||
"reflexsuperset": {GlyphName: "reflexsuperset", Wx: 713.000000, Wy: 0.000000},
|
||||
"registersans": {GlyphName: "registersans", Wx: 790.000000, Wy: 0.000000},
|
||||
"registerserif": {GlyphName: "registerserif", Wx: 790.000000, Wy: 0.000000},
|
||||
"rho": {GlyphName: "rho", Wx: 549.000000, Wy: 0.000000},
|
||||
"second": {GlyphName: "second", Wx: 411.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 278.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 500.000000, Wy: 0.000000},
|
||||
"sigma": {GlyphName: "sigma", Wx: 603.000000, Wy: 0.000000},
|
||||
"sigma1": {GlyphName: "sigma1", Wx: 439.000000, Wy: 0.000000},
|
||||
"similar": {GlyphName: "similar", Wx: 549.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 500.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 250.000000, Wy: 0.000000},
|
||||
"spade": {GlyphName: "spade", Wx: 753.000000, Wy: 0.000000},
|
||||
"suchthat": {GlyphName: "suchthat", Wx: 439.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 713.000000, Wy: 0.000000},
|
||||
"tau": {GlyphName: "tau", Wx: 439.000000, Wy: 0.000000},
|
||||
"therefore": {GlyphName: "therefore", Wx: 863.000000, Wy: 0.000000},
|
||||
"theta": {GlyphName: "theta", Wx: 521.000000, Wy: 0.000000},
|
||||
"theta1": {GlyphName: "theta1", Wx: 631.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 500.000000, Wy: 0.000000},
|
||||
"trademarksans": {GlyphName: "trademarksans", Wx: 786.000000, Wy: 0.000000},
|
||||
"trademarkserif": {GlyphName: "trademarkserif", Wx: 890.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 500.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 500.000000, Wy: 0.000000},
|
||||
"union": {GlyphName: "union", Wx: 768.000000, Wy: 0.000000},
|
||||
"universal": {GlyphName: "universal", Wx: 713.000000, Wy: 0.000000},
|
||||
"upsilon": {GlyphName: "upsilon", Wx: 576.000000, Wy: 0.000000},
|
||||
"weierstrass": {GlyphName: "weierstrass", Wx: 987.000000, Wy: 0.000000},
|
||||
"xi": {GlyphName: "xi", Wx: 493.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 500.000000, Wy: 0.000000},
|
||||
"zeta": {GlyphName: "zeta", Wx: 494.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/times_bold.go
Normal file
362
internal/pdf/model/fonts/times_bold.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Times-Bold. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontTimesBold struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontTimesBold() fontTimesBold {
|
||||
font := fontTimesBold{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontTimesBold) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontTimesBold) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := timesBoldCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontTimesBold) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Times-Bold"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var timesBoldCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 722.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 722.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 667.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 722.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 722.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 500.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 611.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 778.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 778.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 389.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 389.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 389.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 389.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 389.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 389.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 500.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 778.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 778.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 667.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 667.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 944.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 722.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 778.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 1000.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 778.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 778.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 778.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 778.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 778.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 778.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 611.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 778.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 722.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 556.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 667.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 611.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 722.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 1000.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 722.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 722.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 667.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 500.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 500.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 722.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 500.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 833.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 500.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 500.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 581.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 520.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 500.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 930.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 556.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 220.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 394.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 394.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 333.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 220.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 444.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 444.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 500.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 333.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 250.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 747.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 500.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 556.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 500.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 500.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 672.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 556.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 570.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 500.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 444.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 444.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 444.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 444.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 500.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 444.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 1000.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 500.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 444.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 570.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 500.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 333.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 333.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 333.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 556.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 500.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 556.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 500.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 500.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 500.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 500.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 556.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 570.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 500.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 556.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 278.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 333.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 556.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 278.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 394.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 570.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 570.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 494.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 833.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 570.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 556.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 570.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 556.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 500.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 500.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 500.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 722.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 500.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 500.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 500.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 750.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 750.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 300.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 330.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 500.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 556.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 540.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 494.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 1000.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 250.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 250.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 570.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 570.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 556.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 500.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 555.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 500.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 278.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 444.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 444.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 549.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 747.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 389.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 389.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 500.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 333.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 500.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 500.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 250.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 500.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 333.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 416.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 556.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 500.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 750.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 1000.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 500.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 556.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 556.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 500.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 556.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 500.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 722.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 500.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 500.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 500.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 444.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 500.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/times_bold_italic.go
Normal file
362
internal/pdf/model/fonts/times_bold_italic.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Times-BoldItalic. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontTimesBoldItalic struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontTimesBoldItalic() fontTimesBoldItalic {
|
||||
font := fontTimesBoldItalic{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontTimesBoldItalic) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontTimesBoldItalic) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := timesBoldItalicCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontTimesBoldItalic) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Times-BoldItalic"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var timesBoldItalicCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 667.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 944.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 667.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 667.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 667.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 667.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 667.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 667.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 667.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 667.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 667.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 500.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 667.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 722.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 778.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 389.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 389.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 389.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 389.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 389.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 389.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 500.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 667.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 889.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 722.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 722.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 944.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 722.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 611.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 722.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 667.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 556.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 611.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 667.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 889.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 667.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 611.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 500.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 500.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 722.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 500.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 778.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 500.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 500.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 570.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 570.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 500.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 832.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 500.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 220.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 348.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 348.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 333.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 220.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 444.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 444.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 500.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 333.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 250.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 747.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 500.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 500.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 500.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 500.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 608.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 500.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 570.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 500.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 444.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 444.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 444.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 444.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 500.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 444.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 1000.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 500.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 444.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 570.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 500.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 389.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 389.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 333.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 556.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 500.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 556.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 500.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 500.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 500.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 500.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 500.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 570.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 500.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 556.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 278.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 278.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 500.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 278.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 382.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 570.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 606.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 494.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 778.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 606.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 576.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 570.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 556.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 500.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 556.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 500.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 500.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 722.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 500.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 500.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 500.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 750.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 750.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 266.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 300.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 500.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 500.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 500.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 494.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 833.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 250.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 250.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 570.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 570.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 500.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 500.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 555.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 500.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 278.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 389.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 389.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 549.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 747.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 389.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 389.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 500.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 333.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 500.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 500.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 250.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 500.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 278.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 366.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 500.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 500.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 750.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 1000.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 500.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 556.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 556.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 556.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 556.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 556.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 500.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 556.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 556.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 444.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 667.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 500.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 444.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 444.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 500.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 389.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 500.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/times_italic.go
Normal file
362
internal/pdf/model/fonts/times_italic.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Times-Italic. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontTimesItalic struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontTimesItalic() fontTimesItalic {
|
||||
font := fontTimesItalic{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontTimesItalic) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontTimesItalic) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := timesItalicCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontTimesItalic) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Times-Italic"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var timesItalicCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 611.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 889.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 611.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 611.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 611.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 611.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 611.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 611.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 611.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 667.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 667.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 611.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 611.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 611.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 611.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 500.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 611.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 722.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 722.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 333.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 333.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 333.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 333.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 444.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 667.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 556.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 833.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 667.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 667.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 722.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 944.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 722.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 611.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 722.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 611.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 500.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 500.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 556.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 611.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 611.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 833.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 611.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 556.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 556.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 556.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 500.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 500.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 667.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 500.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 778.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 500.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 500.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 422.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 541.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 500.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 920.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 500.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 275.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 400.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 400.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 389.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 389.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 275.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 444.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 444.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 500.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 333.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 250.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 760.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 500.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 500.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 500.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 500.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 544.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 500.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 675.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 500.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 444.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 444.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 444.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 444.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 500.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 889.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 444.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 889.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 500.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 444.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 675.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 500.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 333.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 389.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 278.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 500.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 500.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 500.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 500.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 500.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 500.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 500.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 500.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 675.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 500.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 500.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 278.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 278.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 444.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 278.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 300.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 675.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 675.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 471.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 722.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 675.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 500.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 675.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 500.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 500.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 500.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 500.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 667.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 500.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 500.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 500.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 750.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 750.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 276.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 310.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 500.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 500.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 523.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 476.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 833.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 250.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 250.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 675.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 675.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 500.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 500.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 500.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 420.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 556.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 556.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 556.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 214.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 389.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 389.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 453.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 760.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 389.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 389.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 500.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 333.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 500.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 500.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 250.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 500.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 278.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 300.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 500.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 500.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 750.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 980.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 500.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 500.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 500.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 500.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 500.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 500.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 500.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 444.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 667.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 444.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 444.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 444.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 500.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 389.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 500.000000, Wy: 0.000000},
|
||||
}
|
||||
362
internal/pdf/model/fonts/times_roman.go
Normal file
362
internal/pdf/model/fonts/times_roman.go
Normal file
@@ -0,0 +1,362 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font Times-Roman. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontTimesRoman struct {
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontTimesRoman() fontTimesRoman {
|
||||
font := fontTimesRoman{}
|
||||
font.encoder = textencoding.NewWinAnsiTextEncoder() // Default
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontTimesRoman) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontTimesRoman) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := timesRomanCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontTimesRoman) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("Times-Roman"))
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var timesRomanCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"A": {GlyphName: "A", Wx: 722.000000, Wy: 0.000000},
|
||||
"AE": {GlyphName: "AE", Wx: 889.000000, Wy: 0.000000},
|
||||
"Aacute": {GlyphName: "Aacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Abreve": {GlyphName: "Abreve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Acircumflex": {GlyphName: "Acircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Adieresis": {GlyphName: "Adieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Agrave": {GlyphName: "Agrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Amacron": {GlyphName: "Amacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aogonek": {GlyphName: "Aogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Aring": {GlyphName: "Aring", Wx: 722.000000, Wy: 0.000000},
|
||||
"Atilde": {GlyphName: "Atilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"B": {GlyphName: "B", Wx: 667.000000, Wy: 0.000000},
|
||||
"C": {GlyphName: "C", Wx: 667.000000, Wy: 0.000000},
|
||||
"Cacute": {GlyphName: "Cacute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ccaron": {GlyphName: "Ccaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Ccedilla": {GlyphName: "Ccedilla", Wx: 667.000000, Wy: 0.000000},
|
||||
"D": {GlyphName: "D", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcaron": {GlyphName: "Dcaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Dcroat": {GlyphName: "Dcroat", Wx: 722.000000, Wy: 0.000000},
|
||||
"Delta": {GlyphName: "Delta", Wx: 612.000000, Wy: 0.000000},
|
||||
"E": {GlyphName: "E", Wx: 611.000000, Wy: 0.000000},
|
||||
"Eacute": {GlyphName: "Eacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Ecaron": {GlyphName: "Ecaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Ecircumflex": {GlyphName: "Ecircumflex", Wx: 611.000000, Wy: 0.000000},
|
||||
"Edieresis": {GlyphName: "Edieresis", Wx: 611.000000, Wy: 0.000000},
|
||||
"Edotaccent": {GlyphName: "Edotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Egrave": {GlyphName: "Egrave", Wx: 611.000000, Wy: 0.000000},
|
||||
"Emacron": {GlyphName: "Emacron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Eogonek": {GlyphName: "Eogonek", Wx: 611.000000, Wy: 0.000000},
|
||||
"Eth": {GlyphName: "Eth", Wx: 722.000000, Wy: 0.000000},
|
||||
"Euro": {GlyphName: "Euro", Wx: 500.000000, Wy: 0.000000},
|
||||
"F": {GlyphName: "F", Wx: 556.000000, Wy: 0.000000},
|
||||
"G": {GlyphName: "G", Wx: 722.000000, Wy: 0.000000},
|
||||
"Gbreve": {GlyphName: "Gbreve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Gcommaaccent": {GlyphName: "Gcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"H": {GlyphName: "H", Wx: 722.000000, Wy: 0.000000},
|
||||
"I": {GlyphName: "I", Wx: 333.000000, Wy: 0.000000},
|
||||
"Iacute": {GlyphName: "Iacute", Wx: 333.000000, Wy: 0.000000},
|
||||
"Icircumflex": {GlyphName: "Icircumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"Idieresis": {GlyphName: "Idieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"Idotaccent": {GlyphName: "Idotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"Igrave": {GlyphName: "Igrave", Wx: 333.000000, Wy: 0.000000},
|
||||
"Imacron": {GlyphName: "Imacron", Wx: 333.000000, Wy: 0.000000},
|
||||
"Iogonek": {GlyphName: "Iogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"J": {GlyphName: "J", Wx: 389.000000, Wy: 0.000000},
|
||||
"K": {GlyphName: "K", Wx: 722.000000, Wy: 0.000000},
|
||||
"Kcommaaccent": {GlyphName: "Kcommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"L": {GlyphName: "L", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lacute": {GlyphName: "Lacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcaron": {GlyphName: "Lcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lcommaaccent": {GlyphName: "Lcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Lslash": {GlyphName: "Lslash", Wx: 611.000000, Wy: 0.000000},
|
||||
"M": {GlyphName: "M", Wx: 889.000000, Wy: 0.000000},
|
||||
"N": {GlyphName: "N", Wx: 722.000000, Wy: 0.000000},
|
||||
"Nacute": {GlyphName: "Nacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncaron": {GlyphName: "Ncaron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ncommaaccent": {GlyphName: "Ncommaaccent", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ntilde": {GlyphName: "Ntilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"O": {GlyphName: "O", Wx: 722.000000, Wy: 0.000000},
|
||||
"OE": {GlyphName: "OE", Wx: 889.000000, Wy: 0.000000},
|
||||
"Oacute": {GlyphName: "Oacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ocircumflex": {GlyphName: "Ocircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Odieresis": {GlyphName: "Odieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ograve": {GlyphName: "Ograve", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ohungarumlaut": {GlyphName: "Ohungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Omacron": {GlyphName: "Omacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Oslash": {GlyphName: "Oslash", Wx: 722.000000, Wy: 0.000000},
|
||||
"Otilde": {GlyphName: "Otilde", Wx: 722.000000, Wy: 0.000000},
|
||||
"P": {GlyphName: "P", Wx: 556.000000, Wy: 0.000000},
|
||||
"Q": {GlyphName: "Q", Wx: 722.000000, Wy: 0.000000},
|
||||
"R": {GlyphName: "R", Wx: 667.000000, Wy: 0.000000},
|
||||
"Racute": {GlyphName: "Racute", Wx: 667.000000, Wy: 0.000000},
|
||||
"Rcaron": {GlyphName: "Rcaron", Wx: 667.000000, Wy: 0.000000},
|
||||
"Rcommaaccent": {GlyphName: "Rcommaaccent", Wx: 667.000000, Wy: 0.000000},
|
||||
"S": {GlyphName: "S", Wx: 556.000000, Wy: 0.000000},
|
||||
"Sacute": {GlyphName: "Sacute", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scaron": {GlyphName: "Scaron", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scedilla": {GlyphName: "Scedilla", Wx: 556.000000, Wy: 0.000000},
|
||||
"Scommaaccent": {GlyphName: "Scommaaccent", Wx: 556.000000, Wy: 0.000000},
|
||||
"T": {GlyphName: "T", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcaron": {GlyphName: "Tcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Tcommaaccent": {GlyphName: "Tcommaaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"Thorn": {GlyphName: "Thorn", Wx: 556.000000, Wy: 0.000000},
|
||||
"U": {GlyphName: "U", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uacute": {GlyphName: "Uacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ucircumflex": {GlyphName: "Ucircumflex", Wx: 722.000000, Wy: 0.000000},
|
||||
"Udieresis": {GlyphName: "Udieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ugrave": {GlyphName: "Ugrave", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uhungarumlaut": {GlyphName: "Uhungarumlaut", Wx: 722.000000, Wy: 0.000000},
|
||||
"Umacron": {GlyphName: "Umacron", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uogonek": {GlyphName: "Uogonek", Wx: 722.000000, Wy: 0.000000},
|
||||
"Uring": {GlyphName: "Uring", Wx: 722.000000, Wy: 0.000000},
|
||||
"V": {GlyphName: "V", Wx: 722.000000, Wy: 0.000000},
|
||||
"W": {GlyphName: "W", Wx: 944.000000, Wy: 0.000000},
|
||||
"X": {GlyphName: "X", Wx: 722.000000, Wy: 0.000000},
|
||||
"Y": {GlyphName: "Y", Wx: 722.000000, Wy: 0.000000},
|
||||
"Yacute": {GlyphName: "Yacute", Wx: 722.000000, Wy: 0.000000},
|
||||
"Ydieresis": {GlyphName: "Ydieresis", Wx: 722.000000, Wy: 0.000000},
|
||||
"Z": {GlyphName: "Z", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zacute": {GlyphName: "Zacute", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zcaron": {GlyphName: "Zcaron", Wx: 611.000000, Wy: 0.000000},
|
||||
"Zdotaccent": {GlyphName: "Zdotaccent", Wx: 611.000000, Wy: 0.000000},
|
||||
"a": {GlyphName: "a", Wx: 444.000000, Wy: 0.000000},
|
||||
"aacute": {GlyphName: "aacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"abreve": {GlyphName: "abreve", Wx: 444.000000, Wy: 0.000000},
|
||||
"acircumflex": {GlyphName: "acircumflex", Wx: 444.000000, Wy: 0.000000},
|
||||
"acute": {GlyphName: "acute", Wx: 333.000000, Wy: 0.000000},
|
||||
"adieresis": {GlyphName: "adieresis", Wx: 444.000000, Wy: 0.000000},
|
||||
"ae": {GlyphName: "ae", Wx: 667.000000, Wy: 0.000000},
|
||||
"agrave": {GlyphName: "agrave", Wx: 444.000000, Wy: 0.000000},
|
||||
"amacron": {GlyphName: "amacron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ampersand": {GlyphName: "ampersand", Wx: 778.000000, Wy: 0.000000},
|
||||
"aogonek": {GlyphName: "aogonek", Wx: 444.000000, Wy: 0.000000},
|
||||
"aring": {GlyphName: "aring", Wx: 444.000000, Wy: 0.000000},
|
||||
"asciicircum": {GlyphName: "asciicircum", Wx: 469.000000, Wy: 0.000000},
|
||||
"asciitilde": {GlyphName: "asciitilde", Wx: 541.000000, Wy: 0.000000},
|
||||
"asterisk": {GlyphName: "asterisk", Wx: 500.000000, Wy: 0.000000},
|
||||
"at": {GlyphName: "at", Wx: 921.000000, Wy: 0.000000},
|
||||
"atilde": {GlyphName: "atilde", Wx: 444.000000, Wy: 0.000000},
|
||||
"b": {GlyphName: "b", Wx: 500.000000, Wy: 0.000000},
|
||||
"backslash": {GlyphName: "backslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"bar": {GlyphName: "bar", Wx: 200.000000, Wy: 0.000000},
|
||||
"braceleft": {GlyphName: "braceleft", Wx: 480.000000, Wy: 0.000000},
|
||||
"braceright": {GlyphName: "braceright", Wx: 480.000000, Wy: 0.000000},
|
||||
"bracketleft": {GlyphName: "bracketleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"bracketright": {GlyphName: "bracketright", Wx: 333.000000, Wy: 0.000000},
|
||||
"breve": {GlyphName: "breve", Wx: 333.000000, Wy: 0.000000},
|
||||
"brokenbar": {GlyphName: "brokenbar", Wx: 200.000000, Wy: 0.000000},
|
||||
"bullet": {GlyphName: "bullet", Wx: 350.000000, Wy: 0.000000},
|
||||
"c": {GlyphName: "c", Wx: 444.000000, Wy: 0.000000},
|
||||
"cacute": {GlyphName: "cacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"caron": {GlyphName: "caron", Wx: 333.000000, Wy: 0.000000},
|
||||
"ccaron": {GlyphName: "ccaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ccedilla": {GlyphName: "ccedilla", Wx: 444.000000, Wy: 0.000000},
|
||||
"cedilla": {GlyphName: "cedilla", Wx: 333.000000, Wy: 0.000000},
|
||||
"cent": {GlyphName: "cent", Wx: 500.000000, Wy: 0.000000},
|
||||
"circumflex": {GlyphName: "circumflex", Wx: 333.000000, Wy: 0.000000},
|
||||
"colon": {GlyphName: "colon", Wx: 278.000000, Wy: 0.000000},
|
||||
"comma": {GlyphName: "comma", Wx: 250.000000, Wy: 0.000000},
|
||||
"commaaccent": {GlyphName: "commaaccent", Wx: 250.000000, Wy: 0.000000},
|
||||
"copyright": {GlyphName: "copyright", Wx: 760.000000, Wy: 0.000000},
|
||||
"currency": {GlyphName: "currency", Wx: 500.000000, Wy: 0.000000},
|
||||
"d": {GlyphName: "d", Wx: 500.000000, Wy: 0.000000},
|
||||
"dagger": {GlyphName: "dagger", Wx: 500.000000, Wy: 0.000000},
|
||||
"daggerdbl": {GlyphName: "daggerdbl", Wx: 500.000000, Wy: 0.000000},
|
||||
"dcaron": {GlyphName: "dcaron", Wx: 588.000000, Wy: 0.000000},
|
||||
"dcroat": {GlyphName: "dcroat", Wx: 500.000000, Wy: 0.000000},
|
||||
"degree": {GlyphName: "degree", Wx: 400.000000, Wy: 0.000000},
|
||||
"dieresis": {GlyphName: "dieresis", Wx: 333.000000, Wy: 0.000000},
|
||||
"divide": {GlyphName: "divide", Wx: 564.000000, Wy: 0.000000},
|
||||
"dollar": {GlyphName: "dollar", Wx: 500.000000, Wy: 0.000000},
|
||||
"dotaccent": {GlyphName: "dotaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"dotlessi": {GlyphName: "dotlessi", Wx: 278.000000, Wy: 0.000000},
|
||||
"e": {GlyphName: "e", Wx: 444.000000, Wy: 0.000000},
|
||||
"eacute": {GlyphName: "eacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecaron": {GlyphName: "ecaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"ecircumflex": {GlyphName: "ecircumflex", Wx: 444.000000, Wy: 0.000000},
|
||||
"edieresis": {GlyphName: "edieresis", Wx: 444.000000, Wy: 0.000000},
|
||||
"edotaccent": {GlyphName: "edotaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"egrave": {GlyphName: "egrave", Wx: 444.000000, Wy: 0.000000},
|
||||
"eight": {GlyphName: "eight", Wx: 500.000000, Wy: 0.000000},
|
||||
"ellipsis": {GlyphName: "ellipsis", Wx: 1000.000000, Wy: 0.000000},
|
||||
"emacron": {GlyphName: "emacron", Wx: 444.000000, Wy: 0.000000},
|
||||
"emdash": {GlyphName: "emdash", Wx: 1000.000000, Wy: 0.000000},
|
||||
"endash": {GlyphName: "endash", Wx: 500.000000, Wy: 0.000000},
|
||||
"eogonek": {GlyphName: "eogonek", Wx: 444.000000, Wy: 0.000000},
|
||||
"equal": {GlyphName: "equal", Wx: 564.000000, Wy: 0.000000},
|
||||
"eth": {GlyphName: "eth", Wx: 500.000000, Wy: 0.000000},
|
||||
"exclam": {GlyphName: "exclam", Wx: 333.000000, Wy: 0.000000},
|
||||
"exclamdown": {GlyphName: "exclamdown", Wx: 333.000000, Wy: 0.000000},
|
||||
"f": {GlyphName: "f", Wx: 333.000000, Wy: 0.000000},
|
||||
"fi": {GlyphName: "fi", Wx: 556.000000, Wy: 0.000000},
|
||||
"five": {GlyphName: "five", Wx: 500.000000, Wy: 0.000000},
|
||||
"fl": {GlyphName: "fl", Wx: 556.000000, Wy: 0.000000},
|
||||
"florin": {GlyphName: "florin", Wx: 500.000000, Wy: 0.000000},
|
||||
"four": {GlyphName: "four", Wx: 500.000000, Wy: 0.000000},
|
||||
"fraction": {GlyphName: "fraction", Wx: 167.000000, Wy: 0.000000},
|
||||
"g": {GlyphName: "g", Wx: 500.000000, Wy: 0.000000},
|
||||
"gbreve": {GlyphName: "gbreve", Wx: 500.000000, Wy: 0.000000},
|
||||
"gcommaaccent": {GlyphName: "gcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"germandbls": {GlyphName: "germandbls", Wx: 500.000000, Wy: 0.000000},
|
||||
"grave": {GlyphName: "grave", Wx: 333.000000, Wy: 0.000000},
|
||||
"greater": {GlyphName: "greater", Wx: 564.000000, Wy: 0.000000},
|
||||
"greaterequal": {GlyphName: "greaterequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"guillemotleft": {GlyphName: "guillemotleft", Wx: 500.000000, Wy: 0.000000},
|
||||
"guillemotright": {GlyphName: "guillemotright", Wx: 500.000000, Wy: 0.000000},
|
||||
"guilsinglleft": {GlyphName: "guilsinglleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"guilsinglright": {GlyphName: "guilsinglright", Wx: 333.000000, Wy: 0.000000},
|
||||
"h": {GlyphName: "h", Wx: 500.000000, Wy: 0.000000},
|
||||
"hungarumlaut": {GlyphName: "hungarumlaut", Wx: 333.000000, Wy: 0.000000},
|
||||
"hyphen": {GlyphName: "hyphen", Wx: 333.000000, Wy: 0.000000},
|
||||
"i": {GlyphName: "i", Wx: 278.000000, Wy: 0.000000},
|
||||
"iacute": {GlyphName: "iacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"icircumflex": {GlyphName: "icircumflex", Wx: 278.000000, Wy: 0.000000},
|
||||
"idieresis": {GlyphName: "idieresis", Wx: 278.000000, Wy: 0.000000},
|
||||
"igrave": {GlyphName: "igrave", Wx: 278.000000, Wy: 0.000000},
|
||||
"imacron": {GlyphName: "imacron", Wx: 278.000000, Wy: 0.000000},
|
||||
"iogonek": {GlyphName: "iogonek", Wx: 278.000000, Wy: 0.000000},
|
||||
"j": {GlyphName: "j", Wx: 278.000000, Wy: 0.000000},
|
||||
"k": {GlyphName: "k", Wx: 500.000000, Wy: 0.000000},
|
||||
"kcommaaccent": {GlyphName: "kcommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"l": {GlyphName: "l", Wx: 278.000000, Wy: 0.000000},
|
||||
"lacute": {GlyphName: "lacute", Wx: 278.000000, Wy: 0.000000},
|
||||
"lcaron": {GlyphName: "lcaron", Wx: 344.000000, Wy: 0.000000},
|
||||
"lcommaaccent": {GlyphName: "lcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"less": {GlyphName: "less", Wx: 564.000000, Wy: 0.000000},
|
||||
"lessequal": {GlyphName: "lessequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"logicalnot": {GlyphName: "logicalnot", Wx: 564.000000, Wy: 0.000000},
|
||||
"lozenge": {GlyphName: "lozenge", Wx: 471.000000, Wy: 0.000000},
|
||||
"lslash": {GlyphName: "lslash", Wx: 278.000000, Wy: 0.000000},
|
||||
"m": {GlyphName: "m", Wx: 778.000000, Wy: 0.000000},
|
||||
"macron": {GlyphName: "macron", Wx: 333.000000, Wy: 0.000000},
|
||||
"minus": {GlyphName: "minus", Wx: 564.000000, Wy: 0.000000},
|
||||
"mu": {GlyphName: "mu", Wx: 500.000000, Wy: 0.000000},
|
||||
"multiply": {GlyphName: "multiply", Wx: 564.000000, Wy: 0.000000},
|
||||
"n": {GlyphName: "n", Wx: 500.000000, Wy: 0.000000},
|
||||
"nacute": {GlyphName: "nacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ncaron": {GlyphName: "ncaron", Wx: 500.000000, Wy: 0.000000},
|
||||
"ncommaaccent": {GlyphName: "ncommaaccent", Wx: 500.000000, Wy: 0.000000},
|
||||
"nine": {GlyphName: "nine", Wx: 500.000000, Wy: 0.000000},
|
||||
"notequal": {GlyphName: "notequal", Wx: 549.000000, Wy: 0.000000},
|
||||
"ntilde": {GlyphName: "ntilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"numbersign": {GlyphName: "numbersign", Wx: 500.000000, Wy: 0.000000},
|
||||
"o": {GlyphName: "o", Wx: 500.000000, Wy: 0.000000},
|
||||
"oacute": {GlyphName: "oacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ocircumflex": {GlyphName: "ocircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"odieresis": {GlyphName: "odieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"oe": {GlyphName: "oe", Wx: 722.000000, Wy: 0.000000},
|
||||
"ogonek": {GlyphName: "ogonek", Wx: 333.000000, Wy: 0.000000},
|
||||
"ograve": {GlyphName: "ograve", Wx: 500.000000, Wy: 0.000000},
|
||||
"ohungarumlaut": {GlyphName: "ohungarumlaut", Wx: 500.000000, Wy: 0.000000},
|
||||
"omacron": {GlyphName: "omacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"one": {GlyphName: "one", Wx: 500.000000, Wy: 0.000000},
|
||||
"onehalf": {GlyphName: "onehalf", Wx: 750.000000, Wy: 0.000000},
|
||||
"onequarter": {GlyphName: "onequarter", Wx: 750.000000, Wy: 0.000000},
|
||||
"onesuperior": {GlyphName: "onesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"ordfeminine": {GlyphName: "ordfeminine", Wx: 276.000000, Wy: 0.000000},
|
||||
"ordmasculine": {GlyphName: "ordmasculine", Wx: 310.000000, Wy: 0.000000},
|
||||
"oslash": {GlyphName: "oslash", Wx: 500.000000, Wy: 0.000000},
|
||||
"otilde": {GlyphName: "otilde", Wx: 500.000000, Wy: 0.000000},
|
||||
"p": {GlyphName: "p", Wx: 500.000000, Wy: 0.000000},
|
||||
"paragraph": {GlyphName: "paragraph", Wx: 453.000000, Wy: 0.000000},
|
||||
"parenleft": {GlyphName: "parenleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"parenright": {GlyphName: "parenright", Wx: 333.000000, Wy: 0.000000},
|
||||
"partialdiff": {GlyphName: "partialdiff", Wx: 476.000000, Wy: 0.000000},
|
||||
"percent": {GlyphName: "percent", Wx: 833.000000, Wy: 0.000000},
|
||||
"period": {GlyphName: "period", Wx: 250.000000, Wy: 0.000000},
|
||||
"periodcentered": {GlyphName: "periodcentered", Wx: 250.000000, Wy: 0.000000},
|
||||
"perthousand": {GlyphName: "perthousand", Wx: 1000.000000, Wy: 0.000000},
|
||||
"plus": {GlyphName: "plus", Wx: 564.000000, Wy: 0.000000},
|
||||
"plusminus": {GlyphName: "plusminus", Wx: 564.000000, Wy: 0.000000},
|
||||
"q": {GlyphName: "q", Wx: 500.000000, Wy: 0.000000},
|
||||
"question": {GlyphName: "question", Wx: 444.000000, Wy: 0.000000},
|
||||
"questiondown": {GlyphName: "questiondown", Wx: 444.000000, Wy: 0.000000},
|
||||
"quotedbl": {GlyphName: "quotedbl", Wx: 408.000000, Wy: 0.000000},
|
||||
"quotedblbase": {GlyphName: "quotedblbase", Wx: 444.000000, Wy: 0.000000},
|
||||
"quotedblleft": {GlyphName: "quotedblleft", Wx: 444.000000, Wy: 0.000000},
|
||||
"quotedblright": {GlyphName: "quotedblright", Wx: 444.000000, Wy: 0.000000},
|
||||
"quoteleft": {GlyphName: "quoteleft", Wx: 333.000000, Wy: 0.000000},
|
||||
"quoteright": {GlyphName: "quoteright", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesinglbase": {GlyphName: "quotesinglbase", Wx: 333.000000, Wy: 0.000000},
|
||||
"quotesingle": {GlyphName: "quotesingle", Wx: 180.000000, Wy: 0.000000},
|
||||
"r": {GlyphName: "r", Wx: 333.000000, Wy: 0.000000},
|
||||
"racute": {GlyphName: "racute", Wx: 333.000000, Wy: 0.000000},
|
||||
"radical": {GlyphName: "radical", Wx: 453.000000, Wy: 0.000000},
|
||||
"rcaron": {GlyphName: "rcaron", Wx: 333.000000, Wy: 0.000000},
|
||||
"rcommaaccent": {GlyphName: "rcommaaccent", Wx: 333.000000, Wy: 0.000000},
|
||||
"registered": {GlyphName: "registered", Wx: 760.000000, Wy: 0.000000},
|
||||
"ring": {GlyphName: "ring", Wx: 333.000000, Wy: 0.000000},
|
||||
"s": {GlyphName: "s", Wx: 389.000000, Wy: 0.000000},
|
||||
"sacute": {GlyphName: "sacute", Wx: 389.000000, Wy: 0.000000},
|
||||
"scaron": {GlyphName: "scaron", Wx: 389.000000, Wy: 0.000000},
|
||||
"scedilla": {GlyphName: "scedilla", Wx: 389.000000, Wy: 0.000000},
|
||||
"scommaaccent": {GlyphName: "scommaaccent", Wx: 389.000000, Wy: 0.000000},
|
||||
"section": {GlyphName: "section", Wx: 500.000000, Wy: 0.000000},
|
||||
"semicolon": {GlyphName: "semicolon", Wx: 278.000000, Wy: 0.000000},
|
||||
"seven": {GlyphName: "seven", Wx: 500.000000, Wy: 0.000000},
|
||||
"six": {GlyphName: "six", Wx: 500.000000, Wy: 0.000000},
|
||||
"slash": {GlyphName: "slash", Wx: 278.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 250.000000, Wy: 0.000000},
|
||||
"sterling": {GlyphName: "sterling", Wx: 500.000000, Wy: 0.000000},
|
||||
"summation": {GlyphName: "summation", Wx: 600.000000, Wy: 0.000000},
|
||||
"t": {GlyphName: "t", Wx: 278.000000, Wy: 0.000000},
|
||||
"tcaron": {GlyphName: "tcaron", Wx: 326.000000, Wy: 0.000000},
|
||||
"tcommaaccent": {GlyphName: "tcommaaccent", Wx: 278.000000, Wy: 0.000000},
|
||||
"thorn": {GlyphName: "thorn", Wx: 500.000000, Wy: 0.000000},
|
||||
"three": {GlyphName: "three", Wx: 500.000000, Wy: 0.000000},
|
||||
"threequarters": {GlyphName: "threequarters", Wx: 750.000000, Wy: 0.000000},
|
||||
"threesuperior": {GlyphName: "threesuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"tilde": {GlyphName: "tilde", Wx: 333.000000, Wy: 0.000000},
|
||||
"trademark": {GlyphName: "trademark", Wx: 980.000000, Wy: 0.000000},
|
||||
"two": {GlyphName: "two", Wx: 500.000000, Wy: 0.000000},
|
||||
"twosuperior": {GlyphName: "twosuperior", Wx: 300.000000, Wy: 0.000000},
|
||||
"u": {GlyphName: "u", Wx: 500.000000, Wy: 0.000000},
|
||||
"uacute": {GlyphName: "uacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ucircumflex": {GlyphName: "ucircumflex", Wx: 500.000000, Wy: 0.000000},
|
||||
"udieresis": {GlyphName: "udieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"ugrave": {GlyphName: "ugrave", Wx: 500.000000, Wy: 0.000000},
|
||||
"uhungarumlaut": {GlyphName: "uhungarumlaut", Wx: 500.000000, Wy: 0.000000},
|
||||
"umacron": {GlyphName: "umacron", Wx: 500.000000, Wy: 0.000000},
|
||||
"underscore": {GlyphName: "underscore", Wx: 500.000000, Wy: 0.000000},
|
||||
"uogonek": {GlyphName: "uogonek", Wx: 500.000000, Wy: 0.000000},
|
||||
"uring": {GlyphName: "uring", Wx: 500.000000, Wy: 0.000000},
|
||||
"v": {GlyphName: "v", Wx: 500.000000, Wy: 0.000000},
|
||||
"w": {GlyphName: "w", Wx: 722.000000, Wy: 0.000000},
|
||||
"x": {GlyphName: "x", Wx: 500.000000, Wy: 0.000000},
|
||||
"y": {GlyphName: "y", Wx: 500.000000, Wy: 0.000000},
|
||||
"yacute": {GlyphName: "yacute", Wx: 500.000000, Wy: 0.000000},
|
||||
"ydieresis": {GlyphName: "ydieresis", Wx: 500.000000, Wy: 0.000000},
|
||||
"yen": {GlyphName: "yen", Wx: 500.000000, Wy: 0.000000},
|
||||
"z": {GlyphName: "z", Wx: 444.000000, Wy: 0.000000},
|
||||
"zacute": {GlyphName: "zacute", Wx: 444.000000, Wy: 0.000000},
|
||||
"zcaron": {GlyphName: "zcaron", Wx: 444.000000, Wy: 0.000000},
|
||||
"zdotaccent": {GlyphName: "zdotaccent", Wx: 444.000000, Wy: 0.000000},
|
||||
"zero": {GlyphName: "zero", Wx: 500.000000, Wy: 0.000000},
|
||||
}
|
||||
374
internal/pdf/model/fonts/ttfparser.go
Normal file
374
internal/pdf/model/fonts/ttfparser.go
Normal file
@@ -0,0 +1,374 @@
|
||||
/*
|
||||
* Copyright (c) 2013 Kurt Jung (Gmail: kurt.w.jung)
|
||||
*
|
||||
* Permission to use, copy, modify, and distribute this software for any
|
||||
* purpose with or without fee is hereby granted, provided that the above
|
||||
* copyright notice and this permission notice appear in all copies.
|
||||
*
|
||||
* THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
|
||||
* WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
|
||||
* MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
|
||||
* ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
|
||||
* WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
|
||||
* ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
|
||||
* OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
|
||||
*/
|
||||
|
||||
package fonts
|
||||
|
||||
// Utility to parse TTF font files
|
||||
// Version: 1.0
|
||||
// Date: 2011-06-18
|
||||
// Author: Olivier PLATHEY
|
||||
// Port to Go: Kurt Jung, 2013-07-15
|
||||
|
||||
import (
|
||||
"encoding/binary"
|
||||
"fmt"
|
||||
"os"
|
||||
"regexp"
|
||||
"strings"
|
||||
)
|
||||
|
||||
// TtfType contains metrics of a TrueType font.
|
||||
type TtfType struct {
|
||||
Embeddable bool
|
||||
UnitsPerEm uint16
|
||||
PostScriptName string
|
||||
Bold bool
|
||||
ItalicAngle int16
|
||||
IsFixedPitch bool
|
||||
TypoAscender int16
|
||||
TypoDescender int16
|
||||
UnderlinePosition int16
|
||||
UnderlineThickness int16
|
||||
Xmin, Ymin, Xmax, Ymax int16
|
||||
CapHeight int16
|
||||
Widths []uint16
|
||||
Chars map[uint16]uint16
|
||||
}
|
||||
|
||||
type ttfParser struct {
|
||||
rec TtfType
|
||||
f *os.File
|
||||
tables map[string]uint32
|
||||
numberOfHMetrics uint16
|
||||
numGlyphs uint16
|
||||
}
|
||||
|
||||
// TtfParse extracts various metrics from a TrueType font file.
|
||||
func TtfParse(fileStr string) (TtfRec TtfType, err error) {
|
||||
var t ttfParser
|
||||
t.f, err = os.Open(fileStr)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
version, err := t.ReadStr(4)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
if version == "OTTO" {
|
||||
err = fmt.Errorf("fonts based on PostScript outlines are not supported")
|
||||
return
|
||||
}
|
||||
if version != "\x00\x01\x00\x00" {
|
||||
err = fmt.Errorf("unrecognized file format")
|
||||
return
|
||||
}
|
||||
numTables := int(t.ReadUShort())
|
||||
t.Skip(3 * 2) // searchRange, entrySelector, rangeShift
|
||||
t.tables = make(map[string]uint32)
|
||||
var tag string
|
||||
for j := 0; j < numTables; j++ {
|
||||
tag, err = t.ReadStr(4)
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
t.Skip(4) // checkSum
|
||||
offset := t.ReadULong()
|
||||
t.Skip(4) // length
|
||||
t.tables[tag] = offset
|
||||
}
|
||||
err = t.ParseComponents()
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
t.f.Close()
|
||||
TtfRec = t.rec
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseComponents() (err error) {
|
||||
err = t.ParseHead()
|
||||
if err == nil {
|
||||
err = t.ParseHhea()
|
||||
if err == nil {
|
||||
err = t.ParseMaxp()
|
||||
if err == nil {
|
||||
err = t.ParseHmtx()
|
||||
if err == nil {
|
||||
err = t.ParseCmap()
|
||||
if err == nil {
|
||||
err = t.ParseName()
|
||||
if err == nil {
|
||||
err = t.ParseOS2()
|
||||
if err == nil {
|
||||
err = t.ParsePost()
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseHead() (err error) {
|
||||
err = t.Seek("head")
|
||||
t.Skip(3 * 4) // version, fontRevision, checkSumAdjustment
|
||||
magicNumber := t.ReadULong()
|
||||
if magicNumber != 0x5F0F3CF5 {
|
||||
err = fmt.Errorf("incorrect magic number")
|
||||
return
|
||||
}
|
||||
t.Skip(2) // flags
|
||||
t.rec.UnitsPerEm = t.ReadUShort()
|
||||
t.Skip(2 * 8) // created, modified
|
||||
t.rec.Xmin = t.ReadShort()
|
||||
t.rec.Ymin = t.ReadShort()
|
||||
t.rec.Xmax = t.ReadShort()
|
||||
t.rec.Ymax = t.ReadShort()
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseHhea() (err error) {
|
||||
err = t.Seek("hhea")
|
||||
if err == nil {
|
||||
t.Skip(4 + 15*2)
|
||||
t.numberOfHMetrics = t.ReadUShort()
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseMaxp() (err error) {
|
||||
err = t.Seek("maxp")
|
||||
if err == nil {
|
||||
t.Skip(4)
|
||||
t.numGlyphs = t.ReadUShort()
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseHmtx() (err error) {
|
||||
err = t.Seek("hmtx")
|
||||
if err == nil {
|
||||
t.rec.Widths = make([]uint16, 0, 8)
|
||||
for j := uint16(0); j < t.numberOfHMetrics; j++ {
|
||||
t.rec.Widths = append(t.rec.Widths, t.ReadUShort())
|
||||
t.Skip(2) // lsb
|
||||
}
|
||||
if t.numberOfHMetrics < t.numGlyphs {
|
||||
lastWidth := t.rec.Widths[t.numberOfHMetrics-1]
|
||||
for j := t.numberOfHMetrics; j < t.numGlyphs; j++ {
|
||||
t.rec.Widths = append(t.rec.Widths, lastWidth)
|
||||
}
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseCmap() (err error) {
|
||||
var offset int64
|
||||
if err = t.Seek("cmap"); err != nil {
|
||||
return
|
||||
}
|
||||
t.Skip(2) // version
|
||||
numTables := int(t.ReadUShort())
|
||||
offset31 := int64(0)
|
||||
for j := 0; j < numTables; j++ {
|
||||
platformID := t.ReadUShort()
|
||||
encodingID := t.ReadUShort()
|
||||
offset = int64(t.ReadULong())
|
||||
if platformID == 3 && encodingID == 1 {
|
||||
offset31 = offset
|
||||
}
|
||||
}
|
||||
if offset31 == 0 {
|
||||
err = fmt.Errorf("no Unicode encoding found")
|
||||
return
|
||||
}
|
||||
startCount := make([]uint16, 0, 8)
|
||||
endCount := make([]uint16, 0, 8)
|
||||
idDelta := make([]int16, 0, 8)
|
||||
idRangeOffset := make([]uint16, 0, 8)
|
||||
t.rec.Chars = make(map[uint16]uint16)
|
||||
t.f.Seek(int64(t.tables["cmap"])+offset31, os.SEEK_SET)
|
||||
format := t.ReadUShort()
|
||||
if format != 4 {
|
||||
err = fmt.Errorf("unexpected subtable format: %d", format)
|
||||
return
|
||||
}
|
||||
t.Skip(2 * 2) // length, language
|
||||
segCount := int(t.ReadUShort() / 2)
|
||||
t.Skip(3 * 2) // searchRange, entrySelector, rangeShift
|
||||
for j := 0; j < segCount; j++ {
|
||||
endCount = append(endCount, t.ReadUShort())
|
||||
}
|
||||
t.Skip(2) // reservedPad
|
||||
for j := 0; j < segCount; j++ {
|
||||
startCount = append(startCount, t.ReadUShort())
|
||||
}
|
||||
for j := 0; j < segCount; j++ {
|
||||
idDelta = append(idDelta, t.ReadShort())
|
||||
}
|
||||
offset, _ = t.f.Seek(int64(0), os.SEEK_CUR)
|
||||
for j := 0; j < segCount; j++ {
|
||||
idRangeOffset = append(idRangeOffset, t.ReadUShort())
|
||||
}
|
||||
for j := 0; j < segCount; j++ {
|
||||
c1 := startCount[j]
|
||||
c2 := endCount[j]
|
||||
d := idDelta[j]
|
||||
ro := idRangeOffset[j]
|
||||
if ro > 0 {
|
||||
t.f.Seek(offset+2*int64(j)+int64(ro), os.SEEK_SET)
|
||||
}
|
||||
for c := c1; c <= c2; c++ {
|
||||
if c == 0xFFFF {
|
||||
break
|
||||
}
|
||||
var gid int32
|
||||
if ro > 0 {
|
||||
gid = int32(t.ReadUShort())
|
||||
if gid > 0 {
|
||||
gid += int32(d)
|
||||
}
|
||||
} else {
|
||||
gid = int32(c) + int32(d)
|
||||
}
|
||||
if gid >= 65536 {
|
||||
gid -= 65536
|
||||
}
|
||||
if gid > 0 {
|
||||
t.rec.Chars[c] = uint16(gid)
|
||||
}
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseName() (err error) {
|
||||
err = t.Seek("name")
|
||||
if err == nil {
|
||||
tableOffset, _ := t.f.Seek(0, os.SEEK_CUR)
|
||||
t.rec.PostScriptName = ""
|
||||
t.Skip(2) // format
|
||||
count := t.ReadUShort()
|
||||
stringOffset := t.ReadUShort()
|
||||
for j := uint16(0); j < count && t.rec.PostScriptName == ""; j++ {
|
||||
t.Skip(3 * 2) // platformID, encodingID, languageID
|
||||
nameID := t.ReadUShort()
|
||||
length := t.ReadUShort()
|
||||
offset := t.ReadUShort()
|
||||
if nameID == 6 {
|
||||
// PostScript name
|
||||
t.f.Seek(int64(tableOffset)+int64(stringOffset)+int64(offset), os.SEEK_SET)
|
||||
var s string
|
||||
s, err = t.ReadStr(int(length))
|
||||
if err != nil {
|
||||
return
|
||||
}
|
||||
s = strings.Replace(s, "\x00", "", -1)
|
||||
var re *regexp.Regexp
|
||||
if re, err = regexp.Compile("[(){}<> /%[\\]]"); err != nil {
|
||||
return
|
||||
}
|
||||
t.rec.PostScriptName = re.ReplaceAllString(s, "")
|
||||
}
|
||||
}
|
||||
if t.rec.PostScriptName == "" {
|
||||
err = fmt.Errorf("the name PostScript was not found")
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParseOS2() (err error) {
|
||||
err = t.Seek("OS/2")
|
||||
if err == nil {
|
||||
version := t.ReadUShort()
|
||||
t.Skip(3 * 2) // xAvgCharWidth, usWeightClass, usWidthClass
|
||||
fsType := t.ReadUShort()
|
||||
t.rec.Embeddable = (fsType != 2) && (fsType&0x200) == 0
|
||||
t.Skip(11*2 + 10 + 4*4 + 4)
|
||||
fsSelection := t.ReadUShort()
|
||||
t.rec.Bold = (fsSelection & 32) != 0
|
||||
t.Skip(2 * 2) // usFirstCharIndex, usLastCharIndex
|
||||
t.rec.TypoAscender = t.ReadShort()
|
||||
t.rec.TypoDescender = t.ReadShort()
|
||||
if version >= 2 {
|
||||
t.Skip(3*2 + 2*4 + 2)
|
||||
t.rec.CapHeight = t.ReadShort()
|
||||
} else {
|
||||
t.rec.CapHeight = 0
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ParsePost() (err error) {
|
||||
err = t.Seek("post")
|
||||
if err == nil {
|
||||
t.Skip(4) // version
|
||||
t.rec.ItalicAngle = t.ReadShort()
|
||||
t.Skip(2) // Skip decimal part
|
||||
t.rec.UnderlinePosition = t.ReadShort()
|
||||
t.rec.UnderlineThickness = t.ReadShort()
|
||||
t.rec.IsFixedPitch = t.ReadULong() != 0
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) Seek(tag string) (err error) {
|
||||
ofs, ok := t.tables[tag]
|
||||
if ok {
|
||||
t.f.Seek(int64(ofs), os.SEEK_SET)
|
||||
} else {
|
||||
err = fmt.Errorf("table not found: %s", tag)
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) Skip(n int) {
|
||||
t.f.Seek(int64(n), os.SEEK_CUR)
|
||||
}
|
||||
|
||||
func (t *ttfParser) ReadStr(length int) (str string, err error) {
|
||||
var n int
|
||||
buf := make([]byte, length)
|
||||
n, err = t.f.Read(buf)
|
||||
if err == nil {
|
||||
if n == length {
|
||||
str = string(buf)
|
||||
} else {
|
||||
err = fmt.Errorf("unable to read %d bytes", length)
|
||||
}
|
||||
}
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ReadUShort() (val uint16) {
|
||||
binary.Read(t.f, binary.BigEndian, &val)
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ReadShort() (val int16) {
|
||||
binary.Read(t.f, binary.BigEndian, &val)
|
||||
return
|
||||
}
|
||||
|
||||
func (t *ttfParser) ReadULong() (val uint32) {
|
||||
binary.Read(t.f, binary.BigEndian, &val)
|
||||
return
|
||||
}
|
||||
251
internal/pdf/model/fonts/zapfdingbats.go
Normal file
251
internal/pdf/model/fonts/zapfdingbats.go
Normal file
@@ -0,0 +1,251 @@
|
||||
package fonts
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/textencoding"
|
||||
)
|
||||
|
||||
// Font ZapfDingbats. Implements Font interface.
|
||||
// This is a built-in font and it is assumed that every reader has access to it.
|
||||
type fontZapfDingbats struct {
|
||||
// By default encoder is not set, which means that we use the font's built in encoding.
|
||||
encoder textencoding.TextEncoder
|
||||
}
|
||||
|
||||
func NewFontZapfDingbats() fontZapfDingbats {
|
||||
font := fontZapfDingbats{}
|
||||
return font
|
||||
}
|
||||
|
||||
func (font fontZapfDingbats) SetEncoder(encoder textencoding.TextEncoder) {
|
||||
font.encoder = encoder
|
||||
}
|
||||
|
||||
func (font fontZapfDingbats) GetGlyphCharMetrics(glyph string) (CharMetrics, bool) {
|
||||
metrics, has := zapfDingbatsCharMetrics[glyph]
|
||||
if !has {
|
||||
return metrics, false
|
||||
}
|
||||
|
||||
return metrics, true
|
||||
}
|
||||
|
||||
func (font fontZapfDingbats) ToPdfObject() core.PdfObject {
|
||||
obj := &core.PdfIndirectObject{}
|
||||
|
||||
fontDict := core.MakeDict()
|
||||
fontDict.Set("Type", core.MakeName("Font"))
|
||||
fontDict.Set("Subtype", core.MakeName("Type1"))
|
||||
fontDict.Set("BaseFont", core.MakeName("ZapfDingbats"))
|
||||
if font.encoder != nil {
|
||||
fontDict.Set("Encoding", font.encoder.ToPdfObject())
|
||||
}
|
||||
|
||||
obj.PdfObject = fontDict
|
||||
return obj
|
||||
}
|
||||
|
||||
var zapfDingbatsCharMetrics map[string]CharMetrics = map[string]CharMetrics{
|
||||
"a1": {GlyphName: "a1", Wx: 974.000000, Wy: 0.000000},
|
||||
"a10": {GlyphName: "a10", Wx: 692.000000, Wy: 0.000000},
|
||||
"a100": {GlyphName: "a100", Wx: 668.000000, Wy: 0.000000},
|
||||
"a101": {GlyphName: "a101", Wx: 732.000000, Wy: 0.000000},
|
||||
"a102": {GlyphName: "a102", Wx: 544.000000, Wy: 0.000000},
|
||||
"a103": {GlyphName: "a103", Wx: 544.000000, Wy: 0.000000},
|
||||
"a104": {GlyphName: "a104", Wx: 910.000000, Wy: 0.000000},
|
||||
"a105": {GlyphName: "a105", Wx: 911.000000, Wy: 0.000000},
|
||||
"a106": {GlyphName: "a106", Wx: 667.000000, Wy: 0.000000},
|
||||
"a107": {GlyphName: "a107", Wx: 760.000000, Wy: 0.000000},
|
||||
"a108": {GlyphName: "a108", Wx: 760.000000, Wy: 0.000000},
|
||||
"a109": {GlyphName: "a109", Wx: 626.000000, Wy: 0.000000},
|
||||
"a11": {GlyphName: "a11", Wx: 960.000000, Wy: 0.000000},
|
||||
"a110": {GlyphName: "a110", Wx: 694.000000, Wy: 0.000000},
|
||||
"a111": {GlyphName: "a111", Wx: 595.000000, Wy: 0.000000},
|
||||
"a112": {GlyphName: "a112", Wx: 776.000000, Wy: 0.000000},
|
||||
"a117": {GlyphName: "a117", Wx: 690.000000, Wy: 0.000000},
|
||||
"a118": {GlyphName: "a118", Wx: 791.000000, Wy: 0.000000},
|
||||
"a119": {GlyphName: "a119", Wx: 790.000000, Wy: 0.000000},
|
||||
"a12": {GlyphName: "a12", Wx: 939.000000, Wy: 0.000000},
|
||||
"a120": {GlyphName: "a120", Wx: 788.000000, Wy: 0.000000},
|
||||
"a121": {GlyphName: "a121", Wx: 788.000000, Wy: 0.000000},
|
||||
"a122": {GlyphName: "a122", Wx: 788.000000, Wy: 0.000000},
|
||||
"a123": {GlyphName: "a123", Wx: 788.000000, Wy: 0.000000},
|
||||
"a124": {GlyphName: "a124", Wx: 788.000000, Wy: 0.000000},
|
||||
"a125": {GlyphName: "a125", Wx: 788.000000, Wy: 0.000000},
|
||||
"a126": {GlyphName: "a126", Wx: 788.000000, Wy: 0.000000},
|
||||
"a127": {GlyphName: "a127", Wx: 788.000000, Wy: 0.000000},
|
||||
"a128": {GlyphName: "a128", Wx: 788.000000, Wy: 0.000000},
|
||||
"a129": {GlyphName: "a129", Wx: 788.000000, Wy: 0.000000},
|
||||
"a13": {GlyphName: "a13", Wx: 549.000000, Wy: 0.000000},
|
||||
"a130": {GlyphName: "a130", Wx: 788.000000, Wy: 0.000000},
|
||||
"a131": {GlyphName: "a131", Wx: 788.000000, Wy: 0.000000},
|
||||
"a132": {GlyphName: "a132", Wx: 788.000000, Wy: 0.000000},
|
||||
"a133": {GlyphName: "a133", Wx: 788.000000, Wy: 0.000000},
|
||||
"a134": {GlyphName: "a134", Wx: 788.000000, Wy: 0.000000},
|
||||
"a135": {GlyphName: "a135", Wx: 788.000000, Wy: 0.000000},
|
||||
"a136": {GlyphName: "a136", Wx: 788.000000, Wy: 0.000000},
|
||||
"a137": {GlyphName: "a137", Wx: 788.000000, Wy: 0.000000},
|
||||
"a138": {GlyphName: "a138", Wx: 788.000000, Wy: 0.000000},
|
||||
"a139": {GlyphName: "a139", Wx: 788.000000, Wy: 0.000000},
|
||||
"a14": {GlyphName: "a14", Wx: 855.000000, Wy: 0.000000},
|
||||
"a140": {GlyphName: "a140", Wx: 788.000000, Wy: 0.000000},
|
||||
"a141": {GlyphName: "a141", Wx: 788.000000, Wy: 0.000000},
|
||||
"a142": {GlyphName: "a142", Wx: 788.000000, Wy: 0.000000},
|
||||
"a143": {GlyphName: "a143", Wx: 788.000000, Wy: 0.000000},
|
||||
"a144": {GlyphName: "a144", Wx: 788.000000, Wy: 0.000000},
|
||||
"a145": {GlyphName: "a145", Wx: 788.000000, Wy: 0.000000},
|
||||
"a146": {GlyphName: "a146", Wx: 788.000000, Wy: 0.000000},
|
||||
"a147": {GlyphName: "a147", Wx: 788.000000, Wy: 0.000000},
|
||||
"a148": {GlyphName: "a148", Wx: 788.000000, Wy: 0.000000},
|
||||
"a149": {GlyphName: "a149", Wx: 788.000000, Wy: 0.000000},
|
||||
"a15": {GlyphName: "a15", Wx: 911.000000, Wy: 0.000000},
|
||||
"a150": {GlyphName: "a150", Wx: 788.000000, Wy: 0.000000},
|
||||
"a151": {GlyphName: "a151", Wx: 788.000000, Wy: 0.000000},
|
||||
"a152": {GlyphName: "a152", Wx: 788.000000, Wy: 0.000000},
|
||||
"a153": {GlyphName: "a153", Wx: 788.000000, Wy: 0.000000},
|
||||
"a154": {GlyphName: "a154", Wx: 788.000000, Wy: 0.000000},
|
||||
"a155": {GlyphName: "a155", Wx: 788.000000, Wy: 0.000000},
|
||||
"a156": {GlyphName: "a156", Wx: 788.000000, Wy: 0.000000},
|
||||
"a157": {GlyphName: "a157", Wx: 788.000000, Wy: 0.000000},
|
||||
"a158": {GlyphName: "a158", Wx: 788.000000, Wy: 0.000000},
|
||||
"a159": {GlyphName: "a159", Wx: 788.000000, Wy: 0.000000},
|
||||
"a16": {GlyphName: "a16", Wx: 933.000000, Wy: 0.000000},
|
||||
"a160": {GlyphName: "a160", Wx: 894.000000, Wy: 0.000000},
|
||||
"a161": {GlyphName: "a161", Wx: 838.000000, Wy: 0.000000},
|
||||
"a162": {GlyphName: "a162", Wx: 924.000000, Wy: 0.000000},
|
||||
"a163": {GlyphName: "a163", Wx: 1016.000000, Wy: 0.000000},
|
||||
"a164": {GlyphName: "a164", Wx: 458.000000, Wy: 0.000000},
|
||||
"a165": {GlyphName: "a165", Wx: 924.000000, Wy: 0.000000},
|
||||
"a166": {GlyphName: "a166", Wx: 918.000000, Wy: 0.000000},
|
||||
"a167": {GlyphName: "a167", Wx: 927.000000, Wy: 0.000000},
|
||||
"a168": {GlyphName: "a168", Wx: 928.000000, Wy: 0.000000},
|
||||
"a169": {GlyphName: "a169", Wx: 928.000000, Wy: 0.000000},
|
||||
"a17": {GlyphName: "a17", Wx: 945.000000, Wy: 0.000000},
|
||||
"a170": {GlyphName: "a170", Wx: 834.000000, Wy: 0.000000},
|
||||
"a171": {GlyphName: "a171", Wx: 873.000000, Wy: 0.000000},
|
||||
"a172": {GlyphName: "a172", Wx: 828.000000, Wy: 0.000000},
|
||||
"a173": {GlyphName: "a173", Wx: 924.000000, Wy: 0.000000},
|
||||
"a174": {GlyphName: "a174", Wx: 917.000000, Wy: 0.000000},
|
||||
"a175": {GlyphName: "a175", Wx: 930.000000, Wy: 0.000000},
|
||||
"a176": {GlyphName: "a176", Wx: 931.000000, Wy: 0.000000},
|
||||
"a177": {GlyphName: "a177", Wx: 463.000000, Wy: 0.000000},
|
||||
"a178": {GlyphName: "a178", Wx: 883.000000, Wy: 0.000000},
|
||||
"a179": {GlyphName: "a179", Wx: 836.000000, Wy: 0.000000},
|
||||
"a18": {GlyphName: "a18", Wx: 974.000000, Wy: 0.000000},
|
||||
"a180": {GlyphName: "a180", Wx: 867.000000, Wy: 0.000000},
|
||||
"a181": {GlyphName: "a181", Wx: 696.000000, Wy: 0.000000},
|
||||
"a182": {GlyphName: "a182", Wx: 874.000000, Wy: 0.000000},
|
||||
"a183": {GlyphName: "a183", Wx: 760.000000, Wy: 0.000000},
|
||||
"a184": {GlyphName: "a184", Wx: 946.000000, Wy: 0.000000},
|
||||
"a185": {GlyphName: "a185", Wx: 865.000000, Wy: 0.000000},
|
||||
"a186": {GlyphName: "a186", Wx: 967.000000, Wy: 0.000000},
|
||||
"a187": {GlyphName: "a187", Wx: 831.000000, Wy: 0.000000},
|
||||
"a188": {GlyphName: "a188", Wx: 873.000000, Wy: 0.000000},
|
||||
"a189": {GlyphName: "a189", Wx: 927.000000, Wy: 0.000000},
|
||||
"a19": {GlyphName: "a19", Wx: 755.000000, Wy: 0.000000},
|
||||
"a190": {GlyphName: "a190", Wx: 970.000000, Wy: 0.000000},
|
||||
"a191": {GlyphName: "a191", Wx: 918.000000, Wy: 0.000000},
|
||||
"a192": {GlyphName: "a192", Wx: 748.000000, Wy: 0.000000},
|
||||
"a193": {GlyphName: "a193", Wx: 836.000000, Wy: 0.000000},
|
||||
"a194": {GlyphName: "a194", Wx: 771.000000, Wy: 0.000000},
|
||||
"a195": {GlyphName: "a195", Wx: 888.000000, Wy: 0.000000},
|
||||
"a196": {GlyphName: "a196", Wx: 748.000000, Wy: 0.000000},
|
||||
"a197": {GlyphName: "a197", Wx: 771.000000, Wy: 0.000000},
|
||||
"a198": {GlyphName: "a198", Wx: 888.000000, Wy: 0.000000},
|
||||
"a199": {GlyphName: "a199", Wx: 867.000000, Wy: 0.000000},
|
||||
"a2": {GlyphName: "a2", Wx: 961.000000, Wy: 0.000000},
|
||||
"a20": {GlyphName: "a20", Wx: 846.000000, Wy: 0.000000},
|
||||
"a200": {GlyphName: "a200", Wx: 696.000000, Wy: 0.000000},
|
||||
"a201": {GlyphName: "a201", Wx: 874.000000, Wy: 0.000000},
|
||||
"a202": {GlyphName: "a202", Wx: 974.000000, Wy: 0.000000},
|
||||
"a203": {GlyphName: "a203", Wx: 762.000000, Wy: 0.000000},
|
||||
"a204": {GlyphName: "a204", Wx: 759.000000, Wy: 0.000000},
|
||||
"a205": {GlyphName: "a205", Wx: 509.000000, Wy: 0.000000},
|
||||
"a206": {GlyphName: "a206", Wx: 410.000000, Wy: 0.000000},
|
||||
"a21": {GlyphName: "a21", Wx: 762.000000, Wy: 0.000000},
|
||||
"a22": {GlyphName: "a22", Wx: 761.000000, Wy: 0.000000},
|
||||
"a23": {GlyphName: "a23", Wx: 571.000000, Wy: 0.000000},
|
||||
"a24": {GlyphName: "a24", Wx: 677.000000, Wy: 0.000000},
|
||||
"a25": {GlyphName: "a25", Wx: 763.000000, Wy: 0.000000},
|
||||
"a26": {GlyphName: "a26", Wx: 760.000000, Wy: 0.000000},
|
||||
"a27": {GlyphName: "a27", Wx: 759.000000, Wy: 0.000000},
|
||||
"a28": {GlyphName: "a28", Wx: 754.000000, Wy: 0.000000},
|
||||
"a29": {GlyphName: "a29", Wx: 786.000000, Wy: 0.000000},
|
||||
"a3": {GlyphName: "a3", Wx: 980.000000, Wy: 0.000000},
|
||||
"a30": {GlyphName: "a30", Wx: 788.000000, Wy: 0.000000},
|
||||
"a31": {GlyphName: "a31", Wx: 788.000000, Wy: 0.000000},
|
||||
"a32": {GlyphName: "a32", Wx: 790.000000, Wy: 0.000000},
|
||||
"a33": {GlyphName: "a33", Wx: 793.000000, Wy: 0.000000},
|
||||
"a34": {GlyphName: "a34", Wx: 794.000000, Wy: 0.000000},
|
||||
"a35": {GlyphName: "a35", Wx: 816.000000, Wy: 0.000000},
|
||||
"a36": {GlyphName: "a36", Wx: 823.000000, Wy: 0.000000},
|
||||
"a37": {GlyphName: "a37", Wx: 789.000000, Wy: 0.000000},
|
||||
"a38": {GlyphName: "a38", Wx: 841.000000, Wy: 0.000000},
|
||||
"a39": {GlyphName: "a39", Wx: 823.000000, Wy: 0.000000},
|
||||
"a4": {GlyphName: "a4", Wx: 719.000000, Wy: 0.000000},
|
||||
"a40": {GlyphName: "a40", Wx: 833.000000, Wy: 0.000000},
|
||||
"a41": {GlyphName: "a41", Wx: 816.000000, Wy: 0.000000},
|
||||
"a42": {GlyphName: "a42", Wx: 831.000000, Wy: 0.000000},
|
||||
"a43": {GlyphName: "a43", Wx: 923.000000, Wy: 0.000000},
|
||||
"a44": {GlyphName: "a44", Wx: 744.000000, Wy: 0.000000},
|
||||
"a45": {GlyphName: "a45", Wx: 723.000000, Wy: 0.000000},
|
||||
"a46": {GlyphName: "a46", Wx: 749.000000, Wy: 0.000000},
|
||||
"a47": {GlyphName: "a47", Wx: 790.000000, Wy: 0.000000},
|
||||
"a48": {GlyphName: "a48", Wx: 792.000000, Wy: 0.000000},
|
||||
"a49": {GlyphName: "a49", Wx: 695.000000, Wy: 0.000000},
|
||||
"a5": {GlyphName: "a5", Wx: 789.000000, Wy: 0.000000},
|
||||
"a50": {GlyphName: "a50", Wx: 776.000000, Wy: 0.000000},
|
||||
"a51": {GlyphName: "a51", Wx: 768.000000, Wy: 0.000000},
|
||||
"a52": {GlyphName: "a52", Wx: 792.000000, Wy: 0.000000},
|
||||
"a53": {GlyphName: "a53", Wx: 759.000000, Wy: 0.000000},
|
||||
"a54": {GlyphName: "a54", Wx: 707.000000, Wy: 0.000000},
|
||||
"a55": {GlyphName: "a55", Wx: 708.000000, Wy: 0.000000},
|
||||
"a56": {GlyphName: "a56", Wx: 682.000000, Wy: 0.000000},
|
||||
"a57": {GlyphName: "a57", Wx: 701.000000, Wy: 0.000000},
|
||||
"a58": {GlyphName: "a58", Wx: 826.000000, Wy: 0.000000},
|
||||
"a59": {GlyphName: "a59", Wx: 815.000000, Wy: 0.000000},
|
||||
"a6": {GlyphName: "a6", Wx: 494.000000, Wy: 0.000000},
|
||||
"a60": {GlyphName: "a60", Wx: 789.000000, Wy: 0.000000},
|
||||
"a61": {GlyphName: "a61", Wx: 789.000000, Wy: 0.000000},
|
||||
"a62": {GlyphName: "a62", Wx: 707.000000, Wy: 0.000000},
|
||||
"a63": {GlyphName: "a63", Wx: 687.000000, Wy: 0.000000},
|
||||
"a64": {GlyphName: "a64", Wx: 696.000000, Wy: 0.000000},
|
||||
"a65": {GlyphName: "a65", Wx: 689.000000, Wy: 0.000000},
|
||||
"a66": {GlyphName: "a66", Wx: 786.000000, Wy: 0.000000},
|
||||
"a67": {GlyphName: "a67", Wx: 787.000000, Wy: 0.000000},
|
||||
"a68": {GlyphName: "a68", Wx: 713.000000, Wy: 0.000000},
|
||||
"a69": {GlyphName: "a69", Wx: 791.000000, Wy: 0.000000},
|
||||
"a7": {GlyphName: "a7", Wx: 552.000000, Wy: 0.000000},
|
||||
"a70": {GlyphName: "a70", Wx: 785.000000, Wy: 0.000000},
|
||||
"a71": {GlyphName: "a71", Wx: 791.000000, Wy: 0.000000},
|
||||
"a72": {GlyphName: "a72", Wx: 873.000000, Wy: 0.000000},
|
||||
"a73": {GlyphName: "a73", Wx: 761.000000, Wy: 0.000000},
|
||||
"a74": {GlyphName: "a74", Wx: 762.000000, Wy: 0.000000},
|
||||
"a75": {GlyphName: "a75", Wx: 759.000000, Wy: 0.000000},
|
||||
"a76": {GlyphName: "a76", Wx: 892.000000, Wy: 0.000000},
|
||||
"a77": {GlyphName: "a77", Wx: 892.000000, Wy: 0.000000},
|
||||
"a78": {GlyphName: "a78", Wx: 788.000000, Wy: 0.000000},
|
||||
"a79": {GlyphName: "a79", Wx: 784.000000, Wy: 0.000000},
|
||||
"a8": {GlyphName: "a8", Wx: 537.000000, Wy: 0.000000},
|
||||
"a81": {GlyphName: "a81", Wx: 438.000000, Wy: 0.000000},
|
||||
"a82": {GlyphName: "a82", Wx: 138.000000, Wy: 0.000000},
|
||||
"a83": {GlyphName: "a83", Wx: 277.000000, Wy: 0.000000},
|
||||
"a84": {GlyphName: "a84", Wx: 415.000000, Wy: 0.000000},
|
||||
"a85": {GlyphName: "a85", Wx: 509.000000, Wy: 0.000000},
|
||||
"a86": {GlyphName: "a86", Wx: 410.000000, Wy: 0.000000},
|
||||
"a87": {GlyphName: "a87", Wx: 234.000000, Wy: 0.000000},
|
||||
"a88": {GlyphName: "a88", Wx: 234.000000, Wy: 0.000000},
|
||||
"a89": {GlyphName: "a89", Wx: 390.000000, Wy: 0.000000},
|
||||
"a9": {GlyphName: "a9", Wx: 577.000000, Wy: 0.000000},
|
||||
"a90": {GlyphName: "a90", Wx: 390.000000, Wy: 0.000000},
|
||||
"a91": {GlyphName: "a91", Wx: 276.000000, Wy: 0.000000},
|
||||
"a92": {GlyphName: "a92", Wx: 276.000000, Wy: 0.000000},
|
||||
"a93": {GlyphName: "a93", Wx: 317.000000, Wy: 0.000000},
|
||||
"a94": {GlyphName: "a94", Wx: 317.000000, Wy: 0.000000},
|
||||
"a95": {GlyphName: "a95", Wx: 334.000000, Wy: 0.000000},
|
||||
"a96": {GlyphName: "a96", Wx: 334.000000, Wy: 0.000000},
|
||||
"a97": {GlyphName: "a97", Wx: 392.000000, Wy: 0.000000},
|
||||
"a98": {GlyphName: "a98", Wx: 392.000000, Wy: 0.000000},
|
||||
"a99": {GlyphName: "a99", Wx: 668.000000, Wy: 0.000000},
|
||||
"space": {GlyphName: "space", Wx: 278.000000, Wy: 0.000000},
|
||||
}
|
||||
412
internal/pdf/model/forms.go
Normal file
412
internal/pdf/model/forms.go
Normal file
@@ -0,0 +1,412 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// High level manipulation of forms (AcroForm).
|
||||
type PdfAcroForm struct {
|
||||
Fields *[]*PdfField
|
||||
NeedAppearances *core.PdfObjectBool
|
||||
SigFlags *core.PdfObjectInteger
|
||||
CO *core.PdfObjectArray
|
||||
DR *PdfPageResources
|
||||
DA *core.PdfObjectString
|
||||
Q *core.PdfObjectInteger
|
||||
XFA core.PdfObject
|
||||
|
||||
primitive *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
func NewPdfAcroForm() *PdfAcroForm {
|
||||
acroForm := &PdfAcroForm{}
|
||||
|
||||
container := &core.PdfIndirectObject{}
|
||||
container.PdfObject = core.MakeDict()
|
||||
|
||||
acroForm.primitive = container
|
||||
return acroForm
|
||||
}
|
||||
|
||||
// Used when loading forms from PDF files.
|
||||
func (r *PdfReader) newPdfAcroFormFromDict(d *core.PdfObjectDictionary) (*PdfAcroForm, error) {
|
||||
acroForm := NewPdfAcroForm()
|
||||
|
||||
if obj := d.Get("Fields"); obj != nil {
|
||||
obj, err := r.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fieldArray, ok := core.TraceToDirectObject(obj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("fields not an array (%T)", obj)
|
||||
}
|
||||
|
||||
fields := []*PdfField{}
|
||||
for _, obj := range *fieldArray {
|
||||
obj, err := r.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
container, isIndirect := obj.(*core.PdfIndirectObject)
|
||||
if !isIndirect {
|
||||
if _, isNull := obj.(*core.PdfObjectNull); isNull {
|
||||
common.Log.Trace("Skipping over null field")
|
||||
continue
|
||||
}
|
||||
common.Log.Debug("Field not contained in indirect object %T", obj)
|
||||
return nil, fmt.Errorf("field not in an indirect object")
|
||||
}
|
||||
field, err := r.newPdfFieldFromIndirectObject(container, nil)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
common.Log.Trace("AcroForm Field: %+v", *field)
|
||||
fields = append(fields, field)
|
||||
}
|
||||
acroForm.Fields = &fields
|
||||
}
|
||||
|
||||
if obj := d.Get("NeedAppearances"); obj != nil {
|
||||
val, ok := obj.(*core.PdfObjectBool)
|
||||
if ok {
|
||||
acroForm.NeedAppearances = val
|
||||
} else {
|
||||
common.Log.Debug("error: NeedAppearances invalid (got %T)", obj)
|
||||
}
|
||||
}
|
||||
|
||||
if obj := d.Get("SigFlags"); obj != nil {
|
||||
val, ok := obj.(*core.PdfObjectInteger)
|
||||
if ok {
|
||||
acroForm.SigFlags = val
|
||||
} else {
|
||||
common.Log.Debug("error: SigFlags invalid (got %T)", obj)
|
||||
}
|
||||
}
|
||||
|
||||
if obj := d.Get("CO"); obj != nil {
|
||||
obj = core.TraceToDirectObject(obj)
|
||||
arr, ok := obj.(*core.PdfObjectArray)
|
||||
if ok {
|
||||
acroForm.CO = arr
|
||||
} else {
|
||||
common.Log.Debug("error: CO invalid (got %T)", obj)
|
||||
}
|
||||
}
|
||||
|
||||
if obj := d.Get("DR"); obj != nil {
|
||||
obj = core.TraceToDirectObject(obj)
|
||||
if d, ok := obj.(*core.PdfObjectDictionary); ok {
|
||||
resources, err := NewPdfPageResourcesFromDict(d)
|
||||
if err != nil {
|
||||
common.Log.Error("invalid DR: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
acroForm.DR = resources
|
||||
} else {
|
||||
common.Log.Debug("error: DR invalid (got %T)", obj)
|
||||
}
|
||||
}
|
||||
|
||||
if obj := d.Get("DA"); obj != nil {
|
||||
str, ok := obj.(*core.PdfObjectString)
|
||||
if ok {
|
||||
acroForm.DA = str
|
||||
} else {
|
||||
common.Log.Debug("error: DA invalid (got %T)", obj)
|
||||
}
|
||||
}
|
||||
|
||||
if obj := d.Get("Q"); obj != nil {
|
||||
val, ok := obj.(*core.PdfObjectInteger)
|
||||
if ok {
|
||||
acroForm.Q = val
|
||||
} else {
|
||||
common.Log.Debug("error: Q invalid (got %T)", obj)
|
||||
}
|
||||
}
|
||||
|
||||
if obj := d.Get("XFA"); obj != nil {
|
||||
acroForm.XFA = obj
|
||||
}
|
||||
|
||||
return acroForm, nil
|
||||
}
|
||||
|
||||
func (af *PdfAcroForm) GetContainingPdfObject() core.PdfObject {
|
||||
return af.primitive
|
||||
}
|
||||
|
||||
func (af *PdfAcroForm) ToPdfObject() core.PdfObject {
|
||||
container := af.primitive
|
||||
dict := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
|
||||
if af.Fields != nil {
|
||||
arr := core.PdfObjectArray{}
|
||||
for _, field := range *af.Fields {
|
||||
arr = append(arr, field.ToPdfObject())
|
||||
}
|
||||
dict.Set("Fields", &arr)
|
||||
}
|
||||
|
||||
if af.NeedAppearances != nil {
|
||||
dict.Set("NeedAppearances", af.NeedAppearances)
|
||||
}
|
||||
if af.SigFlags != nil {
|
||||
dict.Set("SigFlags", af.SigFlags)
|
||||
|
||||
}
|
||||
if af.CO != nil {
|
||||
dict.Set("CO", af.CO)
|
||||
}
|
||||
if af.DR != nil {
|
||||
dict.Set("DR", af.DR.ToPdfObject())
|
||||
}
|
||||
if af.DA != nil {
|
||||
dict.Set("DA", af.DA)
|
||||
}
|
||||
if af.Q != nil {
|
||||
dict.Set("Q", af.Q)
|
||||
}
|
||||
if af.XFA != nil {
|
||||
dict.Set("XFA", af.XFA)
|
||||
}
|
||||
|
||||
return container
|
||||
}
|
||||
|
||||
// PdfField represents a field of an interactive form.
|
||||
// Implements PdfModel interface.
|
||||
type PdfField struct {
|
||||
FT *core.PdfObjectName // field type
|
||||
Parent *PdfField
|
||||
// In a non-terminal field, the Kids array shall refer to field dictionaries that are immediate descendants of this field.
|
||||
// In a terminal field, the Kids array ordinarily shall refer to one or more separate widget annotations that are associated
|
||||
// with this field. However, if there is only one associated widget annotation, and its contents have been merged into the field
|
||||
// dictionary, Kids shall be omitted.
|
||||
KidsF []PdfModel // Kids can be array of other fields or widgets (PdfModel).
|
||||
KidsA []*PdfAnnotation
|
||||
T core.PdfObject
|
||||
TU core.PdfObject
|
||||
TM core.PdfObject
|
||||
Ff core.PdfObject // field flag
|
||||
V core.PdfObject //value
|
||||
DV core.PdfObject
|
||||
AA core.PdfObject
|
||||
|
||||
// Variable Text:
|
||||
DA core.PdfObject
|
||||
Q core.PdfObject
|
||||
DS core.PdfObject
|
||||
RV core.PdfObject
|
||||
|
||||
primitive *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
func NewPdfField() *PdfField {
|
||||
field := &PdfField{}
|
||||
|
||||
container := &core.PdfIndirectObject{}
|
||||
container.PdfObject = core.MakeDict()
|
||||
|
||||
field.primitive = container
|
||||
return field
|
||||
}
|
||||
|
||||
// Used when loading fields from PDF files.
|
||||
func (r *PdfReader) newPdfFieldFromIndirectObject(container *core.PdfIndirectObject, parent *PdfField) (*PdfField, error) {
|
||||
d, isDict := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !isDict {
|
||||
return nil, fmt.Errorf("pdf Field indirect object not containing a dictionary")
|
||||
}
|
||||
|
||||
field := NewPdfField()
|
||||
|
||||
// Field type (required in terminal fields).
|
||||
// Can be /Btn /Tx /Ch /Sig
|
||||
// Required for a terminal field (inheritable).
|
||||
var err error
|
||||
if obj := d.Get("FT"); obj != nil {
|
||||
obj, err = r.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
name, ok := obj.(*core.PdfObjectName)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("invalid type of FT field (%T)", obj)
|
||||
}
|
||||
|
||||
field.FT = name
|
||||
}
|
||||
|
||||
// Partial field name (Optional)
|
||||
field.T = d.Get("T")
|
||||
// Alternate description (Optional)
|
||||
field.TU = d.Get("TU")
|
||||
// Mapping name (Optional)
|
||||
field.TM = d.Get("TM")
|
||||
// Field flag. (Optional; inheritable)
|
||||
field.Ff = d.Get("Ff")
|
||||
// Value (Optional; inheritable) - Various types depending on the field type.
|
||||
field.V = d.Get("V")
|
||||
// Default value for reset (Optional; inheritable)
|
||||
field.DV = d.Get("DV")
|
||||
// Additional actions dictionary (Optional)
|
||||
field.AA = d.Get("AA")
|
||||
|
||||
// Variable text:
|
||||
field.DA = d.Get("DA")
|
||||
field.Q = d.Get("Q")
|
||||
field.DS = d.Get("DS")
|
||||
field.RV = d.Get("RV")
|
||||
|
||||
// In a non-terminal field, the Kids array shall refer to field dictionaries that are immediate descendants of this field.
|
||||
// In a terminal field, the Kids array ordinarily shall refer to one or more separate widget annotations that are associated
|
||||
// with this field. However, if there is only one associated widget annotation, and its contents have been merged into the field
|
||||
// dictionary, Kids shall be omitted.
|
||||
|
||||
// Set ourself?
|
||||
if parent != nil {
|
||||
field.Parent = parent
|
||||
}
|
||||
|
||||
// Has a merged-in widget annotation?
|
||||
if obj := d.Get("Subtype"); obj != nil {
|
||||
obj, err = r.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
common.Log.Trace("Merged in annotation (%T)", obj)
|
||||
name, ok := obj.(*core.PdfObjectName)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("invalid type of Subtype (%T)", obj)
|
||||
}
|
||||
if *name == "Widget" {
|
||||
// Is a merged field / widget dict.
|
||||
|
||||
// Check if the annotation has already been loaded?
|
||||
// Most likely referenced to by a page... Could be in either direction.
|
||||
// r.newPdfAnnotationFromIndirectObject acts as a caching mechanism.
|
||||
annot, err := r.newPdfAnnotationFromIndirectObject(container)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
widget, ok := annot.GetContext().(*PdfAnnotationWidget)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("invalid widget")
|
||||
}
|
||||
|
||||
widget.Parent = field.GetContainingPdfObject()
|
||||
field.KidsA = append(field.KidsA, annot)
|
||||
return field, nil
|
||||
}
|
||||
}
|
||||
|
||||
if obj := d.Get("Kids"); obj != nil {
|
||||
obj, err := r.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fieldArray, ok := core.TraceToDirectObject(obj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("kids not an array (%T)", obj)
|
||||
}
|
||||
|
||||
field.KidsF = []PdfModel{}
|
||||
for _, obj := range *fieldArray {
|
||||
obj, err := r.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
container, isIndirect := obj.(*core.PdfIndirectObject)
|
||||
if !isIndirect {
|
||||
return nil, fmt.Errorf("not an indirect object (form field)")
|
||||
}
|
||||
|
||||
childField, err := r.newPdfFieldFromIndirectObject(container, field)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
field.KidsF = append(field.KidsF, childField)
|
||||
}
|
||||
}
|
||||
|
||||
return field, nil
|
||||
}
|
||||
|
||||
func (pf *PdfField) GetContainingPdfObject() core.PdfObject {
|
||||
return pf.primitive
|
||||
}
|
||||
|
||||
// If Kids refer only to a single pdf widget annotation widget, then can merge it in.
|
||||
// Currently not merging it in.
|
||||
func (pf *PdfField) ToPdfObject() core.PdfObject {
|
||||
container := pf.primitive
|
||||
dict := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
|
||||
if pf.Parent != nil {
|
||||
dict.Set("Parent", pf.Parent.GetContainingPdfObject())
|
||||
}
|
||||
|
||||
if pf.KidsF != nil {
|
||||
// Create an array of the kids (fields or widgets).
|
||||
common.Log.Trace("KidsF: %+v", pf.KidsF)
|
||||
arr := core.PdfObjectArray{}
|
||||
for _, child := range pf.KidsF {
|
||||
arr = append(arr, child.ToPdfObject())
|
||||
}
|
||||
dict.Set("Kids", &arr)
|
||||
}
|
||||
if pf.KidsA != nil {
|
||||
common.Log.Trace("KidsA: %+v", pf.KidsA)
|
||||
_, hasKids := dict.Get("Kids").(*core.PdfObjectArray)
|
||||
if !hasKids {
|
||||
dict.Set("Kids", &core.PdfObjectArray{})
|
||||
}
|
||||
arr := dict.Get("Kids").(*core.PdfObjectArray)
|
||||
for _, child := range pf.KidsA {
|
||||
*arr = append(*arr, child.GetContext().ToPdfObject())
|
||||
}
|
||||
}
|
||||
|
||||
if pf.FT != nil {
|
||||
dict.Set("FT", pf.FT)
|
||||
}
|
||||
|
||||
if pf.T != nil {
|
||||
dict.Set("T", pf.T)
|
||||
}
|
||||
if pf.TU != nil {
|
||||
dict.Set("TU", pf.TU)
|
||||
}
|
||||
if pf.TM != nil {
|
||||
dict.Set("TM", pf.TM)
|
||||
}
|
||||
if pf.Ff != nil {
|
||||
dict.Set("Ff", pf.Ff)
|
||||
}
|
||||
if pf.V != nil {
|
||||
dict.Set("V", pf.V)
|
||||
}
|
||||
if pf.DV != nil {
|
||||
dict.Set("DV", pf.DV)
|
||||
}
|
||||
if pf.AA != nil {
|
||||
dict.Set("AA", pf.AA)
|
||||
}
|
||||
|
||||
// Variable text:
|
||||
dict.SetIfNotNil("DA", pf.DA)
|
||||
dict.SetIfNotNil("Q", pf.Q)
|
||||
dict.SetIfNotNil("DS", pf.DS)
|
||||
dict.SetIfNotNil("RV", pf.RV)
|
||||
|
||||
return container
|
||||
}
|
||||
853
internal/pdf/model/functions.go
Normal file
853
internal/pdf/model/functions.go
Normal file
@@ -0,0 +1,853 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"math"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/sampling"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/ps"
|
||||
)
|
||||
|
||||
type PdfValue any
|
||||
|
||||
type PdfFunction interface {
|
||||
Evaluate([]float64) ([]float64, error)
|
||||
ToPdfObject() core.PdfObject
|
||||
}
|
||||
|
||||
// In PDF: A function object may be a dictionary or a stream, depending on the type of function.
|
||||
// - Stream: Type 0, Type 4
|
||||
// - Dictionary: Type 2, Type 3.
|
||||
|
||||
// Loads a PDF Function from a PdfObject (can be either stream or dictionary).
|
||||
func newPdfFunctionFromPdfObject(obj core.PdfObject) (PdfFunction, error) {
|
||||
if stream, is := obj.(*core.PdfObjectStream); is {
|
||||
dict := stream.PdfObjectDictionary
|
||||
|
||||
ftype, ok := dict.Get("FunctionType").(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
common.Log.Error("FunctionType number missing")
|
||||
return nil, errors.New("invalid parameter or missing")
|
||||
}
|
||||
|
||||
switch *ftype {
|
||||
case 0:
|
||||
return newPdfFunctionType0FromStream(stream)
|
||||
case 4:
|
||||
return newPdfFunctionType4FromStream(stream)
|
||||
default:
|
||||
return nil, errors.New("invalid function type")
|
||||
}
|
||||
|
||||
} else if indObj, is := obj.(*core.PdfIndirectObject); is {
|
||||
// Indirect object containing a dictionary.
|
||||
// The indirect object is the container (which is tracked).
|
||||
dict, ok := indObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Error("Function Indirect object not containing dictionary")
|
||||
return nil, errors.New("invalid parameter or missing")
|
||||
}
|
||||
|
||||
ftype, ok := dict.Get("FunctionType").(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
common.Log.Error("FunctionType number missing")
|
||||
return nil, errors.New("invalid parameter or missing")
|
||||
}
|
||||
|
||||
switch *ftype {
|
||||
case 2:
|
||||
return newPdfFunctionType2FromPdfObject(indObj)
|
||||
case 3:
|
||||
return newPdfFunctionType3FromPdfObject(indObj)
|
||||
default:
|
||||
return nil, errors.New("invalid function type")
|
||||
}
|
||||
} else if dict, is := obj.(*core.PdfObjectDictionary); is {
|
||||
ftype, ok := dict.Get("FunctionType").(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
common.Log.Error("FunctionType number missing")
|
||||
return nil, errors.New("invalid parameter or missing")
|
||||
}
|
||||
|
||||
switch *ftype {
|
||||
case 2:
|
||||
return newPdfFunctionType2FromPdfObject(dict)
|
||||
case 3:
|
||||
return newPdfFunctionType3FromPdfObject(dict)
|
||||
default:
|
||||
return nil, errors.New("invalid function type")
|
||||
}
|
||||
} else {
|
||||
common.Log.Debug("Function Type error: %#v", obj)
|
||||
return nil, errors.New("type error")
|
||||
}
|
||||
}
|
||||
|
||||
// Simple linear interpolation from the PDF manual.
|
||||
func interpolate(x, xmin, xmax, ymin, ymax float64) float64 {
|
||||
if math.Abs(xmax-xmin) < 0.000001 {
|
||||
return ymin
|
||||
}
|
||||
|
||||
y := ymin + (x-xmin)*(ymax-ymin)/(xmax-xmin)
|
||||
return y
|
||||
}
|
||||
|
||||
// Type 0 functions use a sequence of sample values (contained in a stream) to provide an approximation
|
||||
// for functions whose domains and ranges are bounded. The samples are organized as an m-dimensional
|
||||
// table in which each entry has n components
|
||||
type PdfFunctionType0 struct {
|
||||
Domain []float64 // required; 2*m length; where m is the number of input values
|
||||
Range []float64 // required (type 0); 2*n length; where n is the number of output values
|
||||
|
||||
NumInputs int
|
||||
NumOutputs int
|
||||
|
||||
Size []int
|
||||
BitsPerSample int
|
||||
Order int // Values 1 or 3 (linear or cubic spline interpolation)
|
||||
Encode []float64
|
||||
Decode []float64
|
||||
|
||||
rawData []byte
|
||||
data []uint32
|
||||
|
||||
container *core.PdfObjectStream
|
||||
}
|
||||
|
||||
// Construct the PDF function object from a stream object (typically loaded from a PDF file).
|
||||
func newPdfFunctionType0FromStream(stream *core.PdfObjectStream) (*PdfFunctionType0, error) {
|
||||
fun := &PdfFunctionType0{}
|
||||
|
||||
fun.container = stream
|
||||
|
||||
dict := stream.PdfObjectDictionary
|
||||
|
||||
// Domain
|
||||
array, has := core.TraceToDirectObject(dict.Get("Domain")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Domain not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
if len(*array)%2 != 0 {
|
||||
common.Log.Error("Domain invalid")
|
||||
return nil, errors.New("invalid domain range")
|
||||
}
|
||||
fun.NumInputs = len(*array) / 2
|
||||
domain, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Domain = domain
|
||||
|
||||
// Range
|
||||
array, has = core.TraceToDirectObject(dict.Get("Range")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Range not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
if len(*array)%2 != 0 {
|
||||
return nil, errors.New("invalid range")
|
||||
}
|
||||
fun.NumOutputs = len(*array) / 2
|
||||
rang, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Range = rang
|
||||
|
||||
// Number of samples in each input dimension
|
||||
array, has = core.TraceToDirectObject(dict.Get("Size")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Size not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
tablesize, err := array.ToIntegerArray()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if len(tablesize) != fun.NumInputs {
|
||||
common.Log.Error("Table size not matching number of inputs")
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
fun.Size = tablesize
|
||||
|
||||
// BitsPerSample
|
||||
bps, has := core.TraceToDirectObject(dict.Get("BitsPerSample")).(*core.PdfObjectInteger)
|
||||
if !has {
|
||||
common.Log.Error("BitsPerSample not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
if *bps != 1 && *bps != 2 && *bps != 4 && *bps != 8 && *bps != 12 && *bps != 16 && *bps != 24 && *bps != 32 {
|
||||
common.Log.Error("Bits per sample outside range (%d)", *bps)
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
fun.BitsPerSample = int(*bps)
|
||||
|
||||
fun.Order = 1
|
||||
order, has := core.TraceToDirectObject(dict.Get("Order")).(*core.PdfObjectInteger)
|
||||
if has {
|
||||
if *order != 1 && *order != 3 {
|
||||
common.Log.Error("invalid order (%d)", *order)
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
fun.Order = int(*order)
|
||||
}
|
||||
|
||||
// Encode: is a 2*m array specifying the linear mapping of input values into the domain of the function's
|
||||
// sample table.
|
||||
array, has = core.TraceToDirectObject(dict.Get("Encode")).(*core.PdfObjectArray)
|
||||
if has {
|
||||
encode, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Encode = encode
|
||||
}
|
||||
|
||||
// Decode
|
||||
array, has = core.TraceToDirectObject(dict.Get("Decode")).(*core.PdfObjectArray)
|
||||
if has {
|
||||
decode, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Decode = decode
|
||||
}
|
||||
|
||||
data, err := core.DecodeStream(stream)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.rawData = data
|
||||
|
||||
return fun, nil
|
||||
}
|
||||
|
||||
func (pft *PdfFunctionType0) ToPdfObject() core.PdfObject {
|
||||
container := pft.container
|
||||
if container != nil {
|
||||
pft.container = &core.PdfObjectStream{}
|
||||
}
|
||||
|
||||
dict := core.MakeDict()
|
||||
dict.Set("FunctionType", core.MakeInteger(0))
|
||||
|
||||
// Domain (required).
|
||||
domainArray := &core.PdfObjectArray{}
|
||||
for _, val := range pft.Domain {
|
||||
domainArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Domain", domainArray)
|
||||
|
||||
// Range (required).
|
||||
rangeArray := &core.PdfObjectArray{}
|
||||
for _, val := range pft.Range {
|
||||
rangeArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Range", rangeArray)
|
||||
|
||||
// Size (required).
|
||||
sizeArray := &core.PdfObjectArray{}
|
||||
for _, val := range pft.Size {
|
||||
sizeArray.Append(core.MakeInteger(int64(val)))
|
||||
}
|
||||
dict.Set("Size", sizeArray)
|
||||
|
||||
dict.Set("BitsPerSample", core.MakeInteger(int64(pft.BitsPerSample)))
|
||||
|
||||
if pft.Order != 1 {
|
||||
dict.Set("Order", core.MakeInteger(int64(pft.Order)))
|
||||
}
|
||||
|
||||
// TODO: Encode.
|
||||
// Either here, or automatically later on when writing out.
|
||||
dict.Set("Length", core.MakeInteger(int64(len(pft.rawData))))
|
||||
container.Stream = pft.rawData
|
||||
|
||||
container.PdfObjectDictionary = dict
|
||||
return container
|
||||
}
|
||||
|
||||
func (pft *PdfFunctionType0) Evaluate(x []float64) ([]float64, error) {
|
||||
if len(x) != pft.NumInputs {
|
||||
common.Log.Error("Number of inputs not matching what is needed")
|
||||
return nil, errors.New("range check error")
|
||||
}
|
||||
|
||||
if pft.data == nil {
|
||||
// Process the samples if not already done.
|
||||
err := pft.processSamples()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
// Fall back to default Encode/Decode params if not set.
|
||||
encode := pft.Encode
|
||||
if encode == nil {
|
||||
encode = []float64{}
|
||||
for i := 0; i < len(pft.Size); i++ {
|
||||
encode = append(encode, 0)
|
||||
encode = append(encode, float64(pft.Size[i]-1))
|
||||
}
|
||||
}
|
||||
decode := pft.Decode
|
||||
if decode == nil {
|
||||
decode = pft.Range
|
||||
}
|
||||
|
||||
indices := []int{}
|
||||
// Start with nearest neighbour interpolation.
|
||||
for i := 0; i < len(x); i++ {
|
||||
xi := x[i]
|
||||
|
||||
xip := math.Min(math.Max(xi, pft.Domain[2*i]), pft.Domain[2*i+1])
|
||||
|
||||
ei := interpolate(xip, pft.Domain[2*i], pft.Domain[2*i+1], encode[2*i], encode[2*i+1])
|
||||
eip := math.Min(math.Max(ei, 0), float64(pft.Size[i]))
|
||||
// eip represents coordinate into the data table.
|
||||
// At this point it is real values.
|
||||
|
||||
// Interpolation shall be used to to determine output values
|
||||
// from the nearest surrounding values in the sample table.
|
||||
|
||||
// Initial implementation is simply nearest neighbour.
|
||||
// Then will add the linear and possibly bicubic/spline.
|
||||
index := int(math.Floor(eip + 0.5))
|
||||
if index < 0 {
|
||||
index = 0
|
||||
} else if index > pft.Size[i] {
|
||||
index = pft.Size[i] - 1
|
||||
}
|
||||
indices = append(indices, index)
|
||||
|
||||
}
|
||||
|
||||
// Calculate the index
|
||||
m := indices[0]
|
||||
for i := 1; i < pft.NumInputs; i++ {
|
||||
add := indices[i]
|
||||
for j := 0; j < i; j++ {
|
||||
add *= pft.Size[j]
|
||||
}
|
||||
m += add
|
||||
}
|
||||
m *= pft.NumOutputs
|
||||
|
||||
// Output values.
|
||||
outputs := []float64{}
|
||||
for j := 0; j < pft.NumOutputs; j++ {
|
||||
rj := pft.data[m+j]
|
||||
rjp := interpolate(float64(rj), 0, math.Pow(2, float64(pft.BitsPerSample)), decode[2*j], decode[2*j+1])
|
||||
yj := math.Min(math.Max(rjp, pft.Range[2*j]), pft.Range[2*j+1])
|
||||
outputs = append(outputs, yj)
|
||||
}
|
||||
|
||||
return outputs, nil
|
||||
}
|
||||
|
||||
// Convert raw data to data table. The maximum supported BitsPerSample is 32, so we store the resulting data
|
||||
// in a uint32 array. This is somewhat wasteful in the case of a small BitsPerSample, but these tables are
|
||||
// presumably not huge at any rate.
|
||||
func (pft *PdfFunctionType0) processSamples() error {
|
||||
data := sampling.ResampleBytes(pft.rawData, pft.BitsPerSample)
|
||||
pft.data = data
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Type 2 functions define an exponential interpolation of one input value and n
|
||||
// output values:
|
||||
//
|
||||
// f(x) = y_0, ..., y_(n-1)
|
||||
//
|
||||
// y_j = C0_j + x^N * (C1_j - C0_j); for 0 <= j < n
|
||||
// When N=1 ; linear interpolation between C0 and C1.
|
||||
type PdfFunctionType2 struct {
|
||||
Domain []float64
|
||||
Range []float64
|
||||
|
||||
C0 []float64
|
||||
C1 []float64
|
||||
N float64
|
||||
|
||||
container *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
// Can be either indirect object or dictionary. If indirect, then must be holding a dictionary,
|
||||
// i.e. acting as a container. When converting back to pdf object, will use the container provided.
|
||||
|
||||
func newPdfFunctionType2FromPdfObject(obj core.PdfObject) (*PdfFunctionType2, error) {
|
||||
fun := &PdfFunctionType2{}
|
||||
|
||||
var dict *core.PdfObjectDictionary
|
||||
if indObj, is := obj.(*core.PdfIndirectObject); is {
|
||||
d, ok := indObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, errors.New("type check error")
|
||||
}
|
||||
fun.container = indObj
|
||||
dict = d
|
||||
} else if d, is := obj.(*core.PdfObjectDictionary); is {
|
||||
dict = d
|
||||
} else {
|
||||
return nil, errors.New("type check error")
|
||||
}
|
||||
|
||||
common.Log.Trace("FUNC2: %s", dict.String())
|
||||
|
||||
// Domain
|
||||
array, has := core.TraceToDirectObject(dict.Get("Domain")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Domain not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
if len(*array)%2 != 0 {
|
||||
common.Log.Error("Domain range invalid")
|
||||
return nil, errors.New("invalid domain range")
|
||||
}
|
||||
domain, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Domain = domain
|
||||
|
||||
// Range
|
||||
array, has = core.TraceToDirectObject(dict.Get("Range")).(*core.PdfObjectArray)
|
||||
if has {
|
||||
if len(*array)%2 != 0 {
|
||||
return nil, errors.New("invalid range")
|
||||
}
|
||||
|
||||
rang, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Range = rang
|
||||
}
|
||||
|
||||
// C0.
|
||||
array, has = core.TraceToDirectObject(dict.Get("C0")).(*core.PdfObjectArray)
|
||||
if has {
|
||||
c0, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.C0 = c0
|
||||
}
|
||||
|
||||
// C1.
|
||||
array, has = core.TraceToDirectObject(dict.Get("C1")).(*core.PdfObjectArray)
|
||||
if has {
|
||||
c1, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.C1 = c1
|
||||
}
|
||||
|
||||
if len(fun.C0) != len(fun.C1) {
|
||||
common.Log.Error("C0 and C1 not matching")
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
|
||||
// Exponent.
|
||||
N, err := getNumberAsFloat(core.TraceToDirectObject(dict.Get("N")))
|
||||
if err != nil {
|
||||
common.Log.Error("N missing or invalid, dict: %s", dict.String())
|
||||
return nil, err
|
||||
}
|
||||
fun.N = N
|
||||
|
||||
return fun, nil
|
||||
}
|
||||
|
||||
func (ftt *PdfFunctionType2) ToPdfObject() core.PdfObject {
|
||||
dict := core.MakeDict()
|
||||
|
||||
dict.Set("FunctionType", core.MakeInteger(2))
|
||||
|
||||
// Domain (required).
|
||||
domainArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Domain {
|
||||
domainArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Domain", domainArray)
|
||||
|
||||
// Range (required).
|
||||
if ftt.Range != nil {
|
||||
rangeArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Range {
|
||||
rangeArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Range", rangeArray)
|
||||
}
|
||||
|
||||
// C0.
|
||||
if ftt.C0 != nil {
|
||||
c0Array := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.C0 {
|
||||
c0Array.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("C0", c0Array)
|
||||
}
|
||||
|
||||
// C1.
|
||||
if ftt.C1 != nil {
|
||||
c1Array := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.C1 {
|
||||
c1Array.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("C1", c1Array)
|
||||
}
|
||||
|
||||
// exponent
|
||||
dict.Set("N", core.MakeFloat(ftt.N))
|
||||
|
||||
// Wrap in a container if we have one already specified.
|
||||
if ftt.container != nil {
|
||||
ftt.container.PdfObject = dict
|
||||
return ftt.container
|
||||
} else {
|
||||
return dict
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
func (ftt *PdfFunctionType2) Evaluate(x []float64) ([]float64, error) {
|
||||
if len(x) != 1 {
|
||||
common.Log.Error("Only one input allowed")
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
|
||||
// Prepare.
|
||||
c0 := []float64{0.0}
|
||||
if ftt.C0 != nil {
|
||||
c0 = ftt.C0
|
||||
}
|
||||
c1 := []float64{1.0}
|
||||
if ftt.C1 != nil {
|
||||
c1 = ftt.C1
|
||||
}
|
||||
|
||||
y := []float64{}
|
||||
for i := 0; i < len(c0); i++ {
|
||||
yi := c0[i] + math.Pow(x[0], ftt.N)*(c1[i]-c0[i])
|
||||
y = append(y, yi)
|
||||
}
|
||||
|
||||
return y, nil
|
||||
}
|
||||
|
||||
// Type 3 functions define stitching of the subdomains of serveral 1-input functions to produce
|
||||
// a single new 1-input function.
|
||||
type PdfFunctionType3 struct {
|
||||
Domain []float64
|
||||
Range []float64
|
||||
|
||||
Functions []PdfFunction // k-1 input functions
|
||||
Bounds []float64 // k-1 numbers; defines the intervals where each function applies
|
||||
Encode []float64 // Array of 2k numbers..
|
||||
|
||||
container *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
func (*PdfFunctionType3) Evaluate(x []float64) ([]float64, error) {
|
||||
if len(x) != 1 {
|
||||
common.Log.Error("Only one input allowed")
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
|
||||
// Determine which function to use
|
||||
|
||||
// Encode
|
||||
|
||||
return nil, errors.New("not implemented yet")
|
||||
}
|
||||
|
||||
func newPdfFunctionType3FromPdfObject(obj core.PdfObject) (*PdfFunctionType3, error) {
|
||||
fun := &PdfFunctionType3{}
|
||||
|
||||
var dict *core.PdfObjectDictionary
|
||||
if indObj, is := obj.(*core.PdfIndirectObject); is {
|
||||
d, ok := indObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, errors.New("type check error")
|
||||
}
|
||||
fun.container = indObj
|
||||
dict = d
|
||||
} else if d, is := obj.(*core.PdfObjectDictionary); is {
|
||||
dict = d
|
||||
} else {
|
||||
return nil, errors.New("type check error")
|
||||
}
|
||||
|
||||
// Domain
|
||||
array, has := core.TraceToDirectObject(dict.Get("Domain")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Domain not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
if len(*array) != 2 {
|
||||
common.Log.Error("Domain invalid")
|
||||
return nil, errors.New("invalid domain range")
|
||||
}
|
||||
domain, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Domain = domain
|
||||
|
||||
// Range
|
||||
array, has = core.TraceToDirectObject(dict.Get("Range")).(*core.PdfObjectArray)
|
||||
if has {
|
||||
if len(*array)%2 != 0 {
|
||||
return nil, errors.New("invalid range")
|
||||
}
|
||||
rang, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Range = rang
|
||||
}
|
||||
|
||||
// Functions.
|
||||
array, has = core.TraceToDirectObject(dict.Get("Functions")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Functions not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
fun.Functions = []PdfFunction{}
|
||||
for _, obj := range *array {
|
||||
subf, err := newPdfFunctionFromPdfObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Functions = append(fun.Functions, subf)
|
||||
}
|
||||
|
||||
// Bounds
|
||||
array, has = core.TraceToDirectObject(dict.Get("Bounds")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Bounds not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
bounds, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Bounds = bounds
|
||||
if len(fun.Bounds) != len(fun.Functions)-1 {
|
||||
common.Log.Error("Bounds (%d) and num functions (%d) not matching", len(fun.Bounds), len(fun.Functions))
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
|
||||
// Encode.
|
||||
array, has = core.TraceToDirectObject(dict.Get("Encode")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Encode not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
encode, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Encode = encode
|
||||
if len(fun.Encode) != 2*len(fun.Functions) {
|
||||
common.Log.Error("Len encode (%d) and num functions (%d) not matching up", len(fun.Encode), len(fun.Functions))
|
||||
return nil, errors.New("range check")
|
||||
}
|
||||
|
||||
return fun, nil
|
||||
}
|
||||
|
||||
func (ftt *PdfFunctionType3) ToPdfObject() core.PdfObject {
|
||||
dict := core.MakeDict()
|
||||
|
||||
dict.Set("FunctionType", core.MakeInteger(3))
|
||||
|
||||
// Domain (required).
|
||||
domainArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Domain {
|
||||
domainArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Domain", domainArray)
|
||||
|
||||
// Range (required).
|
||||
if ftt.Range != nil {
|
||||
rangeArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Range {
|
||||
rangeArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Range", rangeArray)
|
||||
}
|
||||
|
||||
// Functions
|
||||
if ftt.Functions != nil {
|
||||
fArray := &core.PdfObjectArray{}
|
||||
for _, fun := range ftt.Functions {
|
||||
fArray.Append(fun.ToPdfObject())
|
||||
}
|
||||
dict.Set("Functions", fArray)
|
||||
}
|
||||
|
||||
// Bounds.
|
||||
if ftt.Bounds != nil {
|
||||
bArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Bounds {
|
||||
bArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Bounds", bArray)
|
||||
}
|
||||
|
||||
// Encode.
|
||||
if ftt.Encode != nil {
|
||||
eArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Encode {
|
||||
eArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Encode", eArray)
|
||||
}
|
||||
|
||||
// Wrap in a container if we have one already specified.
|
||||
if ftt.container != nil {
|
||||
ftt.container.PdfObject = dict
|
||||
return ftt.container
|
||||
} else {
|
||||
return dict
|
||||
}
|
||||
}
|
||||
|
||||
// Type 4. Postscript calculator functions.
|
||||
type PdfFunctionType4 struct {
|
||||
Domain []float64
|
||||
Range []float64
|
||||
Program *ps.PSProgram
|
||||
|
||||
executor *ps.PSExecutor
|
||||
decodedData []byte
|
||||
|
||||
container *core.PdfObjectStream
|
||||
}
|
||||
|
||||
// Input [x1 x2 x3]
|
||||
func (ftt *PdfFunctionType4) Evaluate(xVec []float64) ([]float64, error) {
|
||||
if ftt.executor == nil {
|
||||
ftt.executor = ps.NewPSExecutor(ftt.Program)
|
||||
}
|
||||
|
||||
inputs := []ps.PSObject{}
|
||||
for _, val := range xVec {
|
||||
inputs = append(inputs, ps.MakeReal(val))
|
||||
}
|
||||
|
||||
outputs, err := ftt.executor.Execute(inputs)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// After execution the outputs are on the stack [y1 ... yM]
|
||||
// Convert to floats.
|
||||
yVec, err := ps.PSObjectArrayToFloat64Array(outputs)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return yVec, nil
|
||||
}
|
||||
|
||||
// Load a type 4 function from a PDF stream object.
|
||||
func newPdfFunctionType4FromStream(stream *core.PdfObjectStream) (*PdfFunctionType4, error) {
|
||||
fun := &PdfFunctionType4{}
|
||||
|
||||
fun.container = stream
|
||||
|
||||
dict := stream.PdfObjectDictionary
|
||||
|
||||
// Domain
|
||||
array, has := core.TraceToDirectObject(dict.Get("Domain")).(*core.PdfObjectArray)
|
||||
if !has {
|
||||
common.Log.Error("Domain not specified")
|
||||
return nil, errors.New("required attribute missing or invalid")
|
||||
}
|
||||
if len(*array)%2 != 0 {
|
||||
common.Log.Error("Domain invalid")
|
||||
return nil, errors.New("invalid domain range")
|
||||
}
|
||||
domain, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Domain = domain
|
||||
|
||||
// Range
|
||||
array, has = core.TraceToDirectObject(dict.Get("Range")).(*core.PdfObjectArray)
|
||||
if has {
|
||||
if len(*array)%2 != 0 {
|
||||
return nil, errors.New("invalid range")
|
||||
}
|
||||
rang, err := array.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Range = rang
|
||||
}
|
||||
|
||||
// Program. Decode the program and parse the PS code.
|
||||
decoded, err := core.DecodeStream(stream)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.decodedData = decoded
|
||||
|
||||
psParser := ps.NewPSParser([]byte(decoded))
|
||||
prog, err := psParser.Parse()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
fun.Program = prog
|
||||
|
||||
return fun, nil
|
||||
}
|
||||
|
||||
func (ftt *PdfFunctionType4) ToPdfObject() core.PdfObject {
|
||||
container := ftt.container
|
||||
if container == nil {
|
||||
ftt.container = &core.PdfObjectStream{}
|
||||
container = ftt.container
|
||||
}
|
||||
|
||||
dict := core.MakeDict()
|
||||
dict.Set("FunctionType", core.MakeInteger(4))
|
||||
|
||||
// Domain (required).
|
||||
domainArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Domain {
|
||||
domainArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Domain", domainArray)
|
||||
|
||||
// Range (required).
|
||||
rangeArray := &core.PdfObjectArray{}
|
||||
for _, val := range ftt.Range {
|
||||
rangeArray.Append(core.MakeFloat(val))
|
||||
}
|
||||
dict.Set("Range", rangeArray)
|
||||
|
||||
if ftt.decodedData == nil && ftt.Program != nil {
|
||||
// Update data. This is used for created functions (not parsed ones).
|
||||
ftt.decodedData = []byte(ftt.Program.String())
|
||||
}
|
||||
|
||||
// TODO: Encode.
|
||||
// Either here, or automatically later on when writing out.
|
||||
dict.Set("Length", core.MakeInteger(int64(len(ftt.decodedData))))
|
||||
|
||||
container.Stream = ftt.decodedData
|
||||
container.PdfObjectDictionary = dict
|
||||
|
||||
return container
|
||||
}
|
||||
294
internal/pdf/model/image.go
Normal file
294
internal/pdf/model/image.go
Normal file
@@ -0,0 +1,294 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
goimage "image"
|
||||
gocolor "image/color"
|
||||
"image/draw"
|
||||
_ "image/gif"
|
||||
_ "image/png"
|
||||
"io"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/model/sampling"
|
||||
)
|
||||
|
||||
// Basic representation of an image.
|
||||
// The colorspace is not specified, but must be known when handling the image.
|
||||
type Image struct {
|
||||
Width int64 // The width of the image in samples
|
||||
Height int64 // The height of the image in samples
|
||||
BitsPerComponent int64 // The number of bits per color component
|
||||
ColorComponents int // Color components per pixel
|
||||
Data []byte // Image data stored as bytes.
|
||||
|
||||
// Transparency data: alpha channel.
|
||||
// Stored in same bits per component as original data with 1 color component.
|
||||
alphaData []byte // Alpha channel data.
|
||||
hasAlpha bool // Indicates whether the alpha channel data is available.
|
||||
|
||||
decode []float64 // [Dmin Dmax ... values for each color component]
|
||||
}
|
||||
|
||||
// Threshold alpha channel. Set all alpha values below threshold to transparent.
|
||||
type AlphaMapFunc func(alpha byte) byte
|
||||
|
||||
// Allow mapping of alpha data for transformations. Can allow custom filtering of alpha data etc.
|
||||
func (img Image) AlphaMap(mapFunc AlphaMapFunc) {
|
||||
for idx, alpha := range img.alphaData {
|
||||
img.alphaData[idx] = mapFunc(alpha)
|
||||
}
|
||||
}
|
||||
|
||||
// Convert the raw byte slice into samples which are stored in a uint32 bit array.
|
||||
// Each sample is represented by BitsPerComponent consecutive bits in the raw data.
|
||||
func (img *Image) GetSamples() []uint32 {
|
||||
samples := sampling.ResampleBytes(img.Data, int(img.BitsPerComponent))
|
||||
|
||||
expectedLen := int(img.Width) * int(img.Height) * img.ColorComponents
|
||||
if len(samples) < expectedLen {
|
||||
// Return error, or fill with 0s?
|
||||
common.Log.Debug("error: Too few samples (got %d, expecting %d)", len(samples), expectedLen)
|
||||
return samples
|
||||
} else if len(samples) > expectedLen {
|
||||
samples = samples[:expectedLen]
|
||||
}
|
||||
return samples
|
||||
}
|
||||
|
||||
// Convert samples to byte-data.
|
||||
func (img *Image) SetSamples(samples []uint32) {
|
||||
resampled := sampling.ResampleUint32(samples, int(img.BitsPerComponent), 8)
|
||||
data := []byte{}
|
||||
for _, val := range resampled {
|
||||
data = append(data, byte(val))
|
||||
}
|
||||
|
||||
img.Data = data
|
||||
}
|
||||
|
||||
// Resample resamples the image data converting from current BitsPerComponent to a target BitsPerComponent
|
||||
// value. Sets the image's BitsPerComponent to the target value following resampling.
|
||||
//
|
||||
// For example, converting an 8-bit RGB image to 1-bit grayscale (common for scanned images):
|
||||
//
|
||||
// // Convert RGB image to grayscale.
|
||||
// rgbColorSpace := pdf.NewPdfColorspaceDeviceRGB()
|
||||
// grayImage, err := rgbColorSpace.ImageToGray(rgbImage)
|
||||
// if err != nil {
|
||||
// return err
|
||||
// }
|
||||
// // Resample as 1 bit.
|
||||
// grayImage.Resample(1)
|
||||
func (img *Image) Resample(targetBitsPerComponent int64) {
|
||||
samples := img.GetSamples()
|
||||
|
||||
// Image data are stored row by row. If the number of bits per row is not a multiple of 8, the end of the
|
||||
// row needs to be padded with extra bits to fill out the last byte.
|
||||
// Thus the processing is done on a row by row basis below.
|
||||
|
||||
// This one simply resamples the data so that each component has target bits per component...
|
||||
// So if the original data was 10011010, then will have 1 0 0 1 1 0 1 0... much longer
|
||||
// The key to resampling is that we need to upsample/downsample,
|
||||
// i.e. 10011010 >> targetBitsPerComponent
|
||||
// Current bits: 8, target bits: 1... need to downsample by 8-1 = 7
|
||||
|
||||
if targetBitsPerComponent < img.BitsPerComponent {
|
||||
downsampling := img.BitsPerComponent - targetBitsPerComponent
|
||||
for i := range samples {
|
||||
samples[i] >>= uint(downsampling)
|
||||
}
|
||||
} else if targetBitsPerComponent > img.BitsPerComponent {
|
||||
upsampling := targetBitsPerComponent - img.BitsPerComponent
|
||||
for i := range samples {
|
||||
samples[i] <<= uint(upsampling)
|
||||
}
|
||||
} else {
|
||||
return
|
||||
}
|
||||
|
||||
// Write out row by row...
|
||||
data := []byte{}
|
||||
for i := int64(0); i < img.Height; i++ {
|
||||
ind1 := i * img.Width * int64(img.ColorComponents)
|
||||
ind2 := (i+1)*img.Width*int64(img.ColorComponents) - 1
|
||||
|
||||
resampled := sampling.ResampleUint32(samples[ind1:ind2], int(targetBitsPerComponent), 8)
|
||||
for _, val := range resampled {
|
||||
data = append(data, byte(val))
|
||||
}
|
||||
}
|
||||
|
||||
img.Data = data
|
||||
img.BitsPerComponent = int64(targetBitsPerComponent)
|
||||
}
|
||||
|
||||
// Converts the Image to a golang Image structure.
|
||||
func (im *Image) ToGoImage() (goimage.Image, error) {
|
||||
common.Log.Trace("Converting to go image")
|
||||
bounds := goimage.Rect(0, 0, int(im.Width), int(im.Height))
|
||||
var img core.DrawableImage
|
||||
|
||||
switch im.ColorComponents {
|
||||
case 1:
|
||||
if im.BitsPerComponent == 16 {
|
||||
img = goimage.NewGray16(bounds)
|
||||
} else {
|
||||
img = goimage.NewGray(bounds)
|
||||
}
|
||||
case 3:
|
||||
if im.BitsPerComponent == 16 {
|
||||
img = goimage.NewRGBA64(bounds)
|
||||
} else {
|
||||
img = goimage.NewRGBA(bounds)
|
||||
}
|
||||
case 4:
|
||||
img = goimage.NewCMYK(bounds)
|
||||
default:
|
||||
// XXX? Force RGB convert?
|
||||
common.Log.Debug("Unsupported number of colors components per sample: %d", im.ColorComponents)
|
||||
return nil, errors.New("unsupported colors")
|
||||
}
|
||||
|
||||
// Draw the data on the image..
|
||||
x := 0
|
||||
y := 0
|
||||
aidx := 0
|
||||
|
||||
samples := im.GetSamples()
|
||||
//bytesPerColor := colorComponents * int(this.BitsPerComponent) / 8
|
||||
bytesPerColor := im.ColorComponents
|
||||
for i := 0; i+bytesPerColor-1 < len(samples); i += bytesPerColor {
|
||||
var c gocolor.Color
|
||||
switch im.ColorComponents {
|
||||
case 1:
|
||||
if im.BitsPerComponent == 16 {
|
||||
val := uint16(samples[i])<<8 | uint16(samples[i+1])
|
||||
c = gocolor.Gray16{val}
|
||||
} else {
|
||||
val := uint8(samples[i] & 0xff)
|
||||
c = gocolor.Gray{val}
|
||||
}
|
||||
case 3:
|
||||
if im.BitsPerComponent == 16 {
|
||||
r := uint16(samples[i])<<8 | uint16(samples[i+1])
|
||||
g := uint16(samples[i+2])<<8 | uint16(samples[i+3])
|
||||
b := uint16(samples[i+4])<<8 | uint16(samples[i+5])
|
||||
a := uint16(0xffff) // Default: solid (0xffff) whereas transparent=0.
|
||||
if im.alphaData != nil && len(im.alphaData) > aidx+1 {
|
||||
a = (uint16(im.alphaData[aidx]) << 8) | uint16(im.alphaData[aidx+1])
|
||||
aidx += 2
|
||||
}
|
||||
c = gocolor.RGBA64{R: r, G: g, B: b, A: a}
|
||||
} else {
|
||||
r := uint8(samples[i] & 0xff)
|
||||
g := uint8(samples[i+1] & 0xff)
|
||||
b := uint8(samples[i+2] & 0xff)
|
||||
a := uint8(0xff) // Default: solid (0xff) whereas transparent=0.
|
||||
if im.alphaData != nil && len(im.alphaData) > aidx {
|
||||
a = uint8(im.alphaData[aidx])
|
||||
aidx++
|
||||
}
|
||||
c = gocolor.RGBA{R: r, G: g, B: b, A: a}
|
||||
}
|
||||
case 4:
|
||||
c1 := uint8(samples[i] & 0xff)
|
||||
m1 := uint8(samples[i+1] & 0xff)
|
||||
y1 := uint8(samples[i+2] & 0xff)
|
||||
k1 := uint8(samples[i+3] & 0xff)
|
||||
c = gocolor.CMYK{C: c1, M: m1, Y: y1, K: k1}
|
||||
}
|
||||
|
||||
img.Set(x, y, c)
|
||||
x++
|
||||
if x == int(im.Width) {
|
||||
x = 0
|
||||
y++
|
||||
}
|
||||
}
|
||||
|
||||
return img, nil
|
||||
}
|
||||
|
||||
// The ImageHandler interface implements common image loading and processing tasks.
|
||||
// Implementing as an interface allows for the possibility to use non-standard libraries for faster
|
||||
// loading and processing of images.
|
||||
type ImageHandler interface {
|
||||
// Read any image type and load into a new Image object.
|
||||
Read(r io.Reader) (*Image, error)
|
||||
|
||||
// Load a Image from a standard Go image structure.
|
||||
NewImageFromGoImage(goimg goimage.Image) (*Image, error)
|
||||
|
||||
// Compress an image.
|
||||
Compress(input *Image, quality int64) (*Image, error)
|
||||
}
|
||||
|
||||
// Default implementation.
|
||||
|
||||
type DefaultImageHandler struct{}
|
||||
|
||||
// Create a Image from a golang Image.
|
||||
func (dih DefaultImageHandler) NewImageFromGoImage(goimg goimage.Image) (*Image, error) {
|
||||
// Speed up jpeg encoding by converting to RGBA first.
|
||||
// Will not be required once the golang image/jpeg package is optimized.
|
||||
b := goimg.Bounds()
|
||||
m := goimage.NewRGBA(goimage.Rect(0, 0, b.Dx(), b.Dy()))
|
||||
draw.Draw(m, m.Bounds(), goimg, b.Min, draw.Src)
|
||||
|
||||
alphaData := []byte{}
|
||||
hasAlpha := false
|
||||
|
||||
data := []byte{}
|
||||
for i := 0; i < len(m.Pix); i += 4 {
|
||||
data = append(data, m.Pix[i], m.Pix[i+1], m.Pix[i+2])
|
||||
|
||||
alpha := m.Pix[i+3]
|
||||
if alpha != 255 {
|
||||
// If all alpha values are 255 (opaque), means that the alpha transparency channel is unnecessary.
|
||||
hasAlpha = true
|
||||
}
|
||||
alphaData = append(alphaData, alpha)
|
||||
}
|
||||
|
||||
imag := Image{}
|
||||
imag.Width = int64(b.Dx())
|
||||
imag.Height = int64(b.Dy())
|
||||
imag.BitsPerComponent = 8 // RGBA colormap
|
||||
imag.ColorComponents = 3
|
||||
imag.Data = data // buf.Bytes()
|
||||
|
||||
imag.hasAlpha = hasAlpha
|
||||
if hasAlpha {
|
||||
imag.alphaData = alphaData
|
||||
}
|
||||
|
||||
return &imag, nil
|
||||
}
|
||||
|
||||
// Reads an image and loads into a new Image object with an RGB
|
||||
// colormap and 8 bits per component.
|
||||
func (dih DefaultImageHandler) Read(reader io.Reader) (*Image, error) {
|
||||
// Load the image with the native implementation.
|
||||
goimg, _, err := goimage.Decode(reader)
|
||||
if err != nil {
|
||||
common.Log.Debug("error decoding file: %s", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return dih.NewImageFromGoImage(goimg)
|
||||
}
|
||||
|
||||
// To be implemented.
|
||||
// Should be able to compress in terms of JPEG quality parameter,
|
||||
// and DPI threshold (need to know bounding area dimensions).
|
||||
func (DefaultImageHandler) Compress(input *Image, quality int64) (*Image, error) {
|
||||
return input, nil
|
||||
}
|
||||
|
||||
var ImageHandling ImageHandler = DefaultImageHandler{}
|
||||
|
||||
func SetImageHandler(imgHandling ImageHandler) {
|
||||
ImageHandling = imgHandling
|
||||
}
|
||||
56
internal/pdf/model/model.go
Normal file
56
internal/pdf/model/model.go
Normal file
@@ -0,0 +1,56 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// A PDFModel is a higher level PDF construct which can be collapsed into a PDF primitive.
|
||||
// Each PDFModel has an underlying Primitive and vice versa.
|
||||
// Copies can be made, but care must be taken to do it properly.
|
||||
type PdfModel interface {
|
||||
ToPdfObject() core.PdfObject
|
||||
GetContainingPdfObject() core.PdfObject
|
||||
}
|
||||
|
||||
// The model manager is used to cache Primitive <-> Model mappings where needed.
|
||||
// In many cases only Model -> Primitive mapping is needed and only a reference to the Primitive
|
||||
// is stored in the Model. In some cases, the Model needs to be found from the Primitive,
|
||||
// and that is where the ModelManager can be used (in both directions).
|
||||
//
|
||||
// Note that it is not always used, the Primitive <-> Model mapping needs to be registered
|
||||
// for each time it is used. Thus, it is only used for special cases, commonly where the same
|
||||
// object is used by two higher level objects. (Example PDF Widgets owned by both Page Annotations,
|
||||
// and the interactive form - AcroForm).
|
||||
type ModelManager struct {
|
||||
primitiveCache map[PdfModel]core.PdfObject
|
||||
modelCache map[core.PdfObject]PdfModel
|
||||
}
|
||||
|
||||
func NewModelManager() *ModelManager {
|
||||
mm := ModelManager{}
|
||||
mm.primitiveCache = map[PdfModel]core.PdfObject{}
|
||||
mm.modelCache = map[core.PdfObject]PdfModel{}
|
||||
return &mm
|
||||
}
|
||||
|
||||
// Register (cache) a model to primitive relationship.
|
||||
func (mm *ModelManager) Register(primitive core.PdfObject, model PdfModel) {
|
||||
mm.primitiveCache[model] = primitive
|
||||
mm.modelCache[primitive] = model
|
||||
}
|
||||
|
||||
func (mm *ModelManager) GetPrimitiveFromModel(model PdfModel) core.PdfObject {
|
||||
primitive, has := mm.primitiveCache[model]
|
||||
if !has {
|
||||
return nil
|
||||
}
|
||||
return primitive
|
||||
}
|
||||
|
||||
func (mm *ModelManager) GetModelFromPrimitive(primitive core.PdfObject) PdfModel {
|
||||
model, has := mm.modelCache[primitive]
|
||||
if !has {
|
||||
return nil
|
||||
}
|
||||
return model
|
||||
}
|
||||
294
internal/pdf/model/outlines.go
Normal file
294
internal/pdf/model/outlines.go
Normal file
@@ -0,0 +1,294 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
type PdfOutlineTreeNode struct {
|
||||
context any // Allow accessing outer structure.
|
||||
First *PdfOutlineTreeNode
|
||||
Last *PdfOutlineTreeNode
|
||||
}
|
||||
|
||||
// PDF outline dictionary (Table 152 - p. 376).
|
||||
type PdfOutline struct {
|
||||
PdfOutlineTreeNode
|
||||
Parent *PdfOutlineTreeNode
|
||||
Count *int64
|
||||
|
||||
primitive *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
// Pdf outline item dictionary (Table 153 - pp. 376 - 377).
|
||||
type PdfOutlineItem struct {
|
||||
PdfOutlineTreeNode
|
||||
Title *core.PdfObjectString
|
||||
Parent *PdfOutlineTreeNode
|
||||
Prev *PdfOutlineTreeNode
|
||||
Next *PdfOutlineTreeNode
|
||||
Count *int64
|
||||
Dest core.PdfObject
|
||||
A core.PdfObject
|
||||
SE core.PdfObject
|
||||
C core.PdfObject
|
||||
F core.PdfObject
|
||||
|
||||
primitive *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
func NewPdfOutline() *PdfOutline {
|
||||
outline := &PdfOutline{}
|
||||
|
||||
container := &core.PdfIndirectObject{}
|
||||
container.PdfObject = core.MakeDict()
|
||||
|
||||
outline.primitive = container
|
||||
|
||||
return outline
|
||||
}
|
||||
|
||||
func NewPdfOutlineTree() *PdfOutline {
|
||||
outlineTree := NewPdfOutline()
|
||||
outlineTree.context = &outlineTree
|
||||
return outlineTree
|
||||
}
|
||||
|
||||
func NewPdfOutlineItem() *PdfOutlineItem {
|
||||
outlineItem := &PdfOutlineItem{}
|
||||
|
||||
container := &core.PdfIndirectObject{}
|
||||
container.PdfObject = core.MakeDict()
|
||||
|
||||
outlineItem.primitive = container
|
||||
return outlineItem
|
||||
}
|
||||
|
||||
func NewOutlineBookmark(title string, page *core.PdfIndirectObject) *PdfOutlineItem {
|
||||
bookmark := PdfOutlineItem{}
|
||||
bookmark.context = &bookmark
|
||||
|
||||
bookmark.Title = core.MakeString(title)
|
||||
|
||||
destArray := core.PdfObjectArray{}
|
||||
destArray = append(destArray, page)
|
||||
destArray = append(destArray, core.MakeName("Fit"))
|
||||
bookmark.Dest = &destArray
|
||||
|
||||
return &bookmark
|
||||
}
|
||||
|
||||
// Does not traverse the tree.
|
||||
func newPdfOutlineFromIndirectObject(container *core.PdfIndirectObject) (*PdfOutline, error) {
|
||||
dict, isDict := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !isDict {
|
||||
return nil, fmt.Errorf("outline object not a dictionary")
|
||||
}
|
||||
|
||||
outline := PdfOutline{}
|
||||
outline.primitive = container
|
||||
outline.context = &outline
|
||||
|
||||
if obj := dict.Get("Type"); obj != nil {
|
||||
typeVal, ok := obj.(*core.PdfObjectName)
|
||||
if ok {
|
||||
if *typeVal != "Outlines" {
|
||||
common.Log.Debug("error Type != Outlines (%s)", *typeVal)
|
||||
// Should be "Outlines" if there, but some files have other types
|
||||
// Log as an error but do not quit.
|
||||
// Might be a good idea to log this kind of deviation from the standard separately.
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if obj := dict.Get("Count"); obj != nil {
|
||||
// This should always be an integer, but in a few cases has been a float.
|
||||
count, err := getNumberAsInt64(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
outline.Count = &count
|
||||
}
|
||||
|
||||
return &outline, nil
|
||||
}
|
||||
|
||||
// Does not traverse the tree.
|
||||
func (pr *PdfReader) newPdfOutlineItemFromIndirectObject(container *core.PdfIndirectObject) (*PdfOutlineItem, error) {
|
||||
dict, isDict := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !isDict {
|
||||
return nil, fmt.Errorf("outline object not a dictionary")
|
||||
}
|
||||
|
||||
item := PdfOutlineItem{}
|
||||
item.primitive = container
|
||||
item.context = &item
|
||||
|
||||
// Title (required).
|
||||
obj := dict.Get("Title")
|
||||
if obj == nil {
|
||||
return nil, fmt.Errorf("missing Title from Outline Item (required)")
|
||||
}
|
||||
obj, err := pr.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
title, ok := core.TraceToDirectObject(obj).(*core.PdfObjectString)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("title not a string (%T)", obj)
|
||||
}
|
||||
item.Title = title
|
||||
|
||||
// Count (optional).
|
||||
if obj := dict.Get("Count"); obj != nil {
|
||||
countVal, ok := obj.(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("count not an integer (%T)", obj)
|
||||
}
|
||||
count := int64(*countVal)
|
||||
item.Count = &count
|
||||
}
|
||||
|
||||
// Other keys.
|
||||
if obj := dict.Get("Dest"); obj != nil {
|
||||
item.Dest, err = pr.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err := pr.traverseObjectData(item.Dest)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := dict.Get("A"); obj != nil {
|
||||
item.A, err = pr.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
err := pr.traverseObjectData(item.A)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := dict.Get("SE"); obj != nil {
|
||||
// XXX: To add structure element support.
|
||||
// Currently not supporting structure elements.
|
||||
item.SE = nil
|
||||
}
|
||||
if obj := dict.Get("C"); obj != nil {
|
||||
item.C, err = pr.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := dict.Get("F"); obj != nil {
|
||||
item.F, err = pr.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
return &item, nil
|
||||
}
|
||||
|
||||
// Get the outer object of the tree node (Outline or OutlineItem).
|
||||
func (n *PdfOutlineTreeNode) getOuter() PdfModel {
|
||||
if outline, isOutline := n.context.(*PdfOutline); isOutline {
|
||||
return outline
|
||||
}
|
||||
if outlineItem, isOutlineItem := n.context.(*PdfOutlineItem); isOutlineItem {
|
||||
return outlineItem
|
||||
}
|
||||
|
||||
common.Log.Debug("error Invalid outline tree node item") // Should never happen.
|
||||
return nil
|
||||
}
|
||||
|
||||
func (pot *PdfOutlineTreeNode) GetContainingPdfObject() core.PdfObject {
|
||||
return pot.getOuter().GetContainingPdfObject()
|
||||
}
|
||||
|
||||
func (pot *PdfOutlineTreeNode) ToPdfObject() core.PdfObject {
|
||||
return pot.getOuter().ToPdfObject()
|
||||
}
|
||||
|
||||
func (po *PdfOutline) GetContainingPdfObject() core.PdfObject {
|
||||
return po.primitive
|
||||
}
|
||||
|
||||
// Recursively build the Outline tree PDF object.
|
||||
func (po *PdfOutline) ToPdfObject() core.PdfObject {
|
||||
container := po.primitive
|
||||
dict := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
|
||||
dict.Set("Type", core.MakeName("Outlines"))
|
||||
|
||||
if po.First != nil {
|
||||
dict.Set("First", po.First.ToPdfObject())
|
||||
}
|
||||
|
||||
if po.Last != nil {
|
||||
dict.Set("Last", po.Last.getOuter().GetContainingPdfObject())
|
||||
//PdfObjectConverterCache[this.Last.getOuter()]
|
||||
}
|
||||
|
||||
if po.Parent != nil {
|
||||
dict.Set("Parent", po.Parent.getOuter().GetContainingPdfObject())
|
||||
}
|
||||
|
||||
return container
|
||||
}
|
||||
|
||||
func (poi *PdfOutlineItem) GetContainingPdfObject() core.PdfObject {
|
||||
return poi.primitive
|
||||
}
|
||||
|
||||
// Outline item.
|
||||
// Recursively build the Outline tree PDF object.
|
||||
func (poi *PdfOutlineItem) ToPdfObject() core.PdfObject {
|
||||
container := poi.primitive
|
||||
dict := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
|
||||
dict.Set("Title", poi.Title)
|
||||
if poi.A != nil {
|
||||
dict.Set("A", poi.A)
|
||||
}
|
||||
if obj := dict.Get("SE"); obj != nil {
|
||||
// XXX: Currently not supporting structure element hierarchy.
|
||||
// Remove it.
|
||||
dict.Remove("SE")
|
||||
// delete(*dict, "SE")
|
||||
}
|
||||
|
||||
if poi.C != nil {
|
||||
dict.Set("C", poi.C)
|
||||
}
|
||||
if poi.Dest != nil {
|
||||
dict.Set("Dest", poi.Dest)
|
||||
}
|
||||
if poi.F != nil {
|
||||
dict.Set("F", poi.F)
|
||||
}
|
||||
if poi.Count != nil {
|
||||
dict.Set("Count", core.MakeInteger(*poi.Count))
|
||||
}
|
||||
if poi.Next != nil {
|
||||
dict.Set("Next", poi.Next.ToPdfObject())
|
||||
}
|
||||
if poi.First != nil {
|
||||
dict.Set("First", poi.First.ToPdfObject())
|
||||
}
|
||||
if poi.Prev != nil {
|
||||
dict.Set("Prev", poi.Prev.getOuter().GetContainingPdfObject())
|
||||
}
|
||||
if poi.Last != nil {
|
||||
dict.Set("Last", poi.Last.getOuter().GetContainingPdfObject())
|
||||
}
|
||||
if poi.Parent != nil {
|
||||
dict.Set("Parent", poi.Parent.getOuter().GetContainingPdfObject())
|
||||
}
|
||||
|
||||
return container
|
||||
}
|
||||
908
internal/pdf/model/page.go
Normal file
908
internal/pdf/model/page.go
Normal file
@@ -0,0 +1,908 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"strings"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// PDF page object (7.7.3.3 - Table 30).
|
||||
type PdfPage struct {
|
||||
Parent core.PdfObject
|
||||
LastModified *PdfDate
|
||||
Resources *PdfPageResources
|
||||
CropBox *PdfRectangle
|
||||
MediaBox *PdfRectangle
|
||||
BleedBox *PdfRectangle
|
||||
TrimBox *PdfRectangle
|
||||
ArtBox *PdfRectangle
|
||||
BoxColorInfo core.PdfObject
|
||||
Contents core.PdfObject
|
||||
Rotate *int64
|
||||
Group core.PdfObject
|
||||
Thumb core.PdfObject
|
||||
B core.PdfObject
|
||||
Dur core.PdfObject
|
||||
Trans core.PdfObject
|
||||
AA core.PdfObject
|
||||
Metadata core.PdfObject
|
||||
PieceInfo core.PdfObject
|
||||
StructParents core.PdfObject
|
||||
ID core.PdfObject
|
||||
PZ core.PdfObject
|
||||
SeparationInfo core.PdfObject
|
||||
Tabs core.PdfObject
|
||||
TemplateInstantiated core.PdfObject
|
||||
PresSteps core.PdfObject
|
||||
UserUnit core.PdfObject
|
||||
VP core.PdfObject
|
||||
|
||||
Annotations []*PdfAnnotation
|
||||
|
||||
// Primitive container.
|
||||
pageDict *core.PdfObjectDictionary
|
||||
primitive *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
func NewPdfPage() *PdfPage {
|
||||
page := PdfPage{}
|
||||
page.pageDict = core.MakeDict()
|
||||
|
||||
container := core.PdfIndirectObject{}
|
||||
container.PdfObject = page.pageDict
|
||||
page.primitive = &container
|
||||
|
||||
return &page
|
||||
}
|
||||
|
||||
func (pp *PdfPage) setContainer(container *core.PdfIndirectObject) {
|
||||
container.PdfObject = pp.pageDict
|
||||
pp.primitive = container
|
||||
}
|
||||
|
||||
func (pp *PdfPage) Duplicate() *PdfPage {
|
||||
dup := *pp
|
||||
dup.pageDict = core.MakeDict()
|
||||
dup.primitive = core.MakeIndirectObject(dup.pageDict)
|
||||
|
||||
return &dup
|
||||
}
|
||||
|
||||
// Build a PdfPage based on the underlying dictionary.
|
||||
// Used in loading existing PDF files.
|
||||
// Note that a new container is created (indirect object).
|
||||
func (reader *PdfReader) newPdfPageFromDict(p *core.PdfObjectDictionary) (*PdfPage, error) {
|
||||
page := NewPdfPage()
|
||||
page.pageDict = p //XXX?
|
||||
|
||||
d := *p
|
||||
|
||||
pType, ok := d.Get("Type").(*core.PdfObjectName)
|
||||
if !ok {
|
||||
return nil, errors.New("missing/Invalid Page dictionary Type")
|
||||
}
|
||||
if *pType != "Page" {
|
||||
return nil, errors.New("page dictionary Type != Page")
|
||||
}
|
||||
|
||||
if obj := d.Get("Parent"); obj != nil {
|
||||
page.Parent = obj
|
||||
}
|
||||
|
||||
if obj := d.Get("LastModified"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
strObj, ok := core.TraceToDirectObject(obj).(*core.PdfObjectString)
|
||||
if !ok {
|
||||
return nil, errors.New("page dictionary LastModified != string")
|
||||
}
|
||||
lastmod, err := NewPdfDate(string(*strObj))
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
page.LastModified = &lastmod
|
||||
}
|
||||
|
||||
if obj := d.Get("Resources"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
dict, ok := core.TraceToDirectObject(obj).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("invalid resource dictionary (%T)", obj)
|
||||
}
|
||||
|
||||
page.Resources, err = NewPdfPageResourcesFromDict(dict)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
} else {
|
||||
// If Resources not explicitly defined, look up the tree (Parent objects) using
|
||||
// the getResources() function. Resources should always be accessible.
|
||||
resources, err := page.getResources()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
if resources == nil {
|
||||
resources = NewPdfPageResources()
|
||||
}
|
||||
page.Resources = resources
|
||||
}
|
||||
|
||||
if obj := d.Get("MediaBox"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
boxArr, ok := core.TraceToDirectObject(obj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, errors.New("page MediaBox not an array")
|
||||
}
|
||||
page.MediaBox, err = NewPdfRectangle(*boxArr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := d.Get("CropBox"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
boxArr, ok := core.TraceToDirectObject(obj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, errors.New("page CropBox not an array")
|
||||
}
|
||||
page.CropBox, err = NewPdfRectangle(*boxArr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := d.Get("BleedBox"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
boxArr, ok := core.TraceToDirectObject(obj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, errors.New("page BleedBox not an array")
|
||||
}
|
||||
page.BleedBox, err = NewPdfRectangle(*boxArr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := d.Get("TrimBox"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
boxArr, ok := core.TraceToDirectObject(obj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, errors.New("page TrimBox not an array")
|
||||
}
|
||||
page.TrimBox, err = NewPdfRectangle(*boxArr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := d.Get("ArtBox"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
boxArr, ok := core.TraceToDirectObject(obj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, errors.New("page ArtBox not an array")
|
||||
}
|
||||
page.ArtBox, err = NewPdfRectangle(*boxArr)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
if obj := d.Get("BoxColorInfo"); obj != nil {
|
||||
page.BoxColorInfo = obj
|
||||
}
|
||||
if obj := d.Get("Contents"); obj != nil {
|
||||
page.Contents = obj
|
||||
}
|
||||
if obj := d.Get("Rotate"); obj != nil {
|
||||
var err error
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
iObj, ok := core.TraceToDirectObject(obj).(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid Page Rotate object")
|
||||
}
|
||||
iVal := int64(*iObj)
|
||||
page.Rotate = &iVal
|
||||
}
|
||||
if obj := d.Get("Group"); obj != nil {
|
||||
page.Group = obj
|
||||
}
|
||||
if obj := d.Get("Thumb"); obj != nil {
|
||||
page.Thumb = obj
|
||||
}
|
||||
if obj := d.Get("B"); obj != nil {
|
||||
page.B = obj
|
||||
}
|
||||
if obj := d.Get("Dur"); obj != nil {
|
||||
page.Dur = obj
|
||||
}
|
||||
if obj := d.Get("Trans"); obj != nil {
|
||||
page.Trans = obj
|
||||
}
|
||||
//if obj := d.Get("Annots"); obj != nil {
|
||||
// page.Annots = obj
|
||||
//}
|
||||
if obj := d.Get("AA"); obj != nil {
|
||||
page.AA = obj
|
||||
}
|
||||
if obj := d.Get("Metadata"); obj != nil {
|
||||
page.Metadata = obj
|
||||
}
|
||||
if obj := d.Get("PieceInfo"); obj != nil {
|
||||
page.PieceInfo = obj
|
||||
}
|
||||
if obj := d.Get("StructParents"); obj != nil {
|
||||
page.StructParents = obj
|
||||
}
|
||||
if obj := d.Get("ID"); obj != nil {
|
||||
page.ID = obj
|
||||
}
|
||||
if obj := d.Get("PZ"); obj != nil {
|
||||
page.PZ = obj
|
||||
}
|
||||
if obj := d.Get("SeparationInfo"); obj != nil {
|
||||
page.SeparationInfo = obj
|
||||
}
|
||||
if obj := d.Get("Tabs"); obj != nil {
|
||||
page.Tabs = obj
|
||||
}
|
||||
if obj := d.Get("TemplateInstantiated"); obj != nil {
|
||||
page.TemplateInstantiated = obj
|
||||
}
|
||||
if obj := d.Get("PresSteps"); obj != nil {
|
||||
page.PresSteps = obj
|
||||
}
|
||||
if obj := d.Get("UserUnit"); obj != nil {
|
||||
page.UserUnit = obj
|
||||
}
|
||||
if obj := d.Get("VP"); obj != nil {
|
||||
page.VP = obj
|
||||
}
|
||||
|
||||
var err error
|
||||
page.Annotations, err = reader.LoadAnnotations(&d)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return page, nil
|
||||
}
|
||||
|
||||
func (reader *PdfReader) LoadAnnotations(d *core.PdfObjectDictionary) ([]*PdfAnnotation, error) {
|
||||
annotsObj := d.Get("Annots")
|
||||
if annotsObj == nil {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
var err error
|
||||
annotsObj, err = reader.traceToObject(annotsObj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
annotsArr, ok := core.TraceToDirectObject(annotsObj).(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("annots not an array")
|
||||
}
|
||||
|
||||
annotations := []*PdfAnnotation{}
|
||||
for _, obj := range *annotsArr {
|
||||
obj, err = reader.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Technically all annotation dictionaries should be inside indirect objects.
|
||||
// In reality, sometimes the annotation dictionary is inline within the Annots array.
|
||||
if _, isNull := obj.(*core.PdfObjectNull); isNull {
|
||||
// Can safely ignore.
|
||||
continue
|
||||
}
|
||||
|
||||
annotDict, isDict := obj.(*core.PdfObjectDictionary)
|
||||
indirectObj, isIndirect := obj.(*core.PdfIndirectObject)
|
||||
if isDict {
|
||||
// Create a container; indirect object; around the dictionary.
|
||||
indirectObj = &core.PdfIndirectObject{}
|
||||
indirectObj.PdfObject = annotDict
|
||||
} else {
|
||||
if !isIndirect {
|
||||
return nil, fmt.Errorf("annotation not in an indirect object")
|
||||
}
|
||||
}
|
||||
|
||||
annot, err := reader.newPdfAnnotationFromIndirectObject(indirectObj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
annotations = append(annotations, annot)
|
||||
}
|
||||
|
||||
return annotations, nil
|
||||
}
|
||||
|
||||
// Get the inheritable media box value, either from the page
|
||||
// or a higher up page/pages struct.
|
||||
func (pp *PdfPage) GetMediaBox() (*PdfRectangle, error) {
|
||||
if pp.MediaBox != nil {
|
||||
return pp.MediaBox, nil
|
||||
}
|
||||
|
||||
node := pp.Parent
|
||||
for node != nil {
|
||||
dictObj, ok := node.(*core.PdfIndirectObject)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid parent object")
|
||||
}
|
||||
|
||||
dict, ok := dictObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid parent objects dictionary")
|
||||
}
|
||||
|
||||
if obj := dict.Get("MediaBox"); obj != nil {
|
||||
arr, ok := obj.(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid media box")
|
||||
}
|
||||
rect, err := NewPdfRectangle(*arr)
|
||||
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return rect, nil
|
||||
}
|
||||
|
||||
node = dict.Get("Parent")
|
||||
}
|
||||
|
||||
return nil, errors.New("media box not defined")
|
||||
}
|
||||
|
||||
// Get the inheritable resources, either from the page or or a higher up page/pages struct.
|
||||
func (pp *PdfPage) getResources() (*PdfPageResources, error) {
|
||||
if pp.Resources != nil {
|
||||
return pp.Resources, nil
|
||||
}
|
||||
|
||||
node := pp.Parent
|
||||
for node != nil {
|
||||
dictObj, ok := node.(*core.PdfIndirectObject)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid parent object")
|
||||
}
|
||||
|
||||
dict, ok := dictObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid parent objects dictionary")
|
||||
}
|
||||
|
||||
if obj := dict.Get("Resources"); obj != nil {
|
||||
prDict, ok := core.TraceToDirectObject(obj).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid resource dict")
|
||||
}
|
||||
resources, err := NewPdfPageResourcesFromDict(prDict)
|
||||
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return resources, nil
|
||||
}
|
||||
|
||||
// Keep moving up the tree...
|
||||
node = dict.Get("Parent")
|
||||
}
|
||||
|
||||
// No resources defined...
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
// Convert the Page to a PDF object dictionary.
|
||||
func (pp *PdfPage) GetPageDict() *core.PdfObjectDictionary {
|
||||
p := pp.pageDict
|
||||
p.Set("Type", core.MakeName("Page"))
|
||||
p.Set("Parent", pp.Parent)
|
||||
|
||||
if pp.LastModified != nil {
|
||||
p.Set("LastModified", pp.LastModified.ToPdfObject())
|
||||
}
|
||||
if pp.Resources != nil {
|
||||
p.Set("Resources", pp.Resources.ToPdfObject())
|
||||
}
|
||||
if pp.CropBox != nil {
|
||||
p.Set("CropBox", pp.CropBox.ToPdfObject())
|
||||
}
|
||||
if pp.MediaBox != nil {
|
||||
p.Set("MediaBox", pp.MediaBox.ToPdfObject())
|
||||
}
|
||||
if pp.BleedBox != nil {
|
||||
p.Set("BleedBox", pp.BleedBox.ToPdfObject())
|
||||
}
|
||||
if pp.TrimBox != nil {
|
||||
p.Set("TrimBox", pp.TrimBox.ToPdfObject())
|
||||
}
|
||||
if pp.ArtBox != nil {
|
||||
p.Set("ArtBox", pp.ArtBox.ToPdfObject())
|
||||
}
|
||||
p.SetIfNotNil("BoxColorInfo", pp.BoxColorInfo)
|
||||
p.SetIfNotNil("Contents", pp.Contents)
|
||||
|
||||
if pp.Rotate != nil {
|
||||
p.Set("Rotate", core.MakeInteger(*pp.Rotate))
|
||||
}
|
||||
|
||||
p.SetIfNotNil("Group", pp.Group)
|
||||
p.SetIfNotNil("Thumb", pp.Thumb)
|
||||
p.SetIfNotNil("B", pp.B)
|
||||
p.SetIfNotNil("Dur", pp.Dur)
|
||||
p.SetIfNotNil("Trans", pp.Trans)
|
||||
p.SetIfNotNil("AA", pp.AA)
|
||||
p.SetIfNotNil("Metadata", pp.Metadata)
|
||||
p.SetIfNotNil("PieceInfo", pp.PieceInfo)
|
||||
p.SetIfNotNil("StructParents", pp.StructParents)
|
||||
p.SetIfNotNil("ID", pp.ID)
|
||||
p.SetIfNotNil("PZ", pp.PZ)
|
||||
p.SetIfNotNil("SeparationInfo", pp.SeparationInfo)
|
||||
p.SetIfNotNil("Tabs", pp.Tabs)
|
||||
p.SetIfNotNil("TemplateInstantiated", pp.TemplateInstantiated)
|
||||
p.SetIfNotNil("PresSteps", pp.PresSteps)
|
||||
p.SetIfNotNil("UserUnit", pp.UserUnit)
|
||||
p.SetIfNotNil("VP", pp.VP)
|
||||
|
||||
if pp.Annotations != nil {
|
||||
arr := core.PdfObjectArray{}
|
||||
for _, annot := range pp.Annotations {
|
||||
if subannot := annot.GetContext(); subannot != nil {
|
||||
arr = append(arr, subannot.ToPdfObject())
|
||||
} else {
|
||||
// Generic annotation dict (without subtype).
|
||||
arr = append(arr, annot.ToPdfObject())
|
||||
}
|
||||
}
|
||||
p.Set("Annots", &arr)
|
||||
}
|
||||
|
||||
return p
|
||||
}
|
||||
|
||||
// Get the page object as an indirect objects. Wraps the Page
|
||||
// dictionary into an indirect object.
|
||||
func (pp *PdfPage) GetPageAsIndirectObject() *core.PdfIndirectObject {
|
||||
return pp.primitive
|
||||
}
|
||||
|
||||
func (pp *PdfPage) GetContainingPdfObject() core.PdfObject {
|
||||
return pp.primitive
|
||||
}
|
||||
|
||||
func (pp *PdfPage) ToPdfObject() core.PdfObject {
|
||||
container := pp.primitive
|
||||
pp.GetPageDict() // update.
|
||||
return container
|
||||
}
|
||||
|
||||
// Add an image to the XObject resources.
|
||||
func (pp *PdfPage) AddImageResource(name core.PdfObjectName, ximg *XObjectImage) error {
|
||||
var xresDict *core.PdfObjectDictionary
|
||||
if pp.Resources.XObject == nil {
|
||||
xresDict = core.MakeDict()
|
||||
pp.Resources.XObject = xresDict
|
||||
} else {
|
||||
var ok bool
|
||||
xresDict, ok = (pp.Resources.XObject).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return errors.New("invalid xres dict type")
|
||||
}
|
||||
|
||||
}
|
||||
// Make a stream object container.
|
||||
xresDict.Set(name, ximg.ToPdfObject())
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Check if has XObject resource by name.
|
||||
func (pp *PdfPage) HasXObjectByName(name core.PdfObjectName) bool {
|
||||
xresDict, has := pp.Resources.XObject.(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
return false
|
||||
}
|
||||
|
||||
if obj := xresDict.Get(name); obj != nil {
|
||||
return true
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
// Get XObject by name.
|
||||
func (pp *PdfPage) GetXObjectByName(name core.PdfObjectName) (core.PdfObject, bool) {
|
||||
xresDict, has := pp.Resources.XObject.(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
return nil, false
|
||||
}
|
||||
|
||||
if obj := xresDict.Get(name); obj != nil {
|
||||
return obj, true
|
||||
} else {
|
||||
return nil, false
|
||||
}
|
||||
}
|
||||
|
||||
// Check if has font resource by name.
|
||||
func (pp *PdfPage) HasFontByName(name core.PdfObjectName) bool {
|
||||
fontDict, has := pp.Resources.Font.(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
return false
|
||||
}
|
||||
|
||||
if obj := fontDict.Get(name); obj != nil {
|
||||
return true
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
// Check if ExtGState name is available.
|
||||
func (pp *PdfPage) HasExtGState(name core.PdfObjectName) bool {
|
||||
if pp.Resources == nil {
|
||||
return false
|
||||
}
|
||||
|
||||
if pp.Resources.ExtGState == nil {
|
||||
return false
|
||||
}
|
||||
|
||||
egsDict, ok := core.TraceToDirectObject(pp.Resources.ExtGState).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("Expected ExtGState dictionary is not a dictionary: %v", core.TraceToDirectObject(pp.Resources.ExtGState))
|
||||
return false
|
||||
}
|
||||
|
||||
// Update the dictionary.
|
||||
obj := egsDict.Get(name)
|
||||
has := obj != nil
|
||||
|
||||
return has
|
||||
}
|
||||
|
||||
// Add a graphics state to the XObject resources.
|
||||
func (pp *PdfPage) AddExtGState(name core.PdfObjectName, egs *core.PdfObjectDictionary) error {
|
||||
if pp.Resources == nil {
|
||||
//this.Resources = &PdfPageResources{}
|
||||
pp.Resources = NewPdfPageResources()
|
||||
}
|
||||
|
||||
if pp.Resources.ExtGState == nil {
|
||||
pp.Resources.ExtGState = core.MakeDict()
|
||||
}
|
||||
|
||||
egsDict, ok := core.TraceToDirectObject(pp.Resources.ExtGState).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("Expected ExtGState dictionary is not a dictionary: %v", core.TraceToDirectObject(pp.Resources.ExtGState))
|
||||
return errors.New("type check error")
|
||||
}
|
||||
|
||||
egsDict.Set(name, egs)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Add a font dictionary to the Font resources.
|
||||
func (pp *PdfPage) AddFont(name core.PdfObjectName, font core.PdfObject) error {
|
||||
if pp.Resources == nil {
|
||||
pp.Resources = NewPdfPageResources()
|
||||
}
|
||||
|
||||
if pp.Resources.Font == nil {
|
||||
pp.Resources.Font = core.MakeDict()
|
||||
}
|
||||
|
||||
fontDict, ok := core.TraceToDirectObject(pp.Resources.Font).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("Expected font dictionary is not a dictionary: %v", core.TraceToDirectObject(pp.Resources.Font))
|
||||
return errors.New("type check error")
|
||||
}
|
||||
|
||||
// Update the dictionary.
|
||||
fontDict.Set(name, font)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
type WatermarkImageOptions struct {
|
||||
Alpha float64
|
||||
FitToWidth bool
|
||||
PreserveAspectRatio bool
|
||||
}
|
||||
|
||||
// Add a watermark to the page.
|
||||
func (pp *PdfPage) AddWatermarkImage(ximg *XObjectImage, opt WatermarkImageOptions) error {
|
||||
// Page dimensions.
|
||||
bbox, err := pp.GetMediaBox()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
pWidth := bbox.Urx - bbox.Llx
|
||||
pHeight := bbox.Ury - bbox.Lly
|
||||
|
||||
wWidth := float64(*ximg.Width)
|
||||
xOffset := (float64(pWidth) - float64(wWidth)) / 2
|
||||
if opt.FitToWidth {
|
||||
wWidth = pWidth
|
||||
xOffset = 0
|
||||
}
|
||||
wHeight := pHeight
|
||||
yOffset := float64(0)
|
||||
if opt.PreserveAspectRatio {
|
||||
wHeight = wWidth * float64(*ximg.Height) / float64(*ximg.Width)
|
||||
yOffset = (pHeight - wHeight) / 2
|
||||
}
|
||||
|
||||
if pp.Resources == nil {
|
||||
pp.Resources = NewPdfPageResources()
|
||||
}
|
||||
|
||||
// Find available image name for this page.
|
||||
i := 0
|
||||
imgName := core.PdfObjectName(fmt.Sprintf("Imw%d", i))
|
||||
for pp.Resources.HasXObjectByName(imgName) {
|
||||
i++
|
||||
imgName = core.PdfObjectName(fmt.Sprintf("Imw%d", i))
|
||||
}
|
||||
|
||||
err = pp.AddImageResource(imgName, ximg)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
i = 0
|
||||
gsName := core.PdfObjectName(fmt.Sprintf("GS%d", i))
|
||||
for pp.HasExtGState(gsName) {
|
||||
i++
|
||||
gsName = core.PdfObjectName(fmt.Sprintf("GS%d", i))
|
||||
}
|
||||
gs0 := core.MakeDict()
|
||||
gs0.Set("BM", core.MakeName("Normal"))
|
||||
gs0.Set("CA", core.MakeFloat(opt.Alpha))
|
||||
gs0.Set("ca", core.MakeFloat(opt.Alpha))
|
||||
err = pp.AddExtGState(gsName, gs0)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
contentStr := fmt.Sprintf("q\n"+
|
||||
"/%s gs\n"+
|
||||
"%.0f 0 0 %.0f %.4f %.4f cm\n"+
|
||||
"/%s Do\n"+
|
||||
"Q", gsName, wWidth, wHeight, xOffset, yOffset, imgName)
|
||||
pp.AddContentStreamByString(contentStr)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Add content stream by string. Puts the content string into a stream
|
||||
// object and points the content stream towards it.
|
||||
func (pp *PdfPage) AddContentStreamByString(contentStr string) {
|
||||
stream := core.PdfObjectStream{}
|
||||
|
||||
sDict := core.MakeDict()
|
||||
stream.PdfObjectDictionary = sDict
|
||||
|
||||
sDict.Set("Length", core.MakeInteger(int64(len(contentStr))))
|
||||
stream.Stream = []byte(contentStr)
|
||||
|
||||
if pp.Contents == nil {
|
||||
// If not set, place it directly.
|
||||
pp.Contents = &stream
|
||||
} else if contArray, isArray := core.TraceToDirectObject(pp.Contents).(*core.PdfObjectArray); isArray {
|
||||
// If an array of content streams, append it.
|
||||
*contArray = append(*contArray, &stream)
|
||||
} else {
|
||||
// Only 1 element in place. Wrap inside a new array and add the new one.
|
||||
contArray := core.PdfObjectArray{}
|
||||
contArray = append(contArray, pp.Contents)
|
||||
contArray = append(contArray, &stream)
|
||||
pp.Contents = &contArray
|
||||
}
|
||||
}
|
||||
|
||||
// Set the content streams based on a string array. Will make 1 object stream
|
||||
// for each string and reference from the page Contents. Each stream will be
|
||||
// encoded using the encoding specified by the StreamEncoder, if empty, will
|
||||
// use identity encoding (raw data).
|
||||
func (pp *PdfPage) SetContentStreams(cStreams []string, encoder core.StreamEncoder) error {
|
||||
if len(cStreams) == 0 {
|
||||
pp.Contents = nil
|
||||
return nil
|
||||
}
|
||||
|
||||
// If encoding is not set, use default raw encoder.
|
||||
if encoder == nil {
|
||||
encoder = core.NewRawEncoder()
|
||||
}
|
||||
|
||||
streamObjs := []*core.PdfObjectStream{}
|
||||
for _, cStream := range cStreams {
|
||||
stream := &core.PdfObjectStream{}
|
||||
|
||||
// Make a new stream dict based on the encoding parameters.
|
||||
sDict := encoder.MakeStreamDict()
|
||||
|
||||
encoded, err := encoder.EncodeBytes([]byte(cStream))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
sDict.Set("Length", core.MakeInteger(int64(len(encoded))))
|
||||
|
||||
stream.PdfObjectDictionary = sDict
|
||||
stream.Stream = []byte(encoded)
|
||||
|
||||
streamObjs = append(streamObjs, stream)
|
||||
}
|
||||
|
||||
// Set the page contents.
|
||||
// Point directly to the object stream if only one, or embed in an array.
|
||||
if len(streamObjs) == 1 {
|
||||
pp.Contents = streamObjs[0]
|
||||
} else {
|
||||
contArray := core.PdfObjectArray{}
|
||||
for _, streamObj := range streamObjs {
|
||||
contArray = append(contArray, streamObj)
|
||||
}
|
||||
pp.Contents = &contArray
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func getContentStreamAsString(cstreamObj core.PdfObject) (string, error) {
|
||||
if cstream, ok := core.TraceToDirectObject(cstreamObj).(*core.PdfObjectString); ok {
|
||||
return string(*cstream), nil
|
||||
}
|
||||
|
||||
if cstream, ok := core.TraceToDirectObject(cstreamObj).(*core.PdfObjectStream); ok {
|
||||
buf, err := core.DecodeStream(cstream)
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
|
||||
return string(buf), nil
|
||||
}
|
||||
return "", fmt.Errorf("invalid content stream object holder (%T)", core.TraceToDirectObject(cstreamObj))
|
||||
}
|
||||
|
||||
// Get Content Stream as an array of strings.
|
||||
func (pp *PdfPage) GetContentStreams() ([]string, error) {
|
||||
if pp.Contents == nil {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
contents := core.TraceToDirectObject(pp.Contents)
|
||||
if contArray, isArray := contents.(*core.PdfObjectArray); isArray {
|
||||
// If an array of content streams, append it.
|
||||
cstreams := []string{}
|
||||
for _, cstreamObj := range *contArray {
|
||||
cstreamStr, err := getContentStreamAsString(cstreamObj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
cstreams = append(cstreams, cstreamStr)
|
||||
}
|
||||
return cstreams, nil
|
||||
} else {
|
||||
// Only 1 element in place. Wrap inside a new array and add the new one.
|
||||
cstreamStr, err := getContentStreamAsString(contents)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
cstreams := []string{cstreamStr}
|
||||
return cstreams, nil
|
||||
}
|
||||
}
|
||||
|
||||
// Get all the content streams for a page as one string.
|
||||
func (pp *PdfPage) GetAllContentStreams() (string, error) {
|
||||
cstreams, err := pp.GetContentStreams()
|
||||
if err != nil {
|
||||
return "", err
|
||||
}
|
||||
return strings.Join(cstreams, " "), nil
|
||||
}
|
||||
|
||||
// Needs to have matching name and colorspace map entry. The Names define the order.
|
||||
type PdfPageResourcesColorspaces struct {
|
||||
Names []string
|
||||
Colorspaces map[string]PdfColorspace
|
||||
|
||||
container *core.PdfIndirectObject
|
||||
}
|
||||
|
||||
func NewPdfPageResourcesColorspaces() *PdfPageResourcesColorspaces {
|
||||
colorspaces := &PdfPageResourcesColorspaces{}
|
||||
colorspaces.Names = []string{}
|
||||
colorspaces.Colorspaces = map[string]PdfColorspace{}
|
||||
colorspaces.container = &core.PdfIndirectObject{}
|
||||
return colorspaces
|
||||
}
|
||||
|
||||
// Set the colorspace corresponding to key. Add to Names if not set.
|
||||
func (pp *PdfPageResourcesColorspaces) Set(key core.PdfObjectName, val PdfColorspace) {
|
||||
if _, has := pp.Colorspaces[string(key)]; !has {
|
||||
pp.Names = append(pp.Names, string(key))
|
||||
}
|
||||
pp.Colorspaces[string(key)] = val
|
||||
}
|
||||
|
||||
func newPdfPageResourcesColorspacesFromPdfObject(obj core.PdfObject) (*PdfPageResourcesColorspaces, error) {
|
||||
colorspaces := &PdfPageResourcesColorspaces{}
|
||||
|
||||
if indObj, isIndirect := obj.(*core.PdfIndirectObject); isIndirect {
|
||||
colorspaces.container = indObj
|
||||
obj = indObj.PdfObject
|
||||
}
|
||||
|
||||
dict, ok := obj.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, errors.New("CS attribute type error")
|
||||
}
|
||||
|
||||
colorspaces.Names = []string{}
|
||||
colorspaces.Colorspaces = map[string]PdfColorspace{}
|
||||
|
||||
for _, csName := range dict.Keys() {
|
||||
csObj := dict.Get(csName)
|
||||
colorspaces.Names = append(colorspaces.Names, string(csName))
|
||||
cs, err := NewPdfColorspaceFromPdfObject(csObj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
colorspaces.Colorspaces[string(csName)] = cs
|
||||
}
|
||||
|
||||
return colorspaces, nil
|
||||
}
|
||||
|
||||
func (pp *PdfPageResourcesColorspaces) ToPdfObject() core.PdfObject {
|
||||
dict := core.MakeDict()
|
||||
for _, csName := range pp.Names {
|
||||
dict.Set(core.PdfObjectName(csName), pp.Colorspaces[csName].ToPdfObject())
|
||||
}
|
||||
|
||||
if pp.container != nil {
|
||||
pp.container.PdfObject = dict
|
||||
return pp.container
|
||||
}
|
||||
|
||||
return dict
|
||||
}
|
||||
420
internal/pdf/model/pattern.go
Normal file
420
internal/pdf/model/pattern.go
Normal file
@@ -0,0 +1,420 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
|
||||
"fmt"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// A PdfPattern can represent a Pattern, either a tiling pattern or a shading pattern.
|
||||
// Note that all patterns shall be treated as colours; a Pattern colour space shall be established with the CS or cs
|
||||
// operator just like other colour spaces, and a particular pattern shall be installed as the current colour with the
|
||||
// SCN or scn operator.
|
||||
type PdfPattern struct {
|
||||
// Type: Pattern
|
||||
PatternType int64
|
||||
context PdfModel // The sub pattern, either PdfTilingPattern (Type 1) or PdfShadingPattern (Type 2).
|
||||
|
||||
container core.PdfObject
|
||||
}
|
||||
|
||||
func (pp *PdfPattern) GetContainingPdfObject() core.PdfObject {
|
||||
return pp.container
|
||||
}
|
||||
|
||||
// Context in this case is a reference to the subpattern entry: either PdfTilingPattern or PdfShadingPattern.
|
||||
func (pp *PdfPattern) GetContext() PdfModel {
|
||||
return pp.context
|
||||
}
|
||||
|
||||
// Set the sub pattern (context). Either PdfTilingPattern or PdfShadingPattern.
|
||||
func (pp *PdfPattern) SetContext(ctx PdfModel) {
|
||||
pp.context = ctx
|
||||
}
|
||||
|
||||
func (pp *PdfPattern) IsTiling() bool {
|
||||
return pp.PatternType == 1
|
||||
}
|
||||
|
||||
func (pp *PdfPattern) IsShading() bool {
|
||||
return pp.PatternType == 2
|
||||
}
|
||||
|
||||
// Check with IsTiling() prior to using this to ensure is a tiling pattern.
|
||||
func (pp *PdfPattern) GetAsTilingPattern() *PdfTilingPattern {
|
||||
return pp.context.(*PdfTilingPattern)
|
||||
}
|
||||
|
||||
// Check with IsShading() prior to using this, to ensure is a shading pattern.
|
||||
func (pp *PdfPattern) GetAsShadingPattern() *PdfShadingPattern {
|
||||
return pp.context.(*PdfShadingPattern)
|
||||
}
|
||||
|
||||
// A Tiling pattern consists of repetitions of a pattern cell with defined intervals.
|
||||
// It is a type 1 pattern. (PatternType = 1).
|
||||
// A tiling pattern is represented by a stream object, where the stream content is
|
||||
// a content stream that describes the pattern cell.
|
||||
type PdfTilingPattern struct {
|
||||
*PdfPattern
|
||||
PaintType *core.PdfObjectInteger // Colored or uncolored tiling pattern.
|
||||
TilingType *core.PdfObjectInteger // Constant spacing, no distortion or constant spacing/faster tiling.
|
||||
BBox *PdfRectangle
|
||||
XStep *core.PdfObjectFloat
|
||||
YStep *core.PdfObjectFloat
|
||||
Resources *PdfPageResources
|
||||
Matrix *core.PdfObjectArray // Pattern matrix (6 numbers).
|
||||
}
|
||||
|
||||
func (ptp *PdfTilingPattern) IsColored() bool {
|
||||
if ptp.PaintType != nil && *ptp.PaintType == 1 {
|
||||
return true
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
// GetContentStream returns the pattern cell's content stream
|
||||
func (ptp *PdfTilingPattern) GetContentStream() ([]byte, error) {
|
||||
decoded, _, err := ptp.GetContentStreamWithEncoder()
|
||||
return decoded, err
|
||||
}
|
||||
|
||||
// GetContentStreamWithEncoder returns the pattern cell's content stream and its encoder
|
||||
// TODO (v3): Change GetContentStreamWithEncoder to GetContentStream
|
||||
func (ptp *PdfTilingPattern) GetContentStreamWithEncoder() ([]byte, core.StreamEncoder, error) {
|
||||
streamObj, ok := ptp.container.(*core.PdfObjectStream)
|
||||
if !ok {
|
||||
common.Log.Debug("Tiling pattern container not a stream (got %T)", ptp.container)
|
||||
return nil, nil, ErrTypeError
|
||||
}
|
||||
|
||||
decoded, err := core.DecodeStream(streamObj)
|
||||
if err != nil {
|
||||
common.Log.Debug("Failed decoding stream, err: %v", err)
|
||||
return nil, nil, err
|
||||
}
|
||||
|
||||
encoder, err := core.NewEncoderFromStream(streamObj)
|
||||
if err != nil {
|
||||
common.Log.Debug("Failed finding decoding encoder: %v", err)
|
||||
return nil, nil, err
|
||||
}
|
||||
|
||||
return decoded, encoder, nil
|
||||
}
|
||||
|
||||
// Set the pattern cell's content stream.
|
||||
func (ptp *PdfTilingPattern) SetContentStream(content []byte, encoder core.StreamEncoder) error {
|
||||
streamObj, ok := ptp.container.(*core.PdfObjectStream)
|
||||
if !ok {
|
||||
common.Log.Debug("Tiling pattern container not a stream (got %T)", ptp.container)
|
||||
return ErrTypeError
|
||||
}
|
||||
|
||||
// If encoding is not set, use raw encoder.
|
||||
if encoder == nil {
|
||||
encoder = core.NewRawEncoder()
|
||||
}
|
||||
|
||||
streamDict := streamObj.PdfObjectDictionary
|
||||
|
||||
// Make a new stream dict based on the encoding parameters.
|
||||
encDict := encoder.MakeStreamDict()
|
||||
// Merge the encoding dict into the stream dict.
|
||||
streamDict.Merge(encDict)
|
||||
|
||||
encoded, err := encoder.EncodeBytes(content)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
// Update length.
|
||||
streamDict.Set("Length", core.MakeInteger(int64(len(encoded))))
|
||||
|
||||
streamObj.Stream = []byte(encoded)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Shading patterns provide a smooth transition between colors across an area to be painted, i.e.
|
||||
// color(x,y) = f(x,y) at each point.
|
||||
// It is a type 2 pattern (PatternType = 2).
|
||||
type PdfShadingPattern struct {
|
||||
*PdfPattern
|
||||
Shading *PdfShading
|
||||
Matrix *core.PdfObjectArray
|
||||
ExtGState core.PdfObject
|
||||
}
|
||||
|
||||
// Load a pdf pattern from an indirect object. Used in parsing/loading PDFs.
|
||||
func newPdfPatternFromPdfObject(container core.PdfObject) (*PdfPattern, error) {
|
||||
pattern := &PdfPattern{}
|
||||
|
||||
var dict *core.PdfObjectDictionary
|
||||
if indObj, is := container.(*core.PdfIndirectObject); is {
|
||||
pattern.container = indObj
|
||||
d, ok := indObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("Pattern indirect object not containing dictionary (got %T)", indObj.PdfObject)
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
dict = d
|
||||
} else if streamObj, is := container.(*core.PdfObjectStream); is {
|
||||
pattern.container = streamObj
|
||||
dict = streamObj.PdfObjectDictionary
|
||||
} else {
|
||||
common.Log.Debug("Pattern not an indirect object or stream")
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
|
||||
// PatternType.
|
||||
obj := dict.Get("PatternType")
|
||||
if obj == nil {
|
||||
common.Log.Debug("Pdf Pattern not containing PatternType")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
patternType, ok := obj.(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
common.Log.Debug("Pattern type not an integer (got %T)", obj)
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
if *patternType != 1 && *patternType != 2 {
|
||||
common.Log.Debug("Pattern type != 1/2 (got %d)", *patternType)
|
||||
return nil, ErrRangeError
|
||||
}
|
||||
pattern.PatternType = int64(*patternType)
|
||||
|
||||
switch *patternType {
|
||||
case 1: // Tiling pattern.
|
||||
ctx, err := newPdfTilingPatternFromDictionary(dict)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
ctx.PdfPattern = pattern
|
||||
pattern.context = ctx
|
||||
return pattern, nil
|
||||
case 2: // Shading pattern.
|
||||
ctx, err := newPdfShadingPatternFromDictionary(dict)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
ctx.PdfPattern = pattern
|
||||
pattern.context = ctx
|
||||
return pattern, nil
|
||||
}
|
||||
|
||||
return nil, errors.New("unknown pattern")
|
||||
}
|
||||
|
||||
// Load entries specific to a pdf tiling pattern from a dictionary. Used in parsing/loading PDFs.
|
||||
func newPdfTilingPatternFromDictionary(dict *core.PdfObjectDictionary) (*PdfTilingPattern, error) {
|
||||
pattern := &PdfTilingPattern{}
|
||||
|
||||
// PaintType (required).
|
||||
obj := dict.Get("PaintType")
|
||||
if obj == nil {
|
||||
common.Log.Debug("PaintType missing")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
paintType, ok := obj.(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
common.Log.Debug("PaintType not an integer (got %T)", obj)
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
pattern.PaintType = paintType
|
||||
|
||||
// TilingType (required).
|
||||
obj = dict.Get("TilingType")
|
||||
if obj == nil {
|
||||
common.Log.Debug("TilingType missing")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
tilingType, ok := obj.(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
common.Log.Debug("TilingType not an integer (got %T)", obj)
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
pattern.TilingType = tilingType
|
||||
|
||||
// BBox (required).
|
||||
obj = dict.Get("BBox")
|
||||
if obj == nil {
|
||||
common.Log.Debug("BBox missing")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
obj = core.TraceToDirectObject(obj)
|
||||
arr, ok := obj.(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
common.Log.Debug("BBox should be specified by an array (got %T)", obj)
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
rect, err := NewPdfRectangle(*arr)
|
||||
if err != nil {
|
||||
common.Log.Debug("BBox error: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
pattern.BBox = rect
|
||||
|
||||
// XStep (required).
|
||||
obj = dict.Get("XStep")
|
||||
if obj == nil {
|
||||
common.Log.Debug("XStep missing")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
xStep, err := getNumberAsFloat(obj)
|
||||
if err != nil {
|
||||
common.Log.Debug("error getting XStep as float: %v", xStep)
|
||||
return nil, err
|
||||
}
|
||||
pattern.XStep = core.MakeFloat(xStep)
|
||||
|
||||
// YStep (required).
|
||||
obj = dict.Get("YStep")
|
||||
if obj == nil {
|
||||
common.Log.Debug("YStep missing")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
yStep, err := getNumberAsFloat(obj)
|
||||
if err != nil {
|
||||
common.Log.Debug("error getting YStep as float: %v", yStep)
|
||||
return nil, err
|
||||
}
|
||||
pattern.YStep = core.MakeFloat(yStep)
|
||||
|
||||
// Resources (required).
|
||||
obj = dict.Get("Resources")
|
||||
if obj == nil {
|
||||
common.Log.Debug("Resources missing")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
dict, ok = core.TraceToDirectObject(obj).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, fmt.Errorf("invalid resource dictionary (%T)", obj)
|
||||
}
|
||||
resources, err := NewPdfPageResourcesFromDict(dict)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
pattern.Resources = resources
|
||||
|
||||
// Matrix (optional).
|
||||
if obj := dict.Get("Matrix"); obj != nil {
|
||||
arr, ok := obj.(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
common.Log.Debug("Matrix not an array (got %T)", obj)
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
pattern.Matrix = arr
|
||||
}
|
||||
|
||||
return pattern, nil
|
||||
}
|
||||
|
||||
// Load entries specific to a pdf shading pattern from a dictionary. Used in parsing/loading PDFs.
|
||||
func newPdfShadingPatternFromDictionary(dict *core.PdfObjectDictionary) (*PdfShadingPattern, error) {
|
||||
pattern := &PdfShadingPattern{}
|
||||
|
||||
// Shading (required).
|
||||
obj := dict.Get("Shading")
|
||||
if obj == nil {
|
||||
common.Log.Debug("Shading missing")
|
||||
return nil, ErrRequiredAttributeMissing
|
||||
}
|
||||
shading, err := newPdfShadingFromPdfObject(obj)
|
||||
if err != nil {
|
||||
common.Log.Debug("error loading shading: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
pattern.Shading = shading
|
||||
|
||||
// Matrix (optional).
|
||||
if obj := dict.Get("Matrix"); obj != nil {
|
||||
arr, ok := obj.(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
common.Log.Debug("Matrix not an array (got %T)", obj)
|
||||
return nil, ErrTypeError
|
||||
}
|
||||
pattern.Matrix = arr
|
||||
}
|
||||
|
||||
// ExtGState (optional).
|
||||
if obj := dict.Get("ExtGState"); obj != nil {
|
||||
pattern.ExtGState = obj
|
||||
}
|
||||
|
||||
return pattern, nil
|
||||
}
|
||||
|
||||
/* Conversions to pdf objects. */
|
||||
|
||||
func (pp *PdfPattern) getDict() *core.PdfObjectDictionary {
|
||||
if indObj, is := pp.container.(*core.PdfIndirectObject); is {
|
||||
dict, ok := indObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil
|
||||
}
|
||||
return dict
|
||||
} else if streamObj, is := pp.container.(*core.PdfObjectStream); is {
|
||||
return streamObj.PdfObjectDictionary
|
||||
} else {
|
||||
common.Log.Debug("Trying to access pattern dictionary of invalid object type (%T)", pp.container)
|
||||
return nil
|
||||
}
|
||||
}
|
||||
|
||||
func (pp *PdfPattern) ToPdfObject() core.PdfObject {
|
||||
d := pp.getDict()
|
||||
d.Set("Type", core.MakeName("Pattern"))
|
||||
d.Set("PatternType", core.MakeInteger(pp.PatternType))
|
||||
|
||||
return pp.container
|
||||
}
|
||||
|
||||
func (pt *PdfTilingPattern) ToPdfObject() core.PdfObject {
|
||||
pt.PdfPattern.ToPdfObject()
|
||||
|
||||
d := pt.getDict()
|
||||
if pt.PaintType != nil {
|
||||
d.Set("PaintType", pt.PaintType)
|
||||
}
|
||||
if pt.TilingType != nil {
|
||||
d.Set("TilingType", pt.TilingType)
|
||||
}
|
||||
if pt.BBox != nil {
|
||||
d.Set("BBox", pt.BBox.ToPdfObject())
|
||||
}
|
||||
if pt.XStep != nil {
|
||||
d.Set("XStep", pt.XStep)
|
||||
}
|
||||
if pt.YStep != nil {
|
||||
d.Set("YStep", pt.YStep)
|
||||
}
|
||||
if pt.Resources != nil {
|
||||
d.Set("Resources", pt.Resources.ToPdfObject())
|
||||
}
|
||||
if pt.Matrix != nil {
|
||||
d.Set("Matrix", pt.Matrix)
|
||||
}
|
||||
|
||||
return pt.container
|
||||
}
|
||||
|
||||
func (psp *PdfShadingPattern) ToPdfObject() core.PdfObject {
|
||||
psp.PdfPattern.ToPdfObject()
|
||||
d := psp.getDict()
|
||||
|
||||
if psp.Shading != nil {
|
||||
d.Set("Shading", psp.Shading.ToPdfObject())
|
||||
}
|
||||
if psp.Matrix != nil {
|
||||
d.Set("Matrix", psp.Matrix)
|
||||
}
|
||||
if psp.ExtGState != nil {
|
||||
d.Set("ExtGState", psp.ExtGState)
|
||||
}
|
||||
|
||||
return psp.container
|
||||
}
|
||||
763
internal/pdf/model/reader.go
Normal file
763
internal/pdf/model/reader.go
Normal file
@@ -0,0 +1,763 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"strings"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// PdfReader represents a PDF file reader. It is a frontend to the lower level parsing mechanism and provides
|
||||
// a higher level access to work with PDF structure and information, such as the page structure etc.
|
||||
type PdfReader struct {
|
||||
parser *core.PdfParser
|
||||
root core.PdfObject
|
||||
pages *core.PdfObjectDictionary
|
||||
pageList []*core.PdfIndirectObject
|
||||
PageList []*PdfPage
|
||||
pageCount int
|
||||
catalog *core.PdfObjectDictionary
|
||||
outlineTree *PdfOutlineTreeNode
|
||||
AcroForm *PdfAcroForm
|
||||
|
||||
modelManager *ModelManager
|
||||
|
||||
// For tracking traversal (cache).
|
||||
traversed map[core.PdfObject]bool
|
||||
}
|
||||
|
||||
// NewPdfReader returns a new PdfReader for an input io.ReadSeeker interface. Can be used to read PDF from
|
||||
// memory or file. Immediately loads and traverses the PDF structure including pages and page contents (if
|
||||
// not encrypted).
|
||||
func NewPdfReader(rs io.ReadSeeker) (*PdfReader, error) {
|
||||
pdfReader := &PdfReader{}
|
||||
pdfReader.traversed = map[core.PdfObject]bool{}
|
||||
|
||||
pdfReader.modelManager = NewModelManager()
|
||||
|
||||
// Create the parser, loads the cross reference table and trailer.
|
||||
parser, err := core.NewParser(rs)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
pdfReader.parser = parser
|
||||
|
||||
isEncrypted, err := pdfReader.IsEncrypted()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Load pdf doc structure if not encrypted.
|
||||
if !isEncrypted {
|
||||
err = pdfReader.loadStructure()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
}
|
||||
|
||||
return pdfReader, nil
|
||||
}
|
||||
|
||||
// IsEncrypted returns true if the PDF file is encrypted.
|
||||
func (pp *PdfReader) IsEncrypted() (bool, error) {
|
||||
return pp.parser.IsEncrypted()
|
||||
}
|
||||
|
||||
// GetEncryptionMethod returns a string containing some information about the encryption method used.
|
||||
// XXX/TODO: May be better to return a standardized struct with information.
|
||||
func (pp *PdfReader) GetEncryptionMethod() string {
|
||||
crypter := pp.parser.GetCrypter()
|
||||
str := crypter.Filter + " - "
|
||||
|
||||
if crypter.V == 0 {
|
||||
str += "Undocumented algorithm"
|
||||
} else if crypter.V == 1 {
|
||||
// RC4 or AES (bits: 40)
|
||||
str += "RC4: 40 bits"
|
||||
} else if crypter.V == 2 {
|
||||
str += fmt.Sprintf("RC4: %d bits", crypter.Length)
|
||||
} else if crypter.V == 3 {
|
||||
str += "Unpublished algorithm"
|
||||
} else if crypter.V >= 4 {
|
||||
// Look at CF, StmF, StrF
|
||||
str += fmt.Sprintf("Stream filter: %s - String filter: %s", crypter.StreamFilter, crypter.StringFilter)
|
||||
str += "; Crypt filters:"
|
||||
for name, cf := range crypter.CryptFilters {
|
||||
str += fmt.Sprintf(" - %s: %s (%d)", name, cf.Cfm, cf.Length)
|
||||
}
|
||||
}
|
||||
perms := crypter.GetAccessPermissions()
|
||||
str += fmt.Sprintf(" - %#v", perms)
|
||||
|
||||
return str
|
||||
}
|
||||
|
||||
// Decrypt decrypts the PDF file with a specified password. Also tries to
|
||||
// decrypt with an empty password. Returns true if successful,
|
||||
// false otherwise.
|
||||
func (pp *PdfReader) Decrypt(password []byte) (bool, error) {
|
||||
success, err := pp.parser.Decrypt(password)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
if !success {
|
||||
return false, nil
|
||||
}
|
||||
|
||||
err = pp.loadStructure()
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Fail to load structure (%s)", err)
|
||||
return false, err
|
||||
}
|
||||
|
||||
return true, nil
|
||||
}
|
||||
|
||||
// CheckAccessRights checks access rights and permissions for a specified password. If either user/owner
|
||||
// password is specified, full rights are granted, otherwise the access rights are specified by the
|
||||
// Permissions flag.
|
||||
//
|
||||
// The bool flag indicates that the user can access and view the file.
|
||||
// The AccessPermissions shows what access the user has for editing etc.
|
||||
// An error is returned if there was a problem performing the authentication.
|
||||
func (pp *PdfReader) CheckAccessRights(password []byte) (bool, core.AccessPermissions, error) {
|
||||
return pp.parser.CheckAccessRights(password)
|
||||
}
|
||||
|
||||
// Loads the structure of the pdf file: pages, outlines, etc.
|
||||
func (pp *PdfReader) loadStructure() error {
|
||||
if pp.parser.GetCrypter() != nil && !pp.parser.IsAuthenticated() {
|
||||
return fmt.Errorf("file need to be decrypted first")
|
||||
}
|
||||
|
||||
trailerDict := pp.parser.GetTrailer()
|
||||
if trailerDict == nil {
|
||||
return fmt.Errorf("missing trailer")
|
||||
}
|
||||
|
||||
// Catalog.
|
||||
root, ok := trailerDict.Get("Root").(*core.PdfObjectReference)
|
||||
if !ok {
|
||||
return fmt.Errorf("invalid Root (trailer: %s)", *trailerDict)
|
||||
}
|
||||
oc, err := pp.parser.LookupByReference(*root)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Failed to read root element catalog: %s", err)
|
||||
return err
|
||||
}
|
||||
pcatalog, ok := oc.(*core.PdfIndirectObject)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Missing catalog: (root %q) (trailer %s)", oc, *trailerDict)
|
||||
return errors.New("missing catalog")
|
||||
}
|
||||
catalog, ok := (*pcatalog).PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Invalid catalog (%s)", pcatalog.PdfObject)
|
||||
return errors.New("invalid catalog")
|
||||
}
|
||||
common.Log.Trace("Catalog: %s", catalog)
|
||||
|
||||
// Pages.
|
||||
pagesRef, ok := catalog.Get("Pages").(*core.PdfObjectReference)
|
||||
if !ok {
|
||||
return errors.New("pages in catalog should be a reference")
|
||||
}
|
||||
op, err := pp.parser.LookupByReference(*pagesRef)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Failed to read pages")
|
||||
return err
|
||||
}
|
||||
ppages, ok := op.(*core.PdfIndirectObject)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Pages object invalid")
|
||||
common.Log.Debug("op: %p", ppages)
|
||||
return errors.New("pages object invalid")
|
||||
}
|
||||
pages, ok := ppages.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Pages object invalid (%s)", ppages)
|
||||
return errors.New("pages object invalid")
|
||||
}
|
||||
pageCount, ok := pages.Get("Count").(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Pages count object invalid")
|
||||
return errors.New("pages count invalid")
|
||||
}
|
||||
|
||||
pp.root = root
|
||||
pp.catalog = catalog
|
||||
pp.pages = pages
|
||||
pp.pageCount = int(*pageCount)
|
||||
pp.pageList = []*core.PdfIndirectObject{}
|
||||
|
||||
traversedPageNodes := map[core.PdfObject]bool{}
|
||||
err = pp.buildPageList(ppages, nil, traversedPageNodes)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
common.Log.Trace("---")
|
||||
common.Log.Trace("TOC")
|
||||
common.Log.Trace("Pages")
|
||||
common.Log.Trace("%d: %s", len(pp.pageList), pp.pageList)
|
||||
|
||||
// Outlines.
|
||||
pp.outlineTree, err = pp.loadOutlines()
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Failed to build outline tree (%s)", err)
|
||||
return err
|
||||
}
|
||||
|
||||
// Load interactive forms and fields.
|
||||
pp.AcroForm, err = pp.loadForms()
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Trace to object. Keeps a list of already visited references to avoid circular references.
|
||||
//
|
||||
// Example circular reference.
|
||||
// 1 0 obj << /Next 2 0 R >>
|
||||
// 2 0 obj << /Next 1 0 R >>
|
||||
func (pp *PdfReader) traceToObjectWrapper(obj core.PdfObject, refList map[*core.PdfObjectReference]bool) (core.PdfObject, error) {
|
||||
// Keep a list of references to avoid circular references.
|
||||
|
||||
ref, isRef := obj.(*core.PdfObjectReference)
|
||||
if isRef {
|
||||
// Make sure not already visited (circular ref).
|
||||
if _, alreadyTraversed := refList[ref]; alreadyTraversed {
|
||||
return nil, errors.New("circular reference")
|
||||
}
|
||||
refList[ref] = true
|
||||
obj, err := pp.parser.LookupByReference(*ref)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return pp.traceToObjectWrapper(obj, refList)
|
||||
}
|
||||
|
||||
// Not a reference, an object. Can be indirect or any direct pdf object (other than reference).
|
||||
return obj, nil
|
||||
}
|
||||
|
||||
func (pp *PdfReader) traceToObject(obj core.PdfObject) (core.PdfObject, error) {
|
||||
refList := map[*core.PdfObjectReference]bool{}
|
||||
return pp.traceToObjectWrapper(obj, refList)
|
||||
}
|
||||
|
||||
func (pp *PdfReader) loadOutlines() (*PdfOutlineTreeNode, error) {
|
||||
if pp.parser.GetCrypter() != nil && !pp.parser.IsAuthenticated() {
|
||||
return nil, fmt.Errorf("file need to be decrypted first")
|
||||
}
|
||||
|
||||
// Has outlines? Otherwise return an empty outlines structure.
|
||||
catalog := pp.catalog
|
||||
outlinesObj := catalog.Get("Outlines")
|
||||
if outlinesObj == nil {
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
common.Log.Trace("-Has outlines")
|
||||
// Trace references to the object.
|
||||
outlineRootObj, err := pp.traceToObject(outlinesObj)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Failed to read outlines")
|
||||
return nil, err
|
||||
}
|
||||
common.Log.Trace("Outline root: %v", outlineRootObj)
|
||||
|
||||
if _, isNull := outlineRootObj.(*core.PdfObjectNull); isNull {
|
||||
common.Log.Trace("Outline root is null - no outlines")
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
outlineRoot, ok := outlineRootObj.(*core.PdfIndirectObject)
|
||||
if !ok {
|
||||
return nil, errors.New("outline root should be an indirect object")
|
||||
}
|
||||
|
||||
dict, ok := outlineRoot.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, errors.New("outline indirect object should contain a dictionary")
|
||||
}
|
||||
|
||||
common.Log.Trace("Outline root dict: %v", dict)
|
||||
|
||||
outlineTree, _, err := pp.buildOutlineTree(outlineRoot, nil, nil)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
common.Log.Trace("Resulting outline tree: %v", outlineTree)
|
||||
|
||||
return outlineTree, nil
|
||||
}
|
||||
|
||||
// Recursive build outline tree.
|
||||
// prev PdfObject,
|
||||
// Input: The indirect object containing an Outlines or Outline item dictionary.
|
||||
// Parent, Prev are the parent or previous node in the hierarchy.
|
||||
// The function returns the corresponding tree node and the last node which is used
|
||||
// for setting the Last pointer of the tree node structures.
|
||||
func (pp *PdfReader) buildOutlineTree(obj core.PdfObject, parent *PdfOutlineTreeNode, prev *PdfOutlineTreeNode) (*PdfOutlineTreeNode, *PdfOutlineTreeNode, error) {
|
||||
container, isInd := obj.(*core.PdfIndirectObject)
|
||||
if !isInd {
|
||||
return nil, nil, fmt.Errorf("outline container not an indirect object %T", obj)
|
||||
}
|
||||
dict, ok := container.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return nil, nil, errors.New("not a dictionary object")
|
||||
}
|
||||
common.Log.Trace("build outline tree: dict: %v (%v) p: %p", dict, container, container)
|
||||
|
||||
if obj := dict.Get("Title"); obj != nil {
|
||||
// Outline item has a title. (required)
|
||||
outlineItem, err := pp.newPdfOutlineItemFromIndirectObject(container)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
outlineItem.Parent = parent
|
||||
outlineItem.Prev = prev
|
||||
|
||||
if firstObj := dict.Get("First"); firstObj != nil {
|
||||
firstObj, err = pp.traceToObject(firstObj)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
if _, isNull := firstObj.(*core.PdfObjectNull); !isNull {
|
||||
first, last, err := pp.buildOutlineTree(firstObj, &outlineItem.PdfOutlineTreeNode, nil)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
outlineItem.First = first
|
||||
outlineItem.Last = last
|
||||
}
|
||||
}
|
||||
|
||||
// Resolve the reference to next
|
||||
if nextObj := dict.Get("Next"); nextObj != nil {
|
||||
nextObj, err = pp.traceToObject(nextObj)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
if _, isNull := nextObj.(*core.PdfObjectNull); !isNull {
|
||||
next, last, err := pp.buildOutlineTree(nextObj, parent, &outlineItem.PdfOutlineTreeNode)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
outlineItem.Next = next
|
||||
return &outlineItem.PdfOutlineTreeNode, last, nil
|
||||
}
|
||||
}
|
||||
|
||||
return &outlineItem.PdfOutlineTreeNode, &outlineItem.PdfOutlineTreeNode, nil
|
||||
} else {
|
||||
// Outline dictionary (structure element).
|
||||
|
||||
outline, err := newPdfOutlineFromIndirectObject(container)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
outline.Parent = parent
|
||||
//outline.Prev = parent
|
||||
|
||||
if firstObj := dict.Get("First"); firstObj != nil {
|
||||
// Has children...
|
||||
firstObj, err = pp.traceToObject(firstObj)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
if _, isNull := firstObj.(*core.PdfObjectNull); !isNull {
|
||||
first, last, err := pp.buildOutlineTree(firstObj, &outline.PdfOutlineTreeNode, nil)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
outline.First = first
|
||||
outline.Last = last
|
||||
}
|
||||
}
|
||||
return &outline.PdfOutlineTreeNode, &outline.PdfOutlineTreeNode, nil
|
||||
}
|
||||
}
|
||||
|
||||
// GetOutlineTree returns the outline tree.
|
||||
func (pp *PdfReader) GetOutlineTree() *PdfOutlineTreeNode {
|
||||
return pp.outlineTree
|
||||
}
|
||||
|
||||
// GetOutlinesFlattened returns a flattened list of tree nodes and titles.
|
||||
func (pp *PdfReader) GetOutlinesFlattened() ([]*PdfOutlineTreeNode, []string, error) {
|
||||
outlineNodeList := []*PdfOutlineTreeNode{}
|
||||
flattenedTitleList := []string{}
|
||||
|
||||
// Recursive flattening function.
|
||||
var flattenFunc func(*PdfOutlineTreeNode, *[]*PdfOutlineTreeNode, *[]string, int)
|
||||
flattenFunc = func(node *PdfOutlineTreeNode, outlineList *[]*PdfOutlineTreeNode, titleList *[]string, depth int) {
|
||||
if node == nil {
|
||||
return
|
||||
}
|
||||
if node.context == nil {
|
||||
common.Log.Debug("error: Missing node.context") // Should not happen ever.
|
||||
return
|
||||
}
|
||||
|
||||
if item, isItem := node.context.(*PdfOutlineItem); isItem {
|
||||
*outlineList = append(*outlineList, &item.PdfOutlineTreeNode)
|
||||
title := strings.Repeat(" ", depth*2) + string(*item.Title)
|
||||
*titleList = append(*titleList, title)
|
||||
if item.Next != nil {
|
||||
flattenFunc(item.Next, outlineList, titleList, depth)
|
||||
}
|
||||
}
|
||||
|
||||
if node.First != nil {
|
||||
title := strings.Repeat(" ", depth*2) + "+"
|
||||
*titleList = append(*titleList, title)
|
||||
flattenFunc(node.First, outlineList, titleList, depth+1)
|
||||
}
|
||||
}
|
||||
flattenFunc(pp.outlineTree, &outlineNodeList, &flattenedTitleList, 0)
|
||||
return outlineNodeList, flattenedTitleList, nil
|
||||
}
|
||||
|
||||
// loadForms loads the AcroForm.
|
||||
func (pp *PdfReader) loadForms() (*PdfAcroForm, error) {
|
||||
if pp.parser.GetCrypter() != nil && !pp.parser.IsAuthenticated() {
|
||||
return nil, fmt.Errorf("file need to be decrypted first")
|
||||
}
|
||||
|
||||
// Has forms?
|
||||
catalog := pp.catalog
|
||||
obj := catalog.Get("AcroForm")
|
||||
if obj == nil {
|
||||
// Nothing to load.
|
||||
return nil, nil
|
||||
}
|
||||
var err error
|
||||
obj, err = pp.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
obj = core.TraceToDirectObject(obj)
|
||||
if _, isNull := obj.(*core.PdfObjectNull); isNull {
|
||||
common.Log.Trace("Acroform is a null object (empty)\n")
|
||||
return nil, nil
|
||||
}
|
||||
|
||||
formsDict, ok := obj.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("invalid AcroForm entry %T", obj)
|
||||
common.Log.Debug("Does not have forms")
|
||||
return nil, fmt.Errorf("invalid acroform entry %T", obj)
|
||||
}
|
||||
common.Log.Trace("Has Acro forms")
|
||||
// Load it.
|
||||
|
||||
// Ensure we have access to everything.
|
||||
common.Log.Trace("Traverse the Acroforms structure")
|
||||
err = pp.traverseObjectData(formsDict)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Unable to traverse AcroForms (%s)", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Create the acro forms object.
|
||||
acroForm, err := pp.newPdfAcroFormFromDict(formsDict)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return acroForm, nil
|
||||
}
|
||||
|
||||
// Build the table of contents.
|
||||
// tree, ex: Pages -> Pages -> Pages -> Page
|
||||
// Traverse through the whole thing recursively.
|
||||
func (pp *PdfReader) buildPageList(node *core.PdfIndirectObject, parent *core.PdfIndirectObject, traversedPageNodes map[core.PdfObject]bool) error {
|
||||
if node == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
if _, alreadyTraversed := traversedPageNodes[node]; alreadyTraversed {
|
||||
common.Log.Debug("Cyclic recursion, skipping")
|
||||
return nil
|
||||
}
|
||||
traversedPageNodes[node] = true
|
||||
|
||||
nodeDict, ok := node.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return errors.New("node not a dictionary")
|
||||
}
|
||||
|
||||
objType, ok := (*nodeDict).Get("Type").(*core.PdfObjectName)
|
||||
if !ok {
|
||||
return errors.New("node missing Type (Required)")
|
||||
}
|
||||
common.Log.Trace("buildPageList node type: %s", *objType)
|
||||
if *objType == "Page" {
|
||||
p, err := pp.newPdfPageFromDict(nodeDict)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
p.setContainer(node)
|
||||
|
||||
if parent != nil {
|
||||
// Set the parent (in case missing or incorrect).
|
||||
nodeDict.Set("Parent", parent)
|
||||
}
|
||||
pp.pageList = append(pp.pageList, node)
|
||||
pp.PageList = append(pp.PageList, p)
|
||||
|
||||
return nil
|
||||
}
|
||||
if *objType != "Pages" {
|
||||
common.Log.Debug("error: Table of content containing non Page/Pages object! (%s)", objType)
|
||||
return errors.New("table of content containing non Page/Pages object")
|
||||
}
|
||||
|
||||
// A Pages object. Update the parent.
|
||||
if parent != nil {
|
||||
nodeDict.Set("Parent", parent)
|
||||
}
|
||||
|
||||
// Resolve the object recursively.
|
||||
err := pp.traverseObjectData(node)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
kidsObj, err := pp.parser.Trace(nodeDict.Get("Kids"))
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Failed loading Kids object")
|
||||
return err
|
||||
}
|
||||
|
||||
var kids *core.PdfObjectArray
|
||||
kids, ok = kidsObj.(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
kidsIndirect, isIndirect := kidsObj.(*core.PdfIndirectObject)
|
||||
if !isIndirect {
|
||||
return errors.New("invalid Kids object")
|
||||
}
|
||||
kids, ok = kidsIndirect.PdfObject.(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return errors.New("invalid Kids indirect object")
|
||||
}
|
||||
}
|
||||
common.Log.Trace("Kids: %s", kids)
|
||||
for idx, child := range *kids {
|
||||
child, ok := child.(*core.PdfIndirectObject)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Page not indirect object - (%s)", child)
|
||||
return errors.New("page not indirect object")
|
||||
}
|
||||
(*kids)[idx] = child
|
||||
err = pp.buildPageList(child, node, traversedPageNodes)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetNumPages returns the number of pages in the document.
|
||||
func (pp *PdfReader) GetNumPages() (int, error) {
|
||||
if pp.parser.GetCrypter() != nil && !pp.parser.IsAuthenticated() {
|
||||
return 0, fmt.Errorf("file need to be decrypted first")
|
||||
}
|
||||
return len(pp.pageList), nil
|
||||
}
|
||||
|
||||
// Resolves a reference, returning the object and indicates whether or not
|
||||
// it was cached.
|
||||
func (pp *PdfReader) resolveReference(ref *core.PdfObjectReference) (core.PdfObject, bool, error) {
|
||||
cachedObj, isCached := pp.parser.ObjCache[int(ref.ObjectNumber)]
|
||||
if !isCached {
|
||||
common.Log.Trace("Reader Lookup ref: %s", ref)
|
||||
obj, err := pp.parser.LookupByReference(*ref)
|
||||
if err != nil {
|
||||
return nil, false, err
|
||||
}
|
||||
pp.parser.ObjCache[int(ref.ObjectNumber)] = obj
|
||||
return obj, false, nil
|
||||
}
|
||||
return cachedObj, true, nil
|
||||
}
|
||||
|
||||
/*
|
||||
* Recursively traverse through the page object data and look up
|
||||
* references to indirect objects.
|
||||
*
|
||||
* GH: Are we fully protected against circular references? (Add tests).
|
||||
*/
|
||||
func (pp *PdfReader) traverseObjectData(o core.PdfObject) error {
|
||||
common.Log.Trace("Traverse object data")
|
||||
if _, isTraversed := pp.traversed[o]; isTraversed {
|
||||
common.Log.Trace("-Already traversed...")
|
||||
return nil
|
||||
}
|
||||
pp.traversed[o] = true
|
||||
|
||||
if io, isIndirectObj := o.(*core.PdfIndirectObject); isIndirectObj {
|
||||
common.Log.Trace("io: %s", io)
|
||||
common.Log.Trace("- %s", io.PdfObject)
|
||||
err := pp.traverseObjectData(io.PdfObject)
|
||||
return err
|
||||
}
|
||||
|
||||
if so, isStreamObj := o.(*core.PdfObjectStream); isStreamObj {
|
||||
err := pp.traverseObjectData(so.PdfObjectDictionary)
|
||||
return err
|
||||
}
|
||||
|
||||
if dict, isDict := o.(*core.PdfObjectDictionary); isDict {
|
||||
common.Log.Trace("- dict: %s", dict)
|
||||
for _, name := range dict.Keys() {
|
||||
v := dict.Get(name)
|
||||
if ref, isRef := v.(*core.PdfObjectReference); isRef {
|
||||
resolvedObj, _, err := pp.resolveReference(ref)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
dict.Set(name, resolvedObj)
|
||||
err = pp.traverseObjectData(resolvedObj)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
} else {
|
||||
err := pp.traverseObjectData(v)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
if arr, isArray := o.(*core.PdfObjectArray); isArray {
|
||||
common.Log.Trace("- array: %s", arr)
|
||||
for idx, v := range *arr {
|
||||
if ref, isRef := v.(*core.PdfObjectReference); isRef {
|
||||
resolvedObj, _, err := pp.resolveReference(ref)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
(*arr)[idx] = resolvedObj
|
||||
|
||||
err = pp.traverseObjectData(resolvedObj)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
} else {
|
||||
err := pp.traverseObjectData(v)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
if _, isRef := o.(*core.PdfObjectReference); isRef {
|
||||
common.Log.Debug("error: Reader tracing a reference!")
|
||||
return errors.New("reader tracing a reference")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// GetPageAsIndirectObject returns an indirect object containing the page dictionary for a specified page number.
|
||||
func (pp *PdfReader) GetPageAsIndirectObject(pageNumber int) (core.PdfObject, error) {
|
||||
if pp.parser.GetCrypter() != nil && !pp.parser.IsAuthenticated() {
|
||||
return nil, fmt.Errorf("file needs to be decrypted first")
|
||||
}
|
||||
if len(pp.pageList) < pageNumber {
|
||||
return nil, errors.New("invalid page number (page count too short)")
|
||||
}
|
||||
page := pp.pageList[pageNumber-1]
|
||||
|
||||
// Look up all references related to page and load everything.
|
||||
err := pp.traverseObjectData(page)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
common.Log.Trace("Page: %T %s", page, page)
|
||||
common.Log.Trace("- %T %s", page.PdfObject, page.PdfObject)
|
||||
|
||||
return page, nil
|
||||
}
|
||||
|
||||
// GetPage returns the PdfPage model for the specified page number.
|
||||
func (pp *PdfReader) GetPage(pageNumber int) (*PdfPage, error) {
|
||||
if pp.parser.GetCrypter() != nil && !pp.parser.IsAuthenticated() {
|
||||
return nil, fmt.Errorf("file needs to be decrypted first")
|
||||
}
|
||||
if len(pp.pageList) < pageNumber {
|
||||
return nil, errors.New("invalid page number (page count too short)")
|
||||
}
|
||||
idx := pageNumber - 1
|
||||
if idx < 0 {
|
||||
return nil, fmt.Errorf("page numbering must start at 1")
|
||||
}
|
||||
page := pp.PageList[idx]
|
||||
|
||||
return page, nil
|
||||
}
|
||||
|
||||
// GetOCProperties returns the optional content properties PdfObject.
|
||||
func (pp *PdfReader) GetOCProperties() (core.PdfObject, error) {
|
||||
dict := pp.catalog
|
||||
obj := dict.Get("OCProperties")
|
||||
var err error
|
||||
obj, err = pp.traceToObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
// Resolve all references...
|
||||
// Should be pretty safe. Should not be referencing to pages or
|
||||
// any large structures. Local structures and references
|
||||
// to OC Groups.
|
||||
err = pp.traverseObjectData(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return obj, nil
|
||||
}
|
||||
|
||||
// Inspect inspects the object types, subtypes and content in the PDF file returning a map of
|
||||
// object type to number of instances of each.
|
||||
func (pp *PdfReader) Inspect() (map[string]int, error) {
|
||||
return pp.parser.Inspect()
|
||||
}
|
||||
|
||||
// GetObjectNums returns the object numbers of the PDF objects in the file
|
||||
// Numbered objects are either indirect objects or stream objects.
|
||||
// e.g. objNums := pdfReader.GetObjectNums()
|
||||
// The underlying objects can then be accessed with
|
||||
// pdfReader.GetIndirectObjectByNumber(objNums[0]) for the first available object.
|
||||
func (r *PdfReader) GetObjectNums() []int {
|
||||
return r.parser.GetObjectNums()
|
||||
}
|
||||
|
||||
// GetIndirectObjectByNumber retrieves and returns a specific PdfObject by object number.
|
||||
func (pp *PdfReader) GetIndirectObjectByNumber(number int) (core.PdfObject, error) {
|
||||
obj, err := pp.parser.LookupByNumber(number)
|
||||
return obj, err
|
||||
}
|
||||
|
||||
// GetTrailer returns the PDF's trailer dictionary.
|
||||
func (pp *PdfReader) GetTrailer() (*core.PdfObjectDictionary, error) {
|
||||
trailerDict := pp.parser.GetTrailer()
|
||||
if trailerDict == nil {
|
||||
return nil, errors.New("trailer missing")
|
||||
}
|
||||
|
||||
return trailerDict, nil
|
||||
}
|
||||
406
internal/pdf/model/resources.go
Normal file
406
internal/pdf/model/resources.go
Normal file
@@ -0,0 +1,406 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// Page resources model.
|
||||
// Implements PdfModel.
|
||||
type PdfPageResources struct {
|
||||
ExtGState core.PdfObject
|
||||
ColorSpace *PdfPageResourcesColorspaces
|
||||
Pattern core.PdfObject
|
||||
Shading core.PdfObject
|
||||
XObject core.PdfObject
|
||||
Font core.PdfObject
|
||||
ProcSet core.PdfObject
|
||||
Properties core.PdfObject
|
||||
// Primitive reource container.
|
||||
primitive *core.PdfObjectDictionary
|
||||
}
|
||||
|
||||
func NewPdfPageResources() *PdfPageResources {
|
||||
r := &PdfPageResources{}
|
||||
r.primitive = core.MakeDict()
|
||||
return r
|
||||
}
|
||||
|
||||
func NewPdfPageResourcesFromDict(dict *core.PdfObjectDictionary) (*PdfPageResources, error) {
|
||||
r := NewPdfPageResources()
|
||||
|
||||
if obj := dict.Get("ExtGState"); obj != nil {
|
||||
r.ExtGState = obj
|
||||
}
|
||||
if obj := dict.Get("ColorSpace"); obj != nil && !isNullObject(obj) {
|
||||
colorspaces, err := newPdfPageResourcesColorspacesFromPdfObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
r.ColorSpace = colorspaces
|
||||
}
|
||||
if obj := dict.Get("Pattern"); obj != nil {
|
||||
r.Pattern = obj
|
||||
}
|
||||
if obj := dict.Get("Shading"); obj != nil {
|
||||
r.Shading = obj
|
||||
}
|
||||
if obj := dict.Get("XObject"); obj != nil {
|
||||
r.XObject = obj
|
||||
}
|
||||
if obj := dict.Get("Font"); obj != nil {
|
||||
r.Font = obj
|
||||
}
|
||||
if obj := dict.Get("ProcSet"); obj != nil {
|
||||
r.ProcSet = obj
|
||||
}
|
||||
if obj := dict.Get("Properties"); obj != nil {
|
||||
r.Properties = obj
|
||||
}
|
||||
|
||||
return r, nil
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) GetContainingPdfObject() core.PdfObject {
|
||||
return r.primitive
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) ToPdfObject() core.PdfObject {
|
||||
d := r.primitive
|
||||
d.SetIfNotNil("ExtGState", r.ExtGState)
|
||||
if r.ColorSpace != nil {
|
||||
d.SetIfNotNil("ColorSpace", r.ColorSpace.ToPdfObject())
|
||||
}
|
||||
d.SetIfNotNil("Pattern", r.Pattern)
|
||||
d.SetIfNotNil("Shading", r.Shading)
|
||||
d.SetIfNotNil("XObject", r.XObject)
|
||||
d.SetIfNotNil("Font", r.Font)
|
||||
d.SetIfNotNil("ProcSet", r.ProcSet)
|
||||
d.SetIfNotNil("Properties", r.Properties)
|
||||
|
||||
return d
|
||||
}
|
||||
|
||||
// Add External Graphics State (GState). The gsDict can be specified either directly as a dictionary or an indirect
|
||||
// object containing a dictionary.
|
||||
func (r *PdfPageResources) AddExtGState(gsName core.PdfObjectName, gsDict core.PdfObject) error {
|
||||
if r.ExtGState == nil {
|
||||
r.ExtGState = core.MakeDict()
|
||||
}
|
||||
|
||||
obj := r.ExtGState
|
||||
dict, ok := core.TraceToDirectObject(obj).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("ExtGState type error (got %T/%T)", obj, core.TraceToDirectObject(obj))
|
||||
return ErrTypeError
|
||||
}
|
||||
|
||||
dict.Set(gsName, gsDict)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Get the ExtGState specified by keyName. Returns a bool indicating whether it was found or not.
|
||||
func (r *PdfPageResources) GetExtGState(keyName core.PdfObjectName) (core.PdfObject, bool) {
|
||||
if r.ExtGState == nil {
|
||||
return nil, false
|
||||
}
|
||||
|
||||
dict, ok := core.TraceToDirectObject(r.ExtGState).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Invalid ExtGState entry - not a dict (got %T)", r.ExtGState)
|
||||
return nil, false
|
||||
}
|
||||
|
||||
if obj := dict.Get(keyName); obj != nil {
|
||||
return obj, true
|
||||
} else {
|
||||
return nil, false
|
||||
}
|
||||
}
|
||||
|
||||
// Check whether a font is defined by the specified keyName.
|
||||
func (r *PdfPageResources) HasExtGState(keyName core.PdfObjectName) bool {
|
||||
_, has := r.GetFontByName(keyName)
|
||||
return has
|
||||
}
|
||||
|
||||
// Get the shading specified by keyName. Returns nil if not existing. The bool flag indicated whether it was found
|
||||
// or not.
|
||||
func (r *PdfPageResources) GetShadingByName(keyName core.PdfObjectName) (*PdfShading, bool) {
|
||||
if r.Shading == nil {
|
||||
return nil, false
|
||||
}
|
||||
|
||||
shadingDict, ok := core.TraceToDirectObject(r.Shading).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Invalid Shading entry - not a dict (got %T)", r.Shading)
|
||||
return nil, false
|
||||
}
|
||||
|
||||
if obj := shadingDict.Get(keyName); obj != nil {
|
||||
shading, err := newPdfShadingFromPdfObject(obj)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: failed to load pdf shading: %v", err)
|
||||
return nil, false
|
||||
}
|
||||
return shading, true
|
||||
} else {
|
||||
return nil, false
|
||||
}
|
||||
}
|
||||
|
||||
// Set a shading resource specified by keyName.
|
||||
func (r *PdfPageResources) SetShadingByName(keyName core.PdfObjectName, shadingObj core.PdfObject) error {
|
||||
if r.Shading == nil {
|
||||
r.Shading = core.MakeDict()
|
||||
}
|
||||
|
||||
shadingDict, has := r.Shading.(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
return ErrTypeError
|
||||
}
|
||||
|
||||
shadingDict.Set(keyName, shadingObj)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Get the pattern specified by keyName. Returns nil if not existing. The bool flag indicated whether it was found
|
||||
// or not.
|
||||
func (r *PdfPageResources) GetPatternByName(keyName core.PdfObjectName) (*PdfPattern, bool) {
|
||||
if r.Pattern == nil {
|
||||
return nil, false
|
||||
}
|
||||
|
||||
patternDict, ok := core.TraceToDirectObject(r.Pattern).(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("error: Invalid Pattern entry - not a dict (got %T)", r.Pattern)
|
||||
return nil, false
|
||||
}
|
||||
|
||||
if obj := patternDict.Get(keyName); obj != nil {
|
||||
pattern, err := newPdfPatternFromPdfObject(obj)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: failed to load pdf pattern: %v", err)
|
||||
return nil, false
|
||||
}
|
||||
|
||||
return pattern, true
|
||||
} else {
|
||||
return nil, false
|
||||
}
|
||||
}
|
||||
|
||||
// Set a pattern resource specified by keyName.
|
||||
func (r *PdfPageResources) SetPatternByName(keyName core.PdfObjectName, pattern core.PdfObject) error {
|
||||
if r.Pattern == nil {
|
||||
r.Pattern = core.MakeDict()
|
||||
}
|
||||
|
||||
patternDict, has := r.Pattern.(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
return ErrTypeError
|
||||
}
|
||||
|
||||
patternDict.Set(keyName, pattern)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Get the font specified by keyName. Returns the PdfObject which the entry refers to.
|
||||
// Returns a bool value indicating whether or not the entry was found.
|
||||
func (r *PdfPageResources) GetFontByName(keyName core.PdfObjectName) (core.PdfObject, bool) {
|
||||
if r.Font == nil {
|
||||
return nil, false
|
||||
}
|
||||
|
||||
fontDict, has := core.TraceToDirectObject(r.Font).(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
common.Log.Debug("error: Font not a dictionary! (got %T)", core.TraceToDirectObject(r.Font))
|
||||
return nil, false
|
||||
}
|
||||
|
||||
if obj := fontDict.Get(keyName); obj != nil {
|
||||
return obj, true
|
||||
} else {
|
||||
return nil, false
|
||||
}
|
||||
}
|
||||
|
||||
// Check whether a font is defined by the specified keyName.
|
||||
func (r *PdfPageResources) HasFontByName(keyName core.PdfObjectName) bool {
|
||||
_, has := r.GetFontByName(keyName)
|
||||
return has
|
||||
}
|
||||
|
||||
// Set the font specified by keyName to the given object.
|
||||
func (r *PdfPageResources) SetFontByName(keyName core.PdfObjectName, obj core.PdfObject) error {
|
||||
if r.Font == nil {
|
||||
// Create if not existing.
|
||||
r.Font = core.MakeDict()
|
||||
}
|
||||
|
||||
fontDict, has := core.TraceToDirectObject(r.Font).(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
common.Log.Debug("error: Font not a dictionary! (got %T)", core.TraceToDirectObject(r.Font))
|
||||
return ErrTypeError
|
||||
}
|
||||
|
||||
fontDict.Set(keyName, obj)
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) GetColorspaceByName(keyName core.PdfObjectName) (PdfColorspace, bool) {
|
||||
if r.ColorSpace == nil {
|
||||
return nil, false
|
||||
}
|
||||
|
||||
cs, has := r.ColorSpace.Colorspaces[string(keyName)]
|
||||
if !has {
|
||||
return nil, false
|
||||
}
|
||||
|
||||
return cs, true
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) HasColorspaceByName(keyName core.PdfObjectName) bool {
|
||||
if r.ColorSpace == nil {
|
||||
return false
|
||||
}
|
||||
|
||||
_, has := r.ColorSpace.Colorspaces[string(keyName)]
|
||||
return has
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) SetColorspaceByName(keyName core.PdfObjectName, cs PdfColorspace) error {
|
||||
if r.ColorSpace == nil {
|
||||
r.ColorSpace = NewPdfPageResourcesColorspaces()
|
||||
}
|
||||
|
||||
r.ColorSpace.Set(keyName, cs)
|
||||
return nil
|
||||
}
|
||||
|
||||
// Check if an XObject with a specified keyName is defined.
|
||||
func (r *PdfPageResources) HasXObjectByName(keyName core.PdfObjectName) bool {
|
||||
obj, _ := r.GetXObjectByName(keyName)
|
||||
if obj != nil {
|
||||
return true
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
type XObjectType int
|
||||
|
||||
const (
|
||||
XObjectTypeUndefined XObjectType = iota
|
||||
XObjectTypeImage XObjectType = iota
|
||||
XObjectTypeForm XObjectType = iota
|
||||
XObjectTypePS XObjectType = iota
|
||||
XObjectTypeUnknown XObjectType = iota
|
||||
)
|
||||
|
||||
// Returns the XObject with the specified keyName and the object type.
|
||||
func (r *PdfPageResources) GetXObjectByName(keyName core.PdfObjectName) (*core.PdfObjectStream, XObjectType) {
|
||||
if r.XObject == nil {
|
||||
return nil, XObjectTypeUndefined
|
||||
}
|
||||
|
||||
xresDict, has := core.TraceToDirectObject(r.XObject).(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
common.Log.Debug("error: XObject not a dictionary! (got %T)", core.TraceToDirectObject(r.XObject))
|
||||
return nil, XObjectTypeUndefined
|
||||
}
|
||||
|
||||
if obj := xresDict.Get(keyName); obj != nil {
|
||||
stream, ok := obj.(*core.PdfObjectStream)
|
||||
if !ok {
|
||||
common.Log.Debug("XObject not pointing to a stream %T", obj)
|
||||
return nil, XObjectTypeUndefined
|
||||
}
|
||||
dict := stream.PdfObjectDictionary
|
||||
|
||||
name, ok := core.TraceToDirectObject(dict.Get("Subtype")).(*core.PdfObjectName)
|
||||
if !ok {
|
||||
common.Log.Debug("XObject Subtype not a Name, dict: %s", dict.String())
|
||||
return nil, XObjectTypeUndefined
|
||||
}
|
||||
|
||||
switch *name {
|
||||
case "Image":
|
||||
return stream, XObjectTypeImage
|
||||
case "Form":
|
||||
return stream, XObjectTypeForm
|
||||
case "PS":
|
||||
return stream, XObjectTypePS
|
||||
default:
|
||||
common.Log.Debug("XObject Subtype not known (%s)", *name)
|
||||
return nil, XObjectTypeUndefined
|
||||
}
|
||||
} else {
|
||||
return nil, XObjectTypeUndefined
|
||||
}
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) SetXObjectByName(keyName core.PdfObjectName, stream *core.PdfObjectStream) error {
|
||||
if r.XObject == nil {
|
||||
r.XObject = core.MakeDict()
|
||||
}
|
||||
|
||||
obj := core.TraceToDirectObject(r.XObject)
|
||||
xresDict, has := obj.(*core.PdfObjectDictionary)
|
||||
if !has {
|
||||
common.Log.Debug("invalid XObject, got %T/%T", r.XObject, obj)
|
||||
return errors.New("type check error")
|
||||
}
|
||||
|
||||
xresDict.Set(keyName, stream)
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) GetXObjectImageByName(keyName core.PdfObjectName) (*XObjectImage, error) {
|
||||
stream, xtype := r.GetXObjectByName(keyName)
|
||||
if stream == nil {
|
||||
return nil, nil
|
||||
}
|
||||
if xtype != XObjectTypeImage {
|
||||
return nil, errors.New("not an image")
|
||||
}
|
||||
|
||||
ximg, err := NewXObjectImageFromStream(stream)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return ximg, nil
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) SetXObjectImageByName(keyName core.PdfObjectName, ximg *XObjectImage) error {
|
||||
stream := ximg.ToPdfObject().(*core.PdfObjectStream)
|
||||
err := r.SetXObjectByName(keyName, stream)
|
||||
return err
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) GetXObjectFormByName(keyName core.PdfObjectName) (*XObjectForm, error) {
|
||||
stream, xtype := r.GetXObjectByName(keyName)
|
||||
if stream == nil {
|
||||
return nil, nil
|
||||
}
|
||||
if xtype != XObjectTypeForm {
|
||||
return nil, errors.New("not a form")
|
||||
}
|
||||
|
||||
xform, err := NewXObjectFormFromStream(stream)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return xform, nil
|
||||
}
|
||||
|
||||
func (r *PdfPageResources) SetXObjectFormByName(keyName core.PdfObjectName, xform *XObjectForm) error {
|
||||
stream := xform.ToPdfObject().(*core.PdfObjectStream)
|
||||
err := r.SetXObjectByName(keyName, stream)
|
||||
return err
|
||||
}
|
||||
191
internal/pdf/model/sampling/resample.go
Normal file
191
internal/pdf/model/sampling/resample.go
Normal file
@@ -0,0 +1,191 @@
|
||||
package sampling
|
||||
|
||||
// Resample the raw data which is in 8-bit (byte) format as a different
|
||||
// bit count per sample, up to 32 bits (uint32).
|
||||
func ResampleBytes(data []byte, bitsPerSample int) []uint32 {
|
||||
samples := []uint32{}
|
||||
|
||||
bitsLeftPerSample := bitsPerSample
|
||||
var sample uint32
|
||||
var remainder byte
|
||||
remainderBits := 0
|
||||
|
||||
index := 0
|
||||
|
||||
i := 0
|
||||
for i < len(data) {
|
||||
// Start with the remainder.
|
||||
if remainderBits > 0 {
|
||||
take := remainderBits
|
||||
if bitsLeftPerSample < take {
|
||||
take = bitsLeftPerSample
|
||||
}
|
||||
|
||||
sample = (sample << uint(take)) | uint32(remainder>>uint(8-take))
|
||||
remainderBits -= take
|
||||
if remainderBits > 0 {
|
||||
remainder = remainder << uint(take)
|
||||
} else {
|
||||
remainder = 0
|
||||
}
|
||||
bitsLeftPerSample -= take
|
||||
if bitsLeftPerSample == 0 {
|
||||
//samples[index] = sample
|
||||
samples = append(samples, sample)
|
||||
bitsLeftPerSample = bitsPerSample
|
||||
sample = 0
|
||||
index++
|
||||
}
|
||||
} else {
|
||||
// Take next byte
|
||||
b := data[i]
|
||||
i++
|
||||
|
||||
// 8 bits.
|
||||
take := 8
|
||||
if bitsLeftPerSample < take {
|
||||
take = bitsLeftPerSample
|
||||
}
|
||||
remainderBits = 8 - take
|
||||
sample = (sample << uint(take)) | uint32(b>>uint(remainderBits))
|
||||
|
||||
if take < 8 {
|
||||
remainder = b << uint(take)
|
||||
}
|
||||
|
||||
bitsLeftPerSample -= take
|
||||
if bitsLeftPerSample == 0 {
|
||||
//samples[index] = sample
|
||||
samples = append(samples, sample)
|
||||
bitsLeftPerSample = bitsPerSample
|
||||
sample = 0
|
||||
index++
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Take care of remaining samples (if enough data available).
|
||||
for remainderBits >= bitsPerSample {
|
||||
take := remainderBits
|
||||
if bitsLeftPerSample < take {
|
||||
take = bitsLeftPerSample
|
||||
}
|
||||
|
||||
sample = (sample << uint(take)) | uint32(remainder>>uint(8-take))
|
||||
remainderBits -= take
|
||||
if remainderBits > 0 {
|
||||
remainder = remainder << uint(take)
|
||||
} else {
|
||||
remainder = 0
|
||||
}
|
||||
bitsLeftPerSample -= take
|
||||
if bitsLeftPerSample == 0 {
|
||||
//samples[index] = sample
|
||||
samples = append(samples, sample)
|
||||
bitsLeftPerSample = bitsPerSample
|
||||
sample = 0
|
||||
index++
|
||||
}
|
||||
}
|
||||
|
||||
return samples
|
||||
}
|
||||
|
||||
// Resample the raw data which is in <=32-bit (uint32) format as a different
|
||||
// bit count per sample, up to 32 bits (uint32).
|
||||
//
|
||||
// bitsPerOutputSample is the number of bits for each output sample (up to 32)
|
||||
// bitsPerInputSample is the number of bits used in each input sample (up to 32)
|
||||
func ResampleUint32(data []uint32, bitsPerInputSample int, bitsPerOutputSample int) []uint32 {
|
||||
samples := []uint32{}
|
||||
|
||||
bitsLeftPerSample := bitsPerOutputSample
|
||||
var sample uint32
|
||||
var remainder uint32
|
||||
remainderBits := 0
|
||||
|
||||
index := 0
|
||||
|
||||
i := 0
|
||||
for i < len(data) {
|
||||
// Start with the remainder.
|
||||
if remainderBits > 0 {
|
||||
take := remainderBits
|
||||
if bitsLeftPerSample < take {
|
||||
take = bitsLeftPerSample
|
||||
}
|
||||
|
||||
sample = (sample << uint(take)) | uint32(remainder>>uint(bitsPerInputSample-take))
|
||||
remainderBits -= take
|
||||
if remainderBits > 0 {
|
||||
remainder = remainder << uint(take)
|
||||
} else {
|
||||
remainder = 0
|
||||
}
|
||||
bitsLeftPerSample -= take
|
||||
if bitsLeftPerSample == 0 {
|
||||
//samples[index] = sample
|
||||
samples = append(samples, sample)
|
||||
bitsLeftPerSample = bitsPerOutputSample
|
||||
sample = 0
|
||||
index++
|
||||
}
|
||||
} else {
|
||||
// Take next byte
|
||||
b := data[i]
|
||||
i++
|
||||
|
||||
// 32 bits.
|
||||
take := bitsPerInputSample
|
||||
if bitsLeftPerSample < take {
|
||||
take = bitsLeftPerSample
|
||||
}
|
||||
remainderBits = bitsPerInputSample - take
|
||||
sample = (sample << uint(take)) | uint32(b>>uint(remainderBits))
|
||||
|
||||
if take < bitsPerInputSample {
|
||||
remainder = b << uint(take)
|
||||
}
|
||||
|
||||
bitsLeftPerSample -= take
|
||||
if bitsLeftPerSample == 0 {
|
||||
//samples[index] = sample
|
||||
samples = append(samples, sample)
|
||||
bitsLeftPerSample = bitsPerOutputSample
|
||||
sample = 0
|
||||
index++
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Take care of remaining samples (if enough data available).
|
||||
for remainderBits >= bitsPerOutputSample {
|
||||
take := remainderBits
|
||||
if bitsLeftPerSample < take {
|
||||
take = bitsLeftPerSample
|
||||
}
|
||||
|
||||
sample = (sample << uint(take)) | uint32(remainder>>uint(bitsPerInputSample-take))
|
||||
remainderBits -= take
|
||||
if remainderBits > 0 {
|
||||
remainder = remainder << uint(take)
|
||||
} else {
|
||||
remainder = 0
|
||||
}
|
||||
bitsLeftPerSample -= take
|
||||
if bitsLeftPerSample == 0 {
|
||||
samples = append(samples, sample)
|
||||
bitsLeftPerSample = bitsPerOutputSample
|
||||
sample = 0
|
||||
index++
|
||||
}
|
||||
}
|
||||
|
||||
// If there are partial output samples, pad with 0s.
|
||||
if bitsLeftPerSample > 0 && bitsLeftPerSample < bitsPerOutputSample {
|
||||
sample <<= uint(bitsLeftPerSample)
|
||||
samples = append(samples, sample)
|
||||
}
|
||||
|
||||
return samples
|
||||
}
|
||||
1102
internal/pdf/model/shading.go
Normal file
1102
internal/pdf/model/shading.go
Normal file
File diff suppressed because it is too large
Load Diff
129
internal/pdf/model/structures.go
Normal file
129
internal/pdf/model/structures.go
Normal file
@@ -0,0 +1,129 @@
|
||||
package model
|
||||
|
||||
// Common basic data structures: PdfRectangle, PdfDate, etc.
|
||||
// These kinds of data structures can be copied, do not need a unique copy of each object.
|
||||
|
||||
import (
|
||||
"errors"
|
||||
"fmt"
|
||||
"regexp"
|
||||
"strconv"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// Definition of a rectangle.
|
||||
type PdfRectangle struct {
|
||||
Llx float64 // Lower left corner (ll).
|
||||
Lly float64
|
||||
Urx float64 // Upper right corner (ur).
|
||||
Ury float64
|
||||
}
|
||||
|
||||
// Create a PDF rectangle object based on an input array of 4 integers.
|
||||
// Defining the lower left (LL) and upper right (UR) corners with
|
||||
// floating point numbers.
|
||||
func NewPdfRectangle(arr core.PdfObjectArray) (*PdfRectangle, error) {
|
||||
rect := PdfRectangle{}
|
||||
if len(arr) != 4 {
|
||||
return nil, errors.New("invalid rectangle array, len != 4")
|
||||
}
|
||||
|
||||
var err error
|
||||
rect.Llx, err = getNumberAsFloat(arr[0])
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
rect.Lly, err = getNumberAsFloat(arr[1])
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
rect.Urx, err = getNumberAsFloat(arr[2])
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
rect.Ury, err = getNumberAsFloat(arr[3])
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return &rect, nil
|
||||
}
|
||||
|
||||
// Convert to a PDF object.
|
||||
func (rect *PdfRectangle) ToPdfObject() core.PdfObject {
|
||||
arr := core.PdfObjectArray{}
|
||||
arr = append(arr, core.MakeFloat(rect.Llx))
|
||||
arr = append(arr, core.MakeFloat(rect.Lly))
|
||||
arr = append(arr, core.MakeFloat(rect.Urx))
|
||||
arr = append(arr, core.MakeFloat(rect.Ury))
|
||||
return &arr
|
||||
}
|
||||
|
||||
// A date is a PDF string of the form:
|
||||
// (D:YYYYMMDDHHmmSSOHH'mm)
|
||||
type PdfDate struct {
|
||||
year int64 // YYYY
|
||||
month int64 // MM (01-12)
|
||||
day int64 // DD (01-31)
|
||||
hour int64 // HH (00-23)
|
||||
minute int64 // mm (00-59)
|
||||
second int64 // SS (00-59)
|
||||
utOffsetSign byte // O ('+' / '-' / 'Z')
|
||||
utOffsetHours int64 // HH' (00-23 followed by ')
|
||||
utOffsetMins int64 // mm (00-59)
|
||||
}
|
||||
|
||||
var reDate = regexp.MustCompile(`\s*D\s*:\s*(\d{4})(\d{2})(\d{2})(\d{2})(\d{2})(\d{2})([+-Z])?(\d{2})?'?(\d{2})?`)
|
||||
|
||||
// Make a new PdfDate object from a PDF date string (see 7.9.4 Dates).
|
||||
// format: "D: YYYYMMDDHHmmSSOHH'mm"
|
||||
func NewPdfDate(dateStr string) (PdfDate, error) {
|
||||
d := PdfDate{}
|
||||
|
||||
matches := reDate.FindAllStringSubmatch(dateStr, 1)
|
||||
if len(matches) < 1 {
|
||||
return d, fmt.Errorf("invalid date string (%s)", dateStr)
|
||||
}
|
||||
if len(matches[0]) != 10 {
|
||||
return d, errors.New("invalid regexp group match length != 10")
|
||||
}
|
||||
|
||||
// No need to handle err from ParseInt, as pre-validated via regexp.
|
||||
d.year, _ = strconv.ParseInt(matches[0][1], 10, 32)
|
||||
d.month, _ = strconv.ParseInt(matches[0][2], 10, 32)
|
||||
d.day, _ = strconv.ParseInt(matches[0][3], 10, 32)
|
||||
d.hour, _ = strconv.ParseInt(matches[0][4], 10, 32)
|
||||
d.minute, _ = strconv.ParseInt(matches[0][5], 10, 32)
|
||||
d.second, _ = strconv.ParseInt(matches[0][6], 10, 32)
|
||||
// Some poor implementations do not include the offset.
|
||||
if len(matches[0][7]) > 0 {
|
||||
d.utOffsetSign = matches[0][7][0]
|
||||
} else {
|
||||
d.utOffsetSign = '+'
|
||||
}
|
||||
if len(matches[0][8]) > 0 {
|
||||
d.utOffsetHours, _ = strconv.ParseInt(matches[0][8], 10, 32)
|
||||
} else {
|
||||
d.utOffsetHours = 0
|
||||
}
|
||||
if len(matches[0][9]) > 0 {
|
||||
d.utOffsetMins, _ = strconv.ParseInt(matches[0][9], 10, 32)
|
||||
} else {
|
||||
d.utOffsetMins = 0
|
||||
}
|
||||
|
||||
return d, nil
|
||||
}
|
||||
|
||||
// Convert to a PDF string object.
|
||||
func (date *PdfDate) ToPdfObject() core.PdfObject {
|
||||
str := fmt.Sprintf("D:%.4d%.2d%.2d%.2d%.2d%.2d%c%.2d'%.2d'",
|
||||
date.year, date.month, date.day, date.hour, date.minute, date.second,
|
||||
date.utOffsetSign, date.utOffsetHours, date.utOffsetMins)
|
||||
pdfStr := core.PdfObjectString(str)
|
||||
return &pdfStr
|
||||
}
|
||||
34
internal/pdf/model/textencoding/encoder.go
Normal file
34
internal/pdf/model/textencoding/encoder.go
Normal file
@@ -0,0 +1,34 @@
|
||||
package textencoding
|
||||
|
||||
import "gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
|
||||
type TextEncoder interface {
|
||||
// Convert a raw utf8 string (series of runes) to an encoded string (series of character codes) to be used in PDF.
|
||||
Encode(raw string) string
|
||||
|
||||
// Conversion between character code and glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
CharcodeToGlyph(code byte) (string, bool)
|
||||
|
||||
// Conversion between glyph name and character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
GlyphToCharcode(glyph string) (byte, bool)
|
||||
|
||||
// Convert rune to character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
RuneToCharcode(val rune) (byte, bool)
|
||||
|
||||
// Convert character code to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
CharcodeToRune(charcode byte) (rune, bool)
|
||||
|
||||
// Convert rune to glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
RuneToGlyph(val rune) (string, bool)
|
||||
|
||||
// Convert glyph to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
GlyphToRune(glyph string) (rune, bool)
|
||||
|
||||
ToPdfObject() core.PdfObject
|
||||
}
|
||||
8569
internal/pdf/model/textencoding/glyphs_glyphlist.go
Normal file
8569
internal/pdf/model/textencoding/glyphs_glyphlist.go
Normal file
File diff suppressed because it is too large
Load Diff
409
internal/pdf/model/textencoding/glyphs_zapfdingbats.go
Normal file
409
internal/pdf/model/textencoding/glyphs_zapfdingbats.go
Normal file
@@ -0,0 +1,409 @@
|
||||
package textencoding
|
||||
|
||||
var zapfdingbatsGlyphToRuneMap = map[string]rune{
|
||||
"a1": '\u2701',
|
||||
"a10": '\u2721',
|
||||
"a100": '\u275e',
|
||||
"a101": '\u2761',
|
||||
"a102": '\u2762',
|
||||
"a103": '\u2763',
|
||||
"a104": '\u2764',
|
||||
"a105": '\u2710',
|
||||
"a106": '\u2765',
|
||||
"a107": '\u2766',
|
||||
"a108": '\u2767',
|
||||
"a109": '\u2660',
|
||||
"a11": '\u261b',
|
||||
"a110": '\u2665',
|
||||
"a111": '\u2666',
|
||||
"a112": '\u2663',
|
||||
"a117": '\u2709',
|
||||
"a118": '\u2708',
|
||||
"a119": '\u2707',
|
||||
"a12": '\u261e',
|
||||
"a120": '\u2460',
|
||||
"a121": '\u2461',
|
||||
"a122": '\u2462',
|
||||
"a123": '\u2463',
|
||||
"a124": '\u2464',
|
||||
"a125": '\u2465',
|
||||
"a126": '\u2466',
|
||||
"a127": '\u2467',
|
||||
"a128": '\u2468',
|
||||
"a129": '\u2469',
|
||||
"a13": '\u270c',
|
||||
"a130": '\u2776',
|
||||
"a131": '\u2777',
|
||||
"a132": '\u2778',
|
||||
"a133": '\u2779',
|
||||
"a134": '\u277a',
|
||||
"a135": '\u277b',
|
||||
"a136": '\u277c',
|
||||
"a137": '\u277d',
|
||||
"a138": '\u277e',
|
||||
"a139": '\u277f',
|
||||
"a14": '\u270d',
|
||||
"a140": '\u2780',
|
||||
"a141": '\u2781',
|
||||
"a142": '\u2782',
|
||||
"a143": '\u2783',
|
||||
"a144": '\u2784',
|
||||
"a145": '\u2785',
|
||||
"a146": '\u2786',
|
||||
"a147": '\u2787',
|
||||
"a148": '\u2788',
|
||||
"a149": '\u2789',
|
||||
"a15": '\u270e',
|
||||
"a150": '\u278a',
|
||||
"a151": '\u278b',
|
||||
"a152": '\u278c',
|
||||
"a153": '\u278d',
|
||||
"a154": '\u278e',
|
||||
"a155": '\u278f',
|
||||
"a156": '\u2790',
|
||||
"a157": '\u2791',
|
||||
"a158": '\u2792',
|
||||
"a159": '\u2793',
|
||||
"a16": '\u270f',
|
||||
"a160": '\u2794',
|
||||
"a161": '\u2192',
|
||||
"a162": '\u27a3',
|
||||
"a163": '\u2194',
|
||||
"a164": '\u2195',
|
||||
"a165": '\u2799',
|
||||
"a166": '\u279b',
|
||||
"a167": '\u279c',
|
||||
"a168": '\u279d',
|
||||
"a169": '\u279e',
|
||||
"a17": '\u2711',
|
||||
"a170": '\u279f',
|
||||
"a171": '\u27a0',
|
||||
"a172": '\u27a1',
|
||||
"a173": '\u27a2',
|
||||
"a174": '\u27a4',
|
||||
"a175": '\u27a5',
|
||||
"a176": '\u27a6',
|
||||
"a177": '\u27a7',
|
||||
"a178": '\u27a8',
|
||||
"a179": '\u27a9',
|
||||
"a18": '\u2712',
|
||||
"a180": '\u27ab',
|
||||
"a181": '\u27ad',
|
||||
"a182": '\u27af',
|
||||
"a183": '\u27b2',
|
||||
"a184": '\u27b3',
|
||||
"a185": '\u27b5',
|
||||
"a186": '\u27b8',
|
||||
"a187": '\u27ba',
|
||||
"a188": '\u27bb',
|
||||
"a189": '\u27bc',
|
||||
"a19": '\u2713',
|
||||
"a190": '\u27bd',
|
||||
"a191": '\u27be',
|
||||
"a192": '\u279a',
|
||||
"a193": '\u27aa',
|
||||
"a194": '\u27b6',
|
||||
"a195": '\u27b9',
|
||||
"a196": '\u2798',
|
||||
"a197": '\u27b4',
|
||||
"a198": '\u27b7',
|
||||
"a199": '\u27ac',
|
||||
"a2": '\u2702',
|
||||
"a20": '\u2714',
|
||||
"a200": '\u27ae',
|
||||
"a201": '\u27b1',
|
||||
"a202": '\u2703',
|
||||
"a203": '\u2750',
|
||||
"a204": '\u2752',
|
||||
"a205": '\u276e',
|
||||
"a206": '\u2770',
|
||||
"a21": '\u2715',
|
||||
"a22": '\u2716',
|
||||
"a23": '\u2717',
|
||||
"a24": '\u2718',
|
||||
"a25": '\u2719',
|
||||
"a26": '\u271a',
|
||||
"a27": '\u271b',
|
||||
"a28": '\u271c',
|
||||
"a29": '\u2722',
|
||||
"a3": '\u2704',
|
||||
"a30": '\u2723',
|
||||
"a31": '\u2724',
|
||||
"a32": '\u2725',
|
||||
"a33": '\u2726',
|
||||
"a34": '\u2727',
|
||||
"a35": '\u2605',
|
||||
"a36": '\u2729',
|
||||
"a37": '\u272a',
|
||||
"a38": '\u272b',
|
||||
"a39": '\u272c',
|
||||
"a4": '\u260e',
|
||||
"a40": '\u272d',
|
||||
"a41": '\u272e',
|
||||
"a42": '\u272f',
|
||||
"a43": '\u2730',
|
||||
"a44": '\u2731',
|
||||
"a45": '\u2732',
|
||||
"a46": '\u2733',
|
||||
"a47": '\u2734',
|
||||
"a48": '\u2735',
|
||||
"a49": '\u2736',
|
||||
"a5": '\u2706',
|
||||
"a50": '\u2737',
|
||||
"a51": '\u2738',
|
||||
"a52": '\u2739',
|
||||
"a53": '\u273a',
|
||||
"a54": '\u273b',
|
||||
"a55": '\u273c',
|
||||
"a56": '\u273d',
|
||||
"a57": '\u273e',
|
||||
"a58": '\u273f',
|
||||
"a59": '\u2740',
|
||||
"a6": '\u271d',
|
||||
"a60": '\u2741',
|
||||
"a61": '\u2742',
|
||||
"a62": '\u2743',
|
||||
"a63": '\u2744',
|
||||
"a64": '\u2745',
|
||||
"a65": '\u2746',
|
||||
"a66": '\u2747',
|
||||
"a67": '\u2748',
|
||||
"a68": '\u2749',
|
||||
"a69": '\u274a',
|
||||
"a7": '\u271e',
|
||||
"a70": '\u274b',
|
||||
"a71": '\u25cf',
|
||||
"a72": '\u274d',
|
||||
"a73": '\u25a0',
|
||||
"a74": '\u274f',
|
||||
"a75": '\u2751',
|
||||
"a76": '\u25b2',
|
||||
"a77": '\u25bc',
|
||||
"a78": '\u25c6',
|
||||
"a79": '\u2756',
|
||||
"a8": '\u271f',
|
||||
"a81": '\u25d7',
|
||||
"a82": '\u2758',
|
||||
"a83": '\u2759',
|
||||
"a84": '\u275a',
|
||||
"a85": '\u276f',
|
||||
"a86": '\u2771',
|
||||
"a87": '\u2772',
|
||||
"a88": '\u2773',
|
||||
"a89": '\u2768',
|
||||
"a9": '\u2720',
|
||||
"a90": '\u2769',
|
||||
"a91": '\u276c',
|
||||
"a92": '\u276d',
|
||||
"a93": '\u276a',
|
||||
"a94": '\u276b',
|
||||
"a95": '\u2774',
|
||||
"a96": '\u2775',
|
||||
"a97": '\u275b',
|
||||
"a98": '\u275c',
|
||||
"a99": '\u275d',
|
||||
}
|
||||
|
||||
var zapfdingbatsRuneToGlyphMap = map[rune]string{
|
||||
'\u2701': "a1",
|
||||
'\u2721': "a10",
|
||||
'\u275e': "a100",
|
||||
'\u2761': "a101",
|
||||
'\u2762': "a102",
|
||||
'\u2763': "a103",
|
||||
'\u2764': "a104",
|
||||
'\u2710': "a105",
|
||||
'\u2765': "a106",
|
||||
'\u2766': "a107",
|
||||
'\u2767': "a108",
|
||||
'\u2660': "a109",
|
||||
'\u261b': "a11",
|
||||
'\u2665': "a110",
|
||||
'\u2666': "a111",
|
||||
'\u2663': "a112",
|
||||
'\u2709': "a117",
|
||||
'\u2708': "a118",
|
||||
'\u2707': "a119",
|
||||
'\u261e': "a12",
|
||||
'\u2460': "a120",
|
||||
'\u2461': "a121",
|
||||
'\u2462': "a122",
|
||||
'\u2463': "a123",
|
||||
'\u2464': "a124",
|
||||
'\u2465': "a125",
|
||||
'\u2466': "a126",
|
||||
'\u2467': "a127",
|
||||
'\u2468': "a128",
|
||||
'\u2469': "a129",
|
||||
'\u270c': "a13",
|
||||
'\u2776': "a130",
|
||||
'\u2777': "a131",
|
||||
'\u2778': "a132",
|
||||
'\u2779': "a133",
|
||||
'\u277a': "a134",
|
||||
'\u277b': "a135",
|
||||
'\u277c': "a136",
|
||||
'\u277d': "a137",
|
||||
'\u277e': "a138",
|
||||
'\u277f': "a139",
|
||||
'\u270d': "a14",
|
||||
'\u2780': "a140",
|
||||
'\u2781': "a141",
|
||||
'\u2782': "a142",
|
||||
'\u2783': "a143",
|
||||
'\u2784': "a144",
|
||||
'\u2785': "a145",
|
||||
'\u2786': "a146",
|
||||
'\u2787': "a147",
|
||||
'\u2788': "a148",
|
||||
'\u2789': "a149",
|
||||
'\u270e': "a15",
|
||||
'\u278a': "a150",
|
||||
'\u278b': "a151",
|
||||
'\u278c': "a152",
|
||||
'\u278d': "a153",
|
||||
'\u278e': "a154",
|
||||
'\u278f': "a155",
|
||||
'\u2790': "a156",
|
||||
'\u2791': "a157",
|
||||
'\u2792': "a158",
|
||||
'\u2793': "a159",
|
||||
'\u270f': "a16",
|
||||
'\u2794': "a160",
|
||||
'\u2192': "a161",
|
||||
'\u27a3': "a162",
|
||||
'\u2194': "a163",
|
||||
'\u2195': "a164",
|
||||
'\u2799': "a165",
|
||||
'\u279b': "a166",
|
||||
'\u279c': "a167",
|
||||
'\u279d': "a168",
|
||||
'\u279e': "a169",
|
||||
'\u2711': "a17",
|
||||
'\u279f': "a170",
|
||||
'\u27a0': "a171",
|
||||
'\u27a1': "a172",
|
||||
'\u27a2': "a173",
|
||||
'\u27a4': "a174",
|
||||
'\u27a5': "a175",
|
||||
'\u27a6': "a176",
|
||||
'\u27a7': "a177",
|
||||
'\u27a8': "a178",
|
||||
'\u27a9': "a179",
|
||||
'\u2712': "a18",
|
||||
'\u27ab': "a180",
|
||||
'\u27ad': "a181",
|
||||
'\u27af': "a182",
|
||||
'\u27b2': "a183",
|
||||
'\u27b3': "a184",
|
||||
'\u27b5': "a185",
|
||||
'\u27b8': "a186",
|
||||
'\u27ba': "a187",
|
||||
'\u27bb': "a188",
|
||||
'\u27bc': "a189",
|
||||
'\u2713': "a19",
|
||||
'\u27bd': "a190",
|
||||
'\u27be': "a191",
|
||||
'\u279a': "a192",
|
||||
'\u27aa': "a193",
|
||||
'\u27b6': "a194",
|
||||
'\u27b9': "a195",
|
||||
'\u2798': "a196",
|
||||
'\u27b4': "a197",
|
||||
'\u27b7': "a198",
|
||||
'\u27ac': "a199",
|
||||
'\u2702': "a2",
|
||||
'\u2714': "a20",
|
||||
'\u27ae': "a200",
|
||||
'\u27b1': "a201",
|
||||
'\u2703': "a202",
|
||||
'\u2750': "a203",
|
||||
'\u2752': "a204",
|
||||
'\u276e': "a205",
|
||||
'\u2770': "a206",
|
||||
'\u2715': "a21",
|
||||
'\u2716': "a22",
|
||||
'\u2717': "a23",
|
||||
'\u2718': "a24",
|
||||
'\u2719': "a25",
|
||||
'\u271a': "a26",
|
||||
'\u271b': "a27",
|
||||
'\u271c': "a28",
|
||||
'\u2722': "a29",
|
||||
'\u2704': "a3",
|
||||
'\u2723': "a30",
|
||||
'\u2724': "a31",
|
||||
'\u2725': "a32",
|
||||
'\u2726': "a33",
|
||||
'\u2727': "a34",
|
||||
'\u2605': "a35",
|
||||
'\u2729': "a36",
|
||||
'\u272a': "a37",
|
||||
'\u272b': "a38",
|
||||
'\u272c': "a39",
|
||||
'\u260e': "a4",
|
||||
'\u272d': "a40",
|
||||
'\u272e': "a41",
|
||||
'\u272f': "a42",
|
||||
'\u2730': "a43",
|
||||
'\u2731': "a44",
|
||||
'\u2732': "a45",
|
||||
'\u2733': "a46",
|
||||
'\u2734': "a47",
|
||||
'\u2735': "a48",
|
||||
'\u2736': "a49",
|
||||
'\u2706': "a5",
|
||||
'\u2737': "a50",
|
||||
'\u2738': "a51",
|
||||
'\u2739': "a52",
|
||||
'\u273a': "a53",
|
||||
'\u273b': "a54",
|
||||
'\u273c': "a55",
|
||||
'\u273d': "a56",
|
||||
'\u273e': "a57",
|
||||
'\u273f': "a58",
|
||||
'\u2740': "a59",
|
||||
'\u271d': "a6",
|
||||
'\u2741': "a60",
|
||||
'\u2742': "a61",
|
||||
'\u2743': "a62",
|
||||
'\u2744': "a63",
|
||||
'\u2745': "a64",
|
||||
'\u2746': "a65",
|
||||
'\u2747': "a66",
|
||||
'\u2748': "a67",
|
||||
'\u2749': "a68",
|
||||
'\u274a': "a69",
|
||||
'\u271e': "a7",
|
||||
'\u274b': "a70",
|
||||
'\u25cf': "a71",
|
||||
'\u274d': "a72",
|
||||
'\u25a0': "a73",
|
||||
'\u274f': "a74",
|
||||
'\u2751': "a75",
|
||||
'\u25b2': "a76",
|
||||
'\u25bc': "a77",
|
||||
'\u25c6': "a78",
|
||||
'\u2756': "a79",
|
||||
'\u271f': "a8",
|
||||
'\u25d7': "a81",
|
||||
'\u2758': "a82",
|
||||
'\u2759': "a83",
|
||||
'\u275a': "a84",
|
||||
'\u276f': "a85",
|
||||
'\u2771': "a86",
|
||||
'\u2772': "a87",
|
||||
'\u2773': "a88",
|
||||
'\u2768': "a89",
|
||||
'\u2720': "a9",
|
||||
'\u2769': "a90",
|
||||
'\u276c': "a91",
|
||||
'\u276d': "a92",
|
||||
'\u276a': "a93",
|
||||
'\u276b': "a94",
|
||||
'\u2774': "a95",
|
||||
'\u2775': "a96",
|
||||
'\u275b': "a97",
|
||||
'\u275c': "a98",
|
||||
'\u275d': "a99",
|
||||
}
|
||||
496
internal/pdf/model/textencoding/symbol.go
Normal file
496
internal/pdf/model/textencoding/symbol.go
Normal file
@@ -0,0 +1,496 @@
|
||||
package textencoding
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// Encoding for Symbol font.
|
||||
type SymbolEncoder struct {
|
||||
}
|
||||
|
||||
func NewSymbolEncoder() SymbolEncoder {
|
||||
encoder := SymbolEncoder{}
|
||||
return encoder
|
||||
}
|
||||
|
||||
// Convert a raw utf8 string (series of runes) to an encoded string (series of character codes) to be used in PDF.
|
||||
func (enc SymbolEncoder) Encode(raw string) string {
|
||||
encoded := []byte{}
|
||||
for _, rune := range raw {
|
||||
code, found := enc.RuneToCharcode(rune)
|
||||
if !found {
|
||||
continue
|
||||
}
|
||||
|
||||
encoded = append(encoded, code)
|
||||
}
|
||||
|
||||
return string(encoded)
|
||||
}
|
||||
|
||||
// Conversion between character code and glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc SymbolEncoder) CharcodeToGlyph(code byte) (string, bool) {
|
||||
glyph, has := symbolEncodingCharcodeToGlyphMap[code]
|
||||
if !has {
|
||||
common.Log.Debug("Symbol encoding error: unable to find charcode->glyph entry (%v)", code)
|
||||
return "", false
|
||||
}
|
||||
return glyph, true
|
||||
}
|
||||
|
||||
// Conversion between glyph name and character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc SymbolEncoder) GlyphToCharcode(glyph string) (byte, bool) {
|
||||
code, found := symbolEncodingGlyphToCharcodeMap[glyph]
|
||||
if !found {
|
||||
common.Log.Debug("Symbol encoding error: unable to find glyph->charcode entry (%s)", glyph)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return code, found
|
||||
}
|
||||
|
||||
// Convert rune to character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc SymbolEncoder) RuneToCharcode(val rune) (byte, bool) {
|
||||
glyph, found := runeToGlyph(val, glyphlistRuneToGlyphMap)
|
||||
if !found {
|
||||
common.Log.Debug("Symbol encoding error: unable to find rune->glyph entry (%v)", val)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
code, found := symbolEncodingGlyphToCharcodeMap[glyph]
|
||||
if !found {
|
||||
common.Log.Debug("Symbol encoding error: unable to find glyph->charcode entry (%s)", glyph)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return code, true
|
||||
}
|
||||
|
||||
// Convert character code to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc SymbolEncoder) CharcodeToRune(charcode byte) (rune, bool) {
|
||||
glyph, found := symbolEncodingCharcodeToGlyphMap[charcode]
|
||||
if !found {
|
||||
common.Log.Debug("Symbol encoding error: unable to find charcode->glyph entry (%d)", charcode)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
val, found := glyphToRune(glyph, glyphlistGlyphToRuneMap)
|
||||
if !found {
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return val, true
|
||||
}
|
||||
|
||||
// Convert rune to glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc SymbolEncoder) RuneToGlyph(val rune) (string, bool) {
|
||||
return runeToGlyph(val, glyphlistRuneToGlyphMap)
|
||||
}
|
||||
|
||||
// Convert glyph to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc SymbolEncoder) GlyphToRune(glyph string) (rune, bool) {
|
||||
return glyphToRune(glyph, glyphlistGlyphToRuneMap)
|
||||
}
|
||||
|
||||
// Convert to PDF Object.
|
||||
func (enc SymbolEncoder) ToPdfObject() core.PdfObject {
|
||||
dict := core.MakeDict()
|
||||
dict.Set("Type", core.MakeName("Encoding"))
|
||||
|
||||
// Returning an empty Encoding object with no differences. Indicates that we are using the font's built-in
|
||||
// encoding.
|
||||
return core.MakeIndirectObject(dict)
|
||||
}
|
||||
|
||||
// Charcode to Glyph map (Symbol encoding)
|
||||
var symbolEncodingCharcodeToGlyphMap map[byte]string = map[byte]string{
|
||||
32: "space",
|
||||
33: "exclam",
|
||||
34: "universal",
|
||||
35: "numbersign",
|
||||
36: "existential",
|
||||
37: "percent",
|
||||
38: "ampersand",
|
||||
39: "suchthat",
|
||||
40: "parenleft",
|
||||
41: "parenright",
|
||||
42: "asteriskmath",
|
||||
43: "plus",
|
||||
44: "comma",
|
||||
45: "minus",
|
||||
46: "period",
|
||||
47: "slash",
|
||||
48: "zero",
|
||||
49: "one",
|
||||
50: "two",
|
||||
51: "three",
|
||||
52: "four",
|
||||
53: "five",
|
||||
54: "six",
|
||||
55: "seven",
|
||||
56: "eight",
|
||||
57: "nine",
|
||||
58: "colon",
|
||||
59: "semicolon",
|
||||
60: "less",
|
||||
61: "equal",
|
||||
62: "greater",
|
||||
63: "question",
|
||||
64: "congruent",
|
||||
65: "Alpha",
|
||||
66: "Beta",
|
||||
67: "Chi",
|
||||
68: "Delta",
|
||||
69: "Epsilon",
|
||||
70: "Phi",
|
||||
71: "Gamma",
|
||||
72: "Eta",
|
||||
73: "Iota",
|
||||
74: "theta1",
|
||||
75: "Kappa",
|
||||
76: "Lambda",
|
||||
77: "Mu",
|
||||
78: "Nu",
|
||||
79: "Omicron",
|
||||
80: "Pi",
|
||||
81: "Theta",
|
||||
82: "Rho",
|
||||
83: "Sigma",
|
||||
84: "Tau",
|
||||
85: "Upsilon",
|
||||
86: "sigma1",
|
||||
87: "Omega",
|
||||
88: "Xi",
|
||||
89: "Psi",
|
||||
90: "Zeta",
|
||||
91: "bracketleft",
|
||||
92: "therefore",
|
||||
93: "bracketright",
|
||||
94: "perpendicular",
|
||||
95: "underscore",
|
||||
96: "radicalex",
|
||||
97: "alpha",
|
||||
98: "beta",
|
||||
99: "chi",
|
||||
100: "delta",
|
||||
101: "epsilon",
|
||||
102: "phi",
|
||||
103: "gamma",
|
||||
104: "eta",
|
||||
105: "iota",
|
||||
106: "phi1",
|
||||
107: "kappa",
|
||||
108: "lambda",
|
||||
109: "mu",
|
||||
110: "nu",
|
||||
111: "omicron",
|
||||
112: "pi",
|
||||
113: "theta",
|
||||
114: "rho",
|
||||
115: "sigma",
|
||||
116: "tau",
|
||||
117: "upsilon",
|
||||
118: "omega1",
|
||||
119: "omega",
|
||||
120: "xi",
|
||||
121: "psi",
|
||||
122: "zeta",
|
||||
123: "braceleft",
|
||||
124: "bar",
|
||||
125: "braceright",
|
||||
126: "similar",
|
||||
160: "Euro",
|
||||
161: "Upsilon1",
|
||||
162: "minute",
|
||||
163: "lessequal",
|
||||
164: "fraction",
|
||||
165: "infinity",
|
||||
166: "florin",
|
||||
167: "club",
|
||||
168: "diamond",
|
||||
169: "heart",
|
||||
170: "spade",
|
||||
171: "arrowboth",
|
||||
172: "arrowleft",
|
||||
173: "arrowup",
|
||||
174: "arrowright",
|
||||
175: "arrowdown",
|
||||
176: "degree",
|
||||
177: "plusminus",
|
||||
178: "second",
|
||||
179: "greaterequal",
|
||||
180: "multiply",
|
||||
181: "proportional",
|
||||
182: "partialdiff",
|
||||
183: "bullet",
|
||||
184: "divide",
|
||||
185: "notequal",
|
||||
186: "equivalence",
|
||||
187: "approxequal",
|
||||
188: "ellipsis",
|
||||
189: "arrowvertex",
|
||||
190: "arrowhorizex",
|
||||
191: "carriagereturn",
|
||||
192: "aleph",
|
||||
193: "Ifraktur",
|
||||
194: "Rfraktur",
|
||||
195: "weierstrass",
|
||||
196: "circlemultiply",
|
||||
197: "circleplus",
|
||||
198: "emptyset",
|
||||
199: "intersection",
|
||||
200: "union",
|
||||
201: "propersuperset",
|
||||
202: "reflexsuperset",
|
||||
203: "notsubset",
|
||||
204: "propersubset",
|
||||
205: "reflexsubset",
|
||||
206: "element",
|
||||
207: "notelement",
|
||||
208: "angle",
|
||||
209: "gradient",
|
||||
210: "registerserif",
|
||||
211: "copyrightserif",
|
||||
212: "trademarkserif",
|
||||
213: "product",
|
||||
214: "radical",
|
||||
215: "dotmath",
|
||||
216: "logicalnot",
|
||||
217: "logicaland",
|
||||
218: "logicalor",
|
||||
219: "arrowdblboth",
|
||||
220: "arrowdblleft",
|
||||
221: "arrowdblup",
|
||||
222: "arrowdblright",
|
||||
223: "arrowdbldown",
|
||||
224: "lozenge",
|
||||
225: "angleleft",
|
||||
226: "registersans",
|
||||
227: "copyrightsans",
|
||||
228: "trademarksans",
|
||||
229: "summation",
|
||||
230: "parenlefttp",
|
||||
231: "parenleftex",
|
||||
232: "parenleftbt",
|
||||
233: "bracketlefttp",
|
||||
234: "bracketleftex",
|
||||
235: "bracketleftbt",
|
||||
236: "bracelefttp",
|
||||
237: "braceleftmid",
|
||||
238: "braceleftbt",
|
||||
239: "braceex",
|
||||
241: "angleright",
|
||||
242: "integral",
|
||||
243: "integraltp",
|
||||
244: "integralex",
|
||||
245: "integralbt",
|
||||
246: "parenrighttp",
|
||||
247: "parenrightex",
|
||||
248: "parenrightbt",
|
||||
249: "bracketrighttp",
|
||||
250: "bracketrightex",
|
||||
251: "bracketrightbt",
|
||||
252: "bracerighttp",
|
||||
253: "bracerightmid",
|
||||
254: "bracerightbt",
|
||||
}
|
||||
|
||||
// Glyph to charcode map (Symbol encoding).
|
||||
var symbolEncodingGlyphToCharcodeMap map[string]byte = map[string]byte{
|
||||
"space": 32,
|
||||
"exclam": 33,
|
||||
"universal": 34,
|
||||
"numbersign": 35,
|
||||
"existential": 36,
|
||||
"percent": 37,
|
||||
"ampersand": 38,
|
||||
"suchthat": 39,
|
||||
"parenleft": 40,
|
||||
"parenright": 41,
|
||||
"asteriskmath": 42,
|
||||
"plus": 43,
|
||||
"comma": 44,
|
||||
"minus": 45,
|
||||
"period": 46,
|
||||
"slash": 47,
|
||||
"zero": 48,
|
||||
"one": 49,
|
||||
"two": 50,
|
||||
"three": 51,
|
||||
"four": 52,
|
||||
"five": 53,
|
||||
"six": 54,
|
||||
"seven": 55,
|
||||
"eight": 56,
|
||||
"nine": 57,
|
||||
"colon": 58,
|
||||
"semicolon": 59,
|
||||
"less": 60,
|
||||
"equal": 61,
|
||||
"greater": 62,
|
||||
"question": 63,
|
||||
"congruent": 64,
|
||||
"Alpha": 65,
|
||||
"Beta": 66,
|
||||
"Chi": 67,
|
||||
"Delta": 68,
|
||||
"Epsilon": 69,
|
||||
"Phi": 70,
|
||||
"Gamma": 71,
|
||||
"Eta": 72,
|
||||
"Iota": 73,
|
||||
"theta1": 74,
|
||||
"Kappa": 75,
|
||||
"Lambda": 76,
|
||||
"Mu": 77,
|
||||
"Nu": 78,
|
||||
"Omicron": 79,
|
||||
"Pi": 80,
|
||||
"Theta": 81,
|
||||
"Rho": 82,
|
||||
"Sigma": 83,
|
||||
"Tau": 84,
|
||||
"Upsilon": 85,
|
||||
"sigma1": 86,
|
||||
"Omega": 87,
|
||||
"Xi": 88,
|
||||
"Psi": 89,
|
||||
"Zeta": 90,
|
||||
"bracketleft": 91,
|
||||
"therefore": 92,
|
||||
"bracketright": 93,
|
||||
"perpendicular": 94,
|
||||
"underscore": 95,
|
||||
"radicalex": 96,
|
||||
"alpha": 97,
|
||||
"beta": 98,
|
||||
"chi": 99,
|
||||
"delta": 100,
|
||||
"epsilon": 101,
|
||||
"phi": 102,
|
||||
"gamma": 103,
|
||||
"eta": 104,
|
||||
"iota": 105,
|
||||
"phi1": 106,
|
||||
"kappa": 107,
|
||||
"lambda": 108,
|
||||
"mu": 109,
|
||||
"nu": 110,
|
||||
"omicron": 111,
|
||||
"pi": 112,
|
||||
"theta": 113,
|
||||
"rho": 114,
|
||||
"sigma": 115,
|
||||
"tau": 116,
|
||||
"upsilon": 117,
|
||||
"omega1": 118,
|
||||
"omega": 119,
|
||||
"xi": 120,
|
||||
"psi": 121,
|
||||
"zeta": 122,
|
||||
"braceleft": 123,
|
||||
"bar": 124,
|
||||
"braceright": 125,
|
||||
"similar": 126,
|
||||
"Euro": 160,
|
||||
"Upsilon1": 161,
|
||||
"minute": 162,
|
||||
"lessequal": 163,
|
||||
"fraction": 164,
|
||||
"infinity": 165,
|
||||
"florin": 166,
|
||||
"club": 167,
|
||||
"diamond": 168,
|
||||
"heart": 169,
|
||||
"spade": 170,
|
||||
"arrowboth": 171,
|
||||
"arrowleft": 172,
|
||||
"arrowup": 173,
|
||||
"arrowright": 174,
|
||||
"arrowdown": 175,
|
||||
"degree": 176,
|
||||
"plusminus": 177,
|
||||
"second": 178,
|
||||
"greaterequal": 179,
|
||||
"multiply": 180,
|
||||
"proportional": 181,
|
||||
"partialdiff": 182,
|
||||
"bullet": 183,
|
||||
"divide": 184,
|
||||
"notequal": 185,
|
||||
"equivalence": 186,
|
||||
"approxequal": 187,
|
||||
"ellipsis": 188,
|
||||
"arrowvertex": 189,
|
||||
"arrowhorizex": 190,
|
||||
"carriagereturn": 191,
|
||||
"aleph": 192,
|
||||
"Ifraktur": 193,
|
||||
"Rfraktur": 194,
|
||||
"weierstrass": 195,
|
||||
"circlemultiply": 196,
|
||||
"circleplus": 197,
|
||||
"emptyset": 198,
|
||||
"intersection": 199,
|
||||
"union": 200,
|
||||
"propersuperset": 201,
|
||||
"reflexsuperset": 202,
|
||||
"notsubset": 203,
|
||||
"propersubset": 204,
|
||||
"reflexsubset": 205,
|
||||
"element": 206,
|
||||
"notelement": 207,
|
||||
"angle": 208,
|
||||
"gradient": 209,
|
||||
"registerserif": 210,
|
||||
"copyrightserif": 211,
|
||||
"trademarkserif": 212,
|
||||
"product": 213,
|
||||
"radical": 214,
|
||||
"dotmath": 215,
|
||||
"logicalnot": 216,
|
||||
"logicaland": 217,
|
||||
"logicalor": 218,
|
||||
"arrowdblboth": 219,
|
||||
"arrowdblleft": 220,
|
||||
"arrowdblup": 221,
|
||||
"arrowdblright": 222,
|
||||
"arrowdbldown": 223,
|
||||
"lozenge": 224,
|
||||
"angleleft": 225,
|
||||
"registersans": 226,
|
||||
"copyrightsans": 227,
|
||||
"trademarksans": 228,
|
||||
"summation": 229,
|
||||
"parenlefttp": 230,
|
||||
"parenleftex": 231,
|
||||
"parenleftbt": 232,
|
||||
"bracketlefttp": 233,
|
||||
"bracketleftex": 234,
|
||||
"bracketleftbt": 235,
|
||||
"bracelefttp": 236,
|
||||
"braceleftmid": 237,
|
||||
"braceleftbt": 238,
|
||||
"braceex": 239,
|
||||
"angleright": 241,
|
||||
"integral": 242,
|
||||
"integraltp": 243,
|
||||
"integralex": 244,
|
||||
"integralbt": 245,
|
||||
"parenrighttp": 246,
|
||||
"parenrightex": 247,
|
||||
"parenrightbt": 248,
|
||||
"bracketrighttp": 249,
|
||||
"bracketrightex": 250,
|
||||
"bracketrightbt": 251,
|
||||
"bracerighttp": 252,
|
||||
"bracerightmid": 253,
|
||||
"bracerightbt": 254,
|
||||
}
|
||||
51
internal/pdf/model/textencoding/utils.go
Normal file
51
internal/pdf/model/textencoding/utils.go
Normal file
@@ -0,0 +1,51 @@
|
||||
package textencoding
|
||||
|
||||
import "gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
|
||||
func glyphToRune(glyph string, glyphToRuneMap map[string]rune) (rune, bool) {
|
||||
ucode, found := glyphToRuneMap[glyph]
|
||||
if found {
|
||||
return ucode, true
|
||||
}
|
||||
|
||||
//common.Log.Debug("Glyph->Rune ERROR: Unable to find glyph %s", glyph)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
func runeToGlyph(ucode rune, runeToGlyphMap map[rune]string) (string, bool) {
|
||||
glyph, found := runeToGlyphMap[ucode]
|
||||
if found {
|
||||
return glyph, true
|
||||
}
|
||||
|
||||
//common.Log.Debug("Rune->Glyph ERROR: Unable to find rune %v", ucode)
|
||||
return "", false
|
||||
}
|
||||
|
||||
func splitWords(raw string, encoder TextEncoder) []string {
|
||||
runes := []rune(raw)
|
||||
|
||||
words := []string{}
|
||||
|
||||
startsAt := 0
|
||||
for idx, code := range runes {
|
||||
glyph, found := encoder.RuneToGlyph(code)
|
||||
if !found {
|
||||
common.Log.Debug("Glyph not found for code: %s\n", string(code))
|
||||
continue
|
||||
}
|
||||
|
||||
if glyph == "space" {
|
||||
word := runes[startsAt:idx]
|
||||
words = append(words, string(word))
|
||||
startsAt = idx + 1
|
||||
}
|
||||
}
|
||||
|
||||
word := runes[startsAt:]
|
||||
if len(word) > 0 {
|
||||
words = append(words, string(word))
|
||||
}
|
||||
|
||||
return words
|
||||
}
|
||||
557
internal/pdf/model/textencoding/winansi.go
Normal file
557
internal/pdf/model/textencoding/winansi.go
Normal file
@@ -0,0 +1,557 @@
|
||||
package textencoding
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// WinAnsiEncoding.
|
||||
type WinAnsiEncoder struct {
|
||||
}
|
||||
|
||||
func NewWinAnsiTextEncoder() WinAnsiEncoder {
|
||||
encoder := WinAnsiEncoder{}
|
||||
return encoder
|
||||
}
|
||||
|
||||
func (winenc WinAnsiEncoder) ToPdfObject() core.PdfObject {
|
||||
return core.MakeName("WinAnsiEncoding")
|
||||
}
|
||||
|
||||
// Convert a raw utf8 string (series of runes) to an encoded string (series of character codes) to be used in PDF.
|
||||
func (winenc WinAnsiEncoder) Encode(raw string) string {
|
||||
encoded := []byte{}
|
||||
for _, rune := range raw {
|
||||
code, has := winenc.RuneToCharcode(rune)
|
||||
if has {
|
||||
encoded = append(encoded, code)
|
||||
}
|
||||
}
|
||||
|
||||
return string(encoded)
|
||||
}
|
||||
|
||||
// Conversion between character code and glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (winenc WinAnsiEncoder) CharcodeToGlyph(code byte) (string, bool) {
|
||||
glyph, has := winansiEncodingCharcodeToGlyphMap[code]
|
||||
if !has {
|
||||
common.Log.Debug("Charcode -> Glyph error: charcode not found: %d\n", code)
|
||||
return "", false
|
||||
}
|
||||
return glyph, true
|
||||
}
|
||||
|
||||
// Conversion between glyph name and character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (winenc WinAnsiEncoder) GlyphToCharcode(glyph string) (byte, bool) {
|
||||
code, found := winansiEncodingGlyphToCharcodeMap[glyph]
|
||||
if !found {
|
||||
common.Log.Debug("Glyph -> Charcode error: glyph not found: %s\n", glyph)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return code, true
|
||||
}
|
||||
|
||||
// Convert rune to character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (winenc WinAnsiEncoder) RuneToCharcode(val rune) (byte, bool) {
|
||||
glyph, found := winenc.RuneToGlyph(val)
|
||||
if !found {
|
||||
return 0, false
|
||||
}
|
||||
|
||||
code, found := winansiEncodingGlyphToCharcodeMap[glyph]
|
||||
if !found {
|
||||
common.Log.Debug("Glyph -> Charcode error: glyph not found %s\n", glyph)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return code, true
|
||||
}
|
||||
|
||||
// Convert character code to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (winenc WinAnsiEncoder) CharcodeToRune(charcode byte) (rune, bool) {
|
||||
glyph, found := winansiEncodingCharcodeToGlyphMap[charcode]
|
||||
if !found {
|
||||
common.Log.Debug("Charcode -> Glyph error: charcode not found: %d\n", charcode)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
ucode, found := glyphToRune(glyph, glyphlistGlyphToRuneMap)
|
||||
if !found {
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return ucode, true
|
||||
}
|
||||
|
||||
// Convert rune to glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (winenc WinAnsiEncoder) RuneToGlyph(val rune) (string, bool) {
|
||||
return runeToGlyph(val, glyphlistRuneToGlyphMap)
|
||||
}
|
||||
|
||||
// Convert glyph to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (winenc WinAnsiEncoder) GlyphToRune(glyph string) (rune, bool) {
|
||||
return glyphToRune(glyph, glyphlistGlyphToRuneMap)
|
||||
}
|
||||
|
||||
// Charcode to glyph name map (WinAnsiEncoding).
|
||||
var winansiEncodingCharcodeToGlyphMap = map[byte]string{
|
||||
32: "space",
|
||||
33: "exclam",
|
||||
34: "quotedbl",
|
||||
35: "numbersign",
|
||||
36: "dollar",
|
||||
37: "percent",
|
||||
38: "ampersand",
|
||||
39: "quotesingle",
|
||||
40: "parenleft",
|
||||
41: "parenright",
|
||||
42: "asterisk",
|
||||
43: "plus",
|
||||
44: "comma",
|
||||
45: "hyphen",
|
||||
46: "period",
|
||||
47: "slash",
|
||||
48: "zero",
|
||||
49: "one",
|
||||
50: "two",
|
||||
51: "three",
|
||||
52: "four",
|
||||
53: "five",
|
||||
54: "six",
|
||||
55: "seven",
|
||||
56: "eight",
|
||||
57: "nine",
|
||||
58: "colon",
|
||||
59: "semicolon",
|
||||
60: "less",
|
||||
61: "equal",
|
||||
62: "greater",
|
||||
63: "question",
|
||||
64: "at",
|
||||
65: "A",
|
||||
66: "B",
|
||||
67: "C",
|
||||
68: "D",
|
||||
69: "E",
|
||||
70: "F",
|
||||
71: "G",
|
||||
72: "H",
|
||||
73: "I",
|
||||
74: "J",
|
||||
75: "K",
|
||||
76: "L",
|
||||
77: "M",
|
||||
78: "N",
|
||||
79: "O",
|
||||
80: "P",
|
||||
81: "Q",
|
||||
82: "R",
|
||||
83: "S",
|
||||
84: "T",
|
||||
85: "U",
|
||||
86: "V",
|
||||
87: "W",
|
||||
88: "X",
|
||||
89: "Y",
|
||||
90: "Z",
|
||||
91: "bracketleft",
|
||||
92: "backslash",
|
||||
93: "bracketright",
|
||||
94: "asciicircum",
|
||||
95: "underscore",
|
||||
96: "grave",
|
||||
97: "a",
|
||||
98: "b",
|
||||
99: "c",
|
||||
100: "d",
|
||||
101: "e",
|
||||
102: "f",
|
||||
103: "g",
|
||||
104: "h",
|
||||
105: "i",
|
||||
106: "j",
|
||||
107: "k",
|
||||
108: "l",
|
||||
109: "m",
|
||||
110: "n",
|
||||
111: "o",
|
||||
112: "p",
|
||||
113: "q",
|
||||
114: "r",
|
||||
115: "s",
|
||||
116: "t",
|
||||
117: "u",
|
||||
118: "v",
|
||||
119: "w",
|
||||
120: "x",
|
||||
121: "y",
|
||||
122: "z",
|
||||
123: "braceleft",
|
||||
124: "bar",
|
||||
125: "braceright",
|
||||
126: "asciitilde",
|
||||
127: "bullet",
|
||||
128: "Euro",
|
||||
129: "bullet",
|
||||
130: "quotesinglbase",
|
||||
131: "florin",
|
||||
132: "quotedblbase",
|
||||
133: "ellipsis",
|
||||
134: "dagger",
|
||||
135: "daggerdbl",
|
||||
136: "circumflex",
|
||||
137: "perthousand",
|
||||
138: "Scaron",
|
||||
139: "guilsinglleft",
|
||||
140: "OE",
|
||||
141: "bullet",
|
||||
142: "Zcaron",
|
||||
143: "bullet",
|
||||
144: "bullet",
|
||||
145: "quoteleft",
|
||||
146: "quoteright",
|
||||
147: "quotedblleft",
|
||||
148: "quotedblright",
|
||||
149: "bullet",
|
||||
150: "endash",
|
||||
151: "emdash",
|
||||
152: "tilde",
|
||||
153: "trademark",
|
||||
154: "scaron",
|
||||
155: "guilsinglright",
|
||||
156: "oe",
|
||||
157: "bullet",
|
||||
158: "zcaron",
|
||||
159: "Ydieresis",
|
||||
160: "space",
|
||||
161: "exclamdown",
|
||||
162: "cent",
|
||||
163: "sterling",
|
||||
164: "currency",
|
||||
165: "yen",
|
||||
166: "brokenbar",
|
||||
167: "section",
|
||||
168: "dieresis",
|
||||
169: "copyright",
|
||||
170: "ordfeminine",
|
||||
171: "guillemotleft",
|
||||
172: "logicalnot",
|
||||
173: "hyphen",
|
||||
174: "registered",
|
||||
175: "macron",
|
||||
176: "degree",
|
||||
177: "plusminus",
|
||||
178: "twosuperior",
|
||||
179: "threesuperior",
|
||||
180: "acute",
|
||||
181: "mu",
|
||||
182: "paragraph",
|
||||
183: "periodcentered",
|
||||
184: "cedilla",
|
||||
185: "onesuperior",
|
||||
186: "ordmasculine",
|
||||
187: "guillemotright",
|
||||
188: "onequarter",
|
||||
189: "onehalf",
|
||||
190: "threequarters",
|
||||
191: "questiondown",
|
||||
192: "Agrave",
|
||||
193: "Aacute",
|
||||
194: "Acircumflex",
|
||||
195: "Atilde",
|
||||
196: "Adieresis",
|
||||
197: "Aring",
|
||||
198: "AE",
|
||||
199: "Ccedilla",
|
||||
200: "Egrave",
|
||||
201: "Eacute",
|
||||
202: "Ecircumflex",
|
||||
203: "Edieresis",
|
||||
204: "Igrave",
|
||||
205: "Iacute",
|
||||
206: "Icircumflex",
|
||||
207: "Idieresis",
|
||||
208: "Eth",
|
||||
209: "Ntilde",
|
||||
210: "Ograve",
|
||||
211: "Oacute",
|
||||
212: "Ocircumflex",
|
||||
213: "Otilde",
|
||||
214: "Odieresis",
|
||||
215: "multiply",
|
||||
216: "Oslash",
|
||||
217: "Ugrave",
|
||||
218: "Uacute",
|
||||
219: "Ucircumflex",
|
||||
220: "Udieresis",
|
||||
221: "Yacute",
|
||||
222: "Thorn",
|
||||
223: "germandbls",
|
||||
224: "agrave",
|
||||
225: "aacute",
|
||||
226: "acircumflex",
|
||||
227: "atilde",
|
||||
228: "adieresis",
|
||||
229: "aring",
|
||||
230: "ae",
|
||||
231: "ccedilla",
|
||||
232: "egrave",
|
||||
233: "eacute",
|
||||
234: "ecircumflex",
|
||||
235: "edieresis",
|
||||
236: "igrave",
|
||||
237: "iacute",
|
||||
238: "icircumflex",
|
||||
239: "idieresis",
|
||||
240: "eth",
|
||||
241: "ntilde",
|
||||
242: "ograve",
|
||||
243: "oacute",
|
||||
244: "ocircumflex",
|
||||
245: "otilde",
|
||||
246: "odieresis",
|
||||
247: "divide",
|
||||
248: "oslash",
|
||||
249: "ugrave",
|
||||
250: "uacute",
|
||||
251: "ucircumflex",
|
||||
252: "udieresis",
|
||||
253: "yacute",
|
||||
254: "thorn",
|
||||
255: "ydieresis",
|
||||
}
|
||||
|
||||
// Glyph to charcode map (WinAnsiEncoding).
|
||||
var winansiEncodingGlyphToCharcodeMap = map[string]byte{
|
||||
"space": 32,
|
||||
"exclam": 33,
|
||||
"quotedbl": 34,
|
||||
"numbersign": 35,
|
||||
"dollar": 36,
|
||||
"percent": 37,
|
||||
"ampersand": 38,
|
||||
"quotesingle": 39,
|
||||
"parenleft": 40,
|
||||
"parenright": 41,
|
||||
"asterisk": 42,
|
||||
"plus": 43,
|
||||
"comma": 44,
|
||||
"hyphen": 45,
|
||||
"period": 46,
|
||||
"slash": 47,
|
||||
"zero": 48,
|
||||
"one": 49,
|
||||
"two": 50,
|
||||
"three": 51,
|
||||
"four": 52,
|
||||
"five": 53,
|
||||
"six": 54,
|
||||
"seven": 55,
|
||||
"eight": 56,
|
||||
"nine": 57,
|
||||
"colon": 58,
|
||||
"semicolon": 59,
|
||||
"less": 60,
|
||||
"equal": 61,
|
||||
"greater": 62,
|
||||
"question": 63,
|
||||
"at": 64,
|
||||
"A": 65,
|
||||
"B": 66,
|
||||
"C": 67,
|
||||
"D": 68,
|
||||
"E": 69,
|
||||
"F": 70,
|
||||
"G": 71,
|
||||
"H": 72,
|
||||
"I": 73,
|
||||
"J": 74,
|
||||
"K": 75,
|
||||
"L": 76,
|
||||
"M": 77,
|
||||
"N": 78,
|
||||
"O": 79,
|
||||
"P": 80,
|
||||
"Q": 81,
|
||||
"R": 82,
|
||||
"S": 83,
|
||||
"T": 84,
|
||||
"U": 85,
|
||||
"V": 86,
|
||||
"W": 87,
|
||||
"X": 88,
|
||||
"Y": 89,
|
||||
"Z": 90,
|
||||
"bracketleft": 91,
|
||||
"backslash": 92,
|
||||
"bracketright": 93,
|
||||
"asciicircum": 94,
|
||||
"underscore": 95,
|
||||
"grave": 96,
|
||||
"a": 97,
|
||||
"b": 98,
|
||||
"c": 99,
|
||||
"d": 100,
|
||||
"e": 101,
|
||||
"f": 102,
|
||||
"g": 103,
|
||||
"h": 104,
|
||||
"i": 105,
|
||||
"j": 106,
|
||||
"k": 107,
|
||||
"l": 108,
|
||||
"m": 109,
|
||||
"n": 110,
|
||||
"o": 111,
|
||||
"p": 112,
|
||||
"q": 113,
|
||||
"r": 114,
|
||||
"s": 115,
|
||||
"t": 116,
|
||||
"u": 117,
|
||||
"v": 118,
|
||||
"w": 119,
|
||||
"x": 120,
|
||||
"y": 121,
|
||||
"z": 122,
|
||||
"braceleft": 123,
|
||||
"bar": 124,
|
||||
"braceright": 125,
|
||||
"asciitilde": 126,
|
||||
"bullet": 127,
|
||||
"Euro": 128,
|
||||
//"bullet": 129,
|
||||
"quotesinglbase": 130,
|
||||
"florin": 131,
|
||||
"quotedblbase": 132,
|
||||
"ellipsis": 133,
|
||||
"dagger": 134,
|
||||
"daggerdbl": 135,
|
||||
"circumflex": 136,
|
||||
"perthousand": 137,
|
||||
"Scaron": 138,
|
||||
"guilsinglleft": 139,
|
||||
"OE": 140,
|
||||
//"bullet": 141,
|
||||
"Zcaron": 142,
|
||||
//"bullet": 143,
|
||||
//"bullet": 144,
|
||||
"quoteleft": 145,
|
||||
"quoteright": 146,
|
||||
"quotedblleft": 147,
|
||||
"quotedblright": 148,
|
||||
//"bullet": 149,
|
||||
"endash": 150,
|
||||
"emdash": 151,
|
||||
"tilde": 152,
|
||||
"trademark": 153,
|
||||
"scaron": 154,
|
||||
"guilsinglright": 155,
|
||||
"oe": 156,
|
||||
//"bullet": 157,
|
||||
"zcaron": 158,
|
||||
"Ydieresis": 159,
|
||||
//"space": 160,
|
||||
"exclamdown": 161,
|
||||
"cent": 162,
|
||||
"sterling": 163,
|
||||
"currency": 164,
|
||||
"yen": 165,
|
||||
"brokenbar": 166,
|
||||
"section": 167,
|
||||
"dieresis": 168,
|
||||
"copyright": 169,
|
||||
"ordfeminine": 170,
|
||||
"guillemotleft": 171,
|
||||
"logicalnot": 172,
|
||||
//"hyphen": 173,
|
||||
"registered": 174,
|
||||
"macron": 175,
|
||||
"degree": 176,
|
||||
"plusminus": 177,
|
||||
"twosuperior": 178,
|
||||
"threesuperior": 179,
|
||||
"acute": 180,
|
||||
"mu": 181,
|
||||
"paragraph": 182,
|
||||
"periodcentered": 183,
|
||||
"cedilla": 184,
|
||||
"onesuperior": 185,
|
||||
"ordmasculine": 186,
|
||||
"guillemotright": 187,
|
||||
"onequarter": 188,
|
||||
"onehalf": 189,
|
||||
"threequarters": 190,
|
||||
"questiondown": 191,
|
||||
"Agrave": 192,
|
||||
"Aacute": 193,
|
||||
"Acircumflex": 194,
|
||||
"Atilde": 195,
|
||||
"Adieresis": 196,
|
||||
"Aring": 197,
|
||||
"AE": 198,
|
||||
"Ccedilla": 199,
|
||||
"Egrave": 200,
|
||||
"Eacute": 201,
|
||||
"Ecircumflex": 202,
|
||||
"Edieresis": 203,
|
||||
"Igrave": 204,
|
||||
"Iacute": 205,
|
||||
"Icircumflex": 206,
|
||||
"Idieresis": 207,
|
||||
"Eth": 208,
|
||||
"Ntilde": 209,
|
||||
"Ograve": 210,
|
||||
"Oacute": 211,
|
||||
"Ocircumflex": 212,
|
||||
"Otilde": 213,
|
||||
"Odieresis": 214,
|
||||
"multiply": 215,
|
||||
"Oslash": 216,
|
||||
"Ugrave": 217,
|
||||
"Uacute": 218,
|
||||
"Ucircumflex": 219,
|
||||
"Udieresis": 220,
|
||||
"Yacute": 221,
|
||||
"Thorn": 222,
|
||||
"germandbls": 223,
|
||||
"agrave": 224,
|
||||
"aacute": 225,
|
||||
"acircumflex": 226,
|
||||
"atilde": 227,
|
||||
"adieresis": 228,
|
||||
"aring": 229,
|
||||
"ae": 230,
|
||||
"ccedilla": 231,
|
||||
"egrave": 232,
|
||||
"eacute": 233,
|
||||
"ecircumflex": 234,
|
||||
"edieresis": 235,
|
||||
"igrave": 236,
|
||||
"iacute": 237,
|
||||
"icircumflex": 238,
|
||||
"idieresis": 239,
|
||||
"eth": 240,
|
||||
"ntilde": 241,
|
||||
"ograve": 242,
|
||||
"oacute": 243,
|
||||
"ocircumflex": 244,
|
||||
"otilde": 245,
|
||||
"odieresis": 246,
|
||||
"divide": 247,
|
||||
"oslash": 248,
|
||||
"ugrave": 249,
|
||||
"uacute": 250,
|
||||
"ucircumflex": 251,
|
||||
"udieresis": 252,
|
||||
"yacute": 253,
|
||||
"thorn": 254,
|
||||
"ydieresis": 255,
|
||||
}
|
||||
537
internal/pdf/model/textencoding/zapfdingbats.go
Normal file
537
internal/pdf/model/textencoding/zapfdingbats.go
Normal file
@@ -0,0 +1,537 @@
|
||||
package textencoding
|
||||
|
||||
import (
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// Encoding for ZapfDingbats font.
|
||||
type ZapfDingbatsEncoder struct {
|
||||
}
|
||||
|
||||
func NewZapfDingbatsEncoder() ZapfDingbatsEncoder {
|
||||
encoder := ZapfDingbatsEncoder{}
|
||||
return encoder
|
||||
}
|
||||
|
||||
// Convert a raw utf8 string (series of runes) to an encoded string (series of character codes) to be used in PDF.
|
||||
func (enc ZapfDingbatsEncoder) Encode(raw string) string {
|
||||
encoded := []byte{}
|
||||
for _, rune := range raw {
|
||||
code, found := enc.RuneToCharcode(rune)
|
||||
if !found {
|
||||
continue
|
||||
}
|
||||
|
||||
encoded = append(encoded, code)
|
||||
}
|
||||
|
||||
return string(encoded)
|
||||
}
|
||||
|
||||
// Conversion between character code and glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc ZapfDingbatsEncoder) CharcodeToGlyph(code byte) (string, bool) {
|
||||
glyph, has := zapfDingbatsEncodingCharcodeToGlyphMap[code]
|
||||
if !has {
|
||||
common.Log.Debug("ZapfDingbats encoding error: unable to find charcode->glyph entry (%v)", code)
|
||||
return "", false
|
||||
}
|
||||
return glyph, true
|
||||
}
|
||||
|
||||
// Conversion between glyph name and character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc ZapfDingbatsEncoder) GlyphToCharcode(glyph string) (byte, bool) {
|
||||
code, found := zapfDingbatsEncodingGlyphToCharcodeMap[glyph]
|
||||
if !found {
|
||||
common.Log.Debug("ZapfDingbats encoding error: unable to find glyph->charcode entry (%s)", glyph)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return code, found
|
||||
}
|
||||
|
||||
// Convert rune to character code.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc ZapfDingbatsEncoder) RuneToCharcode(val rune) (byte, bool) {
|
||||
glyph, found := enc.RuneToGlyph(val)
|
||||
if !found {
|
||||
common.Log.Debug("ZapfDingbats encoding error: unable to find rune->glyph entry (%v)", val)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
code, found := zapfDingbatsEncodingGlyphToCharcodeMap[glyph]
|
||||
if !found {
|
||||
common.Log.Debug("ZapfDingbats encoding error: unable to find glyph->charcode entry (%s)", glyph)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return code, true
|
||||
}
|
||||
|
||||
// Convert character code to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc ZapfDingbatsEncoder) CharcodeToRune(charcode byte) (rune, bool) {
|
||||
glyph, found := zapfDingbatsEncodingCharcodeToGlyphMap[charcode]
|
||||
if !found {
|
||||
common.Log.Debug("ZapfDingbats encoding error: unable to find charcode->glyph entry (%d)", charcode)
|
||||
return 0, false
|
||||
}
|
||||
|
||||
return enc.GlyphToRune(glyph)
|
||||
}
|
||||
|
||||
// Convert rune to glyph name.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc ZapfDingbatsEncoder) RuneToGlyph(val rune) (string, bool) {
|
||||
// Seek in the zapfdingbats list first.
|
||||
glyph, found := runeToGlyph(val, zapfdingbatsRuneToGlyphMap)
|
||||
if !found {
|
||||
// Then revert to glyphlist if not found.
|
||||
glyph, found = runeToGlyph(val, glyphlistRuneToGlyphMap)
|
||||
if !found {
|
||||
common.Log.Debug("ZapfDingbats encoding error: unable to find rune->glyph entry (%v)", val)
|
||||
return "", false
|
||||
}
|
||||
}
|
||||
|
||||
return glyph, true
|
||||
}
|
||||
|
||||
// Convert glyph to rune.
|
||||
// The bool return flag is true if there was a match, and false otherwise.
|
||||
func (enc ZapfDingbatsEncoder) GlyphToRune(glyph string) (rune, bool) {
|
||||
// Seek in the zapfdingbats list first.
|
||||
val, found := glyphToRune(glyph, zapfdingbatsGlyphToRuneMap)
|
||||
if !found {
|
||||
// Then revert to glyphlist if not found.
|
||||
val, found = glyphToRune(glyph, glyphlistGlyphToRuneMap)
|
||||
if !found {
|
||||
common.Log.Debug("Symbol encoding error: unable to find glyph->rune entry (%v)", glyph)
|
||||
return 0, false
|
||||
}
|
||||
}
|
||||
|
||||
return val, true
|
||||
}
|
||||
|
||||
// Convert to PDF Object.
|
||||
func (enc ZapfDingbatsEncoder) ToPdfObject() core.PdfObject {
|
||||
dict := core.MakeDict()
|
||||
dict.Set("Type", core.MakeName("Encoding"))
|
||||
|
||||
// Returning an empty Encoding object with no differences. Indicates that we are using the font's built-in
|
||||
// encoding.
|
||||
return core.MakeIndirectObject(dict)
|
||||
}
|
||||
|
||||
var zapfDingbatsEncodingCharcodeToGlyphMap = map[byte]string{
|
||||
32: "space",
|
||||
33: "a1",
|
||||
34: "a2",
|
||||
35: "a202",
|
||||
36: "a3",
|
||||
37: "a4",
|
||||
38: "a5",
|
||||
39: "a119",
|
||||
40: "a118",
|
||||
41: "a117",
|
||||
42: "a11",
|
||||
43: "a12",
|
||||
44: "a13",
|
||||
45: "a14",
|
||||
46: "a15",
|
||||
47: "a16",
|
||||
48: "a105",
|
||||
49: "a17",
|
||||
50: "a18",
|
||||
51: "a19",
|
||||
52: "a20",
|
||||
53: "a21",
|
||||
54: "a22",
|
||||
55: "a23",
|
||||
56: "a24",
|
||||
57: "a25",
|
||||
58: "a26",
|
||||
59: "a27",
|
||||
60: "a28",
|
||||
61: "a6",
|
||||
62: "a7",
|
||||
63: "a8",
|
||||
64: "a9",
|
||||
65: "a10",
|
||||
66: "a29",
|
||||
67: "a30",
|
||||
68: "a31",
|
||||
69: "a32",
|
||||
70: "a33",
|
||||
71: "a34",
|
||||
72: "a35",
|
||||
73: "a36",
|
||||
74: "a37",
|
||||
75: "a38",
|
||||
76: "a39",
|
||||
77: "a40",
|
||||
78: "a41",
|
||||
79: "a42",
|
||||
80: "a43",
|
||||
81: "a44",
|
||||
82: "a45",
|
||||
83: "a46",
|
||||
84: "a47",
|
||||
85: "a48",
|
||||
86: "a49",
|
||||
87: "a50",
|
||||
88: "a51",
|
||||
89: "a52",
|
||||
90: "a53",
|
||||
91: "a54",
|
||||
92: "a55",
|
||||
93: "a56",
|
||||
94: "a57",
|
||||
95: "a58",
|
||||
96: "a59",
|
||||
97: "a60",
|
||||
98: "a61",
|
||||
99: "a62",
|
||||
100: "a63",
|
||||
101: "a64",
|
||||
102: "a65",
|
||||
103: "a66",
|
||||
104: "a67",
|
||||
105: "a68",
|
||||
106: "a69",
|
||||
107: "a70",
|
||||
108: "a71",
|
||||
109: "a72",
|
||||
110: "a73",
|
||||
111: "a74",
|
||||
112: "a203",
|
||||
113: "a75",
|
||||
114: "a204",
|
||||
115: "a76",
|
||||
116: "a77",
|
||||
117: "a78",
|
||||
118: "a79",
|
||||
119: "a81",
|
||||
120: "a82",
|
||||
121: "a83",
|
||||
122: "a84",
|
||||
123: "a97",
|
||||
124: "a98",
|
||||
125: "a99",
|
||||
126: "a100",
|
||||
128: "a89",
|
||||
129: "a90",
|
||||
130: "a93",
|
||||
131: "a94",
|
||||
132: "a91",
|
||||
133: "a92",
|
||||
134: "a205",
|
||||
135: "a85",
|
||||
136: "a206",
|
||||
137: "a86",
|
||||
138: "a87",
|
||||
139: "a88",
|
||||
140: "a95",
|
||||
141: "a96",
|
||||
161: "a101",
|
||||
162: "a102",
|
||||
163: "a103",
|
||||
164: "a104",
|
||||
165: "a106",
|
||||
166: "a107",
|
||||
167: "a108",
|
||||
168: "a112",
|
||||
169: "a111",
|
||||
170: "a110",
|
||||
171: "a109",
|
||||
172: "a120",
|
||||
173: "a121",
|
||||
174: "a122",
|
||||
175: "a123",
|
||||
176: "a124",
|
||||
177: "a125",
|
||||
178: "a126",
|
||||
179: "a127",
|
||||
180: "a128",
|
||||
181: "a129",
|
||||
182: "a130",
|
||||
183: "a131",
|
||||
184: "a132",
|
||||
185: "a133",
|
||||
186: "a134",
|
||||
187: "a135",
|
||||
188: "a136",
|
||||
189: "a137",
|
||||
190: "a138",
|
||||
191: "a139",
|
||||
192: "a140",
|
||||
193: "a141",
|
||||
194: "a142",
|
||||
195: "a143",
|
||||
196: "a144",
|
||||
197: "a145",
|
||||
198: "a146",
|
||||
199: "a147",
|
||||
200: "a148",
|
||||
201: "a149",
|
||||
202: "a150",
|
||||
203: "a151",
|
||||
204: "a152",
|
||||
205: "a153",
|
||||
206: "a154",
|
||||
207: "a155",
|
||||
208: "a156",
|
||||
209: "a157",
|
||||
210: "a158",
|
||||
211: "a159",
|
||||
212: "a160",
|
||||
213: "a161",
|
||||
214: "a163",
|
||||
215: "a164",
|
||||
216: "a196",
|
||||
217: "a165",
|
||||
218: "a192",
|
||||
219: "a166",
|
||||
220: "a167",
|
||||
221: "a168",
|
||||
222: "a169",
|
||||
223: "a170",
|
||||
224: "a171",
|
||||
225: "a172",
|
||||
226: "a173",
|
||||
227: "a162",
|
||||
228: "a174",
|
||||
229: "a175",
|
||||
230: "a176",
|
||||
231: "a177",
|
||||
232: "a178",
|
||||
233: "a179",
|
||||
234: "a193",
|
||||
235: "a180",
|
||||
236: "a199",
|
||||
237: "a181",
|
||||
238: "a200",
|
||||
239: "a182",
|
||||
241: "a201",
|
||||
242: "a183",
|
||||
243: "a184",
|
||||
244: "a197",
|
||||
245: "a185",
|
||||
246: "a194",
|
||||
247: "a198",
|
||||
248: "a186",
|
||||
249: "a195",
|
||||
250: "a187",
|
||||
251: "a188",
|
||||
252: "a189",
|
||||
253: "a190",
|
||||
254: "a191",
|
||||
}
|
||||
|
||||
var zapfDingbatsEncodingGlyphToCharcodeMap = map[string]byte{
|
||||
"space": 32,
|
||||
"a1": 33,
|
||||
"a2": 34,
|
||||
"a202": 35,
|
||||
"a3": 36,
|
||||
"a4": 37,
|
||||
"a5": 38,
|
||||
"a119": 39,
|
||||
"a118": 40,
|
||||
"a117": 41,
|
||||
"a11": 42,
|
||||
"a12": 43,
|
||||
"a13": 44,
|
||||
"a14": 45,
|
||||
"a15": 46,
|
||||
"a16": 47,
|
||||
"a105": 48,
|
||||
"a17": 49,
|
||||
"a18": 50,
|
||||
"a19": 51,
|
||||
"a20": 52,
|
||||
"a21": 53,
|
||||
"a22": 54,
|
||||
"a23": 55,
|
||||
"a24": 56,
|
||||
"a25": 57,
|
||||
"a26": 58,
|
||||
"a27": 59,
|
||||
"a28": 60,
|
||||
"a6": 61,
|
||||
"a7": 62,
|
||||
"a8": 63,
|
||||
"a9": 64,
|
||||
"a10": 65,
|
||||
"a29": 66,
|
||||
"a30": 67,
|
||||
"a31": 68,
|
||||
"a32": 69,
|
||||
"a33": 70,
|
||||
"a34": 71,
|
||||
"a35": 72,
|
||||
"a36": 73,
|
||||
"a37": 74,
|
||||
"a38": 75,
|
||||
"a39": 76,
|
||||
"a40": 77,
|
||||
"a41": 78,
|
||||
"a42": 79,
|
||||
"a43": 80,
|
||||
"a44": 81,
|
||||
"a45": 82,
|
||||
"a46": 83,
|
||||
"a47": 84,
|
||||
"a48": 85,
|
||||
"a49": 86,
|
||||
"a50": 87,
|
||||
"a51": 88,
|
||||
"a52": 89,
|
||||
"a53": 90,
|
||||
"a54": 91,
|
||||
"a55": 92,
|
||||
"a56": 93,
|
||||
"a57": 94,
|
||||
"a58": 95,
|
||||
"a59": 96,
|
||||
"a60": 97,
|
||||
"a61": 98,
|
||||
"a62": 99,
|
||||
"a63": 100,
|
||||
"a64": 101,
|
||||
"a65": 102,
|
||||
"a66": 103,
|
||||
"a67": 104,
|
||||
"a68": 105,
|
||||
"a69": 106,
|
||||
"a70": 107,
|
||||
"a71": 108,
|
||||
"a72": 109,
|
||||
"a73": 110,
|
||||
"a74": 111,
|
||||
"a203": 112,
|
||||
"a75": 113,
|
||||
"a204": 114,
|
||||
"a76": 115,
|
||||
"a77": 116,
|
||||
"a78": 117,
|
||||
"a79": 118,
|
||||
"a81": 119,
|
||||
"a82": 120,
|
||||
"a83": 121,
|
||||
"a84": 122,
|
||||
"a97": 123,
|
||||
"a98": 124,
|
||||
"a99": 125,
|
||||
"a100": 126,
|
||||
"a89": 128,
|
||||
"a90": 129,
|
||||
"a93": 130,
|
||||
"a94": 131,
|
||||
"a91": 132,
|
||||
"a92": 133,
|
||||
"a205": 134,
|
||||
"a85": 135,
|
||||
"a206": 136,
|
||||
"a86": 137,
|
||||
"a87": 138,
|
||||
"a88": 139,
|
||||
"a95": 140,
|
||||
"a96": 141,
|
||||
"a101": 161,
|
||||
"a102": 162,
|
||||
"a103": 163,
|
||||
"a104": 164,
|
||||
"a106": 165,
|
||||
"a107": 166,
|
||||
"a108": 167,
|
||||
"a112": 168,
|
||||
"a111": 169,
|
||||
"a110": 170,
|
||||
"a109": 171,
|
||||
"a120": 172,
|
||||
"a121": 173,
|
||||
"a122": 174,
|
||||
"a123": 175,
|
||||
"a124": 176,
|
||||
"a125": 177,
|
||||
"a126": 178,
|
||||
"a127": 179,
|
||||
"a128": 180,
|
||||
"a129": 181,
|
||||
"a130": 182,
|
||||
"a131": 183,
|
||||
"a132": 184,
|
||||
"a133": 185,
|
||||
"a134": 186,
|
||||
"a135": 187,
|
||||
"a136": 188,
|
||||
"a137": 189,
|
||||
"a138": 190,
|
||||
"a139": 191,
|
||||
"a140": 192,
|
||||
"a141": 193,
|
||||
"a142": 194,
|
||||
"a143": 195,
|
||||
"a144": 196,
|
||||
"a145": 197,
|
||||
"a146": 198,
|
||||
"a147": 199,
|
||||
"a148": 200,
|
||||
"a149": 201,
|
||||
"a150": 202,
|
||||
"a151": 203,
|
||||
"a152": 204,
|
||||
"a153": 205,
|
||||
"a154": 206,
|
||||
"a155": 207,
|
||||
"a156": 208,
|
||||
"a157": 209,
|
||||
"a158": 210,
|
||||
"a159": 211,
|
||||
"a160": 212,
|
||||
"a161": 213,
|
||||
"a163": 214,
|
||||
"a164": 215,
|
||||
"a196": 216,
|
||||
"a165": 217,
|
||||
"a192": 218,
|
||||
"a166": 219,
|
||||
"a167": 220,
|
||||
"a168": 221,
|
||||
"a169": 222,
|
||||
"a170": 223,
|
||||
"a171": 224,
|
||||
"a172": 225,
|
||||
"a173": 226,
|
||||
"a162": 227,
|
||||
"a174": 228,
|
||||
"a175": 229,
|
||||
"a176": 230,
|
||||
"a177": 231,
|
||||
"a178": 232,
|
||||
"a179": 233,
|
||||
"a193": 234,
|
||||
"a180": 235,
|
||||
"a199": 236,
|
||||
"a181": 237,
|
||||
"a200": 238,
|
||||
"a182": 239,
|
||||
"a201": 241,
|
||||
"a183": 242,
|
||||
"a184": 243,
|
||||
"a197": 244,
|
||||
"a185": 245,
|
||||
"a194": 246,
|
||||
"a198": 247,
|
||||
"a186": 248,
|
||||
"a195": 249,
|
||||
"a187": 250,
|
||||
"a188": 251,
|
||||
"a189": 252,
|
||||
"a190": 253,
|
||||
"a191": 254,
|
||||
}
|
||||
57
internal/pdf/model/utils.go
Normal file
57
internal/pdf/model/utils.go
Normal file
@@ -0,0 +1,57 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
func getNumberAsFloat(obj core.PdfObject) (float64, error) {
|
||||
if fObj, ok := obj.(*core.PdfObjectFloat); ok {
|
||||
return float64(*fObj), nil
|
||||
}
|
||||
|
||||
if iObj, ok := obj.(*core.PdfObjectInteger); ok {
|
||||
return float64(*iObj), nil
|
||||
}
|
||||
|
||||
return 0, errors.New("not a number")
|
||||
}
|
||||
|
||||
func isNullObject(obj core.PdfObject) bool {
|
||||
if _, isNull := obj.(*core.PdfObjectNull); isNull {
|
||||
return true
|
||||
} else {
|
||||
return false
|
||||
}
|
||||
}
|
||||
|
||||
// Convert a list of pdf objects representing floats or integers to a slice of float64 values.
|
||||
func getNumbersAsFloat(objects []core.PdfObject) ([]float64, error) {
|
||||
floats := []float64{}
|
||||
for _, obj := range objects {
|
||||
val, err := getNumberAsFloat(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
floats = append(floats, val)
|
||||
|
||||
}
|
||||
return floats, nil
|
||||
}
|
||||
|
||||
// Cases where expecting an integer, but some implementations actually
|
||||
// store the number in a floating point format.
|
||||
func getNumberAsInt64(obj core.PdfObject) (int64, error) {
|
||||
if iObj, ok := obj.(*core.PdfObjectInteger); ok {
|
||||
return int64(*iObj), nil
|
||||
}
|
||||
|
||||
if fObj, ok := obj.(*core.PdfObjectFloat); ok {
|
||||
common.Log.Debug("Number expected as integer was stored as float (type casting used)")
|
||||
return int64(*fObj), nil
|
||||
}
|
||||
|
||||
return 0, errors.New("not a number")
|
||||
}
|
||||
639
internal/pdf/model/writer.go
Normal file
639
internal/pdf/model/writer.go
Normal file
@@ -0,0 +1,639 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"bufio"
|
||||
"crypto/md5"
|
||||
"crypto/rand"
|
||||
"errors"
|
||||
"fmt"
|
||||
"io"
|
||||
"math"
|
||||
"os"
|
||||
"time"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
var pdfCreator = ""
|
||||
|
||||
func getPdfCreator() string {
|
||||
if len(pdfCreator) > 0 {
|
||||
return pdfCreator
|
||||
}
|
||||
|
||||
// Return default.
|
||||
return ""
|
||||
}
|
||||
|
||||
func SetPdfCreator(creator string) {
|
||||
pdfCreator = creator
|
||||
}
|
||||
|
||||
type PdfWriter struct {
|
||||
root *core.PdfIndirectObject
|
||||
pages *core.PdfIndirectObject
|
||||
objects []core.PdfObject
|
||||
objectsMap map[core.PdfObject]bool // Quick lookup table.
|
||||
writer *bufio.Writer
|
||||
outlineTree *PdfOutlineTreeNode
|
||||
catalog *core.PdfObjectDictionary
|
||||
infoObj *core.PdfIndirectObject
|
||||
|
||||
// Encryption
|
||||
crypter *core.PdfCrypt
|
||||
encryptDict *core.PdfObjectDictionary
|
||||
encryptObj *core.PdfIndirectObject
|
||||
ids *core.PdfObjectArray
|
||||
|
||||
// PDF version
|
||||
majorVersion int
|
||||
minorVersion int
|
||||
|
||||
// Objects to be followed up on prior to writing.
|
||||
// These are objects that are added and reference objects that are not included
|
||||
// for writing.
|
||||
// The map stores the object and the dictionary it is contained in.
|
||||
// Only way so we can access the dictionary entry later.
|
||||
pendingObjects map[core.PdfObject]*core.PdfObjectDictionary
|
||||
|
||||
// Forms.
|
||||
acroForm *PdfAcroForm
|
||||
}
|
||||
|
||||
func NewPdfWriter() PdfWriter {
|
||||
w := PdfWriter{}
|
||||
|
||||
w.objectsMap = map[core.PdfObject]bool{}
|
||||
w.objects = []core.PdfObject{}
|
||||
w.pendingObjects = map[core.PdfObject]*core.PdfObjectDictionary{}
|
||||
|
||||
// PDF Version. Can be changed if using more advanced features in PDF.
|
||||
// By default it is set to 1.3.
|
||||
w.majorVersion = 1
|
||||
w.minorVersion = 3
|
||||
|
||||
// Creation info.
|
||||
infoDict := core.MakeDict()
|
||||
infoDict.Set("Producer", core.MakeString(""))
|
||||
infoDict.Set("Creator", core.MakeString(getPdfCreator()))
|
||||
infoObj := core.PdfIndirectObject{}
|
||||
infoObj.PdfObject = infoDict
|
||||
w.infoObj = &infoObj
|
||||
w.addObject(&infoObj)
|
||||
|
||||
// Root catalog.
|
||||
catalog := core.PdfIndirectObject{}
|
||||
catalogDict := core.MakeDict()
|
||||
catalogDict.Set("Type", core.MakeName("Catalog"))
|
||||
catalog.PdfObject = catalogDict
|
||||
|
||||
w.root = &catalog
|
||||
w.addObject(&catalog)
|
||||
|
||||
// Pages.
|
||||
pages := core.PdfIndirectObject{}
|
||||
pagedict := core.MakeDict()
|
||||
pagedict.Set("Type", core.MakeName("Pages"))
|
||||
kids := core.PdfObjectArray{}
|
||||
pagedict.Set("Kids", &kids)
|
||||
pagedict.Set("Count", core.MakeInteger(0))
|
||||
pages.PdfObject = pagedict
|
||||
|
||||
w.pages = &pages
|
||||
w.addObject(&pages)
|
||||
|
||||
catalogDict.Set("Pages", &pages)
|
||||
w.catalog = catalogDict
|
||||
|
||||
common.Log.Trace("Catalog %s", catalog)
|
||||
|
||||
return w
|
||||
}
|
||||
|
||||
// Set the PDF version of the output file.
|
||||
func (pw *PdfWriter) SetVersion(majorVersion, minorVersion int) {
|
||||
pw.majorVersion = majorVersion
|
||||
pw.minorVersion = minorVersion
|
||||
}
|
||||
|
||||
// Set the optional content properties.
|
||||
func (pw *PdfWriter) SetOCProperties(ocProperties core.PdfObject) error {
|
||||
dict := pw.catalog
|
||||
|
||||
if ocProperties != nil {
|
||||
common.Log.Trace("Setting OC Properties...")
|
||||
dict.Set("OCProperties", ocProperties)
|
||||
// Any risk of infinite loops?
|
||||
pw.addObjects(ocProperties)
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
func (pw *PdfWriter) hasObject(obj core.PdfObject) bool {
|
||||
// Check if already added.
|
||||
for _, o := range pw.objects {
|
||||
// GH: May perform better to use a hash map to check if added?
|
||||
if o == obj {
|
||||
return true
|
||||
}
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
// Adds the object to list of objects and returns true if the obj was
|
||||
// not already added.
|
||||
// Returns false if the object was previously added.
|
||||
func (pw *PdfWriter) addObject(obj core.PdfObject) bool {
|
||||
hasObj := pw.hasObject(obj)
|
||||
if !hasObj {
|
||||
pw.objects = append(pw.objects, obj)
|
||||
return true
|
||||
}
|
||||
|
||||
return false
|
||||
}
|
||||
|
||||
func (pw *PdfWriter) addObjects(obj core.PdfObject) error {
|
||||
common.Log.Trace("Adding objects!")
|
||||
|
||||
if io, isIndirectObj := obj.(*core.PdfIndirectObject); isIndirectObj {
|
||||
common.Log.Trace("Indirect")
|
||||
common.Log.Trace("- %s (%p)", obj, io)
|
||||
common.Log.Trace("- %s", io.PdfObject)
|
||||
if pw.addObject(io) {
|
||||
err := pw.addObjects(io.PdfObject)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
if so, isStreamObj := obj.(*core.PdfObjectStream); isStreamObj {
|
||||
common.Log.Trace("Stream")
|
||||
common.Log.Trace("- %s %p", obj, obj)
|
||||
if pw.addObject(so) {
|
||||
err := pw.addObjects(so.PdfObjectDictionary)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
if dict, isDict := obj.(*core.PdfObjectDictionary); isDict {
|
||||
common.Log.Trace("Dict")
|
||||
common.Log.Trace("- %s", obj)
|
||||
for _, k := range dict.Keys() {
|
||||
v := dict.Get(k)
|
||||
common.Log.Trace("Key %s", k)
|
||||
if k != "Parent" {
|
||||
err := pw.addObjects(v)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
} else {
|
||||
if _, parentIsNull := dict.Get("Parent").(*core.PdfObjectNull); parentIsNull {
|
||||
// Parent is null. We can ignore it.
|
||||
continue
|
||||
}
|
||||
|
||||
if hasObj := pw.hasObject(v); !hasObj {
|
||||
common.Log.Debug("Parent obj is missing!! %T %p %v", v, v, v)
|
||||
pw.pendingObjects[v] = dict
|
||||
// Although it is missing at this point, it could be added later...
|
||||
}
|
||||
// How to handle the parent? Make sure it is present?
|
||||
if parentObj, parentIsRef := dict.Get("Parent").(*core.PdfObjectReference); parentIsRef {
|
||||
// Parent is a reference. Means we can drop it?
|
||||
// Could refer to somewhere outside of the scope of the output doc.
|
||||
// Should be done by the reader already.
|
||||
// -> ERROR.
|
||||
common.Log.Debug("error: Parent is a reference object - Cannot be in writer (needs to be resolved)")
|
||||
return fmt.Errorf("parent is a reference object - Cannot be in writer (needs to be resolved) - %s", parentObj)
|
||||
}
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
if arr, isArray := obj.(*core.PdfObjectArray); isArray {
|
||||
common.Log.Trace("Array")
|
||||
common.Log.Trace("- %s", obj)
|
||||
if arr == nil {
|
||||
return errors.New("array is nil")
|
||||
}
|
||||
for _, v := range *arr {
|
||||
err := pw.addObjects(v)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
return nil
|
||||
}
|
||||
|
||||
if _, isReference := obj.(*core.PdfObjectReference); isReference {
|
||||
// Should never be a reference, should already be resolved.
|
||||
common.Log.Debug("error: Cannot be a reference!")
|
||||
return errors.New("reference not allowed")
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Add a page to the PDF file. The new page should be an indirect
|
||||
// object.
|
||||
func (pw *PdfWriter) AddPage(page *PdfPage) error {
|
||||
obj := page.ToPdfObject()
|
||||
common.Log.Trace("==========")
|
||||
common.Log.Trace("Appending to page list %T", obj)
|
||||
|
||||
pageObj, ok := obj.(*core.PdfIndirectObject)
|
||||
if !ok {
|
||||
return errors.New("page should be an indirect object")
|
||||
}
|
||||
common.Log.Trace("%s", pageObj)
|
||||
common.Log.Trace("%s", pageObj.PdfObject)
|
||||
|
||||
pDict, ok := pageObj.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return errors.New("page object should be a dictionary")
|
||||
}
|
||||
|
||||
otype, ok := pDict.Get("Type").(*core.PdfObjectName)
|
||||
if !ok {
|
||||
return fmt.Errorf("page should have a Type key with a value of type name (%T)", pDict.Get("Type"))
|
||||
|
||||
}
|
||||
if *otype != "Page" {
|
||||
return errors.New("type != Page (Required)")
|
||||
}
|
||||
|
||||
// Copy inherited fields if missing.
|
||||
inheritedFields := []core.PdfObjectName{"Resources", "MediaBox", "CropBox", "Rotate"}
|
||||
parent, hasParent := pDict.Get("Parent").(*core.PdfIndirectObject)
|
||||
common.Log.Trace("Page Parent: %T (%v)", pDict.Get("Parent"), hasParent)
|
||||
for hasParent {
|
||||
common.Log.Trace("Page Parent: %T", parent)
|
||||
parentDict, ok := parent.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return errors.New("invalid Parent object")
|
||||
}
|
||||
for _, field := range inheritedFields {
|
||||
common.Log.Trace("Field %s", field)
|
||||
if pDict.Get(field) != nil {
|
||||
common.Log.Trace("- page has already")
|
||||
continue
|
||||
}
|
||||
|
||||
if obj := parentDict.Get(field); obj != nil {
|
||||
// Parent has the field. Inherit, pass to the new page.
|
||||
common.Log.Trace("Inheriting field %s", field)
|
||||
pDict.Set(field, obj)
|
||||
}
|
||||
}
|
||||
parent, hasParent = parentDict.Get("Parent").(*core.PdfIndirectObject)
|
||||
common.Log.Trace("Next parent: %T", parentDict.Get("Parent"))
|
||||
}
|
||||
|
||||
common.Log.Trace("Traversal done")
|
||||
|
||||
// Update the dictionary.
|
||||
// Reuses the input object, updating the fields.
|
||||
pDict.Set("Parent", pw.pages)
|
||||
pageObj.PdfObject = pDict
|
||||
|
||||
// Add to Pages.
|
||||
pagesDict, ok := pw.pages.PdfObject.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
return errors.New("invalid Pages obj (not a dict)")
|
||||
}
|
||||
kids, ok := pagesDict.Get("Kids").(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
return errors.New("invalid Pages Kids obj (not an array)")
|
||||
}
|
||||
*kids = append(*kids, pageObj)
|
||||
pageCount, ok := pagesDict.Get("Count").(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
return errors.New("invalid Pages Count object (not an integer)")
|
||||
}
|
||||
// Update the count.
|
||||
*pageCount = *pageCount + 1
|
||||
|
||||
pw.addObject(pageObj)
|
||||
|
||||
// Traverse the page and record all object references.
|
||||
err := pw.addObjects(pDict)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Add outlines to a PDF file.
|
||||
func (pw *PdfWriter) AddOutlineTree(outlineTree *PdfOutlineTreeNode) {
|
||||
pw.outlineTree = outlineTree
|
||||
}
|
||||
|
||||
// Add Acroforms to a PDF file. Sets the specified form for writing.
|
||||
func (pw *PdfWriter) SetForms(form *PdfAcroForm) error {
|
||||
pw.acroForm = form
|
||||
return nil
|
||||
}
|
||||
|
||||
// Write out an indirect / stream object.
|
||||
func (pw *PdfWriter) writeObject(num int, obj core.PdfObject) {
|
||||
common.Log.Trace("Write obj #%d\n", num)
|
||||
|
||||
if pobj, isIndirect := obj.(*core.PdfIndirectObject); isIndirect {
|
||||
outStr := fmt.Sprintf("%d 0 obj\n", num)
|
||||
outStr += pobj.PdfObject.DefaultWriteString()
|
||||
outStr += "\nendobj\n"
|
||||
pw.writer.WriteString(outStr)
|
||||
return
|
||||
}
|
||||
|
||||
// XXX/TODO: Add a default encoder if Filter not specified?
|
||||
// Still need to make sure is encrypted.
|
||||
if pobj, isStream := obj.(*core.PdfObjectStream); isStream {
|
||||
outStr := fmt.Sprintf("%d 0 obj\n", num)
|
||||
outStr += pobj.PdfObjectDictionary.DefaultWriteString()
|
||||
outStr += "\nstream\n"
|
||||
pw.writer.WriteString(outStr)
|
||||
pw.writer.Write(pobj.Stream)
|
||||
pw.writer.WriteString("\nendstream\nendobj\n")
|
||||
return
|
||||
}
|
||||
|
||||
pw.writer.WriteString(obj.DefaultWriteString())
|
||||
}
|
||||
|
||||
// Update all the object numbers prior to writing.
|
||||
func (pw *PdfWriter) updateObjectNumbers() {
|
||||
// Update numbers
|
||||
for idx, obj := range pw.objects {
|
||||
if io, isIndirect := obj.(*core.PdfIndirectObject); isIndirect {
|
||||
io.ObjectNumber = int64(idx + 1)
|
||||
io.GenerationNumber = 0
|
||||
}
|
||||
if so, isStream := obj.(*core.PdfObjectStream); isStream {
|
||||
so.ObjectNumber = int64(idx + 1)
|
||||
so.GenerationNumber = 0
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
type EncryptOptions struct {
|
||||
Permissions core.AccessPermissions
|
||||
Algorithm EncryptionAlgorithm
|
||||
}
|
||||
|
||||
// EncryptionAlgorithm is used in EncryptOptions to change the default algorithm used to encrypt the document.
|
||||
type EncryptionAlgorithm int
|
||||
|
||||
const (
|
||||
// RC4_128bit uses RC4 encryption (128 bit)
|
||||
RC4_128bit = EncryptionAlgorithm(iota)
|
||||
// AES_128bit uses AES encryption (128 bit, PDF 1.6)
|
||||
AES_128bit
|
||||
// AES_256bit uses AES encryption (256 bit, PDF 2.0)
|
||||
AES_256bit
|
||||
)
|
||||
|
||||
// Encrypt the output file with a specified user/owner password.
|
||||
func (pw *PdfWriter) Encrypt(userPass, ownerPass []byte, options *EncryptOptions) error {
|
||||
crypter := core.PdfCrypt{}
|
||||
pw.crypter = &crypter
|
||||
|
||||
crypter.EncryptedObjects = map[core.PdfObject]bool{}
|
||||
|
||||
crypter.CryptFilters = core.CryptFilters{}
|
||||
|
||||
algo := RC4_128bit
|
||||
if options != nil {
|
||||
algo = options.Algorithm
|
||||
}
|
||||
|
||||
var cf core.CryptFilter
|
||||
switch algo {
|
||||
case RC4_128bit:
|
||||
crypter.V = 2
|
||||
crypter.R = 3
|
||||
cf = core.NewCryptFilterV2(16)
|
||||
case AES_128bit:
|
||||
pw.SetVersion(1, 5)
|
||||
crypter.V = 4
|
||||
crypter.R = 4
|
||||
cf = core.NewCryptFilterAESV2()
|
||||
case AES_256bit:
|
||||
pw.SetVersion(2, 0)
|
||||
crypter.V = 5
|
||||
crypter.R = 6 // TODO(dennwc): a way to set R=5?
|
||||
cf = core.NewCryptFilterAESV3()
|
||||
default:
|
||||
return fmt.Errorf("unsupported algorithm: %v", options.Algorithm)
|
||||
}
|
||||
crypter.Length = cf.Length * 8
|
||||
|
||||
const (
|
||||
defaultFilter = core.StandardCryptFilter
|
||||
)
|
||||
crypter.CryptFilters[defaultFilter] = cf
|
||||
if crypter.V >= 4 {
|
||||
crypter.StreamFilter = defaultFilter
|
||||
crypter.StringFilter = defaultFilter
|
||||
}
|
||||
|
||||
// Set
|
||||
crypter.P = math.MaxUint32
|
||||
crypter.EncryptMetadata = true
|
||||
if options != nil {
|
||||
crypter.P = int(options.Permissions.GetP())
|
||||
}
|
||||
|
||||
// Generate the encryption dictionary.
|
||||
ed := core.MakeDict()
|
||||
ed.Set("Filter", core.MakeName("Standard"))
|
||||
ed.Set("P", core.MakeInteger(int64(crypter.P)))
|
||||
ed.Set("V", core.MakeInteger(int64(crypter.V)))
|
||||
ed.Set("R", core.MakeInteger(int64(crypter.R)))
|
||||
ed.Set("Length", core.MakeInteger(int64(crypter.Length)))
|
||||
pw.encryptDict = ed
|
||||
|
||||
// Prepare the ID object for the trailer.
|
||||
hashcode := md5.Sum([]byte(time.Now().Format(time.RFC850)))
|
||||
id0 := core.PdfObjectString(hashcode[:])
|
||||
b := make([]byte, 100)
|
||||
rand.Read(b)
|
||||
hashcode = md5.Sum(b)
|
||||
id1 := core.PdfObjectString(hashcode[:])
|
||||
common.Log.Trace("Random b: % x", b)
|
||||
|
||||
pw.ids = &core.PdfObjectArray{&id0, &id1}
|
||||
common.Log.Trace("Gen Id 0: % x", id0)
|
||||
|
||||
// Generate encryption parameters
|
||||
if crypter.R < 5 {
|
||||
crypter.Id0 = string(id0)
|
||||
|
||||
// Make the O and U objects.
|
||||
O, err := crypter.Alg3(userPass, ownerPass)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Error generating O for encryption (%s)", err)
|
||||
return err
|
||||
}
|
||||
crypter.O = []byte(O)
|
||||
common.Log.Trace("gen O: % x", O)
|
||||
U, key, err := crypter.Alg5(userPass)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Error generating O for encryption (%s)", err)
|
||||
return err
|
||||
}
|
||||
common.Log.Trace("gen U: % x", U)
|
||||
crypter.U = []byte(U)
|
||||
crypter.EncryptionKey = key
|
||||
|
||||
ed.Set("O", &O)
|
||||
ed.Set("U", &U)
|
||||
} else { // R >= 5
|
||||
err := crypter.GenerateParams(userPass, ownerPass)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
ed.Set("O", core.MakeString(string(crypter.O)))
|
||||
ed.Set("U", core.MakeString(string(crypter.U)))
|
||||
ed.Set("OE", core.MakeString(string(crypter.OE)))
|
||||
ed.Set("UE", core.MakeString(string(crypter.UE)))
|
||||
ed.Set("EncryptMetadata", core.MakeBool(crypter.EncryptMetadata))
|
||||
if crypter.R > 5 {
|
||||
ed.Set("Perms", core.MakeString(string(crypter.Perms)))
|
||||
}
|
||||
}
|
||||
if crypter.V >= 4 {
|
||||
if err := crypter.SaveCryptFilters(ed); err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
// Make an object to contain the encryption dictionary.
|
||||
io := core.MakeIndirectObject(ed)
|
||||
pw.encryptObj = io
|
||||
pw.addObject(io)
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Write the pdf out.
|
||||
func (pw *PdfWriter) Write(ws io.WriteSeeker) error {
|
||||
// Outlines.
|
||||
if pw.outlineTree != nil {
|
||||
common.Log.Trace("OutlineTree: %+v", pw.outlineTree)
|
||||
outlines := pw.outlineTree.ToPdfObject()
|
||||
common.Log.Trace("Outlines: %+v (%T, p:%p)", outlines, outlines, outlines)
|
||||
pw.catalog.Set("Outlines", outlines)
|
||||
err := pw.addObjects(outlines)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
// Form fields.
|
||||
if pw.acroForm != nil {
|
||||
common.Log.Trace("Writing acro forms")
|
||||
indObj := pw.acroForm.ToPdfObject()
|
||||
common.Log.Trace("AcroForm: %+v", indObj)
|
||||
pw.catalog.Set("AcroForm", indObj)
|
||||
err := pw.addObjects(indObj)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
}
|
||||
|
||||
// Check pending objects prior to write.
|
||||
for pendingObj, pendingObjDict := range pw.pendingObjects {
|
||||
if !pw.hasObject(pendingObj) {
|
||||
common.Log.Debug("error Pending object %+v %T (%p) never added for writing", pendingObj, pendingObj, pendingObj)
|
||||
for _, key := range pendingObjDict.Keys() {
|
||||
val := pendingObjDict.Get(key)
|
||||
if val == pendingObj {
|
||||
common.Log.Debug("Pending object found! and replaced with null")
|
||||
pendingObjDict.Set(key, core.MakeNull())
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
// Set version in the catalog.
|
||||
pw.catalog.Set("Version", core.MakeName(fmt.Sprintf("%d.%d", pw.majorVersion, pw.minorVersion)))
|
||||
|
||||
w := bufio.NewWriter(ws)
|
||||
pw.writer = w
|
||||
|
||||
w.WriteString(fmt.Sprintf("%%PDF-%d.%d\n", pw.majorVersion, pw.minorVersion))
|
||||
w.WriteString("%âãÏÓ\n")
|
||||
w.Flush()
|
||||
|
||||
pw.updateObjectNumbers()
|
||||
|
||||
offsets := []int64{}
|
||||
|
||||
// Write objects
|
||||
common.Log.Trace("Writing %d obj", len(pw.objects))
|
||||
for idx, obj := range pw.objects {
|
||||
common.Log.Trace("Writing %d", idx)
|
||||
pw.writer.Flush()
|
||||
offset, _ := ws.Seek(0, os.SEEK_CUR)
|
||||
offsets = append(offsets, offset)
|
||||
|
||||
// Encrypt prior to writing.
|
||||
// Encrypt dictionary should not be encrypted.
|
||||
if pw.crypter != nil && obj != pw.encryptObj {
|
||||
err := pw.crypter.Encrypt(obj, int64(idx+1), 0)
|
||||
if err != nil {
|
||||
common.Log.Debug("error: Failed encrypting (%s)", err)
|
||||
return err
|
||||
}
|
||||
|
||||
}
|
||||
pw.writeObject(idx+1, obj)
|
||||
}
|
||||
w.Flush()
|
||||
|
||||
xrefOffset, _ := ws.Seek(0, os.SEEK_CUR)
|
||||
// Write xref table.
|
||||
pw.writer.WriteString("xref\r\n")
|
||||
outStr := fmt.Sprintf("%d %d\r\n", 0, len(pw.objects)+1)
|
||||
pw.writer.WriteString(outStr)
|
||||
outStr = fmt.Sprintf("%.10d %.5d f\r\n", 0, 65535)
|
||||
pw.writer.WriteString(outStr)
|
||||
for _, offset := range offsets {
|
||||
outStr = fmt.Sprintf("%.10d %.5d n\r\n", offset, 0)
|
||||
pw.writer.WriteString(outStr)
|
||||
}
|
||||
|
||||
// Generate & write trailer
|
||||
trailer := core.MakeDict()
|
||||
trailer.Set("Info", pw.infoObj)
|
||||
trailer.Set("Root", pw.root)
|
||||
trailer.Set("Size", core.MakeInteger(int64(len(pw.objects)+1)))
|
||||
// If encrypted!
|
||||
if pw.crypter != nil {
|
||||
trailer.Set("Encrypt", pw.encryptObj)
|
||||
trailer.Set("ID", pw.ids)
|
||||
common.Log.Trace("Ids: %s", pw.ids)
|
||||
}
|
||||
pw.writer.WriteString("trailer\n")
|
||||
pw.writer.WriteString(trailer.DefaultWriteString())
|
||||
pw.writer.WriteString("\n")
|
||||
|
||||
// Make offset reference.
|
||||
outStr = fmt.Sprintf("startxref\n%d\n", xrefOffset)
|
||||
pw.writer.WriteString(outStr)
|
||||
pw.writer.WriteString("%%EOF\n")
|
||||
w.Flush()
|
||||
|
||||
return nil
|
||||
}
|
||||
588
internal/pdf/model/xobject.go
Normal file
588
internal/pdf/model/xobject.go
Normal file
@@ -0,0 +1,588 @@
|
||||
package model
|
||||
|
||||
import (
|
||||
"errors"
|
||||
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/common"
|
||||
"gitea.tecamino.com/paadi/pdfmerge/internal/pdf/core"
|
||||
)
|
||||
|
||||
// XObjectForm (Table 95 in 8.10.2).
|
||||
type XObjectForm struct {
|
||||
Filter core.StreamEncoder
|
||||
|
||||
FormType core.PdfObject
|
||||
BBox core.PdfObject
|
||||
Matrix core.PdfObject
|
||||
Resources *PdfPageResources
|
||||
Group core.PdfObject
|
||||
Ref core.PdfObject
|
||||
MetaData core.PdfObject
|
||||
PieceInfo core.PdfObject
|
||||
LastModified core.PdfObject
|
||||
StructParent core.PdfObject
|
||||
StructParents core.PdfObject
|
||||
OPI core.PdfObject
|
||||
OC core.PdfObject
|
||||
Name core.PdfObject
|
||||
|
||||
// Stream data.
|
||||
Stream []byte
|
||||
// Primitive
|
||||
primitive *core.PdfObjectStream
|
||||
}
|
||||
|
||||
var ErrTypeCheck = errors.New("type check error")
|
||||
|
||||
// Create a brand new XObject Form. Creates a new underlying PDF object stream primitive.
|
||||
func NewXObjectForm() *XObjectForm {
|
||||
xobj := &XObjectForm{}
|
||||
stream := &core.PdfObjectStream{}
|
||||
stream.PdfObjectDictionary = core.MakeDict()
|
||||
xobj.primitive = stream
|
||||
return xobj
|
||||
}
|
||||
|
||||
// Build the Form XObject from a stream object.
|
||||
// XXX: Should this be exposed? Consider different access points.
|
||||
func NewXObjectFormFromStream(stream *core.PdfObjectStream) (*XObjectForm, error) {
|
||||
form := &XObjectForm{}
|
||||
form.primitive = stream
|
||||
|
||||
dict := *(stream.PdfObjectDictionary)
|
||||
|
||||
encoder, err := core.NewEncoderFromStream(stream)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
form.Filter = encoder
|
||||
|
||||
if obj := dict.Get("Subtype"); obj != nil {
|
||||
name, ok := obj.(*core.PdfObjectName)
|
||||
if !ok {
|
||||
return nil, errors.New("type error")
|
||||
}
|
||||
if *name != "Form" {
|
||||
common.Log.Debug("invalid form subtype")
|
||||
return nil, errors.New("invalid form subtype")
|
||||
}
|
||||
}
|
||||
|
||||
if obj := dict.Get("FormType"); obj != nil {
|
||||
form.FormType = obj
|
||||
}
|
||||
if obj := dict.Get("BBox"); obj != nil {
|
||||
form.BBox = obj
|
||||
}
|
||||
if obj := dict.Get("Matrix"); obj != nil {
|
||||
form.Matrix = obj
|
||||
}
|
||||
if obj := dict.Get("Resources"); obj != nil {
|
||||
obj = core.TraceToDirectObject(obj)
|
||||
d, ok := obj.(*core.PdfObjectDictionary)
|
||||
if !ok {
|
||||
common.Log.Debug("invalid XObject Form Resources object, pointing to non-dictionary")
|
||||
return nil, errors.New("type check error")
|
||||
}
|
||||
res, err := NewPdfPageResourcesFromDict(d)
|
||||
if err != nil {
|
||||
common.Log.Debug("Failed getting form resources")
|
||||
return nil, err
|
||||
}
|
||||
form.Resources = res
|
||||
common.Log.Trace("Form resources: %#v", form.Resources)
|
||||
}
|
||||
|
||||
form.Group = dict.Get("Group")
|
||||
form.Ref = dict.Get("Ref")
|
||||
form.MetaData = dict.Get("MetaData")
|
||||
form.PieceInfo = dict.Get("PieceInfo")
|
||||
form.LastModified = dict.Get("LastModified")
|
||||
form.StructParent = dict.Get("StructParent")
|
||||
form.StructParents = dict.Get("StructParents")
|
||||
form.OPI = dict.Get("OPI")
|
||||
form.OC = dict.Get("OC")
|
||||
form.Name = dict.Get("Name")
|
||||
|
||||
form.Stream = stream.Stream
|
||||
|
||||
return form, nil
|
||||
}
|
||||
|
||||
func (xform *XObjectForm) GetContainingPdfObject() core.PdfObject {
|
||||
return xform.primitive
|
||||
}
|
||||
|
||||
func (xform *XObjectForm) GetContentStream() ([]byte, error) {
|
||||
decoded, err := core.DecodeStream(xform.primitive)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
||||
return decoded, nil
|
||||
}
|
||||
|
||||
// Update the content stream with specified encoding. If encoding is null, will use the xform.Filter object
|
||||
// or Raw encoding if not set.
|
||||
func (xform *XObjectForm) SetContentStream(content []byte, encoder core.StreamEncoder) error {
|
||||
encoded := content
|
||||
|
||||
if encoder == nil {
|
||||
if xform.Filter != nil {
|
||||
encoder = xform.Filter
|
||||
} else {
|
||||
encoder = core.NewRawEncoder()
|
||||
}
|
||||
}
|
||||
|
||||
enc, err := encoder.EncodeBytes(encoded)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
encoded = enc
|
||||
|
||||
xform.Stream = encoded
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Return a stream object.
|
||||
func (xform *XObjectForm) ToPdfObject() core.PdfObject {
|
||||
stream := xform.primitive
|
||||
|
||||
dict := stream.PdfObjectDictionary
|
||||
if xform.Filter != nil {
|
||||
// Pre-populate the stream dictionary with the encoding related fields.
|
||||
dict = xform.Filter.MakeStreamDict()
|
||||
stream.PdfObjectDictionary = dict
|
||||
}
|
||||
dict.Set("Type", core.MakeName("XObject"))
|
||||
dict.Set("Subtype", core.MakeName("Form"))
|
||||
|
||||
dict.SetIfNotNil("FormType", xform.FormType)
|
||||
dict.SetIfNotNil("BBox", xform.BBox)
|
||||
dict.SetIfNotNil("Matrix", xform.Matrix)
|
||||
if xform.Resources != nil {
|
||||
dict.SetIfNotNil("Resources", xform.Resources.ToPdfObject())
|
||||
}
|
||||
dict.SetIfNotNil("Group", xform.Group)
|
||||
dict.SetIfNotNil("Ref", xform.Ref)
|
||||
dict.SetIfNotNil("MetaData", xform.MetaData)
|
||||
dict.SetIfNotNil("PieceInfo", xform.PieceInfo)
|
||||
dict.SetIfNotNil("LastModified", xform.LastModified)
|
||||
dict.SetIfNotNil("StructParent", xform.StructParent)
|
||||
dict.SetIfNotNil("StructParents", xform.StructParents)
|
||||
dict.SetIfNotNil("OPI", xform.OPI)
|
||||
dict.SetIfNotNil("OC", xform.OC)
|
||||
dict.SetIfNotNil("Name", xform.Name)
|
||||
|
||||
dict.Set("Length", core.MakeInteger(int64(len(xform.Stream))))
|
||||
stream.Stream = xform.Stream
|
||||
|
||||
return stream
|
||||
}
|
||||
|
||||
// XObjectImage (Table 89 in 8.9.5.1).
|
||||
// Implements PdfModel interface.
|
||||
type XObjectImage struct {
|
||||
//ColorSpace PdfObject
|
||||
Width *int64
|
||||
Height *int64
|
||||
ColorSpace PdfColorspace
|
||||
BitsPerComponent *int64
|
||||
Filter core.StreamEncoder
|
||||
|
||||
Intent core.PdfObject
|
||||
ImageMask core.PdfObject
|
||||
Mask core.PdfObject
|
||||
Matte core.PdfObject
|
||||
Decode core.PdfObject
|
||||
Interpolate core.PdfObject
|
||||
Alternatives core.PdfObject
|
||||
SMask core.PdfObject
|
||||
SMaskInData core.PdfObject
|
||||
Name core.PdfObject // Obsolete. Currently read if available and write if available. Not setting on new created files.
|
||||
StructParent core.PdfObject
|
||||
ID core.PdfObject
|
||||
OPI core.PdfObject
|
||||
Metadata core.PdfObject
|
||||
OC core.PdfObject
|
||||
Stream []byte
|
||||
// Primitive
|
||||
primitive *core.PdfObjectStream
|
||||
}
|
||||
|
||||
func NewXObjectImage() *XObjectImage {
|
||||
xobj := &XObjectImage{}
|
||||
stream := &core.PdfObjectStream{}
|
||||
stream.PdfObjectDictionary = core.MakeDict()
|
||||
xobj.primitive = stream
|
||||
return xobj
|
||||
}
|
||||
|
||||
// Creates a new XObject Image from an image object with default options.
|
||||
// If encoder is nil, uses raw encoding (none).
|
||||
func NewXObjectImageFromImage(img *Image, cs PdfColorspace, encoder core.StreamEncoder) (*XObjectImage, error) {
|
||||
xobj := NewXObjectImage()
|
||||
return UpdateXObjectImageFromImage(xobj, img, cs, encoder)
|
||||
}
|
||||
|
||||
// UpdateXObjectImageFromImage creates a new XObject Image from an Image object `img` and default
|
||||
//
|
||||
// masks from xobjIn.
|
||||
//
|
||||
// The default masks are overriden if img.hasAlpha
|
||||
// If `encoder` is nil, uses raw encoding (none).
|
||||
func UpdateXObjectImageFromImage(xobjIn *XObjectImage, img *Image, cs PdfColorspace,
|
||||
encoder core.StreamEncoder) (*XObjectImage, error) {
|
||||
xobj := NewXObjectImage()
|
||||
|
||||
if encoder == nil {
|
||||
encoder = core.NewRawEncoder()
|
||||
}
|
||||
|
||||
encoded, err := encoder.EncodeBytes(img.Data)
|
||||
if err != nil {
|
||||
common.Log.Debug("error with encoding: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
|
||||
xobj.Filter = encoder
|
||||
xobj.Stream = encoded
|
||||
|
||||
// Width and height.
|
||||
imWidth := img.Width
|
||||
imHeight := img.Height
|
||||
xobj.Width = &imWidth
|
||||
xobj.Height = &imHeight
|
||||
|
||||
// Bits.
|
||||
xobj.BitsPerComponent = &img.BitsPerComponent
|
||||
|
||||
// Guess colorspace if not explicitly set.
|
||||
if cs == nil {
|
||||
switch img.ColorComponents {
|
||||
case 1:
|
||||
xobj.ColorSpace = NewPdfColorspaceDeviceGray()
|
||||
case 3:
|
||||
xobj.ColorSpace = NewPdfColorspaceDeviceRGB()
|
||||
case 4:
|
||||
xobj.ColorSpace = NewPdfColorspaceDeviceCMYK()
|
||||
default:
|
||||
return nil, errors.New("colorspace undefined")
|
||||
}
|
||||
} else {
|
||||
xobj.ColorSpace = cs
|
||||
}
|
||||
|
||||
if img.hasAlpha {
|
||||
// Add the alpha channel information as a stencil mask (SMask).
|
||||
// Has same width and height as original and stored in same
|
||||
// bits per component (1 component, hence the DeviceGray channel).
|
||||
smask := NewXObjectImage()
|
||||
smask.Filter = encoder
|
||||
encoded, err := encoder.EncodeBytes(img.alphaData)
|
||||
if err != nil {
|
||||
common.Log.Debug("error with encoding: %v", err)
|
||||
return nil, err
|
||||
}
|
||||
smask.Stream = encoded
|
||||
smask.BitsPerComponent = &img.BitsPerComponent
|
||||
smask.Width = &img.Width
|
||||
smask.Height = &img.Height
|
||||
smask.ColorSpace = NewPdfColorspaceDeviceGray()
|
||||
xobj.SMask = smask.ToPdfObject()
|
||||
} else {
|
||||
xobj.SMask = xobjIn.SMask
|
||||
xobj.ImageMask = xobjIn.ImageMask
|
||||
if xobj.ColorSpace.GetNumComponents() == 1 {
|
||||
smaskMatteToGray(xobj)
|
||||
}
|
||||
}
|
||||
|
||||
return xobj, nil
|
||||
}
|
||||
|
||||
// smaskMatteToGray converts to gray the Matte value in the SMask image referenced by `xobj` (if
|
||||
// there is one)
|
||||
func smaskMatteToGray(xobj *XObjectImage) error {
|
||||
if xobj.SMask == nil {
|
||||
return nil
|
||||
}
|
||||
stream, ok := xobj.SMask.(*core.PdfObjectStream)
|
||||
if !ok {
|
||||
common.Log.Debug("SMask is not *PdfObjectStream")
|
||||
return ErrTypeCheck
|
||||
}
|
||||
dict := stream.PdfObjectDictionary
|
||||
matte := dict.Get("Matte")
|
||||
if matte == nil {
|
||||
return nil
|
||||
}
|
||||
|
||||
gray, err := toGray(matte.(*core.PdfObjectArray))
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
grayMatte := core.MakeArrayFromFloats([]float64{gray})
|
||||
dict.SetIfNotNil("Matte", grayMatte)
|
||||
return nil
|
||||
}
|
||||
|
||||
// toGray converts a 1, 3 or 4 dimensional color `matte` to gray
|
||||
// If `matte` is not a 1, 3 or 4 dimensional color then an error is returned
|
||||
func toGray(matte *core.PdfObjectArray) (float64, error) {
|
||||
colors, err := matte.ToFloat64Array()
|
||||
if err != nil {
|
||||
common.Log.Debug("Bad Matte array: matte=%s err=%v", matte, err)
|
||||
}
|
||||
switch len(colors) {
|
||||
case 1:
|
||||
return colors[0], nil
|
||||
case 3:
|
||||
cs := PdfColorspaceDeviceRGB{}
|
||||
rgbColor, err := cs.ColorFromFloats(colors)
|
||||
if err != nil {
|
||||
return 0.0, err
|
||||
}
|
||||
return rgbColor.(*PdfColorDeviceRGB).ToGray().Val(), nil
|
||||
|
||||
case 4:
|
||||
cs := PdfColorspaceDeviceCMYK{}
|
||||
cmykColor, err := cs.ColorFromFloats(colors)
|
||||
if err != nil {
|
||||
return 0.0, err
|
||||
}
|
||||
rgbColor, err := cs.ColorToRGB(cmykColor.(*PdfColorDeviceCMYK))
|
||||
if err != nil {
|
||||
return 0.0, err
|
||||
}
|
||||
return rgbColor.(*PdfColorDeviceRGB).ToGray().Val(), nil
|
||||
}
|
||||
err = errors.New("bad Matte color")
|
||||
common.Log.Error("toGray: matte=%s err=%v", matte, err)
|
||||
return 0.0, err
|
||||
}
|
||||
|
||||
// Build the image xobject from a stream object.
|
||||
// An image dictionary is the dictionary portion of a stream object representing an image XObject.
|
||||
func NewXObjectImageFromStream(stream *core.PdfObjectStream) (*XObjectImage, error) {
|
||||
img := &XObjectImage{}
|
||||
img.primitive = stream
|
||||
|
||||
dict := *(stream.PdfObjectDictionary)
|
||||
|
||||
encoder, err := core.NewEncoderFromStream(stream)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
img.Filter = encoder
|
||||
|
||||
if obj := core.TraceToDirectObject(dict.Get("Width")); obj != nil {
|
||||
iObj, ok := obj.(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid image width object")
|
||||
}
|
||||
iVal := int64(*iObj)
|
||||
img.Width = &iVal
|
||||
} else {
|
||||
return nil, errors.New("width missing")
|
||||
}
|
||||
|
||||
if obj := core.TraceToDirectObject(dict.Get("Height")); obj != nil {
|
||||
iObj, ok := obj.(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid image height object")
|
||||
}
|
||||
iVal := int64(*iObj)
|
||||
img.Height = &iVal
|
||||
} else {
|
||||
return nil, errors.New("height missing")
|
||||
}
|
||||
|
||||
if obj := core.TraceToDirectObject(dict.Get("ColorSpace")); obj != nil {
|
||||
cs, err := NewPdfColorspaceFromPdfObject(obj)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
img.ColorSpace = cs
|
||||
} else {
|
||||
// If not specified, assume gray..
|
||||
common.Log.Debug("XObject Image colorspace not specified - assuming 1 color component")
|
||||
img.ColorSpace = NewPdfColorspaceDeviceGray()
|
||||
}
|
||||
|
||||
if obj := core.TraceToDirectObject(dict.Get("BitsPerComponent")); obj != nil {
|
||||
iObj, ok := obj.(*core.PdfObjectInteger)
|
||||
if !ok {
|
||||
return nil, errors.New("invalid image height object")
|
||||
}
|
||||
iVal := int64(*iObj)
|
||||
img.BitsPerComponent = &iVal
|
||||
}
|
||||
|
||||
img.Intent = dict.Get("Intent")
|
||||
img.ImageMask = dict.Get("ImageMask")
|
||||
img.Mask = dict.Get("Mask")
|
||||
img.Decode = dict.Get("Decode")
|
||||
img.Interpolate = dict.Get("Interpolate")
|
||||
img.Alternatives = dict.Get("Alternatives")
|
||||
img.SMask = dict.Get("SMask")
|
||||
img.SMaskInData = dict.Get("SMaskInData")
|
||||
img.Matte = dict.Get("Matte")
|
||||
img.Name = dict.Get("Name")
|
||||
img.StructParent = dict.Get("StructParent")
|
||||
img.ID = dict.Get("ID")
|
||||
img.OPI = dict.Get("OPI")
|
||||
img.Metadata = dict.Get("Metadata")
|
||||
img.OC = dict.Get("OC")
|
||||
|
||||
img.Stream = stream.Stream
|
||||
|
||||
return img, nil
|
||||
}
|
||||
|
||||
// Update XObject Image with new image data.
|
||||
func (ximg *XObjectImage) SetImage(img *Image, cs PdfColorspace) error {
|
||||
encoded, err := ximg.Filter.EncodeBytes(img.Data)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
ximg.Stream = encoded
|
||||
|
||||
// Width, height and bits.
|
||||
ximg.Width = &img.Width
|
||||
ximg.Height = &img.Height
|
||||
ximg.BitsPerComponent = &img.BitsPerComponent
|
||||
|
||||
// Guess colorspace if not explicitly set.
|
||||
if cs == nil {
|
||||
switch img.ColorComponents {
|
||||
case 1:
|
||||
ximg.ColorSpace = NewPdfColorspaceDeviceGray()
|
||||
case 3:
|
||||
ximg.ColorSpace = NewPdfColorspaceDeviceRGB()
|
||||
case 4:
|
||||
ximg.ColorSpace = NewPdfColorspaceDeviceCMYK()
|
||||
default:
|
||||
return errors.New("colorspace undefined")
|
||||
}
|
||||
} else {
|
||||
ximg.ColorSpace = cs
|
||||
}
|
||||
|
||||
return nil
|
||||
}
|
||||
|
||||
// Set compression filter. Decodes with current filter sets and encodes the data with the new filter.
|
||||
func (ximg *XObjectImage) SetFilter(encoder core.StreamEncoder) error {
|
||||
encoded := ximg.Stream
|
||||
decoded, err := ximg.Filter.DecodeBytes(encoded)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
ximg.Filter = encoder
|
||||
encoded, err = encoder.EncodeBytes(decoded)
|
||||
if err != nil {
|
||||
return err
|
||||
}
|
||||
|
||||
ximg.Stream = encoded
|
||||
return nil
|
||||
}
|
||||
|
||||
// This will convert to an Image which can be transformed or saved out.
|
||||
// The image data is decoded and the Image returned.
|
||||
func (ximg *XObjectImage) ToImage() (*Image, error) {
|
||||
image := &Image{}
|
||||
|
||||
if ximg.Height == nil {
|
||||
return nil, errors.New("height attribute missing")
|
||||
}
|
||||
image.Height = *ximg.Height
|
||||
|
||||
if ximg.Width == nil {
|
||||
return nil, errors.New("width attribute missing")
|
||||
}
|
||||
image.Width = *ximg.Width
|
||||
|
||||
if ximg.BitsPerComponent == nil {
|
||||
return nil, errors.New("bits per component missing")
|
||||
}
|
||||
image.BitsPerComponent = *ximg.BitsPerComponent
|
||||
|
||||
image.ColorComponents = ximg.ColorSpace.GetNumComponents()
|
||||
|
||||
decoded, err := core.DecodeStream(ximg.primitive)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
image.Data = decoded
|
||||
|
||||
if ximg.Decode != nil {
|
||||
darr, ok := ximg.Decode.(*core.PdfObjectArray)
|
||||
if !ok {
|
||||
common.Log.Debug("invalid Decode object")
|
||||
return nil, errors.New("invalid type")
|
||||
}
|
||||
decode, err := darr.ToFloat64Array()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
image.decode = decode
|
||||
}
|
||||
|
||||
return image, nil
|
||||
}
|
||||
|
||||
func (ximg *XObjectImage) GetContainingPdfObject() core.PdfObject {
|
||||
return ximg.primitive
|
||||
}
|
||||
|
||||
// Return a stream object.
|
||||
func (ximg *XObjectImage) ToPdfObject() core.PdfObject {
|
||||
stream := ximg.primitive
|
||||
|
||||
dict := stream.PdfObjectDictionary
|
||||
if ximg.Filter != nil {
|
||||
//dict.Set("Filter", ximg.Filter)
|
||||
// Pre-populate the stream dictionary with the
|
||||
// encoding related fields.
|
||||
dict = ximg.Filter.MakeStreamDict()
|
||||
stream.PdfObjectDictionary = dict
|
||||
}
|
||||
dict.Set("Type", core.MakeName("XObject"))
|
||||
dict.Set("Subtype", core.MakeName("Image"))
|
||||
dict.Set("Width", core.MakeInteger(*(ximg.Width)))
|
||||
dict.Set("Height", core.MakeInteger(*(ximg.Height)))
|
||||
|
||||
if ximg.BitsPerComponent != nil {
|
||||
dict.Set("BitsPerComponent", core.MakeInteger(*(ximg.BitsPerComponent)))
|
||||
}
|
||||
|
||||
if ximg.ColorSpace != nil {
|
||||
dict.SetIfNotNil("ColorSpace", ximg.ColorSpace.ToPdfObject())
|
||||
}
|
||||
dict.SetIfNotNil("Intent", ximg.Intent)
|
||||
dict.SetIfNotNil("ImageMask", ximg.ImageMask)
|
||||
dict.SetIfNotNil("Mask", ximg.Mask)
|
||||
dict.SetIfNotNil("Decode", ximg.Decode)
|
||||
dict.SetIfNotNil("Interpolate", ximg.Interpolate)
|
||||
dict.SetIfNotNil("Alternatives", ximg.Alternatives)
|
||||
dict.SetIfNotNil("SMask", ximg.SMask)
|
||||
dict.SetIfNotNil("SMaskInData", ximg.SMaskInData)
|
||||
dict.SetIfNotNil("Matte", ximg.Matte)
|
||||
dict.SetIfNotNil("Name", ximg.Name)
|
||||
dict.SetIfNotNil("StructParent", ximg.StructParent)
|
||||
dict.SetIfNotNil("ID", ximg.ID)
|
||||
dict.SetIfNotNil("OPI", ximg.OPI)
|
||||
dict.SetIfNotNil("Metadata", ximg.Metadata)
|
||||
dict.SetIfNotNil("OC", ximg.OC)
|
||||
|
||||
dict.Set("Length", core.MakeInteger(int64(len(ximg.Stream))))
|
||||
stream.Stream = ximg.Stream
|
||||
|
||||
return stream
|
||||
}
|
||||
Reference in New Issue
Block a user